diff -ruN /opt/SUNWut.orig/bin/utset /opt/SUNWut/bin/utset --- /opt/SUNWut.orig/bin/utset 2008-06-18 23:52:37.000000000 +0200 +++ /opt/SUNWut/bin/utset 2008-10-04 16:06:11.000000000 +0200 @@ -870,7 +870,7 @@ print "$R $S" done ) | - (export LC_ALL=C; sort -t 'x' +0 -1n +1 -2n +2 -3n) + (export LC_ALL=C; sort -t 'x' -k 1,1n -k 2,2n -k 3,3n ) exit 0 fi Binary files /opt/SUNWut.orig/lib/compatlinks/liblber.so.199 and /opt/SUNWut/lib/compatlinks/liblber.so.199 differ Binary files /opt/SUNWut.orig/lib/compatlinks/libldap.so.199 and /opt/SUNWut/lib/compatlinks/libldap.so.199 differ diff -ruN /opt/SUNWut.orig/lib/dhcp/isc/dhcp_config_linux /opt/SUNWut/lib/dhcp/isc/dhcp_config_linux --- /opt/SUNWut.orig/lib/dhcp/isc/dhcp_config_linux 2008-06-18 23:52:36.000000000 +0200 +++ /opt/SUNWut/lib/dhcp/isc/dhcp_config_linux 2008-10-04 16:06:11.000000000 +0200 @@ -7,7 +7,11 @@ # UTDHCPDIR="$ETCDIR"/net/dhcp -DHCPDCONF=/etc/dhcpd.conf +if [[ -f "/etc/dhcp3/dhcpd.conf" ]]; then + DHCPDCONF=/etc/dhcp3/dhcpd.conf +else + DHCPDCONF=/etc/dhcpd.conf +fi UTDHCPFILE="$UTDHCPDIR"/utdhcp OPTIONSFILENAME="SunRay-options" OPTIONSFILE="$UTDHCPDIR"/"$OPTIONSFILENAME" @@ -30,12 +34,16 @@ DUMMY_SUBNET_COMMENT="# Sun Ray: dummy subnet to support DHCP clients on remote subnets" CheckChrooted() { - grep $CHROOTKEY $SYSDHCPD | grep -i yes 2>/dev/null 1>&2 - if [[ $? -eq 0 ]]; then - CHROOTED=true + if [[ -f $SYSDHCPD ]]; then + grep $CHROOTKEY $SYSDHCPD | grep -i yes 2>/dev/null 1>&2 + if [[ $? -eq 0 ]]; then + CHROOTED=true + else + CHROOTED=false + fi else CHROOTED=false - fi + fi } GenerateOptionsDHCPDBlock() { diff -ruN /opt/SUNWut.orig/lib/dhcp/isc/utdhcpservice /opt/SUNWut/lib/dhcp/isc/utdhcpservice --- /opt/SUNWut.orig/lib/dhcp/isc/utdhcpservice 2008-06-18 23:52:36.000000000 +0200 +++ /opt/SUNWut/lib/dhcp/isc/utdhcpservice 2008-10-04 16:12:53.000000000 +0200 @@ -49,9 +49,14 @@ # names of files and directories that will be touched by this script # -DHCP_CONFIG="/etc/dhcpd.conf"; +if [[ -f "/etc/dhcp3/dhcpd.conf" ]]; then + DHCP_CONFIG="/etc/dhcp3/dhcpd.conf" +else + DHCP_CONFIG="/etc/dhcpd.conf" +fi DHCP_CONFIG_SAMPLE_RHAS="/usr/share/doc/dhcp-3.0.1/dhcpd.conf.sample"; DHCP_CONFIG_SAMPLE_SLES="/usr/share/doc/packages/dhcp-server/dhcpd.conf"; +DHCP_CONFIG_SAMPLE_DEB="/usr/share/doc/dhcp3-server/examples/dhcpd.conf"; TMPDIR="/var/opt/SUNWut/tmp" CORONA_NAME="SunRay"; CORONA_TITLE="Sun Ray"; @@ -59,6 +64,8 @@ DHCP_DIR="/var/lib/dhcp"; elif [ -d /var/lib/dhcpd ]; then DHCP_DIR="/var/lib/dhcpd"; +elif [ -d /var/lib/dhcp3 ]; then + DHCP_DIR="/var/lib/dhcp3"; fi SUNRAY_FILE_MARK="${CORONA_TITLE} default DHCP config file" @@ -76,6 +83,7 @@ typeset DHCP_RUNNING=true typeset DHCP_PACKAGE_RH="dhcp" typeset DHCP_PACKAGE_SU="dhcp-server" +typeset DHCP_PACKAGE_DEB="dhcp3-server" typeset DHCP_PACKAGE="DHCP" typeset DHCP_STATE="online" @@ -97,7 +105,12 @@ typeset PACKAGE="${DHCP_PACKAGE}" if $DHCP_INSTALLED ; then # get the actual package name including version and release - PACKAGE="$(rpm -q ${DHCP_PACKAGE} 2> /dev/null)" + DPKG=$(which dpkg1) + if [[ -f "$DPKG" ]]; then + PACKAGE="$(dpkg -l | grep dhcp3-server | awk '{print $2$3}' 2> /dev/null)" + else + PACKAGE="$(rpm -q ${DHCP_PACKAGE} 2> /dev/null)" + fi fi if ! $DHCP_RUNNING && [ $DHCP_STATE != "unconfigured" ] ; then DHCP_STATE="disabled" @@ -122,12 +135,18 @@ DHCP_CONFIG_SAMPLE=${DHCP_CONFIG_SAMPLE_RHAS} elif [ -f ${DHCP_CONFIG_SAMPLE_SLES} ]; then DHCP_CONFIG_SAMPLE=${DHCP_CONFIG_SAMPLE_SLES} + elif [ -f ${DHCP_CONFIG_SAMPLE_DEB} ]; then + DHCP_CONFIG_SAMPLE=${DHCP_CONFIG_SAMPLE_DEB} fi diff ${DHCP_CONFIG} ${DHCP_CONFIG_SAMPLE} > /dev/null 2>&1 if [[ $? == 0 ]]; then mv ${DHCP_CONFIG} ${DHCP_CONFIG}.sunray else - dhcpd -t > /dev/null 2>&1 + if [[ -f "/usr/sbin/dhcpd3" ]]; then + dhcpd3 -t > /dev/null 2>&1 + else + dhcpd -t > /dev/null 2>&1 + fi if [[ $? == 0 ]]; then cat > ${DHCP_CONFIG}.$$ <<-! # ${SUNRAY_FILE_MARK} /etc/dhcpd.conf @@ -208,7 +227,11 @@ return 3 fi - /etc/init.d/dhcpd start > /dev/null 2>&1 + if [[ -f /etc/init.d/dhcp3-server ]]; then + /etc/init.d/dhcp3-server start > /dev/null 2>&1 + else + /etc/init.d/dhcpd start > /dev/null 2>&1 + fi return $? } @@ -216,8 +239,11 @@ if ! $DHCP_ENABLED ; then return 3 fi - - /etc/init.d/dhcpd stop > /dev/null 2>&1 + if [[ -f /etc/init.d/dhcp3-server ]]; then + /etc/init.d/dhcp3-server stop > /dev/null 2>&1 + else + /etc/init.d/dhcpd stop > /dev/null 2>&1 + fi return $? } @@ -225,8 +251,11 @@ if ! $DHCP_ENABLED ; then return 3 fi - - /etc/init.d/dhcpd restart > /dev/null 2>&1 + if [[ -f /etc/init.d/dhcp3-server ]]; then + /etc/init.d/dhcp3-server restart > /dev/null 2>&1 + else + /etc/init.d/dhcpd restart > /dev/null 2>&1 + fi return $? } @@ -237,11 +266,16 @@ if [[ $? -ne 0 ]] ; then ${UT_BASEDIR}/lib/utprodinfo -t installed ${DHCP_PACKAGE_SU} 2>/dev/null 1>&2 if [[ $? -ne 0 ]]; then - DHCP_INSTALLED=false - DHCP_ENABLED=false - DHCP_CONFIGURED=false - DHCP_RUNNING=false - DHCP_STATE="uninstalled" + ${UT_BASEDIR}/lib/utprodinfo -t installed ${DHCP_PACKAGE_DEB} 2>/dev/null 1>&2 + if [[ $? -ne 0 ]]; then + DHCP_INSTALLED=false + DHCP_ENABLED=false + DHCP_CONFIGURED=false + DHCP_RUNNING=false + DHCP_STATE="uninstalled" + else + DHCP_PACKAGE=${DHCP_PACKAGE_DEB} + fi else DHCP_PACKAGE=${DHCP_PACKAGE_SU} fi @@ -266,8 +300,11 @@ if [[ $? != 0 ]] ; then DHCP_CONFIGURED=false # Interface / subnet not defined fi - - /etc/init.d/dhcpd status 2> /dev/null | grep "running" >/dev/null 2>&1 + if [[ -f "/etc/init.d/dhcp3-server" ]]; then + /etc/init.d/dhcp3-server status 2> /dev/null | grep "running" >/dev/null 2>&1 + else + /etc/init.d/dhcpd status 2> /dev/null | grep "running" >/dev/null 2>&1 + fi if [[ $? -ne 0 ]]; then DHCP_RUNNING=false fi diff -ruN /opt/SUNWut.orig/lib/iu_modules/M08GDM /opt/SUNWut/lib/iu_modules/M08GDM --- /opt/SUNWut.orig/lib/iu_modules/M08GDM 2008-06-19 00:03:23.000000000 +0200 +++ /opt/SUNWut/lib/iu_modules/M08GDM 2008-10-04 16:15:23.000000000 +0200 @@ -312,7 +312,7 @@ # if IsInstallRequired; then # when installing, pick up the build number from the rpm in the CD image - typeset TMP_NAME=`ls -1tr ${GDM_DIR}/${GDM_NAME}-${GDM_OUR_VERSION}-?*.i386.rpm | tail -1` + typeset TMP_NAME=`ls -1tr ${GDM_DIR}/${GDM_NAME}-${GDM_OUR_VERSION}-?*.i386.rpm | tail -n 1` TMP_NAME=${TMP_NAME##*-} export GDM_RELEASE=${TMP_NAME%%\.i386*} else diff -ruN /opt/SUNWut.orig/lib/iu_modules/M10SunDS /opt/SUNWut/lib/iu_modules/M10SunDS --- /opt/SUNWut.orig/lib/iu_modules/M10SunDS 2008-06-19 00:03:24.000000000 +0200 +++ /opt/SUNWut/lib/iu_modules/M10SunDS 2008-10-04 16:06:11.000000000 +0200 @@ -98,7 +98,7 @@ # NOTE: head -2 to deal with the case the first line is blank. # we need only to know if there is anything under the subtree. # - ANY=$(ldapsearch -b "$BASE" -s one "objectclass=*" dn 2>&- | head -2) + ANY=$(ldapsearch -b "$BASE" -s one "objectclass=*" dn 2>&- | head -n 2) search_st=$? if [[ $search_st -eq 0 ]]; then # subtree exists, check if empty diff -ruN /opt/SUNWut.orig/lib/iu_modules/M40AuthMgr /opt/SUNWut/lib/iu_modules/M40AuthMgr --- /opt/SUNWut.orig/lib/iu_modules/M40AuthMgr 2008-06-19 00:03:26.000000000 +0200 +++ /opt/SUNWut/lib/iu_modules/M40AuthMgr 2008-10-04 16:06:11.000000000 +0200 @@ -261,19 +261,19 @@ # try to set keyval to uncommented pair first old_keyval=$(grep "=" $oldfile 2>&- | - grep "^[ ]*${key}[= ]" | tail -1) + grep "^[ ]*${key}[= ]" | tail -n 1) # if no uncommented pair, take the last commented pair [[ -z "$old_keyval" ]] && \ old_keyval=$(grep "=" $oldfile 2>&- | - grep "^[# ]*${key}[= ]" | tail -1) + grep "^[# ]*${key}[= ]" | tail -n 1) # try to set keyval to uncommented pair first new_keyval=$(grep "=" $newfile 2>&- | - grep "^[ ]*${key}[= ]" | tail -1) + grep "^[ ]*${key}[= ]" | tail -n 1) # if no uncommented pair, take the last commented pair [[ -z "$new_keyval" ]] && \ new_keyval=$(grep "=" $newfile 2>&- | - grep "^[# ]*${key}[= ]" | tail -1) + grep "^[# ]*${key}[= ]" | tail -n 1) # # Check if this parameter does not have to be modified diff -ruN /opt/SUNWut.orig/lib/support_lib/iu_lib /opt/SUNWut/lib/support_lib/iu_lib --- /opt/SUNWut.orig/lib/support_lib/iu_lib 2008-06-19 00:03:28.000000000 +0200 +++ /opt/SUNWut/lib/support_lib/iu_lib 2008-10-04 16:06:11.000000000 +0200 @@ -183,8 +183,8 @@ for patchid in $all_patches; do print -n "... checking patch ${patchid} ... " - exist=$(grep "${patchid}-[0-9][0-9]" ${showrev_p} | head -1) - patch=$(\ls -1 "$dir" 2>&- | grep "^${patchid}" | tail -1) + exist=$(grep "${patchid}-[0-9][0-9]" ${showrev_p} | head -n -1) + patch=$(\ls -1 "$dir" 2>&- | grep "^${patchid}" | tail -n -1) pkgs=$(cd "${dir}/${patch}" 2>&-; \ls -1 */pkginfo 2>&- | sed -e 's:/pkginfo::g') diff -ruN /opt/SUNWut.orig/lib/support_lib/sras_config /opt/SUNWut/lib/support_lib/sras_config --- /opt/SUNWut.orig/lib/support_lib/sras_config 2008-06-19 00:03:29.000000000 +0200 +++ /opt/SUNWut/lib/support_lib/sras_config 2008-10-04 16:06:11.000000000 +0200 @@ -392,13 +392,13 @@ else if [[ $APACHE_INSTALLED == "both" ]]; then if [[ $OS == "Linux" ]]; then - if ! ReplyIsYes "\nThere is an instance of Apache detected in both" \ + if ! ReplyIsYes "\nThere is an istance of Apache detected in both" \ "\n/etc/httpd and /usr/apache. The default is /etc/httpd." \ "\nWould you like to use this instance? Answering \"no\"" \ "\nwill configure the /usr/apache instance." ; then APACHETMP="$ETC_OPT_UT"/http/templates/apache.tpl - APACHECTL="/usr/apache/bin/apachectl" - APACHEDIR="/usr/apache/conf" + APACHECTL="/usr/bin/apache2ctl" + APACHEDIR="/etc/apache2" APACHECFG="$APACHEDIR"/httpd.conf fi UT_LOCATION=$APACHEDIR @@ -580,6 +580,13 @@ rm -f /etc/opt/SUNWut/http/auto.start fi print ${APACHECTL} > /etc/opt/SUNWut/http/auto.start + if [[ -f /etc/default/apache2 ]]; then + . /etc/default/apache2 + if [[ "$NO_START" = "1" ]]; then + echo "# 0 = start on boot; 1 = don't start on boot" > /etc/default/apache2 + echo "NO_START=0" >> /etc/default/apache2 + fi + fi } function RemoveAutoStart { @@ -898,6 +905,8 @@ if [[ $OS == "Linux" ]]; then if [[ -f /etc/httpd/conf/magic || -f /etc/httpd/magic ]]; then HTTPD_SCRIPT=/usr/sbin/httpd + elif [[ -f /etc/apache2/magic ]]; then + HTTPD_SCRIPT=/usr/sbin/apache2 fi fi @@ -938,6 +947,8 @@ BUNDLED_MAGIC=/etc/httpd/conf/magic elif [[ -f /etc/httpd/magic ]]; then BUNDLED_MAGIC=/etc/httpd/magic + elif [[ -f /etc/apache2/magic ]]; then + BUNDLED_MAGIC=/etc/apache2/magic fi ;; esac @@ -1066,11 +1077,26 @@ fi STATUS=1 fi + + # Check for apache in Debian/Ubuntu location + elif [[ -f /etc/apache2/magic ]]; then + APACHEDIR="/etc/apache2" + APACHETMP="$ETC_OPT_UT"/http/templates/apache.tpl.debian + APACHECTL="/etc/init.d/apache2" fi ;; esac if [[ -n $APACHEDIR ]]; then - APACHECFG="$APACHEDIR"/httpd.conf + if [[ "$OS" = "Linux" ]]; then + . /etc/lsb-release + if [[ "$DISTRIB_ID" = "Ubuntu" ]] || [[ "$DISTRIB_ID" = "Debian" ]]; then + APACHECFG="$APACHEDIR"/apache2.conf + else + APACHECFG="$APACHEDIR"/httpd.conf + fi + else + APACHECFG="$APACHEDIR"/httpd.conf + fi fi ApacheInstalled diff -ruN /opt/SUNWut.orig/lib/support_lib/upgrade_lib /opt/SUNWut/lib/support_lib/upgrade_lib --- /opt/SUNWut.orig/lib/support_lib/upgrade_lib 2008-06-19 00:03:29.000000000 +0200 +++ /opt/SUNWut/lib/support_lib/upgrade_lib 2008-10-04 16:06:11.000000000 +0200 @@ -56,9 +56,9 @@ for key in $(awk -F= '{ print $1 }' $oldfile 2>&- | grep -v "^#" | sort -u); do old_keyval=$(grep "^[ ]*$key[= ]" $oldfile 2>&- | - tail -1) + tail -n 1) new_keyval=$(grep "^[ ]*$key[= ]" $newfile 2>&- | - tail -1) + tail -n 1) if [[ -n "$old_keyval" && -n "$new_keyval" ]]; then if [[ "$old_keyval" != "$new_keyval" ]]; then DoUpgrade "$key" "$old_keyval" "$new_keyval" "$newfile" @@ -116,7 +116,7 @@ fi for key in $(grep -v "^#" "$oldfile" 2>&- | awk -F= '{ print $1 }' | sort -u); do - line=$(grep "^${key}[ =]" "$oldfile" 2>&- | tail -1) + line=$(grep "^${key}[ =]" "$oldfile" 2>&- | tail -n 1) grep "$line" "$newfile" 2>&1 >/dev/null || \ DoAppend "$line" "$newfile" done @@ -564,7 +564,7 @@ return 1 fi - _RETURN_VAL=$(ls -1 ${TARFILE}* | tail -1) + _RETURN_VAL=$(ls -1 ${TARFILE}* | tail -n 1) return 0 diff -ruN /opt/SUNWut.orig/lib/utadmingid /opt/SUNWut/lib/utadmingid --- /opt/SUNWut.orig/lib/utadmingid 2008-06-18 23:52:35.000000000 +0200 +++ /opt/SUNWut/lib/utadmingid 2008-10-04 16:06:11.000000000 +0200 @@ -15,7 +15,7 @@ ETCDIR="/etc/opt/SUNWut" UTADMINPW=${ETCDIR}/utadmin.pw if [ -f $UTADMINPW ] ; then - WEBGUI_GROUP=`/bin/ls -gn $UTADMINPW | /bin/awk '{print $3}' ` + WEBGUI_GROUP=`/bin/ls -gn $UTADMINPW | awk '{print $3}' ` fi WEBGUI_GROUP=${WEBGUI_GROUP:-root} print $WEBGUI_GROUP diff -ruN /opt/SUNWut.orig/lib/utctl.d/features/utcronctl /opt/SUNWut/lib/utctl.d/features/utcronctl --- /opt/SUNWut.orig/lib/utctl.d/features/utcronctl 2008-06-18 23:52:29.000000000 +0200 +++ /opt/SUNWut/lib/utctl.d/features/utcronctl 2008-10-04 16:06:11.000000000 +0200 @@ -37,13 +37,13 @@ return fi - (set +e; head -1 $CRONFILE | \ + (set +e; head -n 1 $CRONFILE | \ grep "^# DO NOT EDIT THIS FILE - edit the master and reinstall" \ > /dev/null 2>&1) if [ $? -eq 0 ]; then # comment exists, remove them cat /dev/null >$TMPFILE_COMM - head -3 $CRONFILE | sed \ + head -n 3 $CRONFILE | sed \ -e "/^# DO NOT EDIT THIS FILE - edit the master and reinstall/d" \ -e "/^# (\/[^ ]* installed/d" \ -e "/^# (Cron version/d" >> $TMPFILE_COMM diff -ruN /opt/SUNWut.orig/lib/utctl.d/features/utgdmconfigctl /opt/SUNWut/lib/utctl.d/features/utgdmconfigctl --- /opt/SUNWut.orig/lib/utctl.d/features/utgdmconfigctl 2008-06-18 23:52:30.000000000 +0200 +++ /opt/SUNWut/lib/utctl.d/features/utgdmconfigctl 2008-10-04 16:34:37.000000000 +0200 @@ -206,7 +206,7 @@ SYSTEM_XINITRCD="/etc/X11/xinit/xinitrc.d" SUNRAY_XINITRCD="/etc/opt/SUNWut/xinitrc.d" # Determine GDM Install Path - GDM_PATH=`rpm -ql "gdm" | grep "custom.conf" ` + GDM_PATH=/etc/gdm/custom.conf if [ $? != 0 ]; then print -u2 "Error: Cannot determine GDM install directory" exit 1; diff -ruN /opt/SUNWut.orig/lib/utdmsession /opt/SUNWut/lib/utdmsession --- /opt/SUNWut.orig/lib/utdmsession 2008-06-18 23:52:27.000000000 +0200 +++ /opt/SUNWut/lib/utdmsession 2008-10-04 16:06:11.000000000 +0200 @@ -26,7 +26,7 @@ #exec >/var/tmp/utdmsession.$$ 2>&1 # Debug #set -x -MOD="`/bin/basename $0`" +MOD="`basename $0`" USAGE="usage: $MOD [-c|-d] Xdisplay [-z tag]" UTMNT_DIRLOCK=".session" diff -ruN /opt/SUNWut.orig/lib/utdtsession /opt/SUNWut/lib/utdtsession --- /opt/SUNWut.orig/lib/utdtsession 2008-06-18 23:52:31.000000000 +0200 +++ /opt/SUNWut/lib/utdtsession 2008-10-04 16:06:11.000000000 +0200 @@ -554,7 +554,7 @@ # so that a new session can be created. # get the existing session ID - oldsid=$(head -1 $tif) + oldsid=$(head -n 1 $tif) # get the existing session type OLD_SESSION_TYPE="" diff -ruN /opt/SUNWut.orig/lib/utprodinfo /opt/SUNWut/lib/utprodinfo --- /opt/SUNWut.orig/lib/utprodinfo 2008-06-19 00:03:23.000000000 +0200 +++ /opt/SUNWut/lib/utprodinfo 2008-10-04 16:06:11.000000000 +0200 @@ -75,6 +75,8 @@ set -A SunOS_Mapped_Sed # Mapped parameter query format for the Linux packaging utility set -A Linux_Mapped_Param +# Mapped parameter query format for the dpkg packaging utility +set -A Debian_Mapped_Param # Maximum number of parameters allowed typeset -i MAXParam=1 @@ -82,42 +84,51 @@ Param[${MAXParam}]="BASEDIR" SunOS_Mapped_Param[${MAXParam}]="BASEDIR" Linux_Mapped_Param[${MAXParam}]="%{INSTALLPREFIX}" +Debian_Mapped_Param[${MAXParam}]="INSTALLPREFIX" let MAXParam+=1 # --- VERSION - version number with the build info. Ex: 2.0_37.b Param[${MAXParam}]="VERSION" SunOS_Mapped_Param[${MAXParam}]="VERSION" SunOS_Mapped_Sed[${MAXParam}]="s/\([0-9]\{1,\}\.[0-9]\{1,\}_[0-9]\{1,2\}\.\{0,1\}[a-z]\{0,1\}\),.*/\1/" Linux_Mapped_Param[${MAXParam}]="%{VERSION}_%{RELEASE}" +Debian_Mapped_Param[${MAXParam}]="DEBVERSION" let MAXParam+=1 # --- PSTAMP - product timestamp Param[${MAXParam}]="PSTAMP" SunOS_Mapped_Param[${MAXParam}]="PSTAMP" Linux_Mapped_Param[${MAXParam}]="%{BUILDTIME:date}" +Debian_Mapped_Param[${MAXParam}]="" let MAXParam+=1 # --- NAME - description of the package. Param[${MAXParam}]="NAME" SunOS_Mapped_Param[${MAXParam}]="NAME" Linux_Mapped_Param[${MAXParam}]="%{SUMMARY}" +Debian_Mapped_Param[${MAXParam}]='${Description;40}' let MAXParam+=1 # --- PRODVERS - product version without the build info. Ex: 2.0 Param[${MAXParam}]="PRODVERS" SunOS_Mapped_Param[${MAXParam}]="SUNW_PRODVERS" Linux_Mapped_Param[${MAXParam}]="%{VERSION}" +Debian_Mapped_Param[${MAXParam}]="DEBPRODVERS" let MAXParam+=1 # --- PKGNAME - package name. Ex: SUNWuto Param[${MAXParam}]="PKGNAME" SunOS_Mapped_Param[${MAXParam}]="PKGINST" Linux_Mapped_Param[${MAXParam}]="%{NAME}" +Debian_Mapped_Param[${MAXParam}]='${Package}\\n' let MAXParam+=1 # --- INSTDATE - date the package is installed on the system. Param[${MAXParam}]="INSTDATE" SunOS_Mapped_Param[${MAXParam}]="INSTDATE" Linux_Mapped_Param[${MAXParam}]="%{INSTALLTIME:date}" +Debian_Mapped_Param[${MAXParam}]="" let MAXParam+=1 # --- PATCHLIST - list of patches installed for this package. Param[${MAXParam}]="PATCHLIST" SunOS_Mapped_Param[${MAXParam}]="PATCHLIST" Linux_Mapped_Param[${MAXParam}]="" +Debian_Mapped_Param[${MAXParam}]="" + let MAXParam+=1 @@ -156,14 +167,22 @@ # add key name manipulation sed script SEDLIST="${SEDLIST} -e s/^${SunOS_Mapped_Param[${1}]}=/${Param[${1}]}=/" fi - else - if [[ -n "${Linux_Mapped_Param[${1}]}" ]]; then + elif [[ ${PREFIX} = "Debian" ]]; then + if [[ -n "${Debian_Mapped_Param[${1}]}" ]]; then if ${2}; then - MAPPEDLIST="${MAPPEDLIST}${Param[${1}]}=${Linux_Mapped_Param[${1}]}\\n" + MAPPEDLIST="${MAPPEDLIST}${Param[${1}]}=${Debian_Mapped_Param[${1}]}\\n" else - MAPPEDLIST="${Linux_Mapped_Param[${1}]}\\n" + MAPPEDLIST="${Debian_Mapped_Param[${1}]}\\n" fi fi + else + if [[ -n "${Linux_Mapped_Param[${1}]}" ]]; then + if ${2}; then + MAPPEDLIST="${MAPPEDLIST}${Param[${1}]}=${Linux_Mapped_Param[${1}]}\\n" + else + MAPPEDLIST="${Linux_Mapped_Param[${1}]}\\n" + fi + fi fi } @@ -323,6 +342,14 @@ return $? } +Debian_dispAll() { + $DEBUG + # NOTE: must sort first so that we can return the exit code from grep + dpkg -l | grep "Sun Ray" + return $? +} + + # # dispParams - displays the parameter information in key-value form. # $1 - package name @@ -345,6 +372,43 @@ return 0 } +Debian_dispParams() { + $DEBUG + if ! ${PREFIX}_testPkg installed $PKGNAME; then + # package not installed; + print -u2 "${ERROR_PREF} package $PKGNAME not installed" + return 1 + fi + + buildParamList "$@" + if [[ $? -eq 1 ]]; then + # found no params, just return + return 0 + fi + + # This is becaue the alien converted packaged are lowercase + DEB="`echo "${PKGNAME}" | tr '[A-Z]' '[a-z]'`" + VERSION="" + PRODVERS="" + + # The below is a bit of a hack to get the correct informtin out of dpkg-query + # it always returns /opt as the basedir + + if [ "`echo "${MAPPEDLIST}"|grep "DEBVERSION"`" ]; then + VERSION="`dpkg-query -f '${Version}\n' -W "${DEB}" | sed -e 's/-/_/'`" + fi + if [ "`echo "${MAPPEDLIST}"|grep "DEBPRODVERS"`" ]; then + PRODVERS="`dpkg-query -f '${Version}\n' -W "${DEB}" | sed -e 's/-.*$//'`" + fi + + QL="`echo "${MAPPEDLIST}"|sed -e 's/INSTALLPREFIX/\/opt/g' -e "s/DEBVERSION/${VERSION}/g" -e "s/DEBPRODVERS/${PRODVERS}/g"`" + if [ "`echo "${QL}"|grep '\\$'`" ]; then + dpkg-query -f "${QL}" -W "${DEB}" + else + echo "${QL}" + fi + return 0 +} # # testPkg - test the condition specified on the package. @@ -377,6 +441,34 @@ return 1 } +Debian_testPkg() { + $DEBUG + if [[ $# -ne 2 ]]; then + return 1 + fi + DEB="`echo "$2" | tr '[A-Z]' '[a-z]'`" + case $1 in + "installed") # package installed, could be either partial or complete + dpkg-query -W $DEB > /dev/null 2>&1 + return $?;; + "partial") # package partially installed + # + # rpm does not understand the concept of partially installed packages. + # So, for now, we always return 1 (ie. false) since it can never be + # partially installed packages. + # + return 1;; + "complete") # package completely installed + # dpkg format does not have a verify option, this will return if installed even partially + dpkg-query -q $DEB > /dev/null 2>&1 + return $?;; + esac + + # invalid test condition + print -u2 "${ERROR_PREF} invalid test operation \"$1\"." + return 1 +} + PREFIX=`uname -s` if [[ -z "$PREFIX" ]]; then @@ -384,6 +476,12 @@ print -u2 "${ERROR_PREF} unable to determince the OS running on this system." exit 1 fi +if [[ "$PREFIX" = "Linux" ]]; then + . /etc/lsb-release + if [[ "$DISTRIB_ID" = "Ubuntu" ]] || [[ "$DISTRIB_ID" = "Debian" ]]; then + PREFIX="Debian" + fi +fi OPMODE="" SUBOP="" diff -ruN /opt/SUNWut.orig/lib/utwebadmin /opt/SUNWut/lib/utwebadmin --- /opt/SUNWut.orig/lib/utwebadmin 2008-06-18 23:59:06.000000000 +0200 +++ /opt/SUNWut/lib/utwebadmin 2008-10-04 16:06:11.000000000 +0200 @@ -101,6 +101,10 @@ fi done + # in Debian, /etc/shells starts with a comment and therefore + # this stupid script results in 'SU_SHELL=-s #' + SU_SHELL="-s /bin/ksh" + else echo "Not supported on detected OS ${OS}." 1>&2 exit $EXIT_FAILURE diff -ruN /opt/SUNWut.orig/lib/utxsun /opt/SUNWut/lib/utxsun --- /opt/SUNWut.orig/lib/utxsun 2008-06-18 23:52:34.000000000 +0200 +++ /opt/SUNWut/lib/utxsun 2008-10-04 16:06:11.000000000 +0200 @@ -31,12 +31,17 @@ # fontpath is for a particular system. We'll grep through the # XF86Config file. For FCS we'll do this at install time and # keep the path in a file. -if [[ -f /etc/X11/XF86Config ]] ; then +if [[ -f /etc/X11/xorg.conf ]]; then + XCFG_FILE=/etc/X11/xorg.conf +else + XCFG_FILE=/etc/X11/XF86Config +fi +if [[ -f $XCFG_FILE ]] ; then # match lines with FontPath that are not commented out, # accumulate the path, but remove double quotes before appending: FONTPATH=$($AWK '$1 == "FontPath" { fp = fp "," substr($2,2,length($2)-2) } \ END { print substr(fp,2) } \ - ' /etc/X11/XF86Config) + ' $XCFG_FILE) if [ x$FONTPATH != x ] ; then XMOREOPTS="-fp $FONTPATH" fi diff -ruN /opt/SUNWut.orig/lib/xkb/compat/README /opt/SUNWut/lib/xkb/compat/README --- /opt/SUNWut.orig/lib/xkb/compat/README 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/compat/README 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,37 @@ +The core protocol interpretation of keyboard modifiers does not include direct +support for multiple keyboard groups, so XKB reports the effective keyboard +group to XKB-aware clients using some of reserved bits in the state field of +some core protocol events. This modified state field would not be interpreted +correctly by XKB-unaware clients, so XKB provides a group compatibility mapping +which remaps the keyboard group into a core modifier mask that has similar +effects, when possible. + +XKB maintains three compatibility state components that are used to make +XKB-unaware clients(*) work as well as possible: +- The compatibility state which corresponds to the effective modifier and + effective group state. +- The compatibility lookup state which is the core-protocol equivalent of the + lookup state. +- The compatibility grab state which is the nearest core-protocol equivalent + of the grab state. + +Compatibility state are essentially the corresponding XKB states, but with +keyboard group possibly encoded as one or more modifiers. + +Modifiers that correspond to each keyboard group are described in this +group compatibility map. + + +---- +(*) The implementation of XKB invisibly extends the X library to use the +keyboard extension if it is present. That means, clients that use library or +toolkit routines to interpret keyboard events automatically use all of XKB +features; clients that directly interpret the state field of core protocol +events or the keymap direcly may be affected by some of the XKB differences. +Thus most clients can take all advantages without modification but it also +means that XKB state can be reported to clients that have not explicitly +requested the keyboard extension. + + + +/* $XFree86$ */ diff -ruN /opt/SUNWut.orig/lib/xkb/compat/accessx /opt/SUNWut/lib/xkb/compat/accessx --- /opt/SUNWut.orig/lib/xkb/compat/accessx 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/compat/accessx 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,54 @@ +// $Xorg: accessx,v 1.3 2000/08/17 19:54:34 cpqbld Exp $ + +default partial xkb_compatibility "basic" { + interpret AccessX_Enable { + action= LockControls(controls=AccessXKeys); + }; +}; + +partial xkb_compatibility "full" { + + interpret AccessX_Enable { + action= LockControls(controls=AccessXKeys); + }; + + interpret AccessX_Feedback_Enable { + action= LockControls(controls=AccessXFeedback); + }; + + interpret RepeatKeys_Enable { + action= LockControls(controls=RepeatKeys); + }; + + interpret SlowKeys_Enable { + action= LockControls(controls=SlowKeys); + }; + + interpret BounceKeys_Enable { + action= LockControls(controls=BounceKeys); + }; + + interpret StickyKeys_Enable { + action= LockControls(controls=StickyKeys); + }; + + interpret MouseKeys_Enable { + action= LockControls(controls=MouseKeys); + }; + + interpret MouseKeys_Accel_Enable { + action= LockControls(controls=MouseKeysAccel); + }; + + interpret Overlay1_Enable { + action= LockControls(controls=Overlay1); + }; + + interpret Overlay2_Enable { + action= LockControls(controls=Overlay2); + }; + + interpret AudibleBell_Enable { + action= LockControls(controls=AudibleBell); + }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/compat/basic /opt/SUNWut/lib/xkb/compat/basic --- /opt/SUNWut.orig/lib/xkb/compat/basic 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/compat/basic 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,52 @@ +// $Xorg: basic,v 1.3 2000/08/17 19:54:34 cpqbld Exp $ + +// Minimal set of symbol interpretations to provide +// reasonable default behavior (Num lock, shift and +// caps lock and mode switch) and set up the +// automatic updating of common keyboard LEDs. + +// $XFree86: xc/programs/xkbcomp/compat/basic,v 1.2 2000/11/06 19:24:10 dawes Exp $ + +default xkb_compatibility "basic" { + virtual_modifiers NumLock,AltGr; + + interpret.repeat= False; + setMods.clearLocks= True; + latchMods.clearLocks= True; + latchMods.latchToLock= True; + + interpret Shift_Lock+AnyOf(Shift+Lock) { + action= LockMods(modifiers=Shift); + }; + + interpret Any+Lock { + action= LockMods(modifiers=Lock); + }; + + interpret Num_Lock+Any { + virtualModifier= NumLock; + action= LockMods(modifiers=NumLock); + }; + + interpret Mode_switch { + useModMapMods= level1; + virtualModifier= AltGr; + action= SetGroup(group=+1); + }; + + interpret Any + Any { + action= SetMods(modifiers=modMapMods); + }; + + group 2 = AltGr; + group 3 = AltGr; + group 4 = AltGr; + + include "ledcaps" + include "lednum" + indicator "Shift Lock" { + !allowExplicit; + whichModState= Locked; + modifiers= Shift; + }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/compat/complete /opt/SUNWut/lib/xkb/compat/complete --- /opt/SUNWut.orig/lib/xkb/compat/complete 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/compat/complete 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,10 @@ +// $Xorg: complete,v 1.3 2000/08/17 19:54:34 cpqbld Exp $ +default xkb_compatibility "complete" { + include "basic" + augment "iso9995" + augment "mousekeys" + augment "accessx(full)" + augment "misc" + augment "xfree86" +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/compat/default /opt/SUNWut/lib/xkb/compat/default --- /opt/SUNWut.orig/lib/xkb/compat/default 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/compat/default 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,10 @@ +// $Xorg: default,v 1.3 2000/08/17 19:54:34 cpqbld Exp $ +default xkb_compatibility "default" { + include "basic" + augment "mousekeys" + augment "accessx(basic)" + augment "misc" + augment "iso9995" + augment "xfree86" + augment "japan" +}; diff -ruN /opt/SUNWut.orig/lib/xkb/compat/iso9995 /opt/SUNWut/lib/xkb/compat/iso9995 --- /opt/SUNWut.orig/lib/xkb/compat/iso9995 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/compat/iso9995 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,84 @@ +// $Xorg: iso9995,v 1.3 2000/08/17 19:54:34 cpqbld Exp $ + +// Fairly complete set of symbol interpretations +// to provide reasonable default behavior + +// $XFree86: xc/programs/xkbcomp/compat/iso9995,v 1.3 2003/02/21 03:16:34 dawes Exp $ + +default partial xkb_compatibility "default" { + virtual_modifiers LevelThree,AltGr; + + interpret.repeat= False; + setMods.clearLocks= True; + latchMods.clearLocks= True; + latchMods.latchToLock= True; + + interpret ISO_Lock+Any { + action= ISOLock(affect= all,modifiers=modMapMods); + }; + + interpret ISO_Level2_Latch+Shift { + useModMapMods= level1; + action= LatchMods(modifiers=Shift); + }; + + interpret ISO_Level3_Shift+Any { + useModMapMods= level1; + virtualModifier= LevelThree; + action= SetMods(modifiers=LevelThree); + }; + + interpret ISO_Level3_Shift { + action= SetMods(modifiers=LevelThree); + }; + + interpret ISO_Level3_Latch+Any { + useModMapMods= level1; + virtualModifier= LevelThree; + action= LatchMods(modifiers=LevelThree); + }; + + interpret ISO_Level3_Latch { + action= LatchMods(modifiers=LevelThree); + }; + + interpret ISO_Level3_Lock+Any { + useModMapMods= level1; + virtualModifier= LevelThree; + action= LockMods(modifiers=LevelThree); + }; + + interpret ISO_Level3_Lock { + action= LockMods(modifiers=LevelThree); + }; + + interpret ISO_Group_Latch { + useModMapMods= level1; + virtualModifier= AltGr; + action= LatchGroup(group=2); + }; + + interpret ISO_Next_Group { + useModMapMods= level1; + virtualModifier= AltGr; + action= LockGroup(group=+1); + }; + + interpret ISO_Prev_Group { + useModMapMods= level1; + virtualModifier= AltGr; + action= LockGroup(group=-1); + }; + interpret ISO_First_Group { + action= LockGroup(group=1); + }; + + interpret ISO_Last_Group { + action= LockGroup(group=2); + }; + + indicator "Group 2" { + !allowExplicit; + groups= All-Group1; + }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/compat/japan /opt/SUNWut/lib/xkb/compat/japan --- /opt/SUNWut.orig/lib/xkb/compat/japan 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/compat/japan 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,29 @@ +// $Xorg: japan,v 1.3 2000/08/17 19:54:34 cpqbld Exp $ + +// Japanese keyboards need Eisu and Kana shift and +// lock keys, which are typically bound to the +// second shift level for some other modifier key. +// These interpretations disable the default +// interpretation (which would have these keys set +// the same modifier as the level one symbol). + +default partial xkb_compatibility "japan" { + + interpret.repeat= False; + + interpret Eisu_Shift+Lock { + action= NoAction(); + }; + + interpret Eisu_toggle+Lock { + action= NoAction(); + }; + + interpret Kana_Shift+Lock { + action= NoAction(); + }; + + interpret Kana_Lock+Lock { + action= NoAction(); + }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/compat/keypad /opt/SUNWut/lib/xkb/compat/keypad --- /opt/SUNWut.orig/lib/xkb/compat/keypad 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/compat/keypad 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,60 @@ +// $Xorg: keypad,v 1.3 2000/08/17 19:54:34 cpqbld Exp $ + +// Interpretations needed to implement the numeric keypad +// as an overlay instead of a modifier. + +partial hidden xkb_compatibility "overlay" { + include "keypad(overlay1)" +}; +partial hidden xkb_compatibility "overlay1" { + virtual_modifiers NumLock,AltGr; + + interpret.repeat= False; + setMods.clearLocks= True; + latchMods.clearLocks= True; + latchMods.latchToLock= True; + + interpret Num_Lock { + virtualModifier= NumLock; + action= LockControls(ctrls=overlay1); + }; + interpret Num_Lock+Any { + virtualModifier= NumLock; + action= LockControls(ctrls=overlay1); + }; + + indicator.allowExplicit= True; + indicator.driveskbd= True; + replace indicator "Num Lock" { + whichModState= Locked; + modifiers= NumLock; + controls= Overlay1; + }; + indicator.allowExplicit= True; +}; +partial hidden xkb_compatibility "overlay2" { + virtual_modifiers NumLock,AltGr; + + interpret.repeat= False; + setMods.clearLocks= True; + latchMods.clearLocks= True; + latchMods.latchToLock= True; + + interpret Num_Lock { + virtualModifier= NumLock; + action= LockControls(ctrls=overlay2); + }; + interpret Num_Lock+Any { + virtualModifier= NumLock; + action= LockControls(ctrls=overlay1); + }; + + indicator.allowExplicit= True; + indicator.driveskbd= True; + replace indicator "Num Lock" { + whichModState= Locked; + modifiers= NumLock; + controls= Overlay2; + }; + indicator.allowExplicit= True; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/compat/ledcaps /opt/SUNWut/lib/xkb/compat/ledcaps --- /opt/SUNWut.orig/lib/xkb/compat/ledcaps 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/compat/ledcaps 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,23 @@ +// Use Caps Lock LED to show either Caps Lock, Group, or Shift Lock state + +default partial xkb_compatibility "caps_lock" { + indicator "Caps Lock" { + !allowExplicit; + whichModState= Locked; + modifiers= Lock; + }; +}; + +partial xkb_compatibility "group_lock" { + indicator "Caps Lock" { + modifiers= None; + groups=All-group1; + }; +}; + +partial xkb_compatibility "shift_lock" { + indicator "Caps Lock" { + whichModState= Locked; + modifiers= Shift; + }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/compat/lednum /opt/SUNWut/lib/xkb/compat/lednum --- /opt/SUNWut.orig/lib/xkb/compat/lednum 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/compat/lednum 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,23 @@ +// Use Num Lock LED to show either Num Lock, Group, or Shift Lock state + +default partial xkb_compatibility "num_lock" { + indicator "Num Lock" { + !allowExplicit; + whichModState= Locked; + modifiers= NumLock; + }; +}; + +partial xkb_compatibility "group_lock" { + indicator "Num Lock" { + modifiers= None; + groups=All-group1; + }; +}; + +partial xkb_compatibility "shift_lock" { + indicator "Num Lock" { + whichModState= Locked; + modifiers= Shift; + }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/compat/ledscroll /opt/SUNWut/lib/xkb/compat/ledscroll --- /opt/SUNWut.orig/lib/xkb/compat/ledscroll 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/compat/ledscroll 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,23 @@ +// Use Scroll Lock LED to show either Scroll Lock, Group, or Shift Lock state + +default partial xkb_compatibility "scroll_lock" { + indicator "Scroll Lock" { + allowExplicit; + whichModState= Locked; + modifiers= ScrollLock; + }; +}; + +partial xkb_compatibility "group_lock" { + indicator "Scroll Lock" { + modifiers= None; + groups=All-group1; + }; +}; + +partial xkb_compatibility "shift_lock" { + indicator "Scroll Lock" { + whichModState= Locked; + modifiers= Shift; + }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/compat/misc /opt/SUNWut/lib/xkb/compat/misc --- /opt/SUNWut.orig/lib/xkb/compat/misc 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/compat/misc 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,117 @@ +// $XdotOrg: misc,v 1.3 2000/08/17 19:54:34 cpqbld Exp $ +// $Xorg: misc,v 1.3 2000/08/17 19:54:34 cpqbld Exp $ +// +// +// +// $XFree86: xc/programs/xkbcomp/compat/misc,v 1.4 2003/05/15 13:31:57 pascal Exp $ + +default partial xkb_compatibility "misc" { + + virtual_modifiers Alt,Meta,Super,Hyper,ScrollLock; + + // Interpretations for some other useful keys + + interpret Terminate_Server { + action = Terminate(); + }; + + setMods.clearLocks= True; + + // Sets the "Alt" virtual modifier + + interpret Alt_L+Any { + useModMapMods= level1; + virtualModifier= Alt; + action = SetMods(modifiers=modMapMods); + }; + + interpret Alt_L { + action = SetMods(modifiers=Alt); + }; + + interpret Alt_R+Any { + useModMapMods= level1; + virtualModifier= Alt; + action = SetMods(modifiers=modMapMods); + }; + + interpret Alt_R { + action = SetMods(modifiers=Alt); + }; + + // Sets the "Meta" virtual modifier + + interpret Meta_L+Any { +// useModMapMods= level1; + virtualModifier= Meta; + action = SetMods(modifiers=modMapMods); + }; + + interpret Meta_L { + action = SetMods(modifiers=Meta); + }; + + interpret Meta_R+Any { + useModMapMods= level1; + virtualModifier= Meta; + action = SetMods(modifiers=modMapMods); + }; + + interpret Meta_R { + action = SetMods(modifiers=Alt); + }; + + // Sets the "Super" virtual modifier + + interpret Super_L+Any { +// useModMapMods= level1; + virtualModifier= Super; + action = SetMods(modifiers=modMapMods); + }; + + interpret Super_L { + action = SetMods(modifiers=Super); + }; + + interpret Super_R+Any { + useModMapMods= level1; + virtualModifier= Super; + action = SetMods(modifiers=modMapMods); + }; + + interpret Super_R { + action = SetMods(modifiers=Super); + }; + + // Sets the "Hyper" virtual modifier + + interpret Hyper_L+Any { +// useModMapMods= level1; + virtualModifier= Hyper; + action = SetMods(modifiers=modMapMods); + }; + + interpret Hyper_L { + action = SetMods(modifiers=Hyper); + }; + + interpret Hyper_R+Any { + useModMapMods= level1; + virtualModifier= Hyper; + action = SetMods(modifiers=modMapMods); + }; + + interpret Hyper_R { + action = SetMods(modifiers=Hyper); + }; + + // Sets the "ScrollLock" virtual modifier and + // makes it actually lock when pressed. Sets + // up a map for the scroll lock indicator. + interpret Scroll_Lock+Any { + virtualModifier= ScrollLock; + action = LockMods(modifiers=modMapMods); + }; + + include "ledscroll" +}; diff -ruN /opt/SUNWut.orig/lib/xkb/compat/mousekeys /opt/SUNWut/lib/xkb/compat/mousekeys --- /opt/SUNWut.orig/lib/xkb/compat/mousekeys 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/compat/mousekeys 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,182 @@ + +// $Xorg: mousekeys,v 1.3 2000/08/17 19:54:34 cpqbld Exp $ + +// Interpretations for arrow keys and a bunch of other +// common keysyms which make it possible to bind "mouse" +// keys using xmodmap and activate or deactivate them +// from the keyboard. + +default partial xkb_compatibility "mousekeys" { + + // Keypad actions. + // + interpret.repeat= True; + + interpret KP_1 { + action = MovePtr(x=-1,y= +1); + }; + interpret KP_End { + action = MovePtr(x=-1,y= +1); + }; + + interpret KP_2 { + action = MovePtr(x=+0,y= +1); + }; + interpret KP_Down { + action = MovePtr(x=+0,y= +1); + }; + + interpret KP_3 { + action = MovePtr(x=+1,y=+1); + }; + interpret KP_Next { + action = MovePtr(x=+1,y=+1); + }; + + interpret KP_4 { + action = MovePtr(x=-1,y=+0); + }; + interpret KP_Left { + action = MovePtr(x=-1,y=+0); + }; + + interpret KP_6 { + action = MovePtr(x=+1,y=+0); + }; + interpret KP_Right { + action = MovePtr(x=+1,y=+0); + }; + + interpret KP_7 { + action = MovePtr(x=-1,y=-1); + }; + interpret KP_Home { + action = MovePtr(x=-1,y=-1); + }; + + interpret KP_8 { + action = MovePtr(x=+0,y=-1); + }; + interpret KP_Up { + action = MovePtr(x=+0,y=-1); + }; + + interpret KP_9 { + action = MovePtr(x=+1,y=-1); + }; + interpret KP_Prior { + action = MovePtr(x=+1,y=-1); + }; + + interpret KP_5 { + action = PointerButton(button=default); + }; + interpret KP_Begin { + action = PointerButton(button=default); + }; + + interpret KP_F2 { + action = SetPtrDflt(affect=defaultButton,button=1); + }; + interpret KP_Divide { + action = SetPtrDflt(affect=defaultButton,button=1); + }; + + interpret KP_F3 { + action = SetPtrDflt(affect=defaultButton,button=2); + }; + interpret KP_Multiply { + action = SetPtrDflt(affect=defaultButton,button=2); + }; + + interpret KP_F4 { + action = SetPtrDflt(affect=defaultButton,button=3); + }; + interpret KP_Subtract { + action = SetPtrDflt(affect=defaultButton,button=3); + }; + + interpret KP_Separator { + action = PointerButton(button=default,count=2); + }; + interpret KP_Add { + action = PointerButton(button=default,count=2); + }; + + interpret KP_0 { + action = LockPointerButton(button=default,affect=lock); + }; + interpret KP_Insert { + action = LockPointerButton(button=default,affect=lock); + }; + + interpret KP_Decimal { + action = LockPointerButton(button=default,affect=unlock); + }; + interpret KP_Delete { + action = LockPointerButton(button=default,affect=unlock); + }; + + interpret.repeat= False; + + + // New Keysym Actions. + // + interpret Pointer_Button_Dflt { + action= PointerButton(button=default); + }; + interpret Pointer_Button1 { + action= PointerButton(button=1); + }; + interpret Pointer_Button2 { + action= PointerButton(button=2); + }; + interpret Pointer_Button3 { + action= PointerButton(button=3); + }; + interpret Pointer_DblClick_Dflt { + action= PointerButton(button=default,count=2); + }; + interpret Pointer_DblClick1 { + action= PointerButton(button=1,count=2); + }; + interpret Pointer_DblClick2 { + action= PointerButton(button=2,count=2); + }; + interpret Pointer_DblClick3 { + action= PointerButton(button=3,count=2); + }; + interpret Pointer_Drag_Dflt { + action= LockPointerButton(button=default); + }; + interpret Pointer_Drag1 { + action= LockPointerButton(button=1); + }; + interpret Pointer_Drag2 { + action= LockPointerButton(button=2); + }; + interpret Pointer_Drag3 { + action= LockPointerButton(button=3); + }; + + interpret Pointer_EnableKeys { + action= LockControls(controls=MouseKeys); + }; + interpret Pointer_Accelerate { + action= LockControls(controls=MouseKeysAccel); + }; + interpret Pointer_DfltBtnNext { + action= SetPtrDflt(affect=defaultButton,button= +1); + }; + interpret Pointer_DfltBtnPrev { + action= SetPtrDflt(affect=defaultButton,button= -1); + }; + + + // Allow an indicator for MouseKeys. + indicator "Mouse Keys" { +// !allowExplicit; + indicatorDrivesKeyboard; + controls= MouseKeys; + }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/compat/norepeat /opt/SUNWut/lib/xkb/compat/norepeat --- /opt/SUNWut.orig/lib/xkb/compat/norepeat 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/compat/norepeat 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,11 @@ +// $Xorg: norepeat,v 1.3 2000/08/17 19:54:34 cpqbld Exp $ + +// Put any otherwise normal keys that you don't want to repeat in +// this file + +default partial xkb_compatibility "norepeat" { + interpret Return { + action= NoAction(); + repeat= False; + }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/compat/pc /opt/SUNWut/lib/xkb/compat/pc --- /opt/SUNWut.orig/lib/xkb/compat/pc 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/compat/pc 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,18 @@ +// $Xorg: pc,v 1.3 2000/08/17 19:54:34 cpqbld Exp $ +default partial xkb_compatibility "pc" { + + // Sets the "Alt" virtual modifier + + virtual_modifiers Alt; + + setMods.clearLocks= True; + interpret Alt_L+Any { + virtualModifier= Alt; + action = SetMods(modifiers=modMapMods); + }; + + interpret Alt_R+Any { + virtualModifier= Alt; + action = SetMods(modifiers=modMapMods); + }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/compat/pc98 /opt/SUNWut/lib/xkb/compat/pc98 --- /opt/SUNWut.orig/lib/xkb/compat/pc98 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/compat/pc98 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,62 @@ +// $Xorg: pc98,v 1.3 2000/08/17 19:54:34 cpqbld Exp $ + + + + +// $XFree86: xc/programs/xkbcomp/compat/pc98,v 3.1 1997/10/26 13:25:33 dawes Exp $ + +// Minimal set of symbol interpretations to provide +// reasonable default behavior (Num lock, shift and +// caps lock and mode switch) and set up the +// automatic updating of common keyboard LEDs. + +default xkb_compatibility "basic" { + virtual_modifiers NumLock,AltGr; + + interpret.repeat= False; + setMods.clearLocks= True; + latchMods.clearLocks= True; + latchMods.latchToLock= True; + + interpret Shift_Lock+AnyOf(Shift+Lock) { + action= LockMods(modifiers=Shift); + }; + +// interpret Any+Lock { +// action= LockMods(modifiers=Lock); +// }; + + interpret Num_Lock+Any { + virtualModifier= NumLock; + action= LockMods(modifiers=NumLock); + }; + + interpret Mode_switch { + useModMapMods= level1; + virtualModifier= AltGr; + action= SetGroup(group=2,clearLocks); + }; + + interpret Any + Any { + action= SetMods(modifiers=modMapMods); + }; + + group 2 = AltGr; + group 3 = AltGr; + group 4 = AltGr; + + indicator.allowExplicit= False; + indicator "Caps Lock" { + whichModState= Locked; + modifiers= Lock; + }; + indicator "Num Lock" { + whichModState= Locked; + modifiers= NumLock; + }; + indicator "Shift Lock" { + whichModState= Locked; + modifiers= Shift; + }; + indicator.allowExplicit= True; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/compat/xfree86 /opt/SUNWut/lib/xkb/compat/xfree86 --- /opt/SUNWut.orig/lib/xkb/compat/xfree86 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/compat/xfree86 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,57 @@ +// $XFree86$ +// XFree86 special keysyms + +default partial xkb_compatibility "basic" { + + interpret.repeat= True; + + interpret XF86_Switch_VT_1 { + action = SwitchScreen(Screen=1, !SameServer); + }; + interpret XF86_Switch_VT_2 { + action = SwitchScreen(Screen=2, !SameServer); + }; + interpret XF86_Switch_VT_3 { + action = SwitchScreen(Screen=3, !SameServer); + }; + interpret XF86_Switch_VT_4 { + action = SwitchScreen(Screen=4, !SameServer); + }; + interpret XF86_Switch_VT_5 { + action = SwitchScreen(Screen=5, !SameServer); + }; + interpret XF86_Switch_VT_6 { + action = SwitchScreen(Screen=6, !SameServer); + }; + interpret XF86_Switch_VT_7 { + action = SwitchScreen(Screen=7, !SameServer); + }; + interpret XF86_Switch_VT_8 { + action = SwitchScreen(Screen=8, !SameServer); + }; + interpret XF86_Switch_VT_9 { + action = SwitchScreen(Screen=9, !SameServer); + }; + interpret XF86_Switch_VT_10 { + action = SwitchScreen(Screen=10, !SameServer); + }; + interpret XF86_Switch_VT_11 { + action = SwitchScreen(Screen=11, !SameServer); + }; + interpret XF86_Switch_VT_12 { + action = SwitchScreen(Screen=12, !SameServer); + }; + + interpret XF86_Ungrab { + action = Private(type=0x86, data="Ungrab"); + }; + interpret XF86_ClearGrab { + action = Private(type=0x86, data="ClsGrb"); + }; + interpret XF86_Next_VMode { + action = Private(type=0x86, data="+VMode"); + }; + interpret XF86_Prev_VMode { + action = Private(type=0x86, data="-VMode"); + }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/compat/xtest /opt/SUNWut/lib/xkb/compat/xtest --- /opt/SUNWut.orig/lib/xkb/compat/xtest 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/compat/xtest 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,58 @@ +// $Xorg: xtest,v 1.3 2000/08/17 19:54:34 cpqbld Exp $ +default xkb_compatibility "xtest" { + + // Minimal set of symbol interpretations to provide + // reasonable behavior for testing. The X Test + // Suite assumes that it can set any modifier by + // simulating a KeyPress and clear it by simulating + // a KeyRelease. Because of the way that XKB + // implements locking/latching modifiers, this + // approach fails in some cases (typically the + // lock or num lock modifiers). These symbol + // interpretations make all modifier keys just + // set the corresponding modifier so that xtest + // will see the behavior it expects. + + virtual_modifiers NumLock,AltGr; + + interpret.repeat= False; + setMods.clearLocks= True; + latchMods.clearLocks= True; + latchMods.latchToLock= False; + + interpret Shift_Lock+AnyOf(Shift+Lock) { + action= SetMods(modifiers=Shift); + }; + + interpret Num_Lock+Any { + virtualModifier= NumLock; + action= SetMods(modifiers=NumLock); + }; + + interpret Mode_switch { + useModMapMods= level1; + virtualModifier= AltGr; + action= SetGroup(group=2); + }; + + interpret Any + Any { + action= SetMods(modifiers=modMapMods); + }; + + group 2 = AltGr; + group 3 = AltGr; + group 4 = AltGr; + + indicator.allowExplicit= False; + indicator "Caps Lock" { + modifiers= Lock; + }; + indicator "Num Lock" { + modifiers= NumLock; + }; + indicator "Shift Lock" { + whichModState= Locked; + modifiers= Shift; + }; + indicator.allowExplicit= True; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/geometry/README /opt/SUNWut/lib/xkb/geometry/README --- /opt/SUNWut.orig/lib/xkb/geometry/README 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/geometry/README 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,10 @@ +The geometry component of a keyboard mapping specifies primarily the geometry of +the keyboard. It contains the geometry symbolic name and the keyboard geometry +description. The geometry component might also contain aliases for some keys or +symbolic names for some indicators and might affect the set of indicators that +are physically present. Key aliases defined in the geometry component of a +keyboard mapping override those defined in the keycodes component. + + + +/* $XFree86$ */ diff -ruN /opt/SUNWut.orig/lib/xkb/geometry/amiga /opt/SUNWut/lib/xkb/geometry/amiga --- /opt/SUNWut.orig/lib/xkb/geometry/amiga 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/geometry/amiga 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,270 @@ +// $Xorg: amiga,v 1.3 2000/08/17 19:54:35 cpqbld Exp $ + + + +// $XFree86: xc/programs/xkbcomp/geometry/amiga,v 3.2 1997/10/26 13:25:34 dawes Exp $ + +default xkb_geometry "usa1" { + + description= "Amiga (usa1)"; + width= 490; + height= 175; + + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "BKSP" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "FCTS" { { [ 23,18] }, { [2,1], [ 21,17] } }; + shape "TLDE" { { [ 28,18] }, { [2,1], [ 21,17] } }; + shape "TABK" { { [ 37,18] }, { [2,1], [ 35,17] } }; + shape "CTRL" { { [ 23,18] }, { [2,1], [ 21,17] } }; + shape "CAPS" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "RTRN" { + approx = { [ 16, 0], [42,37] }, + { [16, 0], [42, 0], [42,37], + [ 0,37], [ 0,19], [16,19] }, + { [18, 1], [40, 1], [40,36], + [ 2,36], [ 2,20], [18,20] } }; + shape "LFSH" { { [ 52,18] }, { [2,1], [ 50,17] } }; + shape "RTSH" { { [ 52,18] }, { [2,1], [ 50,17] } }; + shape "MODK" { { [ 23,18] }, { [2,1], [ 21,17] } }; + shape "SPCE" { { [172,18] }, { [2,1], [170,17] } }; + shape "DELE" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [ 35,17] } }; + shape "KPEN" { { [ 18,37] }, { [2,1], [ 16,36] } }; + + section.left= 22; + row.left= 1; + key.shape= "FCTS"; + key.gap= 1; + section "Function" { + top= 28; + row { + top= 1; + keys { { , shape="NORM" }, + { , 9 }, , , , , + { , 9 }, , , , + }; + }; + }; // End of "Function" section + + key.shape= "NORM"; + section "Alpha" { + top= 56; + row { + top= 1; + keys { { , shape="TLDE" }, + , , , , , , + , , , , , , + , { , "BKSP" } + }; + }; + row { + top= 20; + keys { { , "TABK" }, + , , , , , + , , , , , + , , { , "RTRN", -15 } + }; + }; + row { + top= 39; + keys { { , "CTRL" }, { , "CAPS" }, + , , , , , + , , , , , + + }; + }; + row { + top= 58; + keys { { , "LFSH" }, + , , , , , + , , , , , + { , "RTSH" } + }; + }; + row { + top= 77; + key.shape= "MODK"; + keys { { , 10 }, , + { , "SPCE" }, + , + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 56; + left= 326; + row { + top= 1; + key.shape = "DELE"; + keys { , }; + }; + row { + top= 39; + left = 20; + keys { }; + }; + row { + top= 58; + keys { , , }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 56; + left= 392; + row { + top= 1; + keys { , , , }; + }; + row { + top= 20; + keys { , , , }; + }; + row { + top= 39; + keys { , , , }; + }; + row { + top= 58; + keys { , , , { , "KPEN" } }; + }; + row { + top= 77; + keys { { , "KP0" }, }; + }; + }; // End of "Keypad" section + +}; + +xkb_geometry "de" { + + description= "Amiga (de)"; + width= 490; + height= 175; + + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "BKSP" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "FCTS" { { [ 23,18] }, { [2,1], [ 21,17] } }; + shape "TLDE" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "TABK" { { [ 37,18] }, { [2,1], [ 35,17] } }; + shape "CTRL" { { [ 23,18] }, { [2,1], [ 21,17] } }; + shape "CAPS" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "RTRN" { + { [ 0, 0], [28,0], [28,37], [5,37], [5,18], [ 0,18] }, + { [ 2, 1], [26,1], [26,36], [7,36], [7,17], [ 2,17] } }; + shape "LFSH" { { [ 32,18] }, { [2,1], [ 29,17] } }; + shape "RTSH" { { [ 52,18] }, { [2,1], [ 50,17] } }; + shape "MODK" { { [ 23,18] }, { [2,1], [ 21,17] } }; + shape "SPCE" { { [172,18] }, { [2,1], [170,17] } }; + shape "DELE" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [ 35,17] } }; + shape "KPEN" { { [ 18,37] }, { [2,1], [ 16,36] } }; + + section.left= 22; + row.left= 1; + key.shape= "FCTS"; + key.gap= 1; + section "Function" { + top= 28; + row { + top= 1; + keys { { , shape="NORM" }, + { , 9 }, , , , , + { , 9 }, , , , + }; + }; + }; // End of "Function" section + + key.shape= "NORM"; + section "Alpha" { + top= 56; + row { + top= 1; + keys { { , shape="TLDE" }, + , , , , , , + , , , , , , + , { , "BKSP" } + }; + }; + row { + top= 20; + keys { { , "TABK" }, + , , , , , + , , , , , + , , { , "RTRN" } + }; + }; + row { + top= 39; + keys { { , "CTRL" }, { , "CAPS" }, + , , , , , + , , , , , + , + }; + }; + row { + top= 58; + keys { { , "LFSH" }, + , , , , , , + , , , , , + { , "RTSH" } + }; + }; + row { + top= 77; + key.shape= "MODK"; + keys { { , 14 }, , + { , "SPCE" }, + , + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 56; + left= 326; + row { + top= 1; + key.shape = "DELE"; + keys { , }; + }; + row { + top= 39; + left = 20; + keys { }; + }; + row { + top= 58; + keys { , , }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 56; + left= 392; + row { + top= 1; + keys { , , , }; + }; + row { + top= 20; + keys { , , , }; + }; + row { + top= 39; + keys { , , , }; + }; + row { + top= 58; + keys { , , , { , "KPEN" } }; + }; + row { + top= 77; + keys { { , "KP0" }, }; + }; + }; // End of "Keypad" section + +}; diff -ruN /opt/SUNWut.orig/lib/xkb/geometry/ataritt /opt/SUNWut/lib/xkb/geometry/ataritt --- /opt/SUNWut.orig/lib/xkb/geometry/ataritt 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/geometry/ataritt 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,257 @@ +// $Xorg: ataritt,v 1.3 2000/08/17 19:54:35 cpqbld Exp $ + + + +// $XFree86: xc/programs/xkbcomp/geometry/ataritt,v 3.2 1997/10/26 13:25:34 dawes Exp $ + +default xkb_geometry "us" { + + description= "Atari TT (us)"; + width= 480; + height= 173; + + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "BKSP" { { [ 37,18] }, { [2,1], [ 35,17] } }; + shape "TABK" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "RTRN" { approx = { [0,19], [32,37] }, + { [ 14, 0], [32, 0], [32,37], [0,37], [0,19], [14,19] }, + { [ 16, 1], [30, 1], [30,36], [2,36], [2,20], [16,20] } }; + shape "CTRL" { { [ 32,18] }, { [2,1], [ 30,17] } }; + shape "LFSH" { { [ 42,18] }, { [2,1], [ 40,17] } }; + shape "RTSH" { { [ 52,18] }, { [2,1], [ 50,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "SPCE" { { [172,18] }, { [2,1], [170,17] } }; + shape "FCTS" { { [ 28,10] }, { [2,1], [ 26,9] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [ 35,17] } }; + shape "KPEN" { { [ 18,37] }, { [2,1], [ 16,36] } }; + + section.left= 21; + row.left= 1; + key.shape = "NORM"; + key.gap= 1; + section "Function" { + top= 36; + key.shape= "FCTS"; + row { + top= 1; + keys { , , , , + , , , , + , + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 63; + row { + top= 1; + keys { , , , , , + , , , , , + , , , , + { , "BKSP" } + }; + }; + row { + top= 20; + keys { { , "TABK" }, + , , , , , + , , , , , + , , { , "RTRN", -13 }, + }; + }; + row { + top= 39; + keys { { , "CTRL" }, + , , , , , + , , , , , + , { , 34 } + }; + }; + row { + top= 58; + keys { { , "LFSH" }, + , , , , , + , , , , , + { , "RTSH" } + }; + }; + row { + top= 77; + key.shape= "MODK"; + keys { { , 24 }, + { , "SPCE" }, + + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 63; + left= 319; + row { + top= 1; + key.shape = "BKSP"; + keys { , }; + }; + row { + top= 20; + keys { , , }; + }; + row { + top= 39; + keys { , , }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 63; + left= 381; + row { + top= 1; + keys { , , , }; + }; + row { + top= 20; + keys { , , , }; + }; + row { + top= 39; + keys { , , , }; + }; + row { + top= 58; + keys { , , , { , "KPEN" } }; + }; + row { + top= 77; + keys { { , "KP0" }, }; + }; + }; // End of "Keypad" section + +}; + +xkb_geometry "de" { + + description= "Atari TT (de)"; + width= 480; + height= 173; + + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "BKSP" { { [ 27,18] }, { [2,1], [ 25,17] } }; + shape "TABK" { { [ 27,18] }, { [2,1], [ 25,17] } }; + shape "RTRN" { approx = { [0,19], [32,37] }, + { [ 14, 0], [32, 0], [32,37], [0,37], [0,19], [14,19] }, + { [ 16, 1], [30, 1], [30,36], [2,36], [2,20], [16,20] } }; + shape "CTRL" { { [ 32,18] }, { [2,1], [ 30,17] } }; + shape "LFSH" { { [ 23,18] }, { [2,1], [ 21,17] } }; + shape "RTSH" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "SPCE" { { [170,18] }, { [2,1], [168,17] } }; + shape "FCTS" { { [ 28,11] }, { [2,1], [ 26,10] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [ 35,17] } }; + shape "KPEN" { { [ 18,37] }, { [2,1], [ 16,36] } }; + + section.left= 21; + row.left= 1; + key.shape = "NORM"; + key.gap= 1; + section "Function" { + top= 36; + key.shape= "FCTS"; + row { + top= 1; + keys { , , , , + , , , , + , + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 63; + row { + top= 1; + keys { , , , , , + , , , , , + , , , , + { , "BKSP" } + }; + }; + row { + top= 20; + keys { { , "TABK" }, + , , , , , + , , , , , + , , { , "RTRN", -13 }, + }; + }; + row { + top= 39; + keys { { , "CTRL" }, + , , , , , + , , , , , + , { , 34 } + }; + }; + row { + top= 58; + keys { { , "LFSH" }, , + , , , , + , , , , , , + { , "RTSH" } + }; + }; + row { + top= 77; + key.shape= "MODK"; + keys { { , 24 }, { , "SPCE" }, + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 63; + left= 319; + row { + top= 1; + key.shape = "BKSP"; + keys { , }; + }; + row { + top= 20; + keys { , , }; + }; + row { + top= 39; + keys { , , }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 63; + left= 381; + row { + top= 1; + keys { , , , }; + }; + row { + top= 20; + keys { , , , }; + }; + row { + top= 39; + keys { , , , }; + }; + row { + top= 58; + keys { , , , { , "KPEN" } }; + }; + row { + top= 77; + keys { { , "KP0" }, }; + }; + }; // End of "Keypad" section + +}; diff -ruN /opt/SUNWut.orig/lib/xkb/geometry/chicony /opt/SUNWut/lib/xkb/geometry/chicony --- /opt/SUNWut.orig/lib/xkb/geometry/chicony 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/geometry/chicony 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,190 @@ +// -*- indent-tabs-mode: nil -*- +// $XFree86: xc/programs/xkbcomp/geometry/chicony,v 1.1 2003/05/29 12:41:57 pascal Exp $ + +// Created by Alexander Pohoyda +// Geometry specification for Chicony KB-9820 keyboard. + +// 86 keys +default xkb_geometry "us" { + description = "Chicony KB-9820 infra-red keyboard"; + width = 350; + height = 180; + //baseColor = "grey60"; + labelColor = "white"; + + shape "EDGE" { cornerRadius = 25, + { [0, 8], [142.5, 0], [202.5, 0], [347, 8], + [347, 60], [327, 100], [322, 160], + [202.5, 165], [142.5, 165], + [25, 160], [20, 100], [0, 60] } }; + shape "KEYS" { cornerRadius = 2, { [271, 109] } }; + shape "MOUS" { cornerRadius = 12, { [24, 24] } }; + shape "MOUS2" { cornerRadius = 9, { [18, 18] } }; + shape "BTNS" { cornerRadius = 5, { [10, 10] } }; + + solid "Edges" { + top = 0; + left = 0; + shape = "EDGE"; + color = "grey60"; + }; + + solid "KeyPanel" { + shape = "KEYS"; + left = 38; + top = 22; + color = "black"; + }; + + solid "Mouse" { + shape = "MOUS"; + left = 315; + top = 30; + color = "grey30"; + }; + + outline "Mouse2" { + shape = "MOUS2"; + left = 318; + top = 33; + color = "black"; + }; + + solid "Button1" { + shape = "BTNS"; + left = 10; + top = 32; + color = "grey30"; + }; + + solid "Button2" { + shape = "BTNS"; + left = 20; + top = 42; + color = "grey30"; + }; + + outline "Buttons" { + shape = "MOUS"; + left = 8; + top = 30; + color = "black"; + }; + + shape.cornerRadius = 1; + shape "ESC" { { [17, 12] }, { [1.5, 0], [15.5, 10] } }; + shape "SMALL" { { [15, 12] }, { [1.5, 0], [13.5, 10] } }; + shape "THIN" { { [14, 18] }, { [2, 0], [12, 15] } }; + shape "NARR" { { [16, 18] }, { [2, 0], [14, 15] } }; + shape "NORM" { { [17, 18] }, { [2, 0], [15, 15] } }; + shape "WIDER" { { [18, 18] }, { [2, 0], [16, 15] } }; + shape "CAPS" { { [22, 18] }, { [2, 0], [20, 15] } }; + shape "RTSH" { { [23, 18] }, { [2, 0], [21, 15] } }; + shape "WIDEST" { { [30, 18] }, { [2, 0], [28, 15] } }; + shape "SPCE" { { [68, 18] }, { [2, 0], [66, 15] } }; + + section "Function" { + key.shape = "SMALL"; + key.gap = 0.79; + key.color = "grey60"; + left = 38; + top = 22; + row { + top = 1; + keys { { , shape="ESC", 1 }, + { , 1.5 }, , , , + , , , , + , , , , + , , , + }; + }; + }; // End of "Function" section + + section "Control" { + key.shape = "NORM"; + key.gap = 1; + key.color = "grey60"; + left = 38; + top = 111; + row { + top = 1; + keys { , , , , + { , shape="SPCE" }, + , + { , shape="THIN" }, + { , shape="THIN" }, + { , shape="THIN" }, + { , shape="THIN" } }; + }; + }; // End of "Control" section + + section "Editing" { + key.shape = "NORM"; + key.gap = 1; + key.color = "grey60"; + left = 291; + top = 34; + row.vertical = True; + row { + top = 1; + keys { , , , }; + }; + }; // End of "Editing" section + + section "Navigation" { + key.gap = 1; + key.shape = "NARR"; + key.color = "grey60"; + left = 257; + top = 92; + row { + left = 16; + top = 1; + keys { }; + }; + row { + top = 20; + keys { , , }; + }; + }; // End of "Navigation" section + + section "Alpha" { + key.gap = 1; + key.shape = "NORM"; + key.color = "grey60"; + left = 38; + top = 35; + row { + top = 1; + keys { { , shape="NARR" }, + , , , , + , , , , , + , , , { , shape="WIDER" } + }; + }; + row { + top = 20; + keys { , + , , , , , + , , , , , + , , + }; + }; + row { + top = 39; + keys { { , shape="CAPS" }, + , , , , , + , , , , , + , { , shape="WIDEST" } + }; + }; + row { + top = 58; + keys { { , shape="WIDEST" }, + , , , , , + , , , , , + { , shape="RTSH" } + }; + }; + }; // End of "Alpha" section +}; diff -ruN /opt/SUNWut.orig/lib/xkb/geometry/dell /opt/SUNWut/lib/xkb/geometry/dell --- /opt/SUNWut.orig/lib/xkb/geometry/dell 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/geometry/dell 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,185 @@ +// $Xorg: dell,v 1.4 2001/02/09 02:05:49 xorgcvs Exp $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +// $XFree86$ +// +default xkb_geometry "dell101" { + + description= "Dell 101"; + width= 470; + height= 210; + + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [ 16,16] } }; + shape "BKSP" { { [ 38,18] }, { [2,1], [ 36,16] } }; + shape "TABK" { { [ 28,18] }, { [2,1], [ 26,16] } }; + shape "BKSL" { { [ 28,18] }, { [2,1], [ 26,16] } }; + shape "RTRN" { { [ 42,18] }, { [2,1], [ 40,16] } }; + shape "CAPS" { { [ 33,18] }, { [ 28,18] }, { [2,1], [ 26,16] } }; + shape "LFSH" { { [ 42,18] }, { [2,1], [ 40,16] } }; + shape "RTSH" { { [ 52,18] }, { [2,1], [ 50,16] } }; + shape "MODK" { { [ 27,18] }, { [2,1], [ 25,16] } }; + shape "SPCE" { { [133,18] }, { [2,1], [131,16] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [ 35,16] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [ 16,35] } }; + + shape "LEDS" { cornerRadius= 0, { [ 75 ,20 ] } }; + shape "LED" { cornerRadius= 0, { [ 5, 1 ] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 52; + left= 377; + color= "grey10"; + }; + + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 67; + indicator.shape= "LED"; + indicator "Num Lock" { left= 382; }; + indicator "Caps Lock" { left= 407; }; + indicator "Scroll Lock" { left= 433; }; + text.top= 55; + text.color= "black"; + text "NumLockLabel" { left= 378; text="Num\nLock"; }; + text "CapsLockLabel" { left= 403; text="Caps\nLock"; }; + text "ScrollLockLabel" { left= 428; text="Scroll\nLock"; }; + + section.left= 19; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 52; + row { + top= 1; + keys { { , color="grey20" }, + { , 20 }, , , , + { , 11 }, , , , + { , 11 }, , , , + { , 8 }, , + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 91; + row { + top= 1; + keys { , , , , , + , , , , , + , , , + { , "BKSP", color="grey20" } + }; + }; + row { + top= 20; + keys { { , "TABK", color="grey20" }, + , , , , , + , , , , , + , , { , "BKSL" } + }; + }; + row { + top= 39; + keys { { , "CAPS", color="grey20" }, + , , , , , + , , , , , + , { , "RTRN", color="grey20" } + }; + }; + row { + top= 58; + keys { { , "LFSH", color="grey20" }, + , , , , , + , , , , , + { , "RTSH", color="grey20" } + }; + }; + row { + top= 77; + key.shape= "MODK"; + key.color= "grey20"; + keys { , { , 21 }, + { , "SPCE", color="white" }, + , { , 21 } + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 91; + left= 312; + key.color= "grey20"; + row { + top= 1; + keys { , , }; + }; + row { + top= 20; + keys { , , }; + }; + row { + top= 58; + left= 20; + keys { }; + }; + row { + top= 77; + keys { , , }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 91; + left= 376; + row { + top= 1; + key.color= "grey20"; + keys { , , , }; + }; + row { + top= 20; + keys { , , , { , "KPAD", color="grey20" } }; + }; + row { + top= 39; + keys { , , }; + }; + row { + top= 58; + keys { , , , { , "KPAD", color="grey20" } }; + }; + row { + top= 77; + keys { { , "KP0" }, }; + }; + }; // End of "Keypad" section + + alias = ; + alias = ; + +}; // End of "default" geometry diff -ruN /opt/SUNWut.orig/lib/xkb/geometry/digital/lk /opt/SUNWut/lib/xkb/geometry/digital/lk --- /opt/SUNWut.orig/lib/xkb/geometry/digital/lk 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/geometry/digital/lk 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,730 @@ +// $Xorg: lk,v 1.3 2000/08/17 19:54:36 cpqbld Exp $ +// +//Copyright (c) 1996 Digital Equipment Corporation +// +//Permission is hereby granted, free of charge, to any person obtaining +//a copy of this software and associated documentation files (the +//"Software"), to deal in the Software without restriction, including +//without limitation the rights to use, copy, modify, merge, publish, +//distribute, sublicense, and sell copies of the Software, and to +//permit persons to whom the Software is furnished to do so, subject to +//the following conditions: +// +//The above copyright notice and this permission notice shall be included +//in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +//OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL DIGITAL EQUIPMENT CORPORATION BE LIABLE FOR ANY CLAIM, +//DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR +//OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR +//THE USE OR OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of the Digital Equipment +//Corporation shall not be used in advertising or otherwise to promote +//the sale, use or other dealings in this Software without prior written +//authorization from Digital Equipment Corporation. +// +// HISTORY +// Log: lk,v +// Revision 1.2 1996/06/18 09:12:47 erik +// use flags correctly, assorted cleanups and consortium fixes +// +// Revision 1.1.6.2 1995/08/18 21:15:16 William_Walker +// Upgrade XKB to Protocol Rev. 0.64 +// [1995/08/18 20:41:46 William_Walker] +// +// Revision 1.1.2.5 1995/08/11 19:35:47 William_Walker +// Sync up with Erik's pool. +// [1995/08/11 18:35:58 William_Walker] +// +// Revision 1.1.2.4 1995/06/27 12:17:28 William_Walker +// Rename to ISO9995 compliant . +// [1995/06/26 20:23:07 William_Walker] +// +// Revision 1.1.2.3 1995/06/09 20:54:36 William_Walker +// Add VT105 layout support and ISO group support +// [1995/06/09 20:40:38 William_Walker] +// +// Revision 1.1.2.2 1995/06/05 19:21:16 William_Walker +// New file. I love keymaps. +// [1995/06/05 18:05:43 William_Walker] +// +// EndLog +// +// @(#)RCSfile: lk,v Revision: 1.2 (DEC) Date: 1996/01/24 12:16:00 +// +xkb_geometry "lk201" { + width = 530; + height = 170; + shape.cornerRadius = 1; + + shape "NORM" { { [18,19] }, { [3,2], [15,16] } }; + shape "RTRN" { + approx = { [0,0],[23,19] }, + { [0,0], [23,0], [23,39], [5,39], [5,19], [0,19] }, + { [3,2], [20,2], [20,36], [8,36], [8,16], [3,16] } + }; + shape "LONG" { { [37,19] }, { [3,2], [34,16] } }; + shape "TALL" { { [18,39] }, { [3,2], [15,36] } }; + shape "MED" { { [28,19] }, { [3,2], [25,16] } }; + shape "CAPS" { { [28,19] }, { [3,2], [18,16] } }; + shape "SPCE" { { [171,19] },{ [3,2], [168,16]} }; + shape "LEDS" { [ 30,15] }; + shape "LED" { [ 5, 2] }; + + section.left= 27; + row.left = 1; + key.shape = "NORM"; + key.gap = 1; + + section "Function" { top = 20; + row { top = 1; + keys { , , , , , + { , 19 }, , , , , + { , 19 }, , , , + { , 98 }, , , + }; + }; + }; + + section "Editing" { top = 20; left = 350; + row { top = 1; + keys { , { , "LONG" } }; + }; + row { top = 41; + keys { , , }; + }; + row { top = 61; + keys { , , }; + }; + row { top = 81; left = 20; + keys { }; + }; + row { top = 101; + keys { , , }; + }; + }; + + section "Keypad" { top = 60; left = 426; + row { top = 1; + keys { , , , }; + }; + row { top = 21; + keys { , , , }; + }; + row { top = 41; + keys { , , , }; + }; + row { top = 61; + keys { , , , { , "TALL" } }; + }; + row { top = 81; + keys { { , "LONG" }, }; + }; + }; + + section "Alpha" { top = 60; + row { top = 1; left = 15; + keys { , + , , , , , , + , , , , , , + { , "MED" } + }; + }; + row { top = 21; left = 15; + keys { { , "MED" }, + , , , , , , + , , , , , , + { , "RTRN" } + }; + + }; + row { top = 41; + keys { , + { , "CAPS" }, + , , , , , , + , , , , , + }; + }; + row { top = 61; + keys { { , "LONG" }, + , , , , , , + , , , , , + { , "LONG" } + }; + }; + row { top = 81; left = 26; + keys { { , "LONG" }, + { , "SPCE" } + }; + }; + }; + + section.left = 341; + section.top = 3; + + section "Indicators" { + indicator.onColor = "#00ff00"; + indicator.offColor= "#001000"; + indicator.top = 10; + indicator.shape= "LED"; + indicator "Scroll Lock" { left = 9; }; + indicator "Caps Lock" { left = 27; }; + indicator "Compose" { left = 45; }; + indicator "Wait" { left = 63; }; + text.top = 4; + text.color = "black"; + text "HoldScreenLabel" {left = 5; text="Hold\n"; }; + text "CapsLockLabel" {left = 23; text="Lock\n"; }; + text "ComposeLabel" {left = 37; text="Compose\n"; }; + text "WaitLabel" {left = 60; text="Wait\n"; }; + }; +}; + +xkb_geometry "lk401" { + + width = 480; + height = 180; + shape.cornerRadius = 1; + + shape "NORM" { { [18,19] }, { [3,2], [15,16] } }; + shape "RTRN" { + approx = { [0,0],[23,19] }, + { [0,0], [23,0], [23,39], [5,39], [5,19], [0,19] }, + { [3,2], [20,2], [20,36], [8,36], [8,16], [3,16] } + }; + shape "LONG" { { [37,19] }, { [3,2], [34,16] } }; + shape "TALL" { { [18,39] }, { [3,2], [15,36] } }; + shape "MED" { { [28,19] }, { [3,2], [25,16] } }; + shape "CAPS" { { [28,19] }, { [3,2], [18,16] } }; + shape "SPCE" { { [131,19] },{ [3,2], [128,16]} }; + shape "LEDS" { [ 36,15] }; + shape "LED" { [ 5, 2] }; + + section.left= 17; + row.left = 1; + key.shape = "NORM"; + key.gap = 1; + + text "Logo" {left = 20; top = 10; text="digital\n"; }; + + section "Function" { top = 20; + row { top = 1; + keys { , , , , , + { , 15 }, , , , , + { , 15 }, , , , + { , 75 }, , , + }; + }; + }; + + section "Editing" { top = 20; left = 320; + row { top = 1; + keys { , { , "LONG" } }; + }; + row { top = 41; + keys { , , }; + }; + row { top = 61; + keys { , , }; + }; + row { top = 81; left= 20; + keys { }; + }; + row { top = 101; + keys { , , }; + }; + }; + + section "Keypad" { top = 60; left = 385; + row { top = 1; + keys { , , , }; + }; + row { + top = 21; + keys { , , , }; + }; + row { top = 41; + keys { , , , }; + }; + row { top = 61; + keys { , , , { , "TALL" } }; + }; + row { top = 81; + keys { { , "LONG" }, }; + }; + }; + + section "Alpha" { top = 60; + row { top = 1; left = 15; + keys { , + , , , , , , + , , , , , , + { , "MED" } + }; + }; + row { top = 21; left = 15; + keys { { , "MED" }, + , , , , , , + , , , , , , + { , "RTRN" } + }; + + }; + row { top = 41; + keys { , + { , "CAPS" }, + , , , , , , + , , , , , + }; + }; + row { top = 61; + keys { { , "LONG" }, + , , , , , , + , , , , , + { , "LONG" } + }; + }; + row { top = 81; left = 29; + keys { { , "MED" }, + { , "MED" }, + { , "SPCE" }, + { , "MED" }, + { , "MED" } + }; + }; + }; + + section.left = 69; + section.top = 3; + section "Indicators" { + solid "led_panel" { top = 0; left = 0; + cornerRadius = 1; + shape = "LEDS"; + color = "grey"; + }; + indicator.onColor = "#00ff00"; + indicator.offColor= "#001000"; + indicator.shape = "LED"; + indicator.top = 1; + indicator "Scroll Lock" { left = 3; }; + indicator "Caps Lock" { left = 22; }; + }; + section "IndicatorLabels" { + text.top = 4; + text.color = "black"; + text "ScrollLockLabel" {left = 3; text="Scroll\nLock"; }; + text "CapsLockLabel" {left = 22; text="Caps\nLock"; }; + }; +}; + +xkb_geometry "lk450" { + + width = 480; + height = 180; + shape.cornerRadius = 1; + + shape "NORM" { { [18,19] }, { [3,2], [15,16] } }; + shape "RTRN" { + approx = { [0,0],[23,19] }, + { [0,0], [23,0], [23,39], [5,39], [5,19], [0,19] }, + { [3,2], [20,2], [20,36], [8,36], [8,16], [3,16] } + }; + shape "LONG" { { [37,19] }, { [3,2], [34,16] } }; + shape "TALL" { { [18,39] }, { [3,2], [15,36] } }; + shape "MED" { { [28,19] }, { [3,2], [25,16] } }; + shape "CAPS" { { [28,19] }, { [3,2], [18,16] } }; + shape "SPCE" { { [131,19] },{ [3,2], [128,16]} }; + shape "LEDS" { [ 36,15] }; + shape "LED" { [ 5, 2] }; + + section.left= 17; + row.left = 1; + key.shape = "NORM"; + key.gap = 1; + + text "Logo" {left = 20; top = 10; text="digital\n"; }; + + section "Function" { top = 20; + row { top = 1; + keys { , , , , , + { , 15 }, , , , , + { , 15 }, , , , + { , 75 }, , , + }; + }; + }; + + section "Editing" { top = 20; left = 320; + row { top = 1; + keys { , { , "LONG" } }; + }; + row { top = 41; + keys { , , }; + }; + row { top = 61; + keys { , , }; + }; + row { top = 81; left= 20; + keys { }; + }; + row { top = 101; + keys { , , }; + }; + }; + + section "Keypad" { top = 60; left = 385; + row { top = 1; + keys { , , , }; + }; + row { + top = 21; + keys { , , , }; + }; + row { top = 41; + keys { , , , }; + }; + row { top = 61; + keys { , , , { , "TALL" } }; + }; + row { top = 81; + keys { { , "LONG" }, }; + }; + }; + + section "Alpha" { top = 60; + row { top = 1; left = 15; + keys { , + , , , , , , + , , , , , , + { , "MED" } + }; + }; + row { top = 21; left = 15; + keys { { , "MED" }, + , , , , , , + , , , , , , + { , "RTRN" } + }; + + }; + row { top = 41; + keys { , + { , "CAPS" }, + , , , , , , + , , , , , + }; + }; + row { top = 61; + keys { { , "LONG" }, + , , , , , , + , , , , , + { , "LONG" } + }; + }; + row { top = 81; left = 29; + keys { { , "MED" }, + { , "MED" }, + { , "SPCE" }, + { , "MED" }, + { , "MED" } + }; + }; + }; + + section.left = 69; + section.top = 3; + section "Indicators" { + solid "led_panel" { top = 0; left = 0; + cornerRadius = 1; + shape = "LEDS"; + color = "grey"; + }; + indicator.onColor = "#00ff00"; + indicator.offColor= "#001000"; + indicator.shape = "LED"; + indicator.top = 1; + indicator "Scroll Lock" { left = 3; }; + indicator "Caps Lock" { left = 22; }; + }; + section "IndicatorLabels" { + text.top = 4; + text.color = "black"; + text "ScrollLockLabel" {left = 3; text="Scroll\nLock"; }; + text "CapsLockLabel" {left = 22; text="Caps\nLock"; }; + }; +}; + +xkb_geometry "lk401bj" +{ + width = 480; + height = 180; + shape.cornerRadius = 1; + + shape "NORM" { { [18,19] }, { [3,2], [15,16] } }; + shape "RTRN" { + approx = { [0,0],[23,19] }, + { [0,0], [23,0], [23,39], [5,39], [5,19], [0,19] }, + { [3,2], [20,2], [20,36], [8,36], [8,16], [3,16] } + }; + shape "LONG" { { [37,19] }, { [3,2], [34,16] } }; + shape "TALL" { { [18,39] }, { [3,2], [15,36] } }; + shape "MED" { { [28,19] }, { [3,2], [25,16] } }; + shape "CAPS" { { [28,19] }, { [3,2], [18,16] } }; + shape "SPCE" { { [131,19] },{ [3,2], [128,16]} }; + shape "LEDS" { [ 30,15] }; + shape "LED" { [ 5, 2] }; + + section.left= 17; + row.left = 1; + key.shape = "NORM"; + key.gap = 1; + + text "Logo" {left = 20; top = 10; text="digital\n"; }; + + section "Function" { top = 20; + row { top = 1; + keys { , , , , , + { , 15 }, , , , , + { , 15 }, , , , + { , 75 }, , , + }; + }; + }; + + section "Editing" { top = 20; left = 320; + row { top = 1; + keys { , { , "LONG" } }; + }; + row { top = 41; + keys { , , }; + }; + row { top = 61; + keys { , , }; + }; + row { top = 81; left = 20; + keys { }; + }; + row { top = 101; + keys { , , }; + }; + }; + + section "Keypad" { top = 60; left = 385; + row { top = 1; + keys { , , , }; + }; + row { top = 21; + keys { , , , }; + }; + row { top = 41; + keys { , , , }; + }; + row { top = 61; + keys { , , , { , "TALL" } }; + }; + row { top = 81; + keys { { , "LONG" }, }; + }; + }; + + section "Alpha" { top = 60; + row { top = 1; left = 15; + keys { , + , , , , , , + , , , , , , + { , "MED" } + }; + }; + row { top = 21; left = 15; + keys { { , "MED" }, + , , , , , , + , , , , , , + { , "RTRN" } + }; + }; + row { top = 41; + keys { , + { , "CAPS" }, + , , , , , , + , , , , , + }; + }; + row { top = 61; + keys { { , "LONG" }, + , , , , , , + , , , , , + { , "LONG" } + }; + }; + row { top = 81; left = 29; + keys { { , "MED" }, + { , "MED" }, + { , "SPCE" }, + { , "MED" }, + { , "MED" } + }; + }; + }; + + section.left = 69; + section.top = 3; + + section "Indicators" { + solid "led_panel" { top = 0; left = 0; + cornerRadius = 1; + shape = "LEDS"; + color = "grey"; + }; + indicator.onColor = "#00ff00"; + indicator.offColor= "#001000"; + indicator.top = 1; + indicator.shape= "LED"; + indicator "Scroll Lock" { left = 3; }; + indicator "Caps Lock" { left = 22; }; + text.top = 4; + text.color = "black"; + text "ScrollLockLabel" {left = 3; text="Scroll\nLock"; }; + text "CapsLockLabel" {left = 19; text="Caps\nLock"; }; + }; +}; + +xkb_geometry "lk401jj" { + + width = 460; + height = 180; + shape.cornerRadius = 1; + + shape "NORM" { { [18,19] }, { [3,2], [15,16] } }; + shape "RTRN" { + approx = { [0,0],[28,23] }, + { [0,0], [28,0], [28,39], [5,39], [5,19], [0,19] }, + { [3,2], [25,2], [25,36], [8,36], [8,16], [3,16] } + }; + shape "LONG" { { [37,19] }, { [3,2], [34,16] } }; + shape "LONG1" { { [32,19] }, { [3,2], [29,16] } }; + shape "TALL" { { [18,39] }, { [3,2], [15,36] } }; + shape "MED" { { [28,19] }, { [3,2], [25,16] } }; + shape "MED1" { { [23,19] }, { [3,2], [20,16] } }; + shape "CTRL" { { [43,19] }, { [3,2], [38,16] } }; + shape "SPCE" { { [55,19] },{ [3,2], [53,16]} }; + shape "LEDS" { [ 56,15] }; + shape "LED" { [ 5, 2] }; + + section.left = 5; + row.left = 1; + key.shape = "NORM"; + key.gap = 1; + + text "Logo" {left = 7; top = 10; text="digital\n"; }; + + section "Function" { top = 40; + row { top = 1; + keys { , , , , , + { , 18 }, , , , , + { , 18 }, , , , + { , 73 }, , , + }; + }; + }; + + section "Editing" { top = 40; left = 313; + row { top = 1; + keys { , { , "LONG" } }; + }; + row { top = 31; + keys { , , }; + }; + row { top = 51; + keys { , , }; + }; + row { top = 71; left= 20; + keys { }; + }; + row { top = 91; + keys { , , }; + }; + }; + + section "Keypad" { top = 70; left = 377; + row { top = 1; + keys { , , , }; + }; + row { top = 21; + keys { , , , }; + }; + row { top = 41; + keys { , , , }; + }; + row { top = 61; + keys { , , , { , "TALL" } }; + }; + row { top = 81; + keys { { , "LONG" }, }; + }; + }; + + section "Alpha" { top = 70; + row { top = 1; left = 7; + keys { { , "MED1" }, + , , , , , , + , , , , , , + , { , "MED1" } + }; + }; + row { top = 21; left = 7; + keys { { , "LONG1" }, + , , , , , , + , , , , , , + { , "RTRN" } + }; + }; + row { top = 41; + keys { { , "CTRL" }, + , , , , , , + , , , , , + }; + }; + row { top = 61; + keys { , { , "LONG1" }, + , , , , , + , , , , , + , { , "MED" } + }; + }; + row { top = 81; left = 7; + keys { { , "LONG" }, + { , "LONG" }, + { , "LONG" }, + { , "SPCE" }, + { , "LONG" }, + { , "LONG" }, + , + }; + }; + }; + + section.left = 315; + section.top = 20; + + section "Indicators" { + solid "led_panel" { top = 0; left = 0; + cornerRadius = 1; + shape = "LEDS"; + color = "grey"; + }; + indicator.onColor = "#00ff00"; + indicator.offColor= "#001000"; + indicator.top = 11; + indicator.shape= "LED"; + indicator "Scroll Lock" { left = 6; }; + indicator "Caps Lock" { left = 26; }; + text.top = 4; + text.color = "black"; + text "ScrollLockLabel" {left = 3; text="Scroll\nLock"; }; + text "CapsLockLabel" {left = 22; text="Caps\nLock"; }; + }; +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/geometry/digital/pc /opt/SUNWut/lib/xkb/geometry/digital/pc --- /opt/SUNWut.orig/lib/xkb/geometry/digital/pc 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/geometry/digital/pc 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,350 @@ +// $Xorg: pc,v 1.3 2000/08/17 19:54:36 cpqbld Exp $ +// +//Copyright (c) 1996 Digital Equipment Corporation +// +//Permission is hereby granted, free of charge, to any person obtaining +//a copy of this software and associated documentation files (the +//"Software"), to deal in the Software without restriction, including +//without limitation the rights to use, copy, modify, merge, publish, +//distribute, sublicense, and sell copies of the Software, and to +//permit persons to whom the Software is furnished to do so, subject to +//the following conditions: +// +//The above copyright notice and this permission notice shall be included +//in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +//OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL DIGITAL EQUIPMENT CORPORATION BE LIABLE FOR ANY CLAIM, +//DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR +//OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR +//THE USE OR OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of the Digital Equipment +//Corporation shall not be used in advertising or otherwise to promote +//the sale, use or other dealings in this Software without prior written +//authorization from Digital Equipment Corporation. +// +// HISTORY +// Log: pc,v +// Revision 1.2 1996/06/18 09:12:50 erik +// use flags correctly, assorted cleanups and consortium fixes +// +// Revision 1.1.6.2 1995/08/18 21:15:18 William_Walker +// Upgrade XKB to Protocol Rev. 0.64 +// [1995/08/18 20:41:49 William_Walker] +// +// Revision 1.1.2.4 1995/08/11 19:35:48 William_Walker +// Sync up with Erik's pool. +// [1995/08/11 18:36:03 William_Walker] +// +// Revision 1.1.2.3 1995/06/27 12:17:29 William_Walker +// Rename to ISO9995 compliant . +// [1995/06/26 20:23:10 William_Walker] +// +// Revision 1.1.2.2 1995/06/05 19:21:19 William_Walker +// New file. I love keymaps. +// [1995/06/05 18:05:51 William_Walker] +// +// EndLog +// +// @(#)RCSfile: pc,v Revision: 1.2 (DEC) Date: 1996/02/02 14:40:25 +// +partial xkb_geometry "common" { + width = 480; + height = 200; + + shape.cornerRadius = 1; + shape "NORM" { primary = { [18,19] }, { [3,2], [15,16] } }; + shape "KP0" { primary = { [37,19] }, { [3,2], [34,16] } }; + shape "KPAD" { primary = { [18,39] }, { [3,2], [15,36] } }; + shape "LEDS" { [78,22] }; + shape "LED" { [5,2] }; + + text.color = "black"; + section.left = 17; + row.left = 1; + key.shape = "NORM"; + key.gap = 1; + + section "Function" { top = 40; + row { top = 1; + keys { , + { , 20 }, , , , + { , 10 }, , , , + { , 10 }, , , + }; + }; + }; + + section "Editing" { top = 40; left = 308; + row { top = 1; + keys { , , }; + }; + row { top = 41; + keys { , , }; + }; + row { top = 61; + keys { , , }; + }; + row { top = 101; left = 20; + keys { }; + }; + row { top = 121; + keys { , , }; + }; + }; + + section "Keypad" { top = 80; left = 374; + row { top = 1; + keys { , , , }; + }; + row { top = 21; + keys { , , , { , "KPAD" } }; + }; + row { top = 41; + keys { , , }; + }; + row { top = 61; + keys { , , , { , "KPAD" } }; + }; + row { top = 81; + keys { { , "KP0" }, }; + }; + }; +}; + +partial xkb_geometry "leds_on_keys" { + section.top = 40; + section.left = 17; + section "LedPanel" { + indicator.onColor = "#00ff00"; + indicator.offColor = "#001000"; + indicator.shape = "LED"; + indicator "Scroll Lock" { left = 317; top = 5; }; + indicator "Num Lock" { left = 364; top = 45; }; + indicator "Caps Lock" { left = 10; top = 85; }; + }; + + section.left = 375; + section.top = 40; + section "LogoPanel" { + solid "logo_panel" { top = 0; left = 0; + shape = "LEDS"; + color = "grey"; + }; + text "Logo" {left = 28; top = 10; text="digital\n"; }; + }; +}; + +partial xkb_geometry "leds_alone" { + section.left = 375; + section.top = 40; + section "Indicators" { + solid "led_panel" { top = 0; left = 0; + shape = "LEDS"; + color = "grey"; + }; + indicator.top = 16; + indicator.onColor = "#00ff00"; + indicator.offColor = "#001000"; + indicator.shape = "LED"; + indicator "Num Lock" { left = 3; }; + indicator "Caps Lock" { left = 26; }; + indicator "Scroll Lock" { left = 50; }; + text "Logo" {left = 2; top = 3; text="digital\n"; }; + }; + section "IndicatorLabels" { + text.top = 11; + text "NumLockLabel" {left = 10; text="Num\nLock"; }; + text "CapsLockLabel" {left = 33; text="Caps\nLock"; }; + text "ScrollLockLabel" {left = 58; text="Scroll\nLock"; }; + }; +}; + +xkb_geometry "pc101" { + include "digital/pc(common)" + + shape.cornerRadius = 1; + shape "BKSP" { primary = { [36,19] }, { [3,2], [33,16] } }; + shape "TABK" { primary = { [27,19] }, { [3,2], [24,16] } }; + shape "RTRN" { primary = { [41,19] }, { [3,2], [38,16] } }; + shape "CAPS" { primary = { [32,19] }, { [3,2], [29,16] } }; + shape "LFSH" { primary = { [41,19] }, { [3,2], [38,16] } }; + shape "RTSH" { primary = { [51,19] }, { [3,2], [49,16] } }; + shape "MODK" { primary = { [27,19] }, { [3,2], [24,16] } }; + shape "BKSL" { primary = { [27,19] }, { [3,2], [24,16] } }; + shape "SPCE" { primary = { [132,19] },{ [3,2], [129,16]} }; + + section.left = 17; + row.left = 1; + key.shape = "NORM"; + key.gap = 1; + + section "Alpha" { top = 80; + row { top = 1; + keys { , + , , , , , , + , , , , , , + { , "BKSP" } + }; + }; + row { top = 21; + keys { { , "TABK" }, + , , , , , , + , , , , , , + { , "BKSL" } + }; + + }; + row { top = 41; + keys { { , "CAPS" }, + , , , , , , + , , , , , + { , "RTRN" } + }; + }; + row { top = 61; + keys { { , "LFSH" }, + , , , , , , + , , , , + { , "RTSH" } + }; + }; + row { top = 81; + key.shape = "MODK"; + keys { , + { , 20 }, + { , "SPCE" }, + , + { , 21 } + }; + }; + }; +}; + +xkb_geometry "pc102" { + include "digital/pc(common)" + + shape.cornerRadius = 1; + shape "BKSP" { primary = { [36,19] }, { [3,2], [33,16] } }; + shape "TABK" { primary = { [27,19] }, { [3,2], [24,16] } }; + shape "RTRN" { + approx = { [0,0],[28,19] }, + { [0,0], [27,0], [27,39], [5,39], [5,19], [0,19] }, + { [3,2], [24,2], [24,36], [8,36], [8,16], [3,16] } + }; + shape "CAPS" { primary = { [32,19] }, { [3,2], [29,16] } }; + shape "LFSH" { primary = { [22,19] }, { [3,2], [19,16] } }; + shape "RTSH" { primary = { [51,19] }, { [3,2], [49,16] } }; + shape "MODK" { primary = { [27,19] }, { [3,2], [24,16] } }; + shape "BKSL" { primary = { [27,19] }, { [3,2], [24,16] } }; + shape "SPCE" { primary = { [132,19] },{ [3,2], [129,16]} }; + + section.left = 17; + row.left = 1; + key.shape = "NORM"; + key.gap = 1; + + section "Alpha" { top = 80; + row { top = 1; + keys { , + , , , , , , + , , , , , , + { , "BKSP" } + }; + }; + row { top = 21; + keys { { , "TABK" }, + , , , , , , + , , , , , , + { , "RTRN" } + }; + + }; + row { top = 41; + keys { { , "CAPS" }, + , , , , , , + , , , , , + }; + }; + row { top = 61; + keys { { , "LFSH" }, + , , , , , , + , , , , , + { , "RTSH" } + }; + }; + row { top = 81; + key.shape = "MODK"; + keys { , + { , 20 }, + { , "SPCE" }, + , + { , 21 } + }; + }; + }; +}; + +xkb_geometry "pcxaj" { + include "digital/pc(common)" + + shape.cornerRadius = 1; + shape "BKSP" { primary = { [36,19] }, { [3,2], [33,16] } }; + shape "TABK" { primary = { [27,19] }, { [3,2], [24,16] } }; + shape "RTRN" { primary = { [22,19] }, { [3,2], [19,16] } }; + shape "CAPS" { primary = { [32,19] }, { [3,2], [29,16] } }; + shape "LFSH" { primary = { [41,19] }, { [3,2], [38,16] } }; + shape "RTSH" { primary = { [32,19] }, { [3,2], [29,16] } }; + shape "MODK" { primary = { [27,19] }, { [3,2], [24,16] } }; + shape "BKSL" { primary = { [27,19] }, { [3,2], [24,16] } }; + shape "SPCE" { primary = { [114,19]}, { [3,2], [111,16]} }; + + section.left = 17; + row.left = 1; + key.shape = "NORM"; + key.gap = 1; + + section "Alpha" { top = 80; + row { top = 1; + keys { , + , , , , , , + , , , , , , + { , "BKSP" } + }; + }; + row { top = 21; + keys { { , "TABK" }, + , , , , , , + , , , , , , + { , "BKSL" } + }; + }; + row { top = 41; + keys { { , "CAPS" }, + , , , , , , + , , , , , , + { , "RTRN" } + }; + }; + row { top = 61; + keys { { , "LFSH" }, + , , , , , , + , , , , , + { , "RTSH" } + }; + }; + row { top = 81; + key.shape = "MODK"; + keys { , , + { , "NORM" }, + { , "SPCE" }, + { , "NORM" }, + { , "NORM" }, + , + }; + }; + }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/geometry/digital/unix /opt/SUNWut/lib/xkb/geometry/digital/unix --- /opt/SUNWut.orig/lib/xkb/geometry/digital/unix 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/geometry/digital/unix 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,230 @@ +// $Xorg: unix,v 1.3 2000/08/17 19:54:36 cpqbld Exp $ +// +//Copyright (c) 1996 Digital Equipment Corporation +// +//Permission is hereby granted, free of charge, to any person obtaining +//a copy of this software and associated documentation files (the +//"Software"), to deal in the Software without restriction, including +//without limitation the rights to use, copy, modify, merge, publish, +//distribute, sublicense, and sell copies of the Software, and to +//permit persons to whom the Software is furnished to do so, subject to +//the following conditions: +// +//The above copyright notice and this permission notice shall be included +//in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +//OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL DIGITAL EQUIPMENT CORPORATION BE LIABLE FOR ANY CLAIM, +//DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR +//OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR +//THE USE OR OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of the Digital Equipment +//Corporation shall not be used in advertising or otherwise to promote +//the sale, use or other dealings in this Software without prior written +//authorization from Digital Equipment Corporation. +// +// HISTORY +// Log: unix,v +// Revision 1.2 1996/06/18 09:12:53 erik +// use flags correctly, assorted cleanups and consortium fixes +// +// Revision 1.1.2.3 1995/06/27 12:17:30 William_Walker +// Rename to ISO9995 compliant . +// [1995/06/26 20:23:12 William_Walker] +// +// Revision 1.1.2.2 1995/06/05 19:21:23 William_Walker +// New file. I love keymaps. +// [1995/06/05 18:05:56 William_Walker] +// +// EndLog +// +// @(#)RCSfile: unix,v Revision: 1.2 (DEC) Date: 1996/01/24 12:16: +// +xkb_geometry "unix" { + + width = 340; + height = 160; + shape.cornerRadius = 1; + + shape "NORM" { primary = { [18,19] }, { [3,2], [15,16] } }; + shape "AE00" { primary = { [28,19] }, { [3,2], [25,16] } }; + shape "BKSP" { primary = { [46,19] }, { [3,2], [43,16] } }; + shape "TABK" { primary = { [37,19] }, { [3,2], [34,16] } }; + shape "CTRL" { primary = { [46,19] }, { [3,2], [43,16] } }; + shape "RTRN" { primary = { [46,19] }, { [3,2], [43,16] } }; + shape "SHFT" { primary = { [56,19] }, { [3,2], [53,16] } }; + shape "MODK" { primary = { [37,19] }, { [3,2], [34,16] } }; + shape "SPCE" { primary = { [132,19] },{ [3,2], [129,16]} }; + + section.left= 17; + row.left = 1; + key.shape = "NORM"; + key.gap = 1; + + text.color = "black"; + text "Logo" {left = 20; top = 10; text="digital\n"; }; + + section "Function" { top = 30; + row { top = 1; + keys { , , , , , + { , 20 }, , , , , + { , 20 }, , , + }; + }; + }; + + section "Alpha" { top = 50; + row { top = 1; + keys { { , "AE00" }, + , , , , , , + , , , , , , + { , "BKSP" } + }; + }; + row { top = 21; + keys { { , "TABK" }, + , , , , , , + , , , , , , + , + }; + + }; + row { top = 41; left = -4; + keys { { , "CTRL" }, + , , , , , , + , , , , , + { , "RTRN" } + }; + }; + row { top = 61; left = -4; + keys { { , "SHFT" }, + , , , , , , + , , , , + { , "SHFT" } + }; + }; + solid "ExtendKey" { top = 81; left= 1; + shape= "NORM"; + color= "grey20"; + }; + text.top = 89; + text.color = "black"; + text "ExtendLabel" {left = 6; text="Ext\nend"; }; + row { top = 81; left = 19; + key.shape = "MODK"; + keys { { , "NORM" }, , + { , "SPCE" }, + , + }; + }; + }; +}; + +xkb_geometry "lk421jj" { + + width = 315; + height = 170; + shape.cornerRadius = 1; + + shape "NORM" { { [18,19] }, { [3,2], [15,16] } }; + shape "RTRN" { + approx = { [0,0],[28,23] }, + { [0,0], [28,0], [28,39], [5,39], [5,19], [0,19] }, + { [3,2], [25,2], [25,36], [8,36], [8,16], [3,16] } + }; + shape "LONG" { { [37,19] }, { [3,2], [34,16] } }; + shape "LONG1" { { [32,19] }, { [3,2], [29,16] } }; + shape "TALL" { { [18,39] }, { [3,2], [15,36] } }; + shape "MED" { { [23,19] }, { [3,2], [20,16] } }; + shape "CTRL" { { [43,19] }, { [3,2], [38,16] } }; + shape "SPCE" { { [55,19] },{ [3,2], [53,16]} }; + shape "LEDS" { [ 56,15] }; + shape "LED" { [ 5, 2] }; + + section.left = 5; + row.left = 1; + key.shape = "NORM"; + key.gap = 1; + + text "Logo" {left = 7; top = 10; text="digital\n"; }; + + section "Function" { top = 45; + row { top = 1; left = 7; + keys { , , , , , + { , 18 }, , , , + }; + }; + }; + + section "Editing" { top = 45; left= 230; + row { top = 1; + keys { , , , }; + }; + }; + + section "Alpha" { top = 65; + row { top = 1; left = 7; + keys { { , "MED" }, + , , , , , , + , , , , , , + , { , "MED" } + }; + }; + row { top = 21; left = 7; + keys { { , "LONG1" }, + , , , , , , + , , , , , , + { , "RTRN" } + }; + }; + row { top = 41; + keys { { , "CTRL" }, + , , , , , , + , , , , , + }; + }; + row { top = 61; + keys { , { , "LONG1" }, + , , , , , + , , , , , + , { , "LONG1" } + }; + }; + row { top = 81; left = 7; + keys { , , + { , "LONG" }, + { , "LONG" }, + { , "SPCE" }, + { , "LONG" }, + { , "LONG" }, + , + }; + }; + }; + + section.left = 233; + section.top = 20; + + section "Indicators" { + solid "led_panel" { top = 0; left = 0; + cornerRadius = 1; + shape = "LEDS"; + color = "grey"; + }; + indicator.onColor = "#00ff00"; + indicator.offColor= "#001000"; + indicator.top = 11; + indicator.shape= "LED"; + indicator "Scroll Lock" { left = 6; }; + indicator "Caps Lock" { left = 26; }; + text.top = 3; + text.color = "black"; + text "ScrollLockLabel" {left = 3; text="Scroll\nLock"; }; + text "CapsLockLabel" {left = 22; text="Caps\nLock"; }; + }; +}; + + diff -ruN /opt/SUNWut.orig/lib/xkb/geometry/everex /opt/SUNWut/lib/xkb/geometry/everex --- /opt/SUNWut.orig/lib/xkb/geometry/everex 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/geometry/everex 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,174 @@ +// $Xorg: everex,v 1.3 2000/08/17 19:54:35 cpqbld Exp $ +// +// $XFree86$ +// +default xkb_geometry "STEPnote" { + + description= "Everex STEPnote"; + width= 281; + height= 150; + + shape.cornerRadius= 1; + + shape "NORM" { + { [17,17] }, + { [ 2, 1], [ 15, 15 ] } + }; + shape "NARR" { + { [ 15, 17 ] }, + { [ 2, 1 ], [ 13, 15 ] } + }; + shape "FKEY" { + { [ 15.1, 15.5 ] }, + { [ 1, 1 ], [ 14.1, 14.5 ] } + }; + shape "ESC" { + { [ 16.4, 15.5 ] }, + { [ 1, 1 ], [ 14.1, 14.5 ] } + }; + shape "WIDE" { // backspace, tab and Fn + { [ 25, 17 ] }, + { [ 2, 1 ], [ 23, 15 ] } + }; + shape "RTRN" { + { [ 27.5, 17 ] }, + { [ 2, 1 ], [ 25.5, 15 ] } + }; + shape "CAPS" { + { [ 30, 17 ] }, + { [ 2, 1 ], [ 28, 15 ] } + }; + shape "LFSH" { + { [ 38.5, 17 ] }, + { [ 2, 1 ], [ 36.5, 15 ] } + }; + shape "RTSH" { + { [ 21, 17 ] }, + { [ 2, 1 ], [ 19, 15 ] } + }; + shape "SPCE" { + { [ 88.8, 17 ] }, + { [ 2, 1 ], [ 86.8, 15 ] } + }; + shape "WELL" { + { [ 269, 105 ] } + }; + shape "LED" { + cornerRadius= 1.5, + { [ 3, 10 ] } + }; + + section.left= 6; + row.left= 1; + key.shape= "NORM"; + key.gap= 0.5; + + key.color= "grey20"; + labelColor= "white"; + baseColor= "grey20"; + + indicator.top= 20; + indicator.shape= "LED"; + indicator.onColor= "green"; + indicator.offColor= "green30"; + + indicator "Power" { left= 40; }; + indicator "Battery" { left=101; }; + indicator "Suspend" { left=112; }; + indicator "HardDrive" { left=123; }; + indicator "Floppy" { left=134; }; + indicator "KeyPad" { left=145; }; + indicator "Num Lock" { left=156; }; + indicator "Caps Lock" { left=167; }; + indicator "Scroll Lock" { left=178; }; + + solid "KeyWell" { + top= 35; + left= 6; + shape= "WELL"; + color= "grey10"; + }; + section "Whole" { + top= 35; + row { + top= 0.5; + key.color= "grey30"; + key.shape= "FKEY"; + keys { + { , "ESC" }, + , , , , , , + , , , , , , + , , , + }; + }; + row { + top= 16.5; + keys { + { , "NARR" }, + , , , , , , + , , , , , , + { , shape="WIDE", color="grey30" }, + { , shape="NARR", color="grey30" } + }; + }; + row { + top= 34; + keys { + { , shape="WIDE", color="grey30" }, + , , , , , , + , , , , , , + { , "NARR" }, + { , shape="NARR", color="grey30" } + }; + }; + row { + top= 51.5; + keys { + { , shape="CAPS", color="grey30" }, + , , , , , + , , , , , + , + { , shape="RTRN", color="grey30" }, + { , shape="NARR", color="grey30" } + }; + }; + row { + top= 69; + keys { + { , shape="LFSH", color="grey30" }, + , , , , , + , , , , , + { , shape="RTSH", color="grey30" }, + { , shape="NARR", color="grey30" }, + { , shape="NARR", color="grey30" } + }; + }; + row { + top= 86.5; + key.color= "grey30"; + keys { + { , "WIDE" }, + , , + { , shape="SPCE", 18, color="grey20" }, + , , , + { , "NARR" }, { , "NARR" }, + { , "NARR" } + }; + }; + solid "FakeKey" { + top= 86.5; + left= 62.1; + shape= "NORM"; + color= "grey20"; + }; + overlay "KPAD" { + =, =, =, =, + =, =, =, =, + =, =, =, =, + =, =, = + }; + }; // End of "Whole" section + + alias = ; + alias = ; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/geometry/fujitsu /opt/SUNWut/lib/xkb/geometry/fujitsu --- /opt/SUNWut.orig/lib/xkb/geometry/fujitsu 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/geometry/fujitsu 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,315 @@ +// $Xorg: fujitsu,v 1.4 2001/02/09 02:05:49 xorgcvs Exp $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +default xkb_geometry "138" { + + // This is an approximate layout for a (US/ASCII) Fujitsu keyboard. + + description= "Fujitsu English keyboard"; + + width= 480; + height= 215; + + shape "EDGE" { cornerRadius= 2, { [ 480, 215 ] } }; + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "TABK" { { [ 27,18] }, { [2,1], [ 25,17] } }; + shape "RTRN" { + approx = { [ 0, 0], [28,37] }, + { [ 0, 0], [28, 0], [28,37], + [ 5,37], [ 5,19], [ 0,19] }, + { [ 1, 1], [26, 1], [26,36], + [ 7,36], [ 7,18], [ 1,18] } + }; + shape "LFSH" { { [ 41,18] }, { [2,1], [ 39,17] } }; + shape "RTSH" { { [ 33,18] }, { [2,1], [ 31,17] } }; + shape "LCTL" { { [ 32,18] }, { [2,1], [ 30,17] } }; + shape "SPCE" { { [151,18] }, { [2,1], [149,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [ 35,17] } }; + shape "KPEN" { { [ 18,37] }, { [2,1], [ 16,36] } }; + shape "EXEC" { { [ 57,18] }, { [2,1], [ 55,17] } }; + + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + section.left= 15; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + + section "Alpha" { + top= 28; + row { + top= 1; + keys { + , { , 6 }, + { , 30 }, , , , + { , 6 }, , , , + { , 6 }, , , , + { , 68 }, , , + }; + }; + row { + top= 20; + keys { + , { , 6 }, + { , 30 }, , , , + { , 6 }, , , , + { , 6 }, , , , + { , 6 }, , , + { , 6 }, , , + }; + }; + row { + top= 39; + left= 316; + keys { + , , + }; + }; + row { + top= 54; + keys { + , { , 6 }, + , , , , , + , , , , , + , , , , + { , 68 }, , , + + }; + }; + row { + top= 58; + left= 316; + keys { + , , + }; + }; + row { + top= 73; + keys { , + { , 6, "TABK" }, + , , , , , + , , , , , + , , { , "RTRN" }, + { , 68 }, , , + }; + }; + row { + top= 92; + keys { , + { , 6, "LCTL" }, + , , , , , + , , , , , + , , + { , 49 }, + { , 25 }, , , + }; + }; + row { + top= 102; + left= 316; + keys { , { , 19 } + }; + }; + row { + top= 111; + keys { , + { , 6 , "LFSH" }, + , , , , , + , , , , , + , { , "RTSH" }, + { , 25 }, + { , 25 }, , , { , "KPEN" } + }; + }; + row { + top= 130; + keys { , { , 6 }, + , , + { , "SPCE" }, + , , , , + { , 68, "KP0" }, + }; + }; + row { + top= 149; + left= 316; + keys { + { , "EXEC" } + }; + }; + }; // End of "Alpha" section +}; + +xkb_geometry "140" { + + // This is an approximate layout for a Fujitsu Japanese keyboard. + + description= "Fujitsu Japanese keyboard"; + + width= 480; + height= 215; + + shape "EDGE" { cornerRadius= 2, { [ 480, 215 ] } }; + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "TABK" { { [ 27,18] }, { [2,1], [ 25,17] } }; + shape "RTRN" { + approx = { [ 0, 0], [28,37] }, + { [ 0, 0], [28, 0], [28,37], + [ 5,37], [ 5,19], [ 0,19] }, + { [ 1, 1], [26, 1], [26,36], + [ 7,36], [ 7,18], [ 1,18] } + }; + shape "LFSH" { { [ 41,18] }, { [2,1], [ 39,17] } }; + shape "RTSH" { { [ 33,18] }, { [2,1], [ 31,17] } }; + shape "LCTL" { { [ 32,18] }, { [2,1], [ 30,17] } }; + shape "SPCE" { { [113,18] }, { [2,1], [111,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [ 35,17] } }; + shape "KPEN" { { [ 18,37] }, { [2,1], [ 16,36] } }; + shape "HNKN" { { [ 23,18] }, { [2,1], [ 21,17] } }; + shape "EXEC" { { [ 57,18] }, { [2,1], [ 55,17] } }; + + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + section.left= 15; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + + section "Alpha" { + top= 28; + row { + top= 1; + keys { + , { , 6 }, + { , 30 }, , , , + { , 6 }, , , , + { , 6 }, , , , + { , 68 }, , , + }; + }; + row { + top= 20; + keys { + , { , 6 }, + { , 30 }, , , , + { , 6 }, , , , + { , 6 }, , , , + { , 6 }, , , + { , 6 }, , , + }; + }; + row { + top= 39; + left= 316; + keys { + , , + }; + }; + row { + top= 54; + keys { + , { , 6 }, + , , , , , + , , , , , + , , , , + { , 68 }, , , + + }; + }; + row { + top= 58; + left= 316; + keys { + , , + }; + }; + row { + top= 73; + keys { , + { , 6, "TABK" }, + , , , , , + , , , , , + , , { , "RTRN" }, + { , 68 }, , , + }; + }; + row { + top= 92; + keys { , + { , 6, "LCTL" }, + , , , , , + , , , , , + , , + { , 49 }, + { , 25 }, , , + }; + }; + row { + top= 102; + left= 316; + keys { , { , 19 } + }; + }; + row { + top= 111; + keys { , + { , 6 , "LFSH" }, + , , , , , + , , , , , + , { , "RTSH" }, + { , 25 }, + { , 25 }, , , { , "KPEN" } + }; + }; + row { + top= 130; + keys { , { , 6 }, + , , , + { , "SPCE" }, + , , , , , + { , 68, "KP0" }, + }; + }; + row { + top= 149; + left= 134; + keys { + { , "HNKN" }, { , "HNKN" }, + { , 132, "EXEC" } + }; + }; + }; // End of "Alpha" section +}; diff -ruN /opt/SUNWut.orig/lib/xkb/geometry/hp /opt/SUNWut/lib/xkb/geometry/hp --- /opt/SUNWut.orig/lib/xkb/geometry/hp 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/geometry/hp 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,456 @@ +// $Xorg: hp,v 1.4 2001/02/09 02:05:50 xorgcvs Exp $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +// $XFree86: xc/programs/xkbcomp/geometry/hp,v 1.8 2003/08/09 14:30:46 pascal Exp $ + +default xkb_geometry "pc101" { + + description= "HP PC101"; + width= 470; + height= 210; + + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "BKSP" { { [ 37,18] }, { [2,1], [ 35,17] } }; + shape "TABK" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "BKSL" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "RTRN" { { [ 42,18] }, { [2,1], [ 40,17] } }; + shape "CAPS" { { [ 32,18] }, { [2,1], [ 30,17] } }; + shape "LFSH" { { [ 42,18] }, { [2,1], [ 40,17] } }; + shape "RTSH" { { [ 52,18] }, { [2,1], [ 50,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "SPCE" { { [132,18] }, { [2,1], [130,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [ 35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [ 16,36] } }; + + section.left= 19; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 52; + row { + top= 1; + keys { { , color="grey20" }, + { , 18 }, , , , + { , 11 }, , , , + { , 11 }, , , , + { , 8 }, , + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 91; + row { + top= 1; + keys { , , , , , + , , , , , + , , , + { , "BKSP", color="grey20" } + }; + }; + row { + top= 20; + keys { { , "TABK", color="grey20" }, + , , , , , + , , , , , + , , { , "BKSL" } + }; + }; + row { + top= 39; + keys { { , "CAPS", color="grey20" }, + , , , , , + , , , , , + , { , "RTRN", color="grey20" } + }; + }; + row { + top= 58; + keys { { , "LFSH", color="grey20" }, + , , , , , + , , , , , + { , "RTSH", color="grey20" } + }; + }; + row { + top= 77; + key.shape= "MODK"; + key.color= "grey20"; + keys { , { , 20 }, + { , "SPCE", color="white" }, + , { , 20 } + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 91; + left= 310; + key.color= "grey20"; + row { + top= 1; + keys { , , }; + }; + row { + top= 20; + keys { , , }; + }; + row { + top= 58; + left= 20; + keys { }; + }; + row { + top= 77; + keys { , , }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 91; + left= 375; + row { + top= 1; + key.color= "grey20"; + keys { , , , }; + }; + row { + top= 20; + keys { , , , { , "KPAD", color="grey20" } }; + }; + row { + top= 39; + keys { , , }; + }; + row { + top= 58; + keys { , , , { , "KPAD", color="grey20" } }; + }; + row { + top= 77; + keys { { , "KP0" }, }; + }; + }; // End of "Keypad" section + + alias = ; + alias = ; + +}; // End of "default" geometry + +xkb_geometry "hil" { + + description= "HP hil"; + width= 455; + height= 170; + + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "BKSP" { { [ 32,18] }, { [2,1], [ 30,17] } }; + shape "TABK" { { [ 32,18] }, { [2,1], [ 30,17] } }; + shape "BKSL" { { [ 24,18] }, { [2,1], [ 22,17] } }; + shape "RTRN" { { [ 38,18] }, { [2,1], [ 36,17] } }; + shape "LFSH" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "RTSH" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "SPCE" { { [151,18] }, { [2,1], [150,17] } }; + shape "KP0" { { [ 38,18] }, { [2,1], [ 36,17] } }; + shape "KPTB" { { [ 18,38] }, { [2,1], [ 16,37] } }; + shape "TLDE" { { [ 24,18] }, { [2,1], [ 22,17] } }; + shape "FKT1" { { [ 17,14] }, { [2,1], [ 15,13] } }; + shape "FKT2" { { [ 23,14] }, { [2,1], [ 21,13] } }; + + section.left= 19; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 14; + row { + top= 1; + keys { { , "FKT1" }, { , "FKT1" } , + { , "FKT2", 10 }, { , "FKT2" }, + { , "FKT2" }, { , "FKT2" }, + { , "FKT1" }, { , "FKT1" }, + { , "FKT2" }, { , "FKT2" }, + { , "FKT2" }, { , "FKT2" }, + { , "FKT1", 10 }, { , "FKT1" }, + { , "FKT1", 19 }, { , "FKT1" }, + { , "FKT1" }, { , "FKT1" } + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 52; + row { + top= 1; + keys { { , "TLDE" }, , , , , + , , , , , + , , , + { , "BKSP" }, , + }; + }; + row { + top= 20; + keys { { , "TABK" }, + , , , , , + , , , , , + , , { , "BKSL" }, + , + }; + }; + row { + top= 39; + keys { , , + , , , , , + , , , , , + , { , "RTRN" }, + , + }; + }; + row { + top= 58; + keys { , { , "LFSH" }, + , , , , , + , , , , , + { , "RTSH" }, , + , + }; + }; + row { + top= 77; + keys { , { , 30 }, + { , "SPCE" }, + , { , 30 }, , + }; + }; + }; // End of "Alpha" section + + section "Keypad" { + top= 52; + left= 360; + row { + top= 1; + keys { , , , }; + }; + row { + top= 20; + keys { , , , }; + }; + row { + top= 39; + keys { , , , }; + }; + row { + top= 58; + keys { , , , { , "KPTB" } }; + }; + row { + top= 77; + keys { { , "KP0" }, }; + }; + }; // End of "Keypad" section + +}; // End of "default" geometry + + +// Created by Alexander Pohoyda +// Geometry specification for HP Omnibook keyboards. +// Compatible Models: 6100, 6000. + +xkb_geometry "omnibook" { + width = 282; + height = 128; + baseColor = "grey80"; + labelColor = "white"; + + shape "FN0" { cornerRadius = 1, { [15.5, 12] }, { [1, 0], [14.5, 11] } }; + shape "NORM" { cornerRadius = 1, { [18, 16] }, { [2, 0], [16, 14] } }; + shape "BKSP" { cornerRadius = 1, { [31, 16] }, { [2, 0], [29, 14] } }; + shape "TABK" { cornerRadius = 1, { [27, 16] }, { [2, 0], [25, 14] } }; + shape "CAPS" { cornerRadius = 1, { [32, 16] }, { [2, 0], [30, 14] } }; + shape "RTSH" { cornerRadius = 1, { [45, 16] }, { [2, 0], [43, 14] } }; + shape "MODK" { cornerRadius = 1, { [28, 16] }, { [2, 0], [26, 14] } }; + shape "SPCE" { cornerRadius = 1, { [90, 16] }, { [2, 0], [88, 14] } }; + shape "ARRS" { cornerRadius = 1, { [17, 12] }, { [2, 0], [15, 11] } }; + + shape "LED" { cornerRadius = 1, { [2, 4] } }; + + shape "KEYS" { cornerRadius = 1, + { [0, 13], + [197, 13], [197, 0], + [280, 0], [280, 125], + [224, 125], [224, 112], + [0, 112] } + }; + + solid "KeyPanel" { + shape = "KEYS"; + left = 1; + top = 1; + color = "black"; + }; + + shape "NULL1" { cornerRadius = 1, { [54, 16] } }; + + solid "NullPanel1" { + shape = "NULL1"; + left = 226; + top = 96; + color = "grey80"; + }; + + shape "NULL2" { cornerRadius = 1, { [19, 14] } }; + + solid "NullPanel2" { + shape = "NULL2"; + left = 243; + top = 97; + color = "black"; + }; + + indicator.onColor = "green"; + indicator.offColor = "grey10"; + indicator.top = 4; + indicator.shape = "LED"; + indicator "Caps Lock" { left = 45; }; + indicator "Num Lock" { left = 60; }; + indicator "Scroll Lock" { left = 75; }; + indicator "HDDActivity" { onColor = "red"; left = 90; }; + + key.color = "grey60"; + + section "Function" { + key.gap = 0.99; + left = 1; + top = 1; + key.shape = "FN0"; + row { + left = 197; + top = 1; + keys { , , , , }; + }; + row { + top = 14; + keys { , + , , , , + , , , , + , , , , + , , , + }; + }; + }; // End of "Function" section + + section "Control" { + left = 1; + top = 34; + key.gap = 1; + row { + top = 62; + key.shape = "NORM"; + keys { , , , , + { , "SPCE" }, , , + }; + }; + }; // End of "Control" section + + section "Navigation" { + key.shape = "ARRS"; + left = 225; + top = 97; + key.gap = 1.4; + row { + left= 18; + top = 1; + keys { }; + }; + row { + top = 16; + keys { , , }; + }; + }; // End of "Navigation" section + + shape "STIK" { cornerRadius = 4, { [7, 7] } }; + + solid "STIK" { + priority = 255; + color = "red"; + shape = "STIK"; + top = 73; + left = 126; + }; +}; + +// 86 keys +xkb_geometry "omnibook_intl" { + include "hp(omnibook)" + description = "HP Omnibook 6000/6100, Intl"; + + shape "RTRN" { cornerRadius = 1, + { [22, 0], [22, 33], [5, 33], [5, 16], [0, 16], [0, 0] }, + { [20, 0], [20, 31], [7, 31], [7, 14], [2, 14], [2, 0] } }; + shape "LFSH" { cornerRadius = 1, { [23, 16] }, { [2, 0], [21, 14] } }; + + section "Alpha" { + key.gap = 1; + key.color = "grey60"; + key.shape = "NORM"; + left = 1; + top = 27; + row { + top = 1; + keys { , , , , , + , , , , , + , , , { , "BKSP" } + }; + }; + row { + top = 18; + keys { { , "TABK" }, + , , , , , + , , , , , + , , { , "RTRN" } + }; + }; + row { + top = 35; + keys { { , "CAPS" }, + , , , , , + , , , , , + , + }; + }; + row { + top = 52; + keys { { , "LFSH" }, , + , , , , , + , , , , , + { , "RTSH" } + }; + }; + }; // End of "Alpha" section +}; diff -ruN /opt/SUNWut.orig/lib/xkb/geometry/ibm/thinkpad /opt/SUNWut/lib/xkb/geometry/ibm/thinkpad --- /opt/SUNWut.orig/lib/xkb/geometry/ibm/thinkpad 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/geometry/ibm/thinkpad 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,267 @@ +// -*- indent-tabs-mode: nil -*- +// $XFree86: xc/programs/xkbcomp/geometry/ibm/thinkpad,v 1.3 2003/08/09 14:30:48 pascal Exp $ + +// Created by Alexander Pohoyda +// Geometry specification for IBM ThinkPad keyboard. +// Compatible Models: THINKPAD 560Z 2640-90U, THINKPAD 560Z 2640-91U, +// THINKPAD 560Z 2640-B0U, THINKPAD 560Z 2640-B1U, THINKPAD 560Z 2640-RR3, +// THINKPAD 600 2645-31U, THINKPAD 600 2645-35U, THINKPAD 600 2645-41U, +// THINKPAD 600 2645-42U, THINKPAD 600 2645-45U, THINKPAD 600 2645-48U, +// THINKPAD 600 2645-51U, THINKPAD 600 2645-85U, THINKPAD 600 2645-A1U, +// THINKPAD 600 2645-RR1, THINKPAD 600 2645-RR2, THINKPAD 600E 2645-3AU, +// THINKPAD 600E 2645-4AU, THINKPAD 600E 2645-4BU, THINKPAD 600E 2645-55U, +// THINKPAD 600E 2645-5AU, THINKPAD 600E 2645-5BU, THINKPAD 600E 2645-5JU, +// THINKPAD 600E 2645-8AO, THINKPAD 600E 2645-8AU, THINKPAD 600E 2645-8BU, +// THINKPAD 600E 2645-AAU, THINKPAD 600E 2645-RRB, THINKPAD 600E 2645-RRD, +// THINKPAD 600E 2645-RRF, THINKPAD 600E 2645-RRS, THINKPAD A22E 2645-45U + +xkb_geometry "common" { + width = 290; + height = 150; + baseColor = "grey80"; + labelColor = "white"; + + shape "FN0" { cornerRadius = 1, { [17, 12] }, { [2, 0], [15, 10] } }; + shape "NORM" { cornerRadius = 1, { [18, 18] }, { [2.5, 0], [15.5, 14] } }; + shape "BKSP" { cornerRadius = 1, { [37, 18] }, { [2.5, 0], [34.5, 14] } }; + shape "TABK" { cornerRadius = 1, { [27, 18] }, { [2.5, 0], [24.5, 14] } }; + shape "CAPS" { cornerRadius = 1, { [31, 18] }, { [1, 0], [30, 16] }, + { [1, 0], [26, 16] }, + { [2.5, 0], [24.5, 14] } }; + shape "RTSH" { cornerRadius = 1, { [50, 18] }, { [2.5, 0], [46.5, 14] } }; + shape "MODK" { cornerRadius = 1, { [27.5, 18] }, { [2.5, 0], [25, 14] } }; + shape "SPCE" { cornerRadius = 1, { [100, 18] }, { [2.5, 0], [97.5, 14] } }; + shape "ARRS" { cornerRadius = 1, { [16, 13] }, { [1.5, 0], [14.5, 11] } }; + + shape "LED" { cornerRadius = 2, { [3, 3] } }; + + shape "KEYS" { cornerRadius = 2, + { [0, 0], [19, 0], [19, 13], [172, 13], + [172, 0], [286, 0], [286, 138], [216, 138], + [216, 124], [0, 124] } }; + + solid "KeyPanel" { + shape = "KEYS"; + left = 2; + top = 5; + color = "black"; + }; + + shape "NULL1" { cornerRadius = 1, + { [0, 0], [50, 0], [50, 18], [34, 18], [34, 4], + [16, 4], [16, 18], [0, 18] } }; + + solid "NullPanel1" { + shape = "NULL1"; + left = 237; + top = 110; + color = "grey80"; + }; + + shape "NULL2" { cornerRadius = 1, { [17, 13] } }; + + solid "NullPanel2" { + shape = "NULL2"; + left = 219; + top = 129; + color = "grey80"; + }; + + shape "NULL3" { cornerRadius = 1, + { [0, 26], + [72, 26], [72, 13], [76, 13], [76, 26], + [149, 26], [149, 13], [153, 13], [153, 26], + [226, 26], [226, 0], [230, 0], [230, 26], + [284, 26], [285, 27], + [0, 27] } }; + + solid "NullPanel3" { + shape = "NULL3"; + left = 3; + top = 6; + color = "grey80"; + }; + + indicator.onColor = "green"; + indicator.offColor = "grey10"; + indicator.top = 4; + indicator.shape = "LED"; + indicator "HDDActivity" { onColor = "red"; left = 100; }; + indicator "Num Lock" { left = 108; }; + indicator "Caps Lock" { left = 114; }; + indicator "Scroll Lock" { left = 120; }; + indicator "Power" { left = 128; }; + + key.gap = 1; + key.color = "grey60"; + + section "Function" { + left = 2; + top = 5; + key.shape = "FN0"; + row { + top = 1; + keys { , { , 155 }, , }; + }; + row { + top = 14; + keys { , , , , + { , 6 }, , , , + { , 6 }, , , + }; + }; + }; // End of "Function" section + + section "Control" { + left= 2; + top = 109; + key.shape = "MODK"; + row { + top = 1; + keys { { , "NORM" }, , , + { , "SPCE" }, , + }; + }; + }; // End of "Control" section + + section "Editing" { + top = 5; + left = 233; + key.shape = "FN0"; + row { + top = 1; + keys { , , }; + }; + row { + top = 14; + keys { , , }; + }; + }; // End of "Editing" section + + section "Navigation" { + top = 114; + left = 236; + key.shape = "ARRS"; + row { + top = 1; + left = 17; + keys { }; + }; + row { + top = 15; + keys { , , }; + }; + }; // End of "Navigation" section + + shape "STIK" { cornerRadius = 4, { [7, 7] } }; + + solid "STIK" { + priority = 255; + color = "red"; + shape = "STIK"; + top = 85; + left = 126; + }; +}; + +// 85 keys +// US/English (FRU 02K4785). +xkb_geometry "us" { + include "thinkpad(common)" + description = "IBM ThinkPad 560Z/600/600E/A22E, US"; + + shape "RTRN" { cornerRadius = 1, { [43, 18] }, { [2.5, 0], [40.5, 14] } }; + shape "LFSH" { cornerRadius = 1, { [43, 18] }, { [2.5, 0], [40.5, 14] } }; + shape "BKSL" { cornerRadius = 1, { [28, 18] }, { [2.5, 0], [25.5, 14] } }; + + section "Alpha" { + left = 2; + top = 33; + key.gap = 1; + key.color = "grey60"; + key.shape = "NORM"; + row { + top = 1; + keys { , , , , , + , , , , , + , , , { , "BKSP" } + }; + }; + row { + top = 20; + keys { { , "TABK" }, + , , , , , + , , , , , + , , { , "BKSL" } + }; + }; + row { + top = 39; + keys { { , "CAPS" }, + , , , , , + , , , , , + , { , "RTRN" } + }; + }; + row { + top = 58; + keys { { , "LFSH" }, + , , , , , + , , , , , + { , "RTSH" } + }; + }; + }; // End of "Alpha" section +}; + +// 86 keys +// Tested on: DE/German, UK/English (FRU 02K4787). +xkb_geometry "intl" { + include "thinkpad(common)" + description = "IBM ThinkPad 560Z/600/600E/A22E, Intl"; + + shape "RTRN" { cornerRadius = 1, { [28, 0], [28, 37], [4, 37], [4, 18], + [0, 18], [0, 0] }, + { [25.5, 0], [25.5, 33], [6.5, 33], + [6.5, 14], [2.5, 14], [2.5, 0] } }; + shape "LFSH" { cornerRadius = 1, { [24, 18] }, { [2.5, 0], [21.5, 14] } }; + + section "Alpha" { + left = 2; + top = 33; + key.gap = 1; + key.color = "grey60"; + key.shape = "NORM"; + row { + top = 1; + keys { , , , , , + , , , , , + , , , { , "BKSP" } + }; + }; + row { + top = 20; + keys { { , "TABK" }, + , , , , , + , , , , , + , , { , "RTRN" } + }; + }; + row { + top = 39; + keys { { , "CAPS" }, + , , , , , + , , , , , + , + }; + }; + row { + top = 58; + keys { { , "LFSH" }, , + , , , , , + , , , , , + { , "RTSH" } + }; + }; + }; // End of "Alpha" section +}; diff -ruN /opt/SUNWut.orig/lib/xkb/geometry/keytronic /opt/SUNWut/lib/xkb/geometry/keytronic --- /opt/SUNWut.orig/lib/xkb/geometry/keytronic 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/geometry/keytronic 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,255 @@ +// $Xorg: keytronic,v 1.4 2001/02/09 02:05:50 xorgcvs Exp $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +// $XFree86$ +// +default xkb_geometry "FlexPro" { + + // This is an approximate layout for a Key Tronic FlexPro + // keyboard. I just took a similar layout (101 key PC keyboard) + // and adjusted the sizes of a few keys by eye. I didn't actually + // *measure* a real keyboard. + + description= "Key Tronic FlexPro keyboard"; + + width= 515; + height= 200; + + shape "EDGE" { cornerRadius= 2, { [ 515, 200 ] } }; + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [16,17] } }; + shape "BKSP" { { [ 32,18] }, { [2,1], [30,17] } }; + shape "TABK" { { [ 32,18] }, { [2,1], [30,17] } }; + shape "BKSL" { { [ 23,18] }, { [2,1], [21,17] } }; + shape "RTRN" { + approx = { [16, 0], [38,37] }, + { [16, 0], [38, 0], [38,37], + [ 0,37], [ 0,19], [16,19] }, + { [18, 1], [36, 1], [36,36], + [ 2,36], [ 2,20], [18,20] } }; + shape "CAPS" { { [36,18] }, { [2,1], [34,17] } }; + shape "SHFT" { { [46,18] }, { [2,1], [44,17] } }; + shape "LCTL" { { [32,18] }, { [2,1], [30,17] } }; + shape "RCTL" { { [38,18] }, { [2,1], [36,17] } }; + shape "LALT" { { [28,18] }, { [2,1], [26,17] } }; + shape "RALT" { { [33,18] }, { [2,1], [31,17] } }; + shape "LSPC" { { [66,22] }, { [0,0], [66,22] } }; + shape "RSPC" { { [76,22] }, { [0,0], [76,22] } }; + shape "KP0" { { [37,18] }, { [2,1], [35,17] } }; + shape "KPEN" { { [18,37] }, { [2,1], [16,36] } }; + shape "LOGO" { cornerRadius= 3, { [80,35] } }; + + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + section.left= 9; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + + section "Function" { + top= 56; + row { + top = 1; + key.color= "grey20"; + keys { , }; + }; + row { + top = 20; + key.color= "grey20"; + keys { , }; + }; + row { + top = 39; + keys { , }; + }; + row { + top = 58; + key.color= "grey20"; + keys { , }; + }; + row { + top = 77; + key.color= "grey20"; + keys { , }; + }; + row { + top = 96; + keys { , }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 56; + left= 53; + row { + top= 1; + keys { + { , color="grey20" }, { , "BKSL", color="grey20" }, + , , , , + , , , , , + , , , + { , "BKSP", color="grey20" } + }; + }; + row { + top= 20; + keys { + { , color="grey20" }, { , "TABK", color="grey20" }, + , , , , , + , , , , , + , , + { , "RTRN", -14, color="grey20" } + }; + }; + row { + top= 39; + keys { + { , color="grey20" }, { , "CAPS", color="grey20" }, + , , , , , + , , , , , + }; + }; + row { + top= 58; + keys { + { , color="grey20" }, + { , "SHFT", color="grey20" }, + , , , , , + , , , , , + { , "SHFT", color="grey20" } + }; + }; + row { + top= 77; + key.color= "grey20"; + keys { + , + { , shape="LCTL" }, + { , shape="LALT" }, + { , shape="LSPC", 4, color="white" }, + { , shape="RSPC",color="white" }, + { , shape="RALT", 4 }, + { , shape="RCTL" } + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 12; + left= 365; + key.color= "grey20"; + row { + top= 1; + keys { , , }; + }; + row { + top= 45; + keys { , , }; + }; + row { + top= 64; + keys { , , }; + }; + row { + top= 102; + left= 20; + keys { }; + }; + row { + top= 121; + keys { , , }; + }; + }; // End of "Editing" section + + shape "LEDS" { cornerRadius= 3, { [ 76, 20 ] } }; + shape "LED" { cornerRadius= 0, { [ 7, 4 ] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 11; + left= 430; + color= "grey10"; + }; + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 13; + indicator.shape= "LED"; + indicator "Num Lock" { left= 440; }; + indicator "Caps Lock" { left= 467; }; + indicator "Scroll Lock" { left= 489; }; + text.top= 22; + text.color= "black"; + text "NumLockLabel" { left= 438; text="Num\nLock"; }; + text "CapsLockLabel" { left= 465; text="Caps\nLock"; }; + text "ScrollLockLabel" { left= 487; text="Scroll\nLock"; }; + + logo "FlexProLogoImage" { + top= 12; + left= 45; + name= "KeyTronic"; + shape= "LOGO"; + }; + text "KeyTronicLogoText" { + top= 15; + left= 50; + width= 55; + text= "FlexPro"; + font= "times"; + slant= "o"; + weight= "bold"; + fontWidth= "narrow"; + fontSize= 36; + }; + + section "Keypad" { + top= 56; + left= 430; + row { + top= 1; + key.color= "grey20"; + keys { , , , }; + }; + row { + top= 20; + keys { , , , { , color= "grey20" } }; + }; + row { + top= 39; + keys { , , , { , color= "grey20" } }; + }; + row { + top= 58; + keys { , , , { , "KPEN", color= "grey20" } }; + }; + row { + top= 77; + keys { { , "KP0" }, }; + }; + }; // End of "Keypad" section +}; diff -ruN /opt/SUNWut.orig/lib/xkb/geometry/kinesis /opt/SUNWut/lib/xkb/geometry/kinesis --- /opt/SUNWut.orig/lib/xkb/geometry/kinesis 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/geometry/kinesis 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,193 @@ +// $Xorg: kinesis,v 1.3 2000/08/17 19:54:35 cpqbld Exp $ +// +// $XFree86$ +// +default xkb_geometry "model100" { + + // This is an approximate layout for a Kinesis Ergonomic keyboard + // Generated completely by eye. I didn't actually *measure* a real + // keyboard. + + description= "Kinesis Ergonomic Keyboard"; + width= 421; + height= 185; + + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [16,17] } }; + shape "WIDE" { { [ 21,18] }, { [2,1], [19,17] } }; + shape "TALL" { { [ 18,37] }, { [2,1], [16,36] } }; + shape "FKEY" { cornerRadius=0, { [ 10,13] } }; + shape "LED" { cornerRadius= 1.5, { [ 3, 3] } }; + shape "LOGO" { { [ 40, 10 ] } }; + shape "EDGE" { cornerRadius=5, { [ 421, 185 ] } }; + + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + section "LeftFunction" { + left= 15; + top= 11; + key.shape= "FKEY"; + key.gap= 3; + row { + left= 1; + top= 1; + keys { + , , , , , + , , , + }; + }; + }; // End of "LeftFunction" section + + section "RightFunction" { + left= 290; + top= 11; + key.shape= "FKEY"; + key.gap= 3; + row { + left= 1; + top= 0.2; + keys { + , , , , , + , , , + }; + }; + }; // End of "RightFunction" section + + row.vertical= True; + row.top= 1; + key.gap= 0.5; + + logo "KinesisLogoImage" { + top= 25; + left= 240; + name= "Kinesis"; + shape= "LOGO"; + }; + + indicator.shape= "LED"; + indicator.top= 30; + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator "Caps Lock" { left= 23; }; + + section "LeftAlpha" { + top= 34; + left= 15; + row { + left= 2; + key.shape= "WIDE"; + keys { , , , }; + }; + row { + top= 4; + left= 24; + keys { , , { , color="grey20" }, , }; + }; + row { + left= 43; + keys { , , { , color="grey20" }, , }; + }; + row { + left= 62; + keys { , , { , color="grey20" }, , }; + }; + row { + left= 81; + keys { , , { , color="grey20" }, , }; + }; + row { + left= 100; + keys { , , , }; + }; + }; // End of "LeftAlpha" section + + indicator "NumLock" { left= 318; }; + indicator "Overlay" { left= 387; }; + section "RightAlpha" { + top= 34; + left= 290; + row { + left= 2; + keys { , , , }; + }; + row { + left= 21; + keys { , , { , color="grey20" }, , }; + }; + row { + left= 40; + keys { , , { , color="grey20" }, , }; + }; + row { + left= 59; + keys { , , { , color="grey20" }, , }; + }; + row { + top= 4; + left= 78; + keys { , , { , color="grey20" }, , }; + }; + row { + left= 97; + key.shape= "WIDE"; + keys { , , , }; + }; + overlay "KPAD" { + =, =, =, =, + =, =, =, =, + =, =, =, =, + =, =, =, =, + =, = + }; + }; // End of "RightAlpha" section + + section "LeftEdit" { + top= 109; + left= 123; + angle= 20; + row.top= -18; + row { + top= 1; + left= 1; + keys { { , "TALL" } }; + }; + row { + left= 20; + keys { , { , "TALL" } }; + }; + row { + left= 39; + keys { , , }; + }; + }; // End of "RightEdit" section + + section "RightEdit" { + top= 109; + left= 302; + angle= -20; + row.top= -18; + row { + left= -57; + keys { , , }; + }; + row { + left= -38; + keys { , { , "TALL" } }; + }; + row { + top= 1; + left= -19; + keys { { , "TALL" } }; + }; + overlay "KPAD" { + = + }; + }; // End of "Keypad" section + + alias = ; + alias = ; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/geometry/macintosh /opt/SUNWut/lib/xkb/geometry/macintosh --- /opt/SUNWut.orig/lib/xkb/geometry/macintosh 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/geometry/macintosh 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,174 @@ +// $XFree86: xc/programs/xkbcomp/geometry/macintosh,v 1.3 2003/08/09 14:30:47 pascal Exp $ +// +// Some modifications () : +// - Added a key +// - Fixed the shape of the key +// - Moved to the 'AC' row +// - Added a special Macintosh sysctl key +// - Minor changes (Function keys shape, LED position...) + +default xkb_geometry "macintosh" { + + description= "Apple Extended Keyboard II"; + width = 475; + height = 194; + + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "TLDE" { { [ 23,18] }, { [2,1], [ 21,17] } }; + shape "BKSP" { { [ 33,18] }, { [2,1], [ 31,17] } }; + shape "TAB" { { [ 33,18] }, { [2,1], [ 31,17] } }; + shape "RTRN" { + { [0,0],[23,0],[23,37],[4,37],[4,18],[0,18] }, + { [2,1],[21,1],[21,36],[6,36],[6,17],[2,17] } }; + shape "CAPS" { { [ 37,18] }, { [2,1], [ 35,17] } }; + shape "LCTL" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "LALT" { { [ 22,18] }, { [2,1], [ 20,17] } }; + shape "LMTA" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "LFSH" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "RCTL" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "RALT" { { [ 22,18] }, { [2,1], [ 20,17] } }; + shape "RMTA" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "RTSH" { { [ 47,18] }, { [2,1], [ 45,17] } }; + shape "SPCE" { { [123,18] }, { [2,1], [121,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [ 35,17] } }; + shape "KPEN" { { [ 18,37] }, { [2,1], [ 16,36] } }; + // Macintosh keyboards have a special sysctl key at the top right + shape "AAPL" { + { [ 0,0], [ 18,0], [ 18,18], [ 0,18] }, + { [ 1,1], [ 17,1], [ 17,17], [ 1,17] }, + { [ 8,5], [ 8,12], [ 2,9] } }; + + shape "LEDS" { cornerRadius = 0, { [ 55,19] } }; + shape "LED" { cornerRadius = 0, { [ 8, 2] } }; + + solid "LedPanel" { + shape= "LEDS"; + top = 48; + left = 378; + }; + + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top = 50; + indicator.shape= "LED"; + indicator "NumLock" { left = 381; }; + indicator "CapsLock" { left = 398; }; + indicator "ScrollLock" { left = 415; }; + text.top= 55; + text.color= "black"; + text "NumLockLabel" { left = 381; text = "Num\nLock"; }; + text "CapsLockLabel" { left = 398; text = "Caps\nLock"; }; + text "ScrollLockLabel" { left = 415; text = "Scroll\nLock"; }; + + section.left= 19; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + + section "Function" { + top = 48; + row { + top= 1; + keys { , + { , 20 }, , , , + { , 11 }, , , , + { , 11 }, , , , + { , 10 }, , , + // This is the sysctl key on macintosh keyboards + // keycode is 222 with a 4.21 kernel, which is + { , "AAPL", 67 } + }; + }; + }; // End of "Function" section + + section "Alpha" { + top = 87; + row { + top= 1; + keys { { , "TLDE" }, , , , + , , , , , , + , , , { , "BKSP" } + }; + }; + row { + top= 20; + keys { { , "TAB" }, , , , + , , , , , , + , , , { , "RTRN" } + }; + }; + row { + top= 39; + keys { { , "CAPS" }, , , , + , , , , , , + , , + }; + }; + row { + top= 58; + keys { { , "LFSH" }, , , , + , , , , , , + , , { , "RTSH" } + }; + }; + row { + top= 77; + keys { { , "LCTL" }, { , "LALT" }, + { , "LMTA" }, + { , "SPCE" }, + { , "RMTA" }, + { , "RALT" }, { , "RCTL" } + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top = 87; + left = 314; + row { + top= 1; + keys { , , }; + }; + row { + top= 20; + keys { , , }; + }; + row { + top= 58; + left= 20; + keys { }; + }; + row { + top= 77; + keys { , , }; + }; + }; // End of "Editing" section + + // Begin of "Keypad" section + section "Keypad" { + top = 87; + left = 380; + row { + top= 1; + keys { , , , }; + }; + row { + top= 20; + keys { , , , }; + }; + row { + top= 39; + keys { , , , }; + }; + row { + top= 58; + keys { , , , { , "KPEN" } }; + }; + row { + top= 77; + keys { { , "KP0" }, }; + }; + }; // End of "Keypad" section + +}; // End of "default" geometry diff -ruN /opt/SUNWut.orig/lib/xkb/geometry/microsoft /opt/SUNWut/lib/xkb/geometry/microsoft --- /opt/SUNWut.orig/lib/xkb/geometry/microsoft 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/geometry/microsoft 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,256 @@ +// $Xorg: microsoft,v 1.3 2000/08/17 19:54:35 cpqbld Exp $ +// +// $XFree86$ +// +default xkb_geometry "natural" { + + // Approximate layout for a Microsoft Natural Keyboard + description= "Microsoft Natural Keyboard"; + width= 550; + height= 190; + + shape.cornerRadius= 1; + shape "LDEF" { { [ 18,18] }, { [2,1], [15,15] } }; + shape "TABK" { { [ 26,18] }, { [2,1], [23,15] } }; + shape "CAPS" { { [ 30,18] }, { [2,1], [23,15] } }; + shape "LFSH" { { [ 41,18] }, { [2,1], [38,15] } }; + shape "KEY6" { { [ 22,18] }, { [2,1], [15,15] } }; + shape "KEYT" { { [ 33,18] }, { [2,1], [15,15] } }; + shape "KEYG" { { [ 29,18] }, { [2,1], [15,15] } }; + shape "LCTL" { + approx= { [ 32, 22 ] }, + { [ 0, 0], [ 32, 0 ], [ 32, 23 ], [ 0, 22 ] }, + { [ 2, 1], [ 29, 1 ], [ 29, 17 ], [ 2, 15 ] } + }; + shape "LWIN" { + approx= { [ 32, 23 ] }, + { [ 0, 0], [ 32, 0 ], [ 32, 24 ], [ 0, 23 ] }, + { [ 2, 1], [ 29, 1 ], [ 29, 18 ], [ 2, 17 ] } + }; + shape "LALT" { + approx= { [ 32, 24 ] }, + { [ 0, 0], [ 32, 0 ], [ 32, 25 ], [ 0, 24 ] }, + { [ 2, 1], [ 29, 1 ], [ 29, 20 ], [ 2, 19 ] } + }; + shape "RDEF" { { [ 18,18] }, { [3,1], [15,15] } }; + shape "KEY7" { { [ 28, 18 ] }, { [ 14, 1], [26, 15] } }; + shape "KEYH" { { [ 24, 18 ] }, { [ 10, 1], [22, 15] } }; + shape "KEYN" { { [ 32, 18 ] }, { [ 18, 1], [30, 15] } }; + shape "BKSP" { { [ 41, 18 ] }, { [ 3, 1], [39, 15] } }; + shape "BKSL" { { [ 24, 18 ] }, { [ 3, 1], [22, 15] } }; + shape "RTRN" { { [ 37, 18 ] }, { [ 3, 1], [35, 15] } }; + shape "RTSH" { { [ 43, 18 ] }, { [ 3, 1], [41, 15] } }; + shape "RALT" { + approx= { [ 27, 24 ] }, + { [ 0, 0], [ 27, 0 ], [ 27, 24 ], [ 0, 25 ] }, + { [ 3, 1], [ 25, 1 ], [ 25, 19 ], [ 3, 20 ] } + }; + shape "RWIN" { + approx= { [ 27, 23 ] }, + { [ 0, 0], [ 27, 0 ], [ 27, 23 ], [ 0, 24 ] }, + { [ 3, 1], [ 25, 1 ], [ 25, 18 ], [ 3, 19 ] } + }; + shape "MENU" { + approx= { [ 27, 21 ] }, + { [ 0, 0], [ 27, 0 ], [ 27, 21 ], [ 0, 23 ] }, + { [ 3, 1], [ 25, 1 ], [ 25, 16 ], [ 3, 17 ] } + }; + shape "RCTL" { + approx= { [ 27, 19 ] }, + { [ 0, 0], [ 27, 0 ], [ 27, 19 ], [ 0, 21 ] }, + { [ 3, 1], [ 25, 1 ], [ 25, 14 ], [ 3, 15 ] } + }; + shape "KPAD" { { [ 18, 37 ] }, { [ 3, 1 ], [ 16, 34 ] } }; + shape "KP0" { { [ 37, 18 ] }, { [ 3, 1 ], [ 35, 15 ] } }; + shape "SPCE" { + { [ 4, 3], [42,10], [44, 0], [88, 0], [90,10], [130, 3], + [134,26], [99,30], [67,33], [33,30], [ 0,26] }, + { [ 6, 4.5], [43,11], [45, 1], [87, 1], [89,11], [128, 4.5], + [131,23], [99,28], [67,32], [33,28], [ 3,23] } + }; + + shape "EDGE" { + cornerRadius= 2, + { [ 25, 0 ], [ 177, 17 ], [ 329, 0 ], [ 542, 0 ], + [ 542, 150 ], [ 354, 150 ], [ 177, 185 ], [ 0, 150 ] } + }; + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + row.left= 1; + key.shape= "LDEF"; + key.gap= 1; + section "LeftFunction" { + top= 10; + left= 40; + angle= 10; + row { + top= 1; + keys { , { , 12 }, , , , }; + }; + }; // End of "LeftFunction" section + + section "LeftAlpha" { + top= 47; + left= 30; + angle= 10; + row { + top= 1; + keys { , , , , , + , { , "KEY6" } + }; + }; + row { + top= 20; + keys { { , "TABK" }, + , , , , { , "KEYT" } + }; + }; + row { + top= 39; + keys { { , "CAPS" }, + , , , , { , "KEYG" } + }; + }; + row { + top= 58; + keys { { , "LFSH" }, + , , , , + }; + }; + row { + top= 77; + keys { { , "LCTL" }, { , "LWIN" }, { , "LALT" } }; + }; + }; // End of "LeftAlpha" section + + key.shape= "RDEF"; + section "RightFunction" { + top= 32; + left= 195; + angle= -10; + row { + top= 1; + left= 1; + keys { , , , , , , }; + }; + }; // End of "RightFunction" section + + section "RightAlpha" { + top= 71; + left= 190; + angle= -10; + row.left= 1; + row { + top= 1; + keys { { , "KEY7" }, + , , , , , + { , "BKSP" } + }; + }; + row { + top= 20; + keys { + , , , , , , , + { , "BKSL" } + }; + }; + row { + top= 39; + keys { { , "KEYH" }, + , , , , , + { , "RTRN" } + }; + }; + row { + top= 58; + keys { { , "KEYN" }, + , , , , + { , "RTSH" } + }; + }; + row { + top= 77; + left= 40; + keys { { , "RALT" }, { , "RWIN" }, + { , "MENU" }, { , "RCTL" } + }; + }; + }; // End of "RightAlpha" section + + section "SpaceBar" { + top= 139; + left= 111; + key.shape= "SPCE"; + row { keys { }; }; + }; + + section "Editing" { + top= 15; + left= 385; + row { + top= 1; + keys { , , }; + }; + row { + top= 33; + keys { , , }; + }; + row { + top= 53; + keys { , , }; + }; + row { + top= 91; + left= 20; + keys { }; + }; + row { + top= 109; + keys { , , }; + }; + }; // End of "Editing" section + + shape "LED" { + cornerRadius= 0, + { [ 3, 1 ] } + }; + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.left= 177; + indicator.shape= "LED"; + indicator "Num Lock" { top= 90; }; + indicator "Caps Lock" { top= 107; }; + indicator "Scroll Lock" { top= 127; }; + + section "Keypad" { + top= 47; + left= 456; + row { + top= 1; + keys { , , , }; + }; + row { + top= 20; + keys { , , , { , "KPAD" } }; + }; + row { + top= 39; + keys { , , }; + }; + row { + top= 58; + keys { , , , { , "KPAD" } }; + }; + row { + top= 77; + keys { { , "KP0" }, }; + }; + }; // End of "Keypad" section + + alias = ; + alias = ; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/geometry/nec /opt/SUNWut/lib/xkb/geometry/nec --- /opt/SUNWut.orig/lib/xkb/geometry/nec 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/geometry/nec 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,159 @@ +// $Xorg: nec,v 1.4 2001/02/09 02:05:50 xorgcvs Exp $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +// $XFree86: xc/programs/xkbcomp/geometry/nec,v 3.4 2001/01/17 23:45:49 dawes Exp $ + +default xkb_geometry "pc98" { + + description= "Generic PC98"; + width= 405; + height= 172; + + shape.cornerRadius= 1; + shape "NORM" { { [ 17,18] }, { [2,1], [ 15,17] } }; + shape "RTRN" { { [ 20,37] }, { [2,1], [ 18,35] } }; + shape "LFSH" { { [ 42,18] }, { [2,1], [ 40,17] } }; + shape "RTSH" { { [ 31,18] }, { [2,1], [ 29,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "SPCE" { { [115,18] }, { [2,1], [113,17] } }; + shape "FUNC" { { [ 21,18] }, { [2,1], [ 19,17] } }; + shape "BKSP" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [ 16,36] } }; + shape "TABK" { { [ 30,18] }, { [2,1], [ 28,17] } }; + shape "ARRW" { { [ 35,18] }, { [2,1], [ 33,17] } }; + + section.left= 8; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 29; + row { + top= 1; + key.shape="FUNC"; + keys { { , "NORM" }, { , "NORM", 5 }, + { , 6 }, , , , , + { , 6 }, , , , , + { , 6 }, , , , + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 54; + row { + top= 1; + keys { { , shape="BKSP"}, + , , , , + , , , , , + , , , , + { , "BKSP" } + }; + }; + row { + top= 20; + keys { { , "TABK" }, + , , , , , + , , , , , + , , { , "RTRN", 6 } + }; + }; + row { + top= 39; + keys { , , + , , , , , + , , , , , + , + }; + }; + row { + top= 58; + keys { { , "LFSH" }, + , , , , , + , , , , , , + { , "RTSH" } + }; + }; + row { + top= 77; + keys { { , 35 } , , { , "FUNC" }, + { , "SPCE" }, { , "FUNC" } + + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 54; + left= 281; + row { + top= 1; + keys { , }; + }; + row { + top= 20; + keys { , }; + }; + row { + top= 39; + keys { { , "ARRW" } }; + }; + row { + top= 58; + keys { , }; + }; + row { + top= 77; + keys { { , "ARRW" } }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 54; + left= 320; + row { + top= 1; + keys { , , , }; + }; + row { + top= 20; + keys { , , , }; + }; + row { + top= 39; + keys { , , , }; + }; + row { + top= 58; + keys { , , , }; + }; + row { + top= 77; + keys { , , , }; + }; + }; // End of "Keypad" section + +}; // End of "pc98" geometry diff -ruN /opt/SUNWut.orig/lib/xkb/geometry/northgate /opt/SUNWut/lib/xkb/geometry/northgate --- /opt/SUNWut.orig/lib/xkb/geometry/northgate 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/geometry/northgate 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,172 @@ +// $Xorg: northgate,v 1.3 2000/08/17 19:54:36 cpqbld Exp $ +// +// $XFree86$ +// +default xkb_geometry "omnikey101" { + + description= "North Gate Omnikey 101"; + width= 470; + height= 175; + + shape.cornerRadius= 1; + shape "NORM" { { [18,18] }, { [2,1], [16,17] } }; + shape "BKSP" { { [34,18] }, { [2,1], [32,17] } }; + shape "TABK" { { [27,18] }, { [2,1], [25,17] } }; + shape "RTRN" { + approx = { [15, 0], [40,37] }, + { [15, 0], [40, 0], [40,37], + [ 0,37], [ 0,19], [15,19] }, + { [17, 1], [38, 1], [38,36], + [ 2,36], [ 2,20], [17,20] } + }; + shape "CAPS" { { [ 32,18] }, { [2,1], [30,17] } }; + shape "LFSH" { { [ 41,18] }, { [2,1], [39,17] } }; + shape "RTSH" { { [ 30,18] }, { [2,1], [28,17] } }; + shape "MODK" { { [ 26,18] }, { [2,1], [24,17] } }; + shape "SPCE" { { [129,18] }, { [2,1], [127,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [16,36] } }; + + shape "LEDS" { cornerRadius= 0, { [ 76 ,20 ] } }; + shape "LED" { cornerRadius= 0, { [ 1, 3 ] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 32; + left= 375; + color= "grey10"; + }; + + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 46.5; + indicator.shape= "LED"; + indicator "Num Lock" { left= 384; }; + indicator "Caps Lock" { left= 409; }; + indicator "Scroll Lock" { left= 434; }; + text.top= 34; + text.color= "black"; + text "NumLockLabel" { left= 380.5; text="Num\nLock"; }; + text "CapsLockLabel" { left= 405; text="Caps\nLock"; }; + text "ScrollLockLabel" { left= 430; text="Scroll\nLock"; }; + + section.left= 19; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 32; + row { + top= 1; + keys { { , color="grey20" }, + { , 18}, , , , + { , 9 }, , , , + { , 9 }, , , + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 65; + row { + top= 1; + keys { , , , , , + , , , , , + , , , + { , "BKSP", color="grey20" } + }; + }; + row { + top= 20; + keys { { , "TABK", color="grey20" }, + , , , , , + , , , , , + , , + { , "RTRN", -14, color="grey20" } + }; + }; + row { + top= 39; + keys { { , "CAPS", color="grey20" }, + , , , , , + , , , , , + + }; + }; + row { + top= 58; + keys { { , "LFSH", color="grey20" }, + , , , , , + , , , , , + { , "RTSH", color="grey20" }, + }; + }; + row { + top= 77; + key.shape= "MODK"; + key.color= "grey20"; + keys { , + { , 23 }, + { , "SPCE", color="white" }, + , + { , 23 } + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 32; + left= 308; + key.color= "grey20"; + row { + top= 1; + keys { , , }; + }; + row { + top= 33; + keys { , , }; + }; + row { + top= 53; + keys { , , }; + }; + row { + top= 91; + left= 20; + keys { }; + }; + row { + top= 110; + keys { , , }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 65; + left= 374; + row { + top= 1; + key.color= "grey20"; + keys { , , , }; + }; + row { + top= 20; + keys { , , , { , "KPAD", color="grey20" } }; + }; + row { + top= 39; + keys { , , }; + }; + row { + top= 58; + keys { , , , { , "KPAD", color="grey20" } }; + }; + row { + top= 77; + keys { { , "KP0" }, }; + }; + }; // End of "Keypad" section + + alias = ; + alias = ; + +}; // End of "default" geometry diff -ruN /opt/SUNWut.orig/lib/xkb/geometry/pc /opt/SUNWut/lib/xkb/geometry/pc --- /opt/SUNWut.orig/lib/xkb/geometry/pc 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/geometry/pc 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,1159 @@ +// $Xorg: pc,v 1.4 2001/02/09 02:05:50 xorgcvs Exp $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +// $XFree86: xc/programs/xkbcomp/geometry/pc,v 3.14 2003/08/09 14:30:47 pascal Exp $ + +default xkb_geometry "pc101" { + + description= "Generic 101"; + width= 470; + height= 210; + + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [ 16,16] } }; + shape "BKSP" { { [ 38,18] }, { [2,1], [ 36,16] } }; + shape "TABK" { { [ 28,18] }, { [2,1], [ 26,16] } }; + shape "BKSL" { { [ 28,18] }, { [2,1], [ 26,16] } }; + shape "RTRN" { { [ 42,18] }, { [2,1], [ 40,16] } }; + shape "CAPS" { { [ 33,18] }, { [2,1], [ 31,16] } }; + shape "LFSH" { { [ 42,18] }, { [2,1], [ 40,16] } }; + shape "RTSH" { { [ 52,18] }, { [2,1], [ 50,16] } }; + shape "MODK" { { [ 27,18] }, { [2,1], [ 25,16] } }; + shape "SPCE" { { [133,18] }, { [2,1], [131,16] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [ 35,16] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [ 16,35] } }; + + shape "LEDS" { cornerRadius= 0, { [ 75 ,20 ] } }; + shape "LED" { cornerRadius= 0, { [ 5, 1 ] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 52; + left= 377; + color= "grey10"; + }; + + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 67; + indicator.shape= "LED"; + indicator "Num Lock" { left= 382; }; + indicator "Caps Lock" { left= 407; }; + indicator "Scroll Lock" { left= 433; }; + text.top= 55; + text.color= "black"; + text "NumLockLabel" { left= 378; text="Num\nLock"; }; + text "CapsLockLabel" { left= 403; text="Caps\nLock"; }; + text "ScrollLockLabel" { left= 428; text="Scroll\nLock"; }; + + section.left= 19; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 52; + row { + top= 1; + keys { { , color="grey20" }, + { , 20 }, , , , + { , 11 }, , , , + { , 11 }, , , , + { , 8 }, , + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 91; + row { + top= 1; + keys { , , , , , + , , , , , + , , , + { , "BKSP", color="grey20" } + }; + }; + row { + top= 20; + keys { { , "TABK", color="grey20" }, + , , , , , + , , , , , + , , { , "BKSL" } + }; + }; + row { + top= 39; + keys { { , "CAPS", color="grey20" }, + , , , , , + , , , , , + , { , "RTRN", color="grey20" } + }; + }; + row { + top= 58; + keys { { , "LFSH", color="grey20" }, + , , , , , + , , , , , + { , "RTSH", color="grey20" } + }; + }; + row { + top= 77; + key.shape= "MODK"; + key.color= "grey20"; + keys { , { , 21 }, + { , "SPCE", color="white" }, + , { , 21 } + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 91; + left= 312; + key.color= "grey20"; + row { + top= 1; + keys { , , }; + }; + row { + top= 20; + keys { , , }; + }; + row { + top= 58; + left= 20; + keys { }; + }; + row { + top= 77; + keys { , , }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 91; + left= 376; + row { + top= 1; + key.color= "grey20"; + keys { , , , }; + }; + row { + top= 20; + keys { , , , { , "KPAD", color="grey20" } }; + }; + row { + top= 39; + keys { , , }; + }; + row { + top= 58; + keys { , , , { , "KPAD", color="grey20" } }; + }; + row { + top= 77; + keys { { , "KP0" }, }; + }; + }; // End of "Keypad" section + + alias = ; + alias = ; + +}; // End of "default" geometry + +xkb_geometry "pc102" { + + description= "Generic 102"; + width= 470; + height= 210; + + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [ 16,16] } }; + shape "BKSP" { { [ 38,18] }, { [2,1], [ 36,16] } }; + shape "TABK" { { [ 28,18] }, { [2,1], [ 26,16] } }; + shape "BKSL" { { [ 28,18] }, { [2,1], [ 26,16] } }; + shape "RTRN" { + { [16,0],[ 43,0],[43,37],[2,37],[2,19],[16,19] }, + { [18,1],[ 41,1],[41,36],[4,36],[4,20],[18,20] } }; + shape "CAPS" { { [ 33,18] }, { [2,1], [ 31,16] } }; + shape "LFSH" { { [ 25,18] }, { [2,1], [ 23,16] } }; + shape "RTSH" { { [ 49,18] }, { [2,1], [ 47,16] } }; + shape "MODK" { { [ 27,18] }, { [2,1], [ 25,16] } }; + shape "SPCE" { { [134,18] }, { [2,1], [132,16] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [ 35,16] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [ 16,35] } }; + + shape "LEDS" { cornerRadius= 0, { [ 75 ,20 ] } }; + shape "LED" { cornerRadius= 0, { [ 5, 1 ] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 52; + left= 377; + color= "grey10"; + }; + + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 67; + indicator.shape= "LED"; + indicator "Num Lock" { left= 382; }; + indicator "Caps Lock" { left= 407; }; + indicator "Scroll Lock" { left= 433; }; + text.top= 55; + text.color= "black"; + text "NumLockLabel" { left= 378; text="Num\nLock"; }; + text "CapsLockLabel" { left= 403; text="Caps\nLock"; }; + text "ScrollLockLabel" { left= 428; text="Scroll\nLock"; }; + + section.left= 19; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 52; + row { + top= 1; + keys { { , "TABK", color="grey20" }, + { , 10 }, , , , + { , 11 }, , , , + { , 11 }, , , , + { , 8 }, , + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 91; + row { + top= 1; + keys { , , , , , + , , , , , + , , , , + { , color="grey20" } + }; + }; + row { + top= 20; + keys { { , "TABK", color="grey20" }, + , , , , , + , , , , , + , , { , -15, "RTRN", color="grey20" } + }; + }; + row { + top= 39; + keys { { , "CAPS", color="grey20" }, + , , , , , + , , , , , + + }; + }; + row { + top= 58; + keys { { , "LFSH", color="grey20" }, + , , , , , , + , , , , , + { , "RTSH", color="grey20" } + }; + }; + row { + top= 77; + key.shape= "MODK"; + key.color= "grey20"; + keys { , { , 20 }, + { , "SPCE", color="white" }, + , { , 20 } + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 91; + left= 312; + key.color= "grey20"; + row { + top= 1; + keys { , , }; + }; + row { + top= 20; + keys { , , }; + }; + row { + top= 58; + left= 20; + keys { }; + }; + row { + top= 77; + keys { , , }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 91; + left= 376; + row { + top= 1; + key.color= "grey20"; + keys { , , , }; + }; + row { + top= 20; + keys { , , , { , "KPAD", color="grey20" } }; + }; + row { + top= 39; + keys { , , }; + }; + row { + top= 58; + keys { , , , { , "KPAD", color="grey20" } }; + }; + row { + top= 77; + keys { { , "KP0" }, }; + }; + }; // End of "Keypad" section + + alias = ; + alias = ; + +}; // End of "pc102" geometry + +xkb_geometry "pc104" { + + description= "Generic 104"; + width= 470; + height= 210; + + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [ 16,16] } }; + shape "BKSP" { { [ 38,18] }, { [2,1], [ 36,16] } }; + shape "TABK" { { [ 28,18] }, { [2,1], [ 26,16] } }; + shape "BKSL" { { [ 28,18] }, { [2,1], [ 26,16] } }; + shape "RTRN" { { [ 42,18] }, { [2,1], [ 40,16] } }; + shape "CAPS" { { [ 33,18] }, { [2,1], [ 31,16] } }; + shape "LFSH" { { [ 42,18] }, { [2,1], [ 40,16] } }; + shape "RTSH" { { [ 52,18] }, { [2,1], [ 50,16] } }; + shape "MODK" { { [ 27,18] }, { [2,1], [ 25,16] } }; + shape "SMOD" { { [ 23,18] }, { [2,1], [ 21,16] } }; + shape "SPCE" { { [113,18] }, { [2,1], [111,16] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [ 35,16] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [ 16,35] } }; + + shape "LEDS" { cornerRadius= 0, { [ 75 ,20 ] } }; + shape "LED" { cornerRadius= 0, { [ 5, 1 ] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 52; + left= 377; + color= "grey10"; + }; + + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 67; + indicator.shape= "LED"; + indicator "Num Lock" { left= 382; }; + indicator "Caps Lock" { left= 407; }; + indicator "Scroll Lock" { left= 433; }; + text.top= 55; + text.color= "black"; + text "NumLockLabel" { left= 378; text="Num\nLock"; }; + text "CapsLockLabel" { left= 403; text="Caps\nLock"; }; + text "ScrollLockLabel" { left= 428; text="Scroll\nLock"; }; + + section.left= 19; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 52; + row { + top= 1; + keys { { , color="grey20" }, + { , 20 }, , , , + { , 11 }, , , , + { , 11 }, , , , + { , 8 }, , + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 91; + row { + top= 1; + keys { , , , , , + , , , , , + , , , + { , "BKSP", color="grey20" } + }; + }; + row { + top= 20; + keys { { , "TABK", color="grey20" }, + , , , , , + , , , , , + , , { , "BKSL" } + }; + }; + row { + top= 39; + keys { { , "CAPS", color="grey20" }, + , , , , , + , , , , , + , { , "RTRN", color="grey20" } + }; + }; + row { + top= 58; + keys { { , "LFSH", color="grey20" }, + , , , , , + , , , , , + { , "RTSH", color="grey20" } + }; + }; + row { + top= 77; + key.shape= "SMOD"; + key.color= "grey20"; + keys { { , "MODK" }, , , + { , "SPCE", color="white" }, + , , , + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 91; + left= 312; + key.color= "grey20"; + row { + top= 1; + keys { , , }; + }; + row { + top= 20; + keys { , , }; + }; + row { + top= 58; + left= 20; + keys { }; + }; + row { + top= 77; + keys { , , }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 91; + left= 376; + row { + top= 1; + key.color= "grey20"; + keys { , , , }; + }; + row { + top= 20; + keys { , , , { , "KPAD", color="grey20" } }; + }; + row { + top= 39; + keys { , , }; + }; + row { + top= 58; + keys { , , , { , "KPAD", color="grey20" } }; + }; + row { + top= 77; + keys { { , "KP0" }, }; + }; + }; // End of "Keypad" section + + alias = ; + alias = ; + +}; // End of "pc104" geometry + +xkb_geometry "pc105" { + + description= "Generic 105"; + width= 470; + height= 210; + + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [ 16,16] } }; + shape "BKSP" { { [ 38,18] }, { [2,1], [ 36,16] } }; + shape "TABK" { { [ 28,18] }, { [2,1], [ 26,16] } }; + shape "BKSL" { { [ 28,18] }, { [2,1], [ 26,16] } }; + shape "RTRN" { { [ 42,18] }, { [2,1], [ 40,16] } }; + shape "CAPS" { { [ 33,18] }, { [2,1], [ 31,16] } }; + shape "LFSH" { { [ 25,18] }, { [2,1], [ 23,16] } }; + shape "RTSH" { { [ 52,18] }, { [2,1], [ 50,16] } }; + shape "MODK" { { [ 27,18] }, { [2,1], [ 25,16] } }; + shape "SMOD" { { [ 23,18] }, { [2,1], [ 21,16] } }; + shape "SPCE" { { [113,18] }, { [2,1], [111,16] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [ 35,16] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [ 16,35] } }; + + shape "LEDS" { cornerRadius= 0, { [ 75 ,20 ] } }; + shape "LED" { cornerRadius= 0, { [ 5, 1 ] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 52; + left= 377; + color= "grey10"; + }; + + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 67; + indicator.shape= "LED"; + indicator "Num Lock" { left= 382; }; + indicator "Caps Lock" { left= 407; }; + indicator "Scroll Lock" { left= 433; }; + text.top= 55; + text.color= "black"; + text "NumLockLabel" { left= 378; text="Num\nLock"; }; + text "CapsLockLabel" { left= 403; text="Caps\nLock"; }; + text "ScrollLockLabel" { left= 428; text="Scroll\nLock"; }; + + section.left= 19; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 52; + row { + top= 1; + keys { { , color="grey20" }, + { , 20 }, , , , + { , 11 }, , , , + { , 11 }, , , , + { , 8 }, , + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 91; + row { + top= 1; + keys { , , , , , + , , , , , + , , , + { , "BKSP", color="grey20" } + }; + }; + row { + top= 20; + keys { { , "TABK", color="grey20" }, + , , , , , + , , , , , + , , { , "BKSL" } + }; + }; + row { + top= 39; + keys { { , "CAPS", color="grey20" }, + , , , , , + , , , , , + , { , "RTRN", color="grey20" } + }; + }; + row { + top= 58; + keys { { , "LFSH", color="grey20" }, + , , , , , , + , , , , , + { , "RTSH", color="grey20" } + }; + }; + row { + top= 77; + key.shape= "SMOD"; + key.color= "grey20"; + keys { { , "MODK" }, , , + { , "SPCE", color="white" }, + , , , + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 91; + left= 312; + key.color= "grey20"; + row { + top= 1; + keys { , , }; + }; + row { + top= 20; + keys { , , }; + }; + row { + top= 58; + left= 20; + keys { }; + }; + row { + top= 77; + keys { , , }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 91; + left= 376; + row { + top= 1; + key.color= "grey20"; + keys { , , , }; + }; + row { + top= 20; + keys { , , , { , "KPAD", color="grey20" } }; + }; + row { + top= 39; + keys { , , }; + }; + row { + top= 58; + keys { , , , { , "KPAD", color="grey20" } }; + }; + row { + top= 77; + keys { { , "KP0" }, }; + }; + }; // End of "Keypad" section + + alias = ; + alias = ; + +}; // End of "pc105" geometry + + +// Added for japanese 106 keyboard +// by tsuka@kawalab.dnj.ynu.ac.jp . +xkb_geometry "jp106" { + + description= "Japanese 106"; + width= 470; + height= 180; + + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "BKSP" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "TABK" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "BKSL" { { [ 27,18] }, { [2,1], [ 25,17] } }; + shape "RTRN" { + { [0,0],[ 27,0],[27,37],[4,37],[4,18],[0,18] } , + { [2,1],[ 25,1],[25,36],[5,36],[5,17],[2,17] } }; + shape "CAPS" { { [ 32,18] }, { [2,1], [ 30,17] } }; + shape "LFSH" { { [ 42,18] }, { [2,1], [ 40,17] } }; + shape "RTSH" { { [ 32,18] }, { [2,1], [ 30,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "SPCE" { { [ 46,18] }, { [2,1], [ 44,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [ 35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [ 16,36] } }; + + shape "LEDS" { cornerRadius= 0, { [ 76 ,20 ] } }; + shape "LED" { cornerRadius= 0, { [ 5, 1 ] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 25; + left= 375; + color= "grey10"; + }; + + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 40; + indicator.shape= "LED"; + indicator "Num Lock" { left= 379; }; + indicator "Caps Lock" { left= 404; }; + indicator "Scroll Lock" { left= 429; }; + text.top= 28; + text.color= "black"; + text "NumLockLabel" { left= 378; text="Num\nLock"; }; + text "CapsLockLabel" { left= 403; text="Caps\nLock"; }; + text "ScrollLockLabel" { left= 428; text="Scroll\nLock"; }; + + section.left= 19; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 25; + row { + top= 1; + keys { { , color="grey20" }, + { , 18 }, , , , + { , 11 ,color="grey20"}, {,color="grey20"}, + { , color="grey20"}, {,color="grey20"}, + { , 11 }, , , , + { , 8 }, , + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 61; + row { + top= 1; + keys { {,color="grey20"}, , , + , , , , , + , , , , , + , { , "BKSP", color="grey20" } + }; + }; + row { + top= 20; + keys { { , "TABK", color="grey20" }, + , , , , , + , , , , , + , , { , 1 ,"RTRN",color="grey20" } + }; + }; + row { + top= 39; + keys { { , "CAPS", color="grey20" }, + , , , , , + , , , , , + , + }; + }; + row { + top= 58; + keys { { , "LFSH", color="grey20" }, + , , , , , + , , , , , + , { , "RTSH", color="grey20" } + }; + }; + row { + top= 77; + key.shape= "MODK"; + key.color= "grey20"; + keys { , { , 20 },, + { , "SPCE", color="white" }, + ,,, { , 17 } + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 61; + left= 310; + key.color= "grey20"; + row { + top= 1; + keys { , , }; + }; + row { + top= 20; + keys { , , }; + }; + row { + top= 58; + left= 20; + keys { }; + }; + row { + top= 77; + keys { , , }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 61; + left= 375; + row { + top= 1; + key.color= "grey20"; + keys { , , , }; + }; + row { + top= 20; + keys { , , , { , "KPAD", color="grey20" } }; + }; + row { + top= 39; + keys { , , }; + }; + row { + top= 58; + keys { , , , { , "KPAD", color="grey20" } }; + }; + row { + top= 77; + keys { { , "KP0" }, }; + }; + }; // End of "Keypad" section + + alias = ; + alias = ; + +}; // End of "jp106" geometry + +// Added for brazilian ABNT2 by Ricardo Y. Igarashi(iga@that.com.br) +xkb_geometry "abnt2" { + + description= "Brazilian ABNT2"; + width= 470; + height= 180; + + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "BKSP" { { [ 37,18] }, { [2,1], [ 35,17] } }; + shape "TABK" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "BKSL" { { [ 27,18] }, { [2,1], [ 25,17] } }; + shape "RTRN" { + { [0,0],[ 27,0],[27,37],[4,37],[4,18],[0,18] } , + { [2,1],[ 25,1],[25,36],[5,36],[5,17],[2,17] } }; + shape "CAPS" { { [ 32,18] }, { [2,1], [ 30,17] } }; + shape "LFSH" { { [ 24,18] }, { [2,1], [ 22,17] } }; + shape "RTSH" { { [ 31,18] }, { [2,1], [ 29,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "SPCE" { { [133,18] }, { [2,1], [131,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [ 35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [ 16,36] } }; + + shape "LEDS" { cornerRadius= 0, { [ 76 ,20 ] } }; + shape "LED" { cornerRadius= 0, { [ 5, 1 ] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 25; + left= 375; + color= "grey10"; + }; + + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 40; + indicator.shape= "LED"; + indicator "Num Lock" { left= 379; }; + indicator "Caps Lock" { left= 404; }; + indicator "Scroll Lock" { left= 429; }; + text.top= 28; + text.color= "black"; + text "NumLockLabel" { left= 378; text="Num\nLock"; }; + text "CapsLockLabel" { left= 403; text="Caps\nLock"; }; + text "ScrollLockLabel" { left= 428; text="Scroll\nLock"; }; + + section.left= 19; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 25; + row { + top= 1; + keys { { , color="grey20" }, + { , 18 }, , , , + { , 11 ,color="grey20"}, {,color="grey20"}, + { , color="grey20"}, {,color="grey20"}, + { , 11 }, , , , + { , 8 }, , + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 61; + row { + top= 1; + keys { {,color="grey20"}, , , + , , , , , + , , , , , + { , "BKSP", color="grey20" } + }; + }; + row { + top= 20; + keys { { , "TABK", color="grey20" }, + , , , , , + , , , , , + , , { , 1 ,"RTRN",color="grey20" } + }; + }; + row { + top= 39; + keys { { , "CAPS", color="grey20" }, + , , , , , + , , , , , + , + }; + }; + row { + top= 58; + keys { { , "LFSH", color="grey20" }, , + , , , , , + , , , , , + , { , "RTSH", color="grey20" } + }; + }; + row { + top= 77; + key.shape= "MODK"; + key.color= "grey20"; + keys { , { , 20 }, + { , "SPCE", color="white" }, + , { , 17 } + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 61; + left= 310; + key.color= "grey20"; + row { + top= 1; + keys { , , }; + }; + row { + top= 20; + keys { , , }; + }; + row { + top= 58; + left= 20; + keys { }; + }; + row { + top= 77; + keys { , , }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 61; + left= 375; + row { + top= 1; + key.color= "grey20"; + keys { , , , }; + }; + row { + top= 20; + keys { , , , { , "KPAD", color="grey20" } }; + }; + row { + top= 39; + keys { , , }; + }; + row { + top= 58; + keys { , , , { , "KPAD", color="grey20" } }; + }; + row { + top= 77; + keys { { , "KP0" }, }; + }; + }; // End of "Keypad" section + + alias = ; + alias = ; + +}; // End of "abnt2" geometry + + +// Created by Alexander Pohoyda + +xkb_geometry "pc86" { + description = "Noname keyboard with 86 keys, DE"; + width = 287; + height = 143; + baseColor = "grey20"; + + shape "EDGE" { cornerRadius = 2, { [287, 143] } }; + shape "LED" { cornerRadius = 2, { [3, 3] } }; + shape "LEDS" { cornerRadius = 0, { [75, 5] } }; + shape "KEYS" { cornerRadius = 0, { [271, 109] } }; + + outline "Edges" { + top = 0; + left = 0; + shape = "EDGE"; + color = "black"; + }; + + solid "KeyPanel" { + shape = "KEYS"; + left = 8; + top = 22; + color = "grey70"; + }; + + solid "LedPanel" { + shape = "LEDS"; + left = 212; + top = 10; + color = "black"; + }; + + indicator.onColor = "green"; + indicator.offColor = "green30"; + indicator.top = 11; + indicator.shape = "LED"; + indicator "Num Lock" { left = 212 + 7; }; + indicator "Caps Lock" { left = 212 + 23; }; + indicator "Scroll Lock" { left = 212 + 39; }; + text.fontSize = 6; + text.top = 10; + text.color = "white"; + text "NumLockLabel" { left = 212 + 7 + 5; text = "Num\nLock"; }; + text "CapsLockLabel" { left = 212 + 23 + 5; text = "Caps\nLock"; }; + text "ScrollLockLabel" { left = 212 + 39 + 5; text = "Scroll\nLock"; }; + + shape.cornerRadius = 1; + shape "SMALL" { { [15, 12] }, { [1.5, 0], [13.5, 10] } }; + shape "NARR" { { [13, 18] }, { [1.5, 0], [11.5, 14] } }; + shape "NORM" { { [18, 18] }, { [3, 0], [15, 14] } }; + shape "NORM_1" { { [22, 18] }, { [4, 0], [22, 18] }, + { [7, 0], [19, 14] } }; + shape "WIDER" { { [23, 18] }, { [3, 0], [20, 14] } }; + shape "WIDEST" { { [27, 18] }, { [3, 0], [24, 14] } }; + shape "SPCE" { { [75, 18] }, { [3, 0], [72, 14] } }; + + section "Function" { + key.shape = "SMALL"; + key.gap = 0.99; + key.color = "grey30"; + left = 8; + top = 22; + row { + top = 1; + keys { , + , , , , + , , , , + , , , , + , , , + }; + }; + }; // End of "Function" section + + section "Control" { + key.shape = "NORM"; + key.gap = 1; + key.color = "grey30"; + left = 8; + top = 111; + row { + top = 1; + keys { , , , + { , shape="SPCE", 39 }, , + , + }; + }; + }; // End of "Control" section + + section "Editing" { + key.shape = "NARR"; + key.gap = 1; + key.color = "grey30"; + left = 265; + top = 34; + row.vertical = True; + row { + top = 1; + keys { , , , }; + }; + }; // End of "Editing" section + + section "Navigation" { + key.gap = 1; + key.shape = "NARR"; + key.color = "grey30"; + left = 236; + top = 92; + row { + left = 14; + top = 1; + keys { }; + }; + row { + top = 20; + keys { , , }; + }; + }; // End of "Navigation" section + + section "Alpha" { + key.gap = 1; + key.shape = "NORM"; + key.color = "grey10"; + left = 8; + top = 35; + row { + top = 1; + keys { { , shape="NORM_1" }, , , , + , , , , , + , , , + { , shape="WIDER", color="grey30" } + }; + }; + row { + top = 20; + keys { { , shape="NARR", color="grey30" }, + , , , , , + , , , , , + , , { , shape="NARR" } + }; + }; + row { + top = 39; + keys { { , color="grey30" }, + , , , , , + , , , , , + , { , shape="WIDEST", color="grey30" } + }; + }; + row { + top = 58; + keys { { , shape="WIDEST", color="grey30" }, + , , , , , + , , , , , + { , shape="WIDER", color="grey30" } + }; + }; + row { + left = 57; + top = 77; + keys { , }; + }; + }; // End of "Alpha" section + + alias = ; + alias = ; +}; // End of "pc86" geometry diff -ruN /opt/SUNWut.orig/lib/xkb/geometry/sgi/O2 /opt/SUNWut/lib/xkb/geometry/sgi/O2 --- /opt/SUNWut.orig/lib/xkb/geometry/sgi/O2 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/geometry/sgi/O2 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,618 @@ +// $Xorg: O2,v 1.3 2000/08/17 19:54:36 cpqbld Exp $ +// +// Copyright (c) 1996 by Silicon Graphics Computer Systems, Inc. +// +// Permission to use, copy, modify, and distribute this +// software and its documentation for any purpose and without +// fee is hereby granted, provided that the above copyright +// notice appear in all copies and that both that copyright +// notice and this permission notice appear in supporting +// documentation, and that the name of Silicon Graphics not be +// used in advertising or publicity pertaining to distribution +// of the software without specific prior written permission. +// Silicon Graphics makes no representation about the suitability +// of this software for any purpose. It is provided "as is" +// without any express or implied warranty. +// +// SILICON GRAPHICS DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS +// SOFTWARE, INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY +// AND FITNESS FOR A PARTICULAR PURPOSE. IN NO EVENT SHALL SILICON +// GRAPHICS BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL +// DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, +// DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE +// OR OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH +// THE USE OR PERFORMANCE OF THIS SOFTWARE. +// +// $XFree86$ +// +default xkb_geometry "pc101" { + + // This is an approximate layout for a 101-key (US/ASCII) SGI + // keyboard. I just took a similar layout (101 key PC keyboard) + // and adjusted the sizes of a few keys by eye. I didn't actually + // *measure* a real keyboard. + + description= "101-key keyboard for Silicon Graphics O2"; + + width= 448; + height= 162; + + shape "EDGE" { + cornerRadius= 2, + { [ 15, 0 ], [ 433, 0 ], [ 433, 10 ], [ 448, 10 ], + [ 448, 162 ], [ 0, 162 ], [ 0, 10 ], [ 15, 10 ] } + }; + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [16,17] } }; + shape "BKSP" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "TABK" { { [ 28,18] }, { [2,1], [26,17] } }; + shape "BKSL" { { [ 27,18] }, { [2,1], [25,17] } }; + shape "RTRN" { { [ 40,18] }, { [2,1], [37,17] } }; + shape "CAPS" { { [ 34,18] }, { [2,1], [29,17] } }; + shape "RTSH" { { [ 49,18] }, { [2,1], [47,17] } }; + shape "LFSH" { { [ 44,18] }, { [2,1], [42,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [26,17] } }; + shape "SPCE" { { [130,18] }, { [2,1], [128,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [16,36] } }; + shape "LOGO" { { [ 12,12] } }; + + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + section.left= 6; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 25; + row { + top= 1; + keys { { , color="grey20" }, + { , 19}, , , , + { , 11}, , , , + { , 11}, , , + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 58; + row { + top= 1; + keys { , , , , , + , , , , , + , , , + { , "BKSP", color="grey20" } + }; + }; + row { + top= 20; + keys { { , "TABK", color= "grey20" }, + , , , , , + , , , , , + , , + { , "BKSL" } + }; + }; + row { + top= 39; + keys { { , "CAPS", color="grey20" }, + , , , , , + , , , , , + , { , "RTRN", color="grey20" } + }; + }; + row { + top= 58; + keys { { , "LFSH", color="grey20" }, + , , , , , + , , , , , + { , "RTSH", color="grey20" } + }; + }; + row { + top= 77; + key.shape= "MODK"; + key.color= "grey20"; + keys { , { , 20 }, + { , "SPCE",color="white" }, + , { , 20 } + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 25; + left= 299; + key.color= "grey20"; + row { + top= 1; + keys { , , }; + }; + row { + top= 33; + keys { , , }; + }; + row { + top= 53; + keys { , , }; + }; + row { + top= 91; + left= 20; + keys { }; + }; + row { + top= 110; + keys { , , }; + }; + }; // End of "Editing" section + + shape "LEDS" { cornerRadius= 0, { [ 76 ,20 ] } }; + shape "LED" { cornerRadius= 0, { [ 3, 1.5] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 25; + left= 364; + color= "grey10"; + }; + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 40.5; + indicator.shape= "LED"; + indicator "Num Lock" { left= 372; }; + indicator "Caps Lock" { left= 397; }; + indicator "Scro llLock" { left= 422; }; + + text.font= "helvetica"; + text.weight= "bold"; + text.slant= "r"; + text.fontWidth= "normal"; + text.fontSize= 12; + text.top= 39.5; + text.color= "black"; + text "NumLockLabel" { left= 376.5; text="1"; }; + text "CapsLockLabel" { left= 401.5; text="A"; }; + text "ScrollLockLabel" { left= 426.5; text="S"; }; + + logo "SGILogoImage" { + top= 26.5; + left= 396; + name= "SGI"; + shape= "LOGO"; + }; + text.font= "helvetica"; + text.weight= "bold"; + text.slant= "o"; + text.fontWidth= "narrow"; + text.fontSize= 18; + text "SiliconLogoText" { + top= 27; + left= 375; + width= 20; + text= "Silicon"; + }; + text "GraphicsLogoText" { + top= 27; + left= 409; + width= 20; + text= "Graphics"; + }; + + section "Keypad" { + top= 58; + left= 363; + row { + top= 1; + key.color= "grey20"; + keys { , , , }; + }; + row { + top= 20; + keys { , , , { , "KPAD", color= "grey20" } }; + }; + row { + top= 39; + keys { , , }; + }; + row { + top= 58; + keys { , , , { , "KPAD", color= "grey20" } }; + }; + row { + top= 77; + keys { { , "KP0" }, }; + }; + }; // End of "Keypad" section + alias = ; + alias = ; +}; + +xkb_geometry "pc102" { + + // This is an approximate layout for 102-key SGI international + // keyboards. I just took a similar layout (101 key PC keyboard) + // and adjusted the sizes of a few keys by eye. I didn't actually + // *measure* a real keyboard. + + description= "Silicon Graphics 102-key Keyboard"; + width= 470; + height= 193; + + shape.cornerRadius= 1; + shape "EDGE" { cornerRadius=2, { [ 470, 193 ] } }; + shape "NORM" { { [18,18] }, { [2,1], [16,17] } }; + shape "BKSP" { { [35,18] }, { [2,1], [33,17] } }; + shape "TABK" { { [27,18] }, { [2,1], [25,17] } }; + shape "RTRN" { + approx = { [ 0, 0], [26,37] }, + { [ 0, 0], [26, 0], [26,37], + [ 5,37], [ 5,18], [ 0,18] }, + { [ 1, 1], [24, 1], [24,36], + [ 7,36], [ 7,17], [ 1,17] } + }; + shape "CAPS" { { [ 32,18] }, { [2,1], [25,17] } }; + shape "RTSH" { { [ 50,18] }, { [2,1], [48,17] } }; + shape "LFSH" { { [ 22,18] }, { [2,1], [20,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [26,17] } }; + shape "SPCE" { { [130,18] }, { [2,1], [128,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [16,36] } }; + shape "LOGO" { { [ 16,16] } }; + + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + section.left= 19; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 50; + row { + top= 1; + keys { { , color="grey20" }, + { , 18}, , , , + { , 10}, , , , + { , 10}, , , + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 83; + row { + top= 1; + keys { , , , , , + , , , , , + , , , + { , "BKSP", color= "grey20" } + }; + }; + row { + top= 20; + keys { { , "TABK", color= "grey20" }, + , , , , , + , , , , , + , , + { , "RTRN", color= "grey20" } + }; + }; + row { + top= 39; + keys { { , "CAPS", color= "grey20" }, + , , , , , + , , , , , + , + }; + }; + row { + top= 58; + keys { { , "LFSH", color= "grey20" }, , + , , , , , + , , , , , + { , "RTSH", color= "grey20" } + }; + }; + row { + top= 77; + key.shape= "MODK"; + key.color= "grey20"; + keys { , + { , 19 }, + { , "SPCE", color="white" }, + , + { , 19 } + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 50; + left= 308; + key.color= "grey20"; + row { + top= 1; + keys { , , }; + }; + row { + top= 33; + keys { , , }; + }; + row { + top= 53; + keys { , , }; + }; + row { + top= 91; + left= 20; + keys { }; + }; + row { + top= 110; + keys { , , }; + }; + }; // End of "Editing" section + + shape "LEDS" { cornerRadius= 0, { [ 76 ,20 ] } }; + shape "LED" { cornerRadius= 0, { [ 1, 3 ] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 50; + left= 375; + color= "grey10"; + }; + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 64.5; + indicator.shape= "LED"; + indicator "Num Lock" { left= 384; }; + indicator "Caps Lock" { left= 409; }; + indicator "Scroll Lock" { left= 434; }; + text.top= 52; + text.color= "black"; + text "NumLockLabel" { left= 380.5; text="Num\nLock"; }; + text "CapsLockLabel" { left= 405; text="Caps\nLock"; }; + text "ScrollLockLabel" { left= 430; text="Scroll\nLock"; }; + + logo "SGILogoImage" { + top= 17; + left= 22; + name= "SGI"; + shape= "LOGO"; + }; + text "SGILogoText" { + top= 21; + left= 40; + width= 50; + text= "SiliconGraphics"; + font= "helvetica"; + slant= "o"; + weight= "bold"; + setWidth= "narrow"; + fontSize= 24; + }; + + section "Keypad" { + top= 83; + left= 374; + row { + top= 1; + key.color= "grey20"; + keys { , , , }; + }; + row { + top= 20; + keys { , , , { , "KPAD", color="grey20" } }; + }; + row { + top= 39; + keys { , , }; + }; + row { + top= 58; + keys { , , , { , "KPAD", color="grey20" } }; + }; + row { + top= 77; + keys { { , "KP0" }, }; + }; + }; // End of "Keypad" section + alias = ; + alias = ; +}; + +xkb_geometry "jp106" { + description= "Silicon Graphics 106-key Japanese keyboard"; + width= 442; + height= 167; + + shape "EDGE" { cornerRadius= 2, { [ 442, 167 ] } }; + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "BKSP" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "TABK" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "BKSL" { { [ 27,18] }, { [2,1], [ 25,17] } }; + shape "RTRN" { + { [0,0],[ 27,0],[27,37],[4,37],[4,18],[0,18] } , + { [2,1],[ 25,1],[25,36],[5,36],[5,17],[2,17] } }; + shape "CAPS" { { [ 32,18] }, { [2,1], [ 30,17] } }; + shape "LFSH" { { [ 42,18] }, { [2,1], [ 40,17] } }; + shape "RTSH" { { [ 32,18] }, { [2,1], [ 30,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "SPCE" { { [ 46,18] }, { [2,1], [ 44,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [ 35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [ 16,36] } }; + shape "LOGO" { { [ 16,16] } }; + + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + logo "SGILogoImage" { + top= 5; + left= 6; + name= "SGI"; + shape= "LOGO"; + }; + + text "SGILogoText" { + top= 9; + left= 25; + width= 50; + text= "SiliconGraphics"; + font= "helvetica"; + slant= "o"; + weight= "bold"; + fontWidth= "narrow"; + fontSize= 24; + }; + + shape "LEDS" { cornerRadius= 0.1, { [ 76 ,20 ] } }; + shape "LED" { cornerRadius= 0, { [ 5, 1 ] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 25; + left= 362; + color= "grey10"; + }; + + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 40; + indicator.shape= "LED"; + indicator "Num Lock" { left= 366; }; + indicator "Caps Lock" { left= 391; }; + indicator "Scroll Lock" { left= 416; }; + text.top= 28; + text.color= "black"; + text "NumLockLabel" { left= 366; text="Num\nLock"; }; + text "CapsLockLabel" { left= 391; text="Caps\nLock"; }; + text "ScrollLockLabel" { left= 416; text="Scroll\nLock"; }; + + section.left= 5; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 25; + row { + top= 1; + keys { { , color="grey20" }, + { , 18 }, , , , + { , 11 ,color="grey20"}, {,color="grey20"}, + { , color="grey20"}, {,color="grey20"}, + { , 11 }, , , , + { , 8 }, , + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 61; + row { + top= 1; + keys { {,color="grey20"}, , , + , , , , , + , , , , , + , { , "BKSP", color="grey20" } + }; + }; + row { + top= 20; + keys { { , "TABK", color="grey20" }, + , , , , , + , , , , , + , , { , 1 ,"RTRN",color="grey20" } + }; + }; + row { + top= 39; + keys { { , "CAPS", color="grey20" }, + , , , , , + , , , , , + , + }; + }; + row { + top= 58; + keys { { , "LFSH", color="grey20" }, + , , , , , + , , , , , + , { , "RTSH", color="grey20" } + }; + }; + row { + top= 77; + key.shape= "MODK"; + key.color= "grey20"; + keys { , { , 20 },, + { , "SPCE", color="white" }, + ,,, { , 17 } + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 61; + left= 296; + key.color= "grey20"; + row { + top= 1; + keys { , , }; + }; + row { + top= 20; + keys { , , }; + }; + row { + top= 58; + left= 20; + keys { }; + }; + row { + top= 77; + keys { , , }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 61; + left= 361; + row { + top= 1; + key.color= "grey20"; + keys { , , , }; + }; + row { + top= 20; + keys { , , , { , "KPAD", color="grey20" } }; + }; + row { + top= 39; + keys { , , }; + }; + row { + top= 58; + keys { , , , { , "KPAD", color="grey20" } }; + }; + row { + top= 77; + keys { { , "KP0" }, }; + }; + }; // End of "Keypad" section + + alias = ; + alias = ; + +}; // End of "jp106" geometry + diff -ruN /opt/SUNWut.orig/lib/xkb/geometry/sgi/indigo /opt/SUNWut/lib/xkb/geometry/sgi/indigo --- /opt/SUNWut.orig/lib/xkb/geometry/sgi/indigo 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/geometry/sgi/indigo 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,413 @@ +// $Xorg: indigo,v 1.3 2000/08/17 19:54:37 cpqbld Exp $ +// +// Copyright (c) 1996 by Silicon Graphics Computer Systems, Inc. +// +// Permission to use, copy, modify, and distribute this +// software and its documentation for any purpose and without +// fee is hereby granted, provided that the above copyright +// notice appear in all copies and that both that copyright +// notice and this permission notice appear in supporting +// documentation, and that the name of Silicon Graphics not be +// used in advertising or publicity pertaining to distribution +// of the software without specific prior written permission. +// Silicon Graphics makes no representation about the suitability +// of this software for any purpose. It is provided "as is" +// without any express or implied warranty. +// +// SILICON GRAPHICS DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS +// SOFTWARE, INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY +// AND FITNESS FOR A PARTICULAR PURPOSE. IN NO EVENT SHALL SILICON +// GRAPHICS BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL +// DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, +// DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE +// OR OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH +// THE USE OR PERFORMANCE OF THIS SOFTWARE. +// +// $XFree86$ +// +default xkb_geometry "pc101" { + + // This is an approximate layout for a 101-key (US/ASCII) SGI + // keyboard. I just took a similar layout (101 key PC keyboard) + // and adjusted the sizes of a few keys by eye. I didn't actually + // *measure* a real keyboard. + + description= "Silicon Graphics 101-key keyboard"; + + width= 472; + height= 193; + + shape "EDGE" { cornerRadius= 2, { [ 472, 193 ] } }; + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [16,17] } }; + shape "BKSP" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "TABK" { { [ 28,18] }, { [2,1], [26,17] } }; + shape "BKSL" { { [ 27,18] }, { [2,1], [25,17] } }; + shape "RTRN" { { [ 40,18] }, { [2,1], [37,17] } }; + shape "CAPS" { { [ 34,18] }, { [2,1], [29,17] } }; + shape "RTSH" { { [ 49,18] }, { [2,1], [47,17] } }; + shape "LFSH" { { [ 44,18] }, { [2,1], [42,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [26,17] } }; + shape "SPCE" { { [130,18] }, { [2,1], [128,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [16,36] } }; + shape "LOGO" { { [ 16,16] } }; + + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + section.left= 19; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 50; + row { + top= 1; + keys { { , color="grey20" }, + { , 19}, , , , + { , 11}, , , , + { , 11}, , , + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 83; + row { + top= 1; + keys { , , , , , + , , , , , + , , , + { , "BKSP", color="grey20" } + }; + }; + row { + top= 20; + keys { { , "TABK", color= "grey20" }, + , , , , , + , , , , , + , , + { , "BKSL" } + }; + }; + row { + top= 39; + keys { { , "CAPS", color="grey20" }, + , , , , , + , , , , , + , { , "RTRN", color="grey20" } + }; + }; + row { + top= 58; + keys { { , "LFSH", color="grey20" }, + , , , , , + , , , , , + { , "RTSH", color="grey20" } + }; + }; + row { + top= 77; + key.shape= "MODK"; + key.color= "grey20"; + keys { , { , 20 }, + { , "SPCE",color="white" }, + , { , 20 } + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 50; + left= 312; + key.color= "grey20"; + row { + top= 1; + keys { , , }; + }; + row { + top= 33; + keys { , , }; + }; + row { + top= 53; + keys { , , }; + }; + row { + top= 91; + left= 20; + keys { }; + }; + row { + top= 110; + keys { , , }; + }; + }; // End of "Editing" section + + shape "LEDS" { cornerRadius= 0, { [ 76 ,20 ] } }; + shape "LED" { cornerRadius= 0, { [ 1, 3 ] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 50; + left= 377; + color= "grey10"; + }; + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 64.5; + indicator.shape= "LED"; + indicator "Num Lock" { left= 386; }; + indicator "Caps Lock" { left= 411; }; + indicator "Scroll Lock" { left= 436; }; + text.top= 52; + text.color= "black"; + text "NumLockLabel" { left= 382.5; text="Num\nLock"; }; + text "CapsLockLabel" { left= 407; text="Caps\nLock"; }; + text "ScrollLockLabel" { left= 432; text="Scroll\nLock"; }; + + logo "SGILogoImage" { + top= 17; + left= 22; + name= "SGI"; + shape= "LOGO"; + }; + text "SGILogoText" { + top= 21; + left= 40; + width= 50; + text= "SiliconGraphics"; + font= "helvetica"; + slant= "o"; + weight= "bold"; + fontWidth= "narrow"; + fontSize= 24; + }; + + section "Keypad" { + top= 83; + left= 376; + row { + top= 1; + key.color= "grey20"; + keys { , , , }; + }; + row { + top= 20; + keys { , , , { , "KPAD", color= "grey20" } }; + }; + row { + top= 39; + keys { , , }; + }; + row { + top= 58; + keys { , , , { , "KPAD", color= "grey20" } }; + }; + row { + top= 77; + keys { { , "KP0" }, }; + }; + }; // End of "Keypad" section + alias = ; + alias = ; +}; +xkb_geometry "pc102" { + + // This is an approximate layout for 102-key SGI international + // keyboards. I just took a similar layout (101 key PC keyboard) + // and adjusted the sizes of a few keys by eye. I didn't actually + // *measure* a real keyboard. + + description= "Silicon Graphics 102-key Keyboard"; + width= 470; + height= 193; + + shape.cornerRadius= 1; + shape "EDGE" { cornerRadius=2, { [ 470, 193 ] } }; + shape "NORM" { { [18,18] }, { [2,1], [16,17] } }; + shape "BKSP" { { [35,18] }, { [2,1], [33,17] } }; + shape "TABK" { { [27,18] }, { [2,1], [25,17] } }; + shape "RTRN" { + approx = { [ 0, 0], [26,37] }, + { [ 0, 0], [26, 0], [26,37], + [ 5,37], [ 5,18], [ 0,18] }, + { [ 1, 1], [24, 1], [24,36], + [ 7,36], [ 7,17], [ 1,17] } + }; + shape "CAPS" { { [ 32,18] }, { [2,1], [25,17] } }; + shape "RTSH" { { [ 50,18] }, { [2,1], [48,17] } }; + shape "LFSH" { { [ 22,18] }, { [2,1], [20,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [26,17] } }; + shape "SPCE" { { [130,18] }, { [2,1], [128,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [16,36] } }; + shape "LOGO" { { [ 16,16] } }; + + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + section.left= 19; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 50; + row { + top= 1; + keys { { , color="grey20" }, + { , 18}, , , , + { , 10}, , , , + { , 10}, , , + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 83; + row { + top= 1; + keys { , , , , , + , , , , , + , , , + { , "BKSP", color= "grey20" } + }; + }; + row { + top= 20; + keys { { , "TABK", color= "grey20" }, + , , , , , + , , , , , + , , + { , "RTRN", color= "grey20" } + }; + }; + row { + top= 39; + keys { { , "CAPS", color= "grey20" }, + , , , , , + , , , , , + , + }; + }; + row { + top= 58; + keys { { , "LFSH", color= "grey20" }, , + , , , , , + , , , , , + { , "RTSH", color= "grey20" } + }; + }; + row { + top= 77; + key.shape= "MODK"; + key.color= "grey20"; + keys { , + { , 19 }, + { , "SPCE", color="white" }, + , + { , 19 } + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 50; + left= 308; + key.color= "grey20"; + row { + top= 1; + keys { , , }; + }; + row { + top= 33; + keys { , , }; + }; + row { + top= 53; + keys { , , }; + }; + row { + top= 91; + left= 20; + keys { }; + }; + row { + top= 110; + keys { , , }; + }; + }; // End of "Editing" section + + shape "LEDS" { cornerRadius= 0, { [ 76 ,20 ] } }; + shape "LED" { cornerRadius= 0, { [ 1, 3 ] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 50; + left= 375; + color= "grey10"; + }; + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 64.5; + indicator.shape= "LED"; + indicator "Num Lock" { left= 384; }; + indicator "Caps Lock" { left= 409; }; + indicator "Scroll Lock" { left= 434; }; + text.top= 52; + text.color= "black"; + text "NumLockLabel" { left= 380.5; text="Num\nLock"; }; + text "CapsLockLabel" { left= 405; text="Caps\nLock"; }; + text "ScrollLockLabel" { left= 430; text="Scroll\nLock"; }; + + logo "SGILogoImage" { + top= 17; + left= 22; + name= "SGI"; + shape= "LOGO"; + }; + text "SGILogoText" { + top= 21; + left= 40; + width= 50; + text= "SiliconGraphics"; + font= "helvetica"; + slant= "o"; + weight= "bold"; + setWidth= "narrow"; + fontSize= 24; + }; + + section "Keypad" { + top= 83; + left= 374; + row { + top= 1; + key.color= "grey20"; + keys { , , , }; + }; + row { + top= 20; + keys { , , , { , "KPAD", color="grey20" } }; + }; + row { + top= 39; + keys { , , }; + }; + row { + top= 58; + keys { , , , { , "KPAD", color="grey20" } }; + }; + row { + top= 77; + keys { { , "KP0" }, }; + }; + }; // End of "Keypad" section + alias = ; + alias = ; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/geometry/sgi/indy /opt/SUNWut/lib/xkb/geometry/sgi/indy --- /opt/SUNWut.orig/lib/xkb/geometry/sgi/indy 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/geometry/sgi/indy 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,601 @@ +// $Xorg: indy,v 1.3 2000/08/17 19:54:37 cpqbld Exp $ +// +// Copyright (c) 1996 by Silicon Graphics Computer Systems, Inc. +// +// Permission to use, copy, modify, and distribute this +// software and its documentation for any purpose and without +// fee is hereby granted, provided that the above copyright +// notice appear in all copies and that both that copyright +// notice and this permission notice appear in supporting +// documentation, and that the name of Silicon Graphics not be +// used in advertising or publicity pertaining to distribution +// of the software without specific prior written permission. +// Silicon Graphics makes no representation about the suitability +// of this software for any purpose. It is provided "as is" +// without any express or implied warranty. +// +// SILICON GRAPHICS DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS +// SOFTWARE, INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY +// AND FITNESS FOR A PARTICULAR PURPOSE. IN NO EVENT SHALL SILICON +// GRAPHICS BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL +// DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, +// DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE +// OR OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH +// THE USE OR PERFORMANCE OF THIS SOFTWARE. +// +// $XFree86$ +// +default xkb_geometry "pc101" { + + // This is an approximate layout for a 101-key (US/ASCII) SGI + // keyboard. I just took a similar layout (101 key PC keyboard) + // and adjusted the sizes of a few keys by eye. I didn't actually + // *measure* a real keyboard. + + description= "Silicon Graphics 101-key keyboard"; + + width= 472; + height= 193; + + shape "EDGE" { cornerRadius= 2, { [ 472, 193 ] } }; + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [16,17] } }; + shape "BKSP" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "TABK" { { [ 28,18] }, { [2,1], [26,17] } }; + shape "BKSL" { { [ 27,18] }, { [2,1], [25,17] } }; + shape "RTRN" { { [ 40,18] }, { [2,1], [37,17] } }; + shape "CAPS" { { [ 34,18] }, { [2,1], [29,17] } }; + shape "RTSH" { { [ 49,18] }, { [2,1], [47,17] } }; + shape "LFSH" { { [ 44,18] }, { [2,1], [42,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [26,17] } }; + shape "SPCE" { { [130,18] }, { [2,1], [128,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [16,36] } }; + shape "LOGO" { { [ 16,16] } }; + + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + section.left= 19; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 50; + row { + top= 1; + keys { { , color="grey20" }, + { , 19}, , , , + { , 11}, , , , + { , 11}, , , + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 83; + row { + top= 1; + keys { , , , , , + , , , , , + , , , + { , "BKSP", color="grey20" } + }; + }; + row { + top= 20; + keys { { , "TABK", color= "grey20" }, + , , , , , + , , , , , + , , + { , "BKSL" } + }; + }; + row { + top= 39; + keys { { , "CAPS", color="grey20" }, + , , , , , + , , , , , + , { , "RTRN", color="grey20" } + }; + }; + row { + top= 58; + keys { { , "LFSH", color="grey20" }, + , , , , , + , , , , , + { , "RTSH", color="grey20" } + }; + }; + row { + top= 77; + key.shape= "MODK"; + key.color= "grey20"; + keys { , { , 20 }, + { , "SPCE",color="white" }, + , { , 20 } + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 50; + left= 312; + key.color= "grey20"; + row { + top= 1; + keys { , , }; + }; + row { + top= 33; + keys { , , }; + }; + row { + top= 53; + keys { , , }; + }; + row { + top= 91; + left= 20; + keys { }; + }; + row { + top= 110; + keys { , , }; + }; + }; // End of "Editing" section + + shape "LEDS" { cornerRadius= 0, { [ 76 ,20 ] } }; + shape "LED" { cornerRadius= 0, { [ 1, 3 ] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 50; + left= 377; + color= "grey10"; + }; + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 64.5; + indicator.shape= "LED"; + indicator "Num Lock" { left= 386; }; + indicator "Caps Lock" { left= 411; }; + indicator "Scroll Lock" { left= 436; }; + text.top= 52; + text.color= "black"; + text "NumLockLabel" { left= 382.5; text="Num\nLock"; }; + text "CapsLockLabel" { left= 407; text="Caps\nLock"; }; + text "ScrollLockLabel" { left= 432; text="Scroll\nLock"; }; + + logo "SGILogoImage" { + top= 17; + left= 22; + name= "SGI"; + shape= "LOGO"; + }; + text "SGILogoText" { + top= 21; + left= 40; + width= 50; + text= "SiliconGraphics"; + font= "helvetica"; + slant= "o"; + weight= "bold"; + fontWidth= "narrow"; + fontSize= 24; + }; + + section "Keypad" { + top= 83; + left= 376; + row { + top= 1; + key.color= "grey20"; + keys { , , , }; + }; + row { + top= 20; + keys { , , , { , "KPAD", color= "grey20" } }; + }; + row { + top= 39; + keys { , , }; + }; + row { + top= 58; + keys { , , , { , "KPAD", color= "grey20" } }; + }; + row { + top= 77; + keys { { , "KP0" }, }; + }; + }; // End of "Keypad" section + alias = ; + alias = ; +}; + +xkb_geometry "pc102" { + + // This is an approximate layout for 102-key SGI international + // keyboards. I just took a similar layout (101 key PC keyboard) + // and adjusted the sizes of a few keys by eye. I didn't actually + // *measure* a real keyboard. + + description= "Silicon Graphics 102-key Keyboard"; + width= 470; + height= 193; + + shape.cornerRadius= 1; + shape "EDGE" { cornerRadius=2, { [ 470, 193 ] } }; + shape "NORM" { { [18,18] }, { [2,1], [16,17] } }; + shape "BKSP" { { [35,18] }, { [2,1], [33,17] } }; + shape "TABK" { { [27,18] }, { [2,1], [25,17] } }; + shape "RTRN" { + approx = { [ 0, 0], [26,37] }, + { [ 0, 0], [26, 0], [26,37], + [ 5,37], [ 5,18], [ 0,18] }, + { [ 1, 1], [24, 1], [24,36], + [ 7,36], [ 7,17], [ 1,17] } + }; + shape "CAPS" { { [ 32,18] }, { [2,1], [25,17] } }; + shape "RTSH" { { [ 50,18] }, { [2,1], [48,17] } }; + shape "LFSH" { { [ 22,18] }, { [2,1], [20,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [26,17] } }; + shape "SPCE" { { [130,18] }, { [2,1], [128,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [16,36] } }; + shape "LOGO" { { [ 16,16] } }; + + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + section.left= 19; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 50; + row { + top= 1; + keys { { , color="grey20" }, + { , 18}, , , , + { , 10}, , , , + { , 10}, , , + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 83; + row { + top= 1; + keys { , , , , , + , , , , , + , , , + { , "BKSP", color= "grey20" } + }; + }; + row { + top= 20; + keys { { , "TABK", color= "grey20" }, + , , , , , + , , , , , + , , + { , "RTRN", color= "grey20" } + }; + }; + row { + top= 39; + keys { { , "CAPS", color= "grey20" }, + , , , , , + , , , , , + , + }; + }; + row { + top= 58; + keys { { , "LFSH", color= "grey20" }, , + , , , , , + , , , , , + { , "RTSH", color= "grey20" } + }; + }; + row { + top= 77; + key.shape= "MODK"; + key.color= "grey20"; + keys { , + { , 19 }, + { , "SPCE", color="white" }, + , + { , 19 } + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 50; + left= 308; + key.color= "grey20"; + row { + top= 1; + keys { , , }; + }; + row { + top= 33; + keys { , , }; + }; + row { + top= 53; + keys { , , }; + }; + row { + top= 91; + left= 20; + keys { }; + }; + row { + top= 110; + keys { , , }; + }; + }; // End of "Editing" section + + shape "LEDS" { cornerRadius= 0, { [ 76 ,20 ] } }; + shape "LED" { cornerRadius= 0, { [ 1, 3 ] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 50; + left= 375; + color= "grey10"; + }; + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 64.5; + indicator.shape= "LED"; + indicator "Num Lock" { left= 384; }; + indicator "Caps Lock" { left= 409; }; + indicator "Scroll Lock" { left= 434; }; + text.top= 52; + text.color= "black"; + text "NumLockLabel" { left= 380.5; text="Num\nLock"; }; + text "CapsLockLabel" { left= 405; text="Caps\nLock"; }; + text "ScrollLockLabel" { left= 430; text="Scroll\nLock"; }; + + logo "SGILogoImage" { + top= 17; + left= 22; + name= "SGI"; + shape= "LOGO"; + }; + text "SGILogoText" { + top= 21; + left= 40; + width= 50; + text= "SiliconGraphics"; + font= "helvetica"; + slant= "o"; + weight= "bold"; + setWidth= "narrow"; + fontSize= 24; + }; + + section "Keypad" { + top= 83; + left= 374; + row { + top= 1; + key.color= "grey20"; + keys { , , , }; + }; + row { + top= 20; + keys { , , , { , "KPAD", color="grey20" } }; + }; + row { + top= 39; + keys { , , }; + }; + row { + top= 58; + keys { , , , { , "KPAD", color="grey20" } }; + }; + row { + top= 77; + keys { { , "KP0" }, }; + }; + }; // End of "Keypad" section + alias = ; + alias = ; +}; + +xkb_geometry "jp106" { + description= "Silicon Graphics 106-key Japanese keyboard"; + width= 442; + height= 167; + + shape "EDGE" { cornerRadius= 2, { [ 442, 167 ] } }; + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "BKSP" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "TABK" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "BKSL" { { [ 27,18] }, { [2,1], [ 25,17] } }; + shape "RTRN" { + { [0,0],[ 27,0],[27,37],[4,37],[4,18],[0,18] } , + { [2,1],[ 25,1],[25,36],[5,36],[5,17],[2,17] } }; + shape "CAPS" { { [ 32,18] }, { [2,1], [ 30,17] } }; + shape "LFSH" { { [ 42,18] }, { [2,1], [ 40,17] } }; + shape "RTSH" { { [ 32,18] }, { [2,1], [ 30,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "SPCE" { { [ 46,18] }, { [2,1], [ 44,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [ 35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [ 16,36] } }; + shape "LOGO" { { [ 16,16] } }; + + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + logo "SGILogoImage" { + top= 5; + left= 6; + name= "SGI"; + shape= "LOGO"; + }; + + text "SGILogoText" { + top= 9; + left= 25; + width= 50; + text= "SiliconGraphics"; + font= "helvetica"; + slant= "o"; + weight= "bold"; + fontWidth= "narrow"; + fontSize= 24; + }; + + shape "LEDS" { cornerRadius= 0.1, { [ 76 ,20 ] } }; + shape "LED" { cornerRadius= 0, { [ 5, 1 ] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 25; + left= 362; + color= "grey10"; + }; + + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 40; + indicator.shape= "LED"; + indicator "Num Lock" { left= 366; }; + indicator "Caps Lock" { left= 391; }; + indicator "Scroll Lock" { left= 416; }; + text.top= 28; + text.color= "black"; + text "NumLockLabel" { left= 366; text="Num\nLock"; }; + text "CapsLockLabel" { left= 391; text="Caps\nLock"; }; + text "ScrollLockLabel" { left= 416; text="Scroll\nLock"; }; + + section.left= 5; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 25; + row { + top= 1; + keys { { , color="grey20" }, + { , 18 }, , , , + { , 11 ,color="grey20"}, {,color="grey20"}, + { , color="grey20"}, {,color="grey20"}, + { , 11 }, , , , + { , 8 }, , + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 61; + row { + top= 1; + keys { {,color="grey20"}, , , + , , , , , + , , , , , + , { , "BKSP", color="grey20" } + }; + }; + row { + top= 20; + keys { { , "TABK", color="grey20" }, + , , , , , + , , , , , + , , { , 1 ,"RTRN",color="grey20" } + }; + }; + row { + top= 39; + keys { { , "CAPS", color="grey20" }, + , , , , , + , , , , , + , + }; + }; + row { + top= 58; + keys { { , "LFSH", color="grey20" }, + , , , , , + , , , , , + , { , "RTSH", color="grey20" } + }; + }; + row { + top= 77; + key.shape= "MODK"; + key.color= "grey20"; + keys { , { , 20 },, + { , "SPCE", color="white" }, + ,,, { , 17 } + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 61; + left= 296; + key.color= "grey20"; + row { + top= 1; + keys { , , }; + }; + row { + top= 20; + keys { , , }; + }; + row { + top= 58; + left= 20; + keys { }; + }; + row { + top= 77; + keys { , , }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 61; + left= 361; + row { + top= 1; + key.color= "grey20"; + keys { , , , }; + }; + row { + top= 20; + keys { , , , { , "KPAD", color="grey20" } }; + }; + row { + top= 39; + keys { , , }; + }; + row { + top= 58; + keys { , , , { , "KPAD", color="grey20" } }; + }; + row { + top= 77; + keys { { , "KP0" }, }; + }; + }; // End of "Keypad" section + + alias = ; + alias = ; + +}; // End of "jp106" geometry diff -ruN /opt/SUNWut.orig/lib/xkb/geometry/sony /opt/SUNWut/lib/xkb/geometry/sony --- /opt/SUNWut.orig/lib/xkb/geometry/sony 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/geometry/sony 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,180 @@ +// $Xorg: sony,v 1.4 2001/02/09 02:05:51 xorgcvs Exp $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +default xkb_geometry "nwp5461" { + + description= "Sony NEWS NWS-5000 Keyboard"; + width= 425; + height= 190; + + shape.cornerRadius= 1; + shape "NORM" { { [18,18] }, { [2,1], [16,17] } }; + shape "BKSP" { { [28,18] }, { [2,1], [26,17] } }; + shape "TABK" { { [28,18] }, { [2,1], [26,17] } }; + shape "BKSL" { { [28,18] }, { [2,1], [26,17] } }; + shape "RTRN" { + approx = { [15, 0], [33,37] }, + { [15, 0], [33, 0], [33,37], + [ 0,37], [ 0,19], [15,19] }, + { [17, 1], [31, 1], [31,36], + [ 2,36], [ 2,20], [17,20] } + }; + shape "SHFT" { { [42,18] }, { [2,1], [40,17] } }; + shape "MODK" { { [33,18] }, { [2,1], [31,17] } }; + shape "SPCE" { { [85,18] }, { [2,1], [83,17] } }; + shape "KPEN" { { [18,38] }, { [2,1], [16,37] } }; + shape "STOP" { { [28,18] }, { [2,1], [26,17] } }; + shape "CUT" { { [55,18] }, { [2,1], [53,17] } }; + shape "EXEC" { { [32,18] }, { [2,1], [30,17] } }; + shape "UNK" { { [18,18] }, { [2,1], [16,17] } }; + shape "CAPS" { { [18,18] }, { [2,1], [16,17] } }; + shape "FKEY" { { [23,18] }, { [2,1], [21,17] } }; + + section.left= 13; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 55; + row { + top= 1; + left= 37; + key.shape="FKEY"; + keys { , , , , , + { , 5 }, , , , , + { , 5 }, + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 80; + row { + top= 1; + keys { { , color="grey20" } , + , , , , + , , , , + , , , , + , { , "BKSP", color="grey20" } + }; + }; + row { + top= 20; + keys { { , "TABK", color="grey20" }, + , , , , , + , , , , , + , , { , color="grey20" }, + { , "RTRN", -14, color="grey20" } + }; + }; + row { + top= 39; + keys { { , "MODK", color="grey20" }, + , , , , , + , , , , , + , + }; + }; + row { + top= 58; + keys { { , "SHFT", color="grey20" }, + , , , , , + , , , , , , + { , "SHFT", color="grey20" } + }; + }; + row { + top= 77; + key.shape= "MODK"; + key.color= "grey20"; + keys { , { , "CAPS" }, + { , "STOP", color="white" }, + { , "SPCE", color="white" }, + { , "CUT", color="white" }, + { , "UNK" }, { , "UNK" }, + { , "EXEC" } + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 80; + left= 312; + key.color= "grey20"; + row { + top= 1; + keys { }; + }; + row { + top= 20; + keys { }; + }; + row { + top= 39; + keys { }; + }; + row { + top= 58; + keys { }; + }; + row { + top= 77; + keys { }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 61; + left= 334; + row { + top= 1; + key.color= "grey20"; + keys { { , 19 }, , }; + }; + row { + top= 20; + keys { , , , { , color="grey20" } }; + }; + row { + top= 39; + keys { , , , { , color="grey20" } }; + }; + row { + top= 58; + keys { , , , { , "KPEN", color="grey20" } }; + }; + row { + top= 77; + keys { , { , color="grey20" }, }; + }; + row { + top= 96; + key.color= "grey20"; + keys { , , , }; + }; + }; // End of "Keypad" section + +}; // End of "default" geometry diff -ruN /opt/SUNWut.orig/lib/xkb/geometry/sun /opt/SUNWut/lib/xkb/geometry/sun --- /opt/SUNWut.orig/lib/xkb/geometry/sun 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/geometry/sun 2008-06-18 23:52:46.000000000 +0200 @@ -0,0 +1,2760 @@ +// $TOG: sun /main/8 1998/02/10 13:43:59 kaleb $ +// +//Copyright 1996, 1998 The Open Group +// +//All Rights Reserved. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +xkb_geometry "type4" { + + // This is an approximate layout for a (US/ASCII) Sun Type4 US + // keyboard. + + description= "Sun Type4 keyboard"; + + width= 452; + height= 185; + + shape "EDGE" { cornerRadius= 2, { [ 452, 185 ] } }; + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [16,17] } }; + shape "BKSP" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "TABK" { { [ 27,18] }, { [2,1], [25,17] } }; + shape "DELE" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "RTRN" { + approx = { [ 0, 0], [28,37] }, + { [ 0, 0], [28, 0], [28,37], + [ 5,37], [ 5,19], [ 0,19] }, + { [ 1, 1], [26, 1], [26,36], + [ 7,36], [ 7,18], [ 1,18] } + }; + shape "CAPS" { { [ 32,18] }, { [2,1], [30,17] } }; + shape "LFSH" { { [ 41,18] }, { [2,1], [39,17] } }; + shape "RTSH" { { [ 33,18] }, { [2,1], [31,17] } }; + shape "LCTL" { { [ 32,18] }, { [2,1], [30,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [26,17] } }; + shape "SPCE" { { [170,18] }, { [2,1], [168,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [16,36] } }; + shape "HELP" { { [ 37,18] }, { [2,1], [35,17] } }; + + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + section.left= 17; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + + section "Alpha" { + top= 58; + row { + top= 1; + keys { , , + { , 9 }, , , , + , , , , + , , , , + , { , "DELE" }, + { , 9 }, , , + }; + }; + row { + top= 20; + keys { , , { , 9 }, + , , , , , + , , , , , + , , + { , "BKSP" }, + { , 9 }, , , + + }; + }; + row { + top= 39; + keys { , , + { , 9, shape="TABK" }, + , , , , , + , , , , , + , , { , "RTRN" }, + { , 9 }, , , { , "KPAD" } + }; + }; + row { + top= 58; + keys { , , + { , 9, shape="LCTL" }, + , , , , , + , , , , , + , , + { , 33 }, , + }; + }; + row { + top= 77; + keys { , , + { , 9 , shape="LFSH" }, + , , , , , + , , , , , + { , "RTSH" }, , + { , 9} , , , { , "KPAD" } + }; + }; + row { + top= 96; + keys { { , "HELP" }, { , 9 }, + , , { , "SPCE" }, + , , , + { , 9, shape="KP0" }, + }; + }; + }; // End of "Alpha" section + + shape "LEDS" { cornerRadius= 0, { [ 78 ,21 ] } }; + shape "LED" { cornerRadius= 0, { [ 7, 4 ] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 28; + left= 358; + }; + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 43; + indicator.shape= "LED"; + indicator "CapsLock" { left= 364; }; + indicator "Compose" { left= 383; }; + indicator "ScrollLock" { left= 402; }; + indicator "NumLock" { left= 421; }; + text.top= 34; + text.color= "black"; + text "CapsLockLabel" { left= 364; text="Caps\nLock"; }; + text "ComposeLabel" { left= 380; text="Compose"; }; + text "ScrollLockLabel" { left= 402; text="Scroll\nLock"; }; + text "NumLockLabel" { left= 421; text="Num\nLock"; }; +}; + +xkb_geometry "type4tuv" { + + // This is an approximate layout for a (US/ASCII) Sun Type4 TUV + // (European) keyboard with an extra key between the Shift_L + // and the Z keys, and two keys above the Bksp key, instead + // of a large delete key. + + description= "Sun Type4tuv keyboard"; + + width= 452; + height= 185; + + shape "EDGE" { cornerRadius= 2, { [ 452, 185 ] } }; + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [16,17] } }; + shape "BKSP" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "TABK" { { [ 27,18] }, { [2,1], [25,17] } }; + + shape "RTRN" { + approx = { [ 0, 0], [28,37] }, + { [ 0, 0], [28, 0], [28,37], + [ 5,37], [ 5,19], [ 0,19] }, + { [ 1, 1], [26, 1], [26,36], + [ 7,36], [ 7,18], [ 1,18] } + }; + shape "CAPS" { { [ 32,18] }, { [2,1], [30,17] } }; + shape "RTSH" { { [ 33,18] }, { [2,1], [31,17] } }; + shape "LCTL" { { [ 32,18] }, { [2,1], [30,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [26,17] } }; + shape "SPCE" { { [170,18] }, { [2,1], [168,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [16,36] } }; + shape "HELP" { { [ 37,18] }, { [2,1], [35,17] } }; + + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + section.left= 17; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + + section "Alpha" { + top= 58; + row { + top= 1; + keys { , , + { , 9 }, , , , + , , , , + , , , , + , ,, + { , 9 }, , , + }; + }; + row { + top= 20; + keys { , , { , 9 }, + , , , , , + , , , , , + , , + { , "BKSP" }, + { , 9 }, , , + + }; + }; + row { + top= 39; + keys { , , + { , 9, shape="TABK" }, + , , , , , + , , , , , + , , { , "RTRN" }, + { , 9 }, , , { , "KPAD" } + }; + }; + row { + top= 58; + keys { , , + { , 9, shape="LCTL" }, + , , , , , + , , , , , + , , + { , 33 }, , + }; + }; + row { + top= 77; + keys { , , + { , 9 }, , + , , , , , + , , , , , + { , "RTSH" }, , + { , 9} , , , { , "KPAD" } + }; + }; + row { + top= 96; + keys { { , "HELP" }, { , 9 }, + , , { , "SPCE" }, + , , , + { , 9, shape="KP0" }, + }; + }; + }; // End of "Alpha" section + + shape "LEDS" { cornerRadius= 0, { [ 78 ,21 ] } }; + shape "LED" { cornerRadius= 0, { [ 7, 4 ] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 28; + left= 358; + }; + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 43; + indicator.shape= "LED"; + indicator "CapsLock" { left= 364; }; + indicator "Compose" { left= 383; }; + indicator "ScrollLock" { left= 402; }; + indicator "NumLock" { left= 421; }; + text.top= 34; + text.color= "black"; + text "CapsLockLabel" { left= 364; text="Caps\nLock"; }; + text "ComposeLabel" { left= 380; text="Compose"; }; + text "ScrollLockLabel" { left= 402; text="Scroll\nLock"; }; + text "NumLockLabel" { left= 421; text="Num\nLock"; }; +}; + +xkb_geometry "type4_ca" { + + // This is an approximate layout for a (US/ASCII) Sun Type4 + // Canadian and British keyboard with an extra key between + // the Shift_L + // and the Z keys. + + description= "Sun Type4_uk keyboard"; + + width= 452; + height= 185; + + shape "EDGE" { cornerRadius= 2, { [ 452, 185 ] } }; + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [16,17] } }; + shape "BKSP" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "TABK" { { [ 27,18] }, { [2,1], [25,17] } }; + shape "DELE" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "RTRN" { + approx = { [ 0, 0], [28,37] }, + { [ 0, 0], [28, 0], [28,37], + [ 5,37], [ 5,19], [ 0,19] }, + { [ 1, 1], [26, 1], [26,36], + [ 7,36], [ 7,18], [ 1,18] } + }; + shape "CAPS" { { [ 32,18] }, { [2,1], [30,17] } }; + shape "RTSH" { { [ 33,18] }, { [2,1], [31,17] } }; + shape "LCTL" { { [ 32,18] }, { [2,1], [30,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [26,17] } }; + shape "SPCE" { { [170,18] }, { [2,1], [168,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [16,36] } }; + shape "HELP" { { [ 37,18] }, { [2,1], [35,17] } }; + + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + section.left= 17; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + + section "Alpha" { + top= 58; + row { + top= 1; + keys { , , + { , 9 }, , , , + , , , , + , , , , + , { , "DELE" }, + { , 9 }, , , + }; + }; + row { + top= 20; + keys { , , { , 9 }, + , , , , , + , , , , , + , , + { , "BKSP" }, + { , 9 }, , , + + }; + }; + row { + top= 39; + keys { , , + { , 9, shape="TABK" }, + , , , , , + , , , , , + , , { , "RTRN" }, + { , 9 }, , , { , "KPAD" } + }; + }; + row { + top= 58; + keys { , , + { , 9, shape="LCTL" }, + , , , , , + , , , , , + , , + { , 33 }, , + }; + }; + row { + top= 77; + keys { , , + { , 9 }, , + , , , , , + , , , , , + { , "RTSH" }, , + { , 9} , , , { , "KPAD" } + }; + }; + row { + top= 96; + keys { { , "HELP" }, { , 9 }, + , , { , "SPCE" }, + , , , + { , 9, shape="KP0" }, + }; + }; + }; // End of "Alpha" section + + shape "LEDS" { cornerRadius= 0, { [ 78 ,21 ] } }; + shape "LED" { cornerRadius= 0, { [ 7, 4 ] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 28; + left= 358; + }; + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 43; + indicator.shape= "LED"; + indicator "CapsLock" { left= 364; }; + indicator "Compose" { left= 383; }; + indicator "ScrollLock" { left= 402; }; + indicator "NumLock" { left= 421; }; + text.top= 34; + text.color= "black"; + text "CapsLockLabel" { left= 364; text="Caps\nLock"; }; + text "ComposeLabel" { left= 380; text="Compose"; }; + text "ScrollLockLabel" { left= 402; text="Scroll\nLock"; } +; + text "NumLockLabel" { left= 421; text="Num\nLock"; }; +}; + +xkb_geometry "type4jp" { + + // This is an approximate layout for a Japanese Sun Type4 + // keyboard, based on the European TUV keyboard. It has two keys + // above the Bksp key, instead of a large delete key, but lacks + // the extra key between Shift_L and Z. + + description= "Sun Japanese Type4 keyboard"; + + width= 452; + height= 185; + + shape "EDGE" { cornerRadius= 2, { [ 452, 185 ] } }; + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [16,17] } }; + shape "BKSP" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "TABK" { { [ 27,18] }, { [2,1], [25,17] } }; + + shape "RTRN" { + approx = { [ 0, 0], [28,37] }, + { [ 0, 0], [28, 0], [28,37], + [ 5,37], [ 5,19], [ 0,19] }, + { [ 1, 1], [26, 1], [26,36], + [ 7,36], [ 7,18], [ 1,18] } + }; + shape "CAPS" { { [ 32,18] }, { [2,1], [30,17] } }; + shape "RTSH" { { [ 33,18] }, { [2,1], [31,17] } }; + shape "LCTL" { { [ 32,18] }, { [2,1], [30,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [26,17] } }; + shape "SPCE" { { [ 97,18] }, { [2,1], [95,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [16,36] } }; + shape "HELP" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "LFSH" { { [ 41,18] }, { [2,1], [39,17] } }; + shape "KANJ" { { [ 27,18] }, { [2,1], [25,17] } }; + shape "EXEC" { { [ 27,18] }, { [2,1], [25,17] } }; + + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + section.left= 17; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + + section "Alpha" { + top= 58; + row { + top= 1; + keys { , , + { , 9 }, , , , + , , , , + , , , , + , ,, + { , 9 }, , , + }; + }; + row { + top= 20; + keys { , , { , 9 }, + , , , , , + , , , , , + , , + { , "BKSP" }, + { , 9 }, , , + + }; + }; + row { + top= 39; + keys { , , + { , 9, shape="TABK" }, + , , , , , + , , , , , + , , { , "RTRN" }, + { , 9 }, , , { , "KPAD" } + }; + }; + row { + top= 58; + keys { , , + { , 9, shape="LCTL" }, + , , , , , + , , , , , + , , + { , 33 }, , + }; + }; + row { + top= 77; + keys { , , + { , 9, shape="LFSH" }, + , , , , , + , , , , , + , { , "RTSH" }, + { , 9} , , , { , "KPAD" } + }; + }; + row { + top= 96; + keys { { , "HELP" }, { , 9 }, + , , { , "EXEC"} , { , "SPCE" }, + { , "KANJ" }, , , , , + { , 9, shape="KP0" }, + }; + }; + }; // End of "Alpha" section + + shape "LEDS" { cornerRadius= 0, { [ 78 ,21 ] } }; + shape "LED" { cornerRadius= 0, { [ 7, 4 ] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 28; + left= 358; + }; + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 43; + indicator.shape= "LED"; + indicator "CapsLock" { left= 364; }; + indicator "Compose" { left= 383; }; + indicator "ScrollLock" { left= 402; }; + indicator "NumLock" { left= 421; }; + text.top= 34; + text.color= "black"; + text "CapsLockLabel" { left= 364; text="Caps\nLock"; }; + text "ComposeLabel" { left= 380; text="Compose"; }; + text "ScrollLockLabel" { left= 402; text="Scroll\nLock"; }; + text "NumLockLabel" { left= 421; text="Num\nLock"; }; +}; + +xkb_geometry "t5" { + + // This is an approximate layout for a (US/ASCII) Sun Type5 + // keyboard. I just took a similar layout (101 key PC keyboard) + // and adjusted the sizes. + + width= 515; + height= 170; + + shape "EDGE" { cornerRadius= 2, { [ 515, 170 ] } }; + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [16,17] } }; + shape "BKSP" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "TABK" { { [ 27,18] }, { [2,1], [25,17] } }; + shape "BKSL" { { [ 27,18] }, { [2,1], [25,17] } }; + shape "RTRN" { { [ 42,18] }, { [2,1], [40,17] } }; + shape "CAPS" { { [ 32,18] }, { [2,1], [30,17] } }; + shape "LFSH" { { [ 42,18] }, { [2,1], [40,17] } }; + shape "RTSH" { { [ 51,18] }, { [2,1], [49,17] } }; + shape "LCTL" { { [ 32,18] }, { [2,1], [30,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [26,17] } }; + shape "SPCE" { { [156,18] }, { [2,1], [154,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [16,36] } }; + shape "HELP" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "LOGO" { { [ 16,16] } }; + + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + section.left= 14; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 24; + row { + top= 1; + keys { { , "HELP" }, { , 9 }, + { , 19 }, , , , + { , 11 }, , , , + { , 11 }, , , , + { , 9 }, , , + { , 9 }, , , + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 61; + row { + top= 1; + keys { , , + { , 9}, , , , , + , , , , , + , , , + { , "BKSP", color="grey20" } + }; + }; + row { + top= 20; + keys { , , { , 9, shape="TABK" }, + , , , , , + , , , , , + , , + { , "BKSL" } + }; + }; + row { + top= 39; + keys { , , { , 9, shape="CAPS" }, + , , , , , + , , , , , + , + { , "RTRN" } + }; + }; + row { + top= 58; + keys { , , { , 9 , shape="LFSH" }, + , , , , , + , , , , , + { , "RTSH", color="grey20" } + }; + }; + row { + top= 77; + keys { , , { , 9, shape="LCTL" }, + , , + { , "SPCE" }, + , , + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 61; + left= 352; + row { + top= 1; + keys { , , }; + }; + row { + top= 20; + keys { , , }; + }; + row { + top= 58; + left= 20; + keys { }; + }; + row { + top= 77; + keys { , , }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 61; + left= 420; + row { + top= 1; + keys { , , , }; + }; + row { + top= 20; + keys { , , , { , "KPAD", color= "grey20" } }; + }; + row { + top= 39; + keys { , , }; + }; + row { + top= 58; + keys { , , , { , "KPAD", color= "grey20" } }; + }; + row { + top= 77; + keys { { , "KP0" }, }; + }; + }; // End of "Keypad" section +}; + +xkb_geometry "t5tuv" { + + // This is an approximate layout for a (US/ASCII) Sun Type5 + // keyboard. I just took a similar layout (101 key PC keyboard) + // and adjusted the sizes. + + width= 515; + height= 170; + + shape "EDGE" { cornerRadius= 2, { [ 515, 170 ] } }; + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [16,17] } }; + shape "BKSP" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "TABK" { { [ 27,18] }, { [2,1], [25,17] } }; + shape "RTRN" { + approx = { [ 0, 0], [28,37] }, + { [ 0, 0], [28, 0], [28,37], + [ 5,37], [ 5,18], [ 0,18] }, + { [ 1, 1], [26, 1], [26,36], + [ 7,36], [ 7,17], [ 1,17] } + }; + shape "CAPS" { { [ 32,18] }, { [2,1], [30,17] } }; + shape "LFSH" { { [ 24,18] }, { [2,1], [22,17] } }; + shape "RTSH" { { [ 51,18] }, { [2,1], [49,17] } }; + shape "LCTL" { { [ 32,18] }, { [2,1], [30,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [26,17] } }; + shape "SPCE" { { [157,18] }, { [2,1], [155,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [16,36] } }; + shape "HELP" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "LOGO" { { [ 16,16] } }; + + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + section.left= 14; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 24; + row { + top= 1; + keys { { , "HELP" }, { , 9 }, + { , 19 }, , , , + { , 11 }, , , , + { , 11 }, , , , + { , 9 }, , , + { , 9 }, , , + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 61; + row { + top= 1; + keys { , , + { , 9}, , , , , + , , , , , + , , , + { , "BKSP", color="grey20" } + }; + }; + row { + top= 20; + keys { , , { , 9, shape="TABK" }, + , , , , , + , , , , , + , , + { , "RTRN" } + }; + }; + row { + top= 39; + keys { , , { , 9, shape="CAPS" }, + , , , , , + , , , , , + , + }; + }; + row { + top= 58; + keys { , , { , 9 , shape="LFSH" }, , + , , , , , + , , , , , + { , "RTSH", color="grey20" } + }; + }; + row { + top= 77; + keys { , , { , 9, shape="LCTL" }, + , , + { , "SPCE" }, + , , + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 61; + left= 352; + row { + top= 1; + keys { , , }; + }; + row { + top= 20; + keys { , , }; + }; + row { + top= 58; + left= 20; + keys { }; + }; + row { + top= 77; + keys { , , }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 61; + left= 420; + row { + top= 1; + keys { , , , }; + }; + row { + top= 20; + keys { , , , { , "KPAD", color= "grey20" } }; + }; + row { + top= 39; + keys { , , }; + }; + row { + top= 58; + keys { , , , { , "KPAD", color= "grey20" } }; + }; + row { + top= 77; + keys { { , "KP0" }, }; + }; + }; // End of "Keypad" section +}; + +xkb_geometry "t5jp" { + + // This is an approximate layout for a (US/ASCII) Sun Type5 + // keyboard. I just took a similar layout (101 key PC keyboard) + // and adjusted the sizes. + + width= 515; + height= 170; + + shape "EDGE" { cornerRadius= 2, { [ 515, 170 ] } }; + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [16,17] } }; + shape "BKSP" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "TABK" { { [ 27,18] }, { [2,1], [25,17] } }; + shape "KANJ" { { [ 27,18] }, { [2,1], [25,17] } }; + shape "EXEC" { { [ 27,18] }, { [2,1], [25,17] } }; + shape "RTRN" { + approx = { [ 0, 0], [28,37] }, + { [ 0, 0], [28, 0], [28,37], + [ 5,37], [ 5,18], [ 0,18] }, + { [ 1, 1], [26, 1], [26,36], + [ 7,36], [ 7,17], [ 1,17] } + }; + shape "CAPS" { { [ 32,18] }, { [2,1], [30,17] } }; + shape "LFSH" { { [ 42,18] }, { [2,1], [40,17] } }; + shape "RTSH" { { [ 33,18] }, { [2,1], [31,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [26,17] } }; + shape "SPCE" { { [ 97,18] }, { [2,1], [95,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [16,36] } }; + shape "HELP" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "LOGO" { { [ 16,16] } }; + + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + section.left= 14; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 24; + row { + top= 1; + keys { { , "HELP" }, { , 9 }, + { , 19 }, , , , + { , 11 }, , , , + { , 11 }, , , , + { , 9 }, , , + { , 9 }, , , + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 61; + row { + top= 1; + keys { , , + { , 9}, , , , , + , , , , , + , , , + { , "BKSP", color="grey20" } + }; + }; + row { + top= 20; + keys { , , { , 9, shape="TABK" }, + , , , , , + , , , , , + , , + { , "RTRN" } + }; + }; + row { + top= 39; + keys { , , { , 9, shape="CAPS" }, + , , , , , + , , , , , + , + }; + }; + row { + top= 58; + keys { , , { , 9 , shape="LFSH" }, + , , , , , + , , , , , , + { , "RTSH", color="grey20" } + }; + }; + row { + top= 77; + keys { , , { , 9 }, + , , { , "EXEC" }, + { , "SPCE" }, { , "KANJ" }, , + , , + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 61; + left= 352; + row { + top= 1; + keys { , , }; + }; + row { + top= 20; + keys { , , }; + }; + row { + top= 58; + left= 20; + keys { }; + }; + row { + top= 77; + keys { , , }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 61; + left= 420; + row { + top= 1; + keys { , , , }; + }; + row { + top= 20; + keys { , , , { , "KPAD", color= "grey20" } }; + }; + row { + top= 39; + keys { , , }; + }; + row { + top= 58; + keys { , , , { , "KPAD", color= "grey20" } }; + }; + row { + top= 77; + keys { { , "KP0" }, }; + }; + }; // End of "Keypad" section +}; + +xkb_geometry "t5unix" { + + // This is an approximate layout for a (US/ASCII) Sun Type5 + // keyboard. I just took a similar layout (101 key PC keyboard) + // and adjusted the sizes. + + width= 515; + height= 170; + + shape "EDGE" { cornerRadius= 2, { [ 515, 170 ] } }; + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [16,17] } }; + shape "BKSP" { { [ 27,18] }, { [2,1], [25,17] } }; + shape "TABK" { { [ 27,18] }, { [2,1], [25,17] } }; + shape "BKSL" { { [ 27,18] }, { [2,1], [25,17] } }; + shape "RTRN" { { [ 42,18] }, { [2,1], [40,17] } }; + shape "CAPS" { { [ 32,18] }, { [2,1], [30,17] } }; + shape "LFSH" { { [ 42,18] }, { [2,1], [40,17] } }; + shape "RTSH" { { [ 51,18] }, { [2,1], [49,17] } }; + shape "LCTL" { { [ 32,18] }, { [2,1], [30,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [26,17] } }; + shape "SPCE" { { [157,18] }, { [2,1], [155,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [16,36] } }; + shape "HELP" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "LOGO" { { [ 16,16] } }; + + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + section.left= 14; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 24; + row { + top= 1; + keys { { , "HELP" }, { , 9 }, + { , 19 }, , , , + { , 11 }, , , , + { , 11 }, , , , + { , 9 }, , , + { , 9 }, , , + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 61; + row { + top= 1; + keys { , , + { , 9}, , , , , + , , , , , + , , , + , + }; + }; + row { + top= 20; + keys { , , { , 9, shape="TABK" }, + , , , , , + , , , , , + , , + { , "BKSP" } + }; + }; + row { + top= 39; + keys { , , { , 9, shape="LCTL" }, + , , , , , + , , , , , + , + { , "RTRN" } + }; + }; + row { + top= 58; + keys { , , { , 9 , shape="LFSH" }, + , , , , , + , , , , , + { , "RTSH", color="grey20" } + }; + }; + row { + top= 77; + keys { , , { , 9, shape="CAPS" }, + , , + { , "SPCE" }, + , , + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 61; + left= 352; + row { + top= 1; + keys { , , }; + }; + row { + top= 20; + keys { , , }; + }; + row { + top= 58; + left= 20; + keys { }; + }; + row { + top= 77; + keys { , , }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 61; + left= 420; + row { + top= 1; + keys { , , , }; + }; + row { + top= 20; + keys { , , , { , "KPAD", color= "grey20" } }; + }; + row { + top= 39; + keys { , , }; + }; + row { + top= 58; + keys { , , , { , "KPAD", color= "grey20" } }; + }; + row { + top= 77; + keys { { , "KP0" }, }; + }; + }; // End of "Keypad" section +}; + +xkb_geometry "t5hobo" { + + // This is an approximate layout for a (US/ASCII) Sun Type5 + // keyboard. I just took a similar layout (101 key PC keyboard) + // and adjusted the sizes. + // + // I modified this to look like the hobo keyboard. + + width= 425; + height= 170; + + shape "EDGE" { cornerRadius= 2, { [ 425, 170 ] } }; + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [16,17] } }; + shape "FKEY" { { [ 15,18] }, { [0.5,0.5], [14.5, 17.5] } }; + shape "BKSP" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "TABK" { { [ 27,18] }, { [2,1], [25,17] } }; + shape "BKSL" { { [ 28,18] }, { [2,1], [26,17] } }; + shape "RTRN" { { [ 42,18] }, { [2,1], [40,17] } }; + shape "CAPS" { { [ 32,18] }, { [2,1], [30,17] } }; + shape "LFSH" { { [ 42,18] }, { [2,1], [40,17] } }; + shape "RTSH" { { [ 32,18] }, { [2,1], [30,17] } }; + shape "LCTL" { { [ 32,18] }, { [2,1], [30,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [26,17] } }; + shape "SPCE" { { [156,18] }, { [2,1], [154,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [16,36] } }; + shape "HELP" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "LOGO" { { [ 16,16] } }; + + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + section.left= 14; + row.left= 1; + key.shape= "FKEY"; + key.gap= 1; + section "Function" { + top= 24; + row { + top= 1; + keys { { , "HELP" }, { , 9 }, + { , 4 }, , , , + { , 4 }, , , , + { , 4 }, , , , + { , 4 }, , , , + { , 9, "NORM" }, {, "NORM"}, {, "NORM"} + }; + }; + }; // End of "Function" section + + key.shape= "NORM"; + section "Alpha" { + top= 61; + row { + top= 1; + keys { , , + { , 9}, , , , , + , , , , , + , , , + { , "BKSP", color="grey20" } + }; + }; + row { + top= 20; + keys { , , { , 9, shape="TABK" }, + , , , , , + , , , , , + , , + { , "BKSL" } + }; + }; + row { + top= 39; + keys { , , { , 9, shape="CAPS" }, + , , , , , + , , , , , + , + { , "RTRN" } + }; + }; + row { + top= 58; + keys { , , { , 9 , shape="LFSH" }, + , , , , , + , , , , , + { , "RTSH", color="grey20" }, + }; + }; + row { + top= 77; + keys { , , { , 9, shape="LCTL" }, + , , + { , "SPCE" }, + , , + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 61; + left= 352; + row { + top= 1; + keys { , , }; + }; + row { + top= 20; + keys { , , }; + }; + row { + + top= 58; + left= 20; + keys { }; + }; + row { + top= 77; + keys { , , }; + }; + }; // End of "Editing" section +}; + +xkb_geometry "t5tuvhobo" { + + // This is an approximate layout for a (US/ASCII) Sun Type5 + // keyboard. I just took a similar layout (101 key PC keyboard) + // and adjusted the sizes. + // + // I modified this to look like the hobo keyboard. + + width= 425; + height= 170; + + shape "EDGE" { cornerRadius= 2, { [ 425, 170 ] } }; + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [16,17] } }; + shape "FKEY" { { [ 15,18] }, { [0.5,0.5], [14.5, 17.5] } }; + shape "BKSP" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "TABK" { { [ 27,18] }, { [2,1], [25,17] } }; + shape "BKSL" { { [ 28,18] }, { [2,1], [26,17] } }; + shape "RTRN" { { [ 42,18] }, { [2,1], [40,17] } }; + shape "CAPS" { { [ 32,18] }, { [2,1], [30,17] } }; + shape "LFSH" { { [ 24,18] }, { [2,1], [22,17] } }; + shape "RTSH" { { [ 32,18] }, { [2,1], [30,17] } }; + shape "LCTL" { { [ 32,18] }, { [2,1], [30,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [26,17] } }; + shape "SPCE" { { [156,18] }, { [2,1], [154,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [16,36] } }; + shape "HELP" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "LOGO" { { [ 16,16] } }; + + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + section.left= 14; + row.left= 1; + key.shape= "FKEY"; + key.gap= 1; + section "Function" { + top= 24; + row { + top= 1; + keys { { , "HELP" }, { , 9 }, + { , 4 }, , , , + { , 4 }, , , , + { , 4 }, , , , + { , 4 }, , , , + { , 9, "NORM" }, {, "NORM"}, {, "NORM"} + }; + }; + }; // End of "Function" section + + key.shape= "NORM"; + section "Alpha" { + top= 61; + row { + top= 1; + keys { , , + { , 9}, , , , , + , , , , , + , , , + { , "BKSP", color="grey20" } + }; + }; + row { + top= 20; + keys { , , { , 9, shape="TABK" }, + , , , , , + , , , , , + , , + { , "BKSL" } + }; + }; + row { + top= 39; + keys { , , { , 9, shape="CAPS" }, + , , , , , + , , , , , + , + { , "RTRN" } + }; + }; + row { + top= 58; + keys { , , { , 9 , shape="LFSH" }, , + , , , , , + , , , , , + { , "RTSH", color="grey20" }, + }; + }; + row { + top= 77; + keys { , , { , 9, shape="LCTL" }, + , , + { , "SPCE" }, + , , + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 61; + left= 352; + row { + top= 1; + keys { , , }; + }; + row { + top= 20; + keys { , , }; + }; + row { + + top= 58; + left= 20; + keys { }; + }; + row { + top= 77; + keys { , , }; + }; + }; // End of "Editing" section +}; + +xkb_geometry "t5jphobo" { + + // This is an approximate layout for a (US/ASCII) Sun Type5 + // keyboard. I just took a similar layout (101 key PC keyboard) + // and adjusted the sizes. + + width= 425; + height= 170; + + shape "EDGE" { cornerRadius= 2, { [ 425, 170 ] } }; + shape.cornerRadius= 1; + shape "FKEY" { { [ 15,18] }, { [0.5,0.5], [14.5, 17.5] } }; + shape "NORM" { { [ 18,18] }, { [2,1], [16,17] } }; + shape "BKSP" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "TABK" { { [ 27,18] }, { [2,1], [25,17] } }; + shape "KANJ" { { [ 27,18] }, { [2,1], [25,17] } }; + shape "EXEC" { { [ 27,18] }, { [2,1], [25,17] } }; + shape "RTRN" { + approx = { [ 0, 0], [28,37] }, + { [ 0, 0], [28, 0], [28,37], + [ 5,37], [ 5,18], [ 0,18] }, + { [ 1, 1], [26, 1], [26,36], + [ 7,36], [ 7,17], [ 1,17] } + }; + shape "CAPS" { { [ 32,18] }, { [2,1], [30,17] } }; + shape "LFSH" { { [ 42,18] }, { [2,1], [40,17] } }; + shape "RTSH" { { [ 33,18] }, { [2,1], [31,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [26,17] } }; + shape "SPCE" { { [ 97,18] }, { [2,1], [95,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [16,36] } }; + shape "HELP" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "LOGO" { { [ 16,16] } }; + + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + section.left= 14; + row.left= 1; + key.shape= "FKEY"; + key.gap= 1; + section "Function" { + top= 24; + row { + top= 1; + keys { { , "HELP" }, { , 9 }, + { , 4 }, , , , + { , 4 }, , , , + { , 4 }, , , , + { , 4 }, , , , + { , 9, "NORM" }, {, "NORM"}, {, "NORM"} + }; + }; + }; // End of "Function" section + + key.shape= "NORM"; + section "Alpha" { + top= 61; + row { + top= 1; + keys { , , + { , 9}, , , , , + , , , , , + , , , + { , "BKSP", color="grey20" } + }; + }; + row { + top= 20; + keys { , , { , 9, shape="TABK" }, + , , , , , + , , , , , + , , + { , "RTRN" } + }; + }; + row { + top= 39; + keys { , , { , 9, shape="CAPS" }, + , , , , , + , , , , , + , + }; + }; + row { + top= 58; + keys { , , { , 9 , shape="LFSH" }, + , , , , , + , , , , , , + { , "RTSH", color="grey20" } + }; + }; + row { + top= 77; + keys { , , { , 9 }, + , , { , "EXEC" }, + { , "SPCE" }, { , "KANJ" }, , + , , + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 61; + left= 352; + row { + top= 1; + keys { , , }; + }; + row { + top= 20; + keys { , , }; + }; + row { + top= 58; + left= 20; + keys { }; + }; + row { + top= 77; + keys { , , }; + }; + }; // End of "Editing" section +}; + +xkb_geometry "t6" { + + // This is an approximate layout for a (US/ASCII) Sun Type6 + // keyboard. I just took a similar layout (101 key PC keyboard) + // and adjusted the sizes. + + width= 515; + height= 170; + + shape "EDGE" { cornerRadius= 2, { [ 515, 170 ] } }; + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [16,17] } }; + shape "BKSP" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "TABK" { { [ 27,18] }, { [2,1], [25,17] } }; + shape "BKSL" { { [ 27,18] }, { [2,1], [25,17] } }; + shape "RTRN" { { [ 42,18] }, { [2,1], [40,17] } }; + shape "CAPS" { { [ 32,18] }, { [2,1], [30,17] } }; + shape "LFSH" { { [ 42,18] }, { [2,1], [40,17] } }; + shape "RTSH" { { [ 51,18] }, { [2,1], [49,17] } }; + shape "LCTL" { { [ 32,18] }, { [2,1], [30,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [26,17] } }; + shape "SPCE" { { [136,18] }, { [2,1], [134,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [16,36] } }; + shape "HELP" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "RMTA" { { [ 28,18] }, { [2,1], [26,17] } }; + shape "LMTA" { { [ 28,18] }, { [2,1], [26,17] } }; + shape "LOGO" { { [ 16,16] } }; + + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + section.left= 14; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 24; + row { + top= 1; + keys { { , "HELP" }, { , 9 }, + { , 19 }, , , , + { , 11 }, , , , + { , 11 }, , , , + { , 9 }, , , + { , 9 }, , , + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 61; + row { + top= 1; + keys { , , + { , 9}, , , , , + , , , , , + , , , + { , "BKSP", color="grey20" } + }; + }; + row { + top= 20; + keys { , , { , 9, shape="TABK" }, + , , , , , + , , , , , + , , + { , "BKSL" } + }; + }; + row { + top= 39; + keys { , , { , 9, shape="CAPS" }, + , , , , , + , , , , , + , + { , "RTRN" } + }; + }; + row { + top= 58; + keys { , , { , 9 , shape="LFSH" }, + , , , , , + , , , , , + { , "RTSH", color="grey20" } + }; + }; + row { + top= 77; + keys { , , { , 9, shape="LCTL" }, + , { , "LMTA" }, + { , "SPCE" }, + { , "RMTA" }, , + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 61; + left= 352; + row { + top= 1; + keys { , , }; + }; + row { + top= 20; + keys { , , }; + }; + row { + top= 58; + left= 20; + keys { }; + }; + row { + top= 77; + keys { , , }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 61; + left= 420; + row { + top= 1; + keys { , , , }; + }; + row { + top= 20; + keys { , , , { , "KPAD", color= "grey20" } }; + }; + row { + top= 39; + keys { , , }; + }; + row { + top= 58; + keys { , , , { , "KPAD", color= "grey20" } }; + }; + row { + top= 77; + keys { { , "KP0" }, }; + }; + }; // End of "Keypad" section + + shape "LEDS" { cornerRadius= 0, { [ 78 ,21 ] } }; + shape "LED" { cornerRadius= 2, { [ 3, 6 ] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 1; + left= 218; + }; + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 10; + indicator.shape= "LED"; + indicator "CapsLock" { left= 243; }; + indicator "Compose" { left= 281; }; + indicator "ScrollLock" { left= 262; }; + indicator "NumLock" { left= 224; }; + text.top= 1; + text.color= "black"; + text "CapsLockLabel" { left= 243; text="Caps\nLock"; }; + text "ComposeLabel" { left= 281; text="Compose"; }; + text "ScrollLockLabel" { left= 262; text="Scroll\nLock"; }; + text "NumLockLabel" { left= 224; text="Num\nLock"; }; + + +}; + +xkb_geometry "t6tuv" { + + // This is an approximate layout for a (US/ASCII) Sun Type6 + // keyboard. I just took a similar layout (101 key PC keyboard) + // and adjusted the sizes. + + width= 515; + height= 170; + + shape "EDGE" { cornerRadius= 2, { [ 515, 170 ] } }; + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [16,17] } }; + shape "BKSP" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "TABK" { { [ 27,18] }, { [2,1], [25,17] } }; + shape "RTRN" { + approx = { [ 0, 0], [28,37] }, + { [ 0, 0], [28, 0], [28,37], + [ 5,37], [ 5,18], [ 0,18] }, + { [ 1, 1], [26, 1], [26,36], + [ 7,36], [ 7,17], [ 1,17] } + }; + shape "CAPS" { { [ 32,18] }, { [2,1], [30,17] } }; + shape "LFSH" { { [ 24,18] }, { [2,1], [22,17] } }; + shape "RTSH" { { [ 51,18] }, { [2,1], [49,17] } }; + shape "LCTL" { { [ 32,18] }, { [2,1], [30,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [26,17] } }; + shape "SPCE" { { [137,18] }, { [2,1], [135,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [16,36] } }; + shape "RMTA" { { [ 28,18] }, { [2,1], [26,17] } }; + shape "LMTA" { { [ 28,18] }, { [2,1], [26,17] } }; + shape "HELP" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "LOGO" { { [ 16,16] } }; + + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + section.left= 14; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 24; + row { + top= 1; + keys { { , "HELP" }, { , 9 }, + { , 19 }, , , , + { , 11 }, , , , + { , 11 }, , , , + { , 9 }, , , + { , 9 }, , , + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 61; + row { + top= 1; + keys { , , + { , 9}, , , , , + , , , , , + , , , + { , "BKSP", color="grey20" } + }; + }; + row { + top= 20; + keys { , , { , 9, shape="TABK" }, + , , , , , + , , , , , + , , + { , "RTRN" } + }; + }; + row { + top= 39; + keys { , , { , 9, shape="CAPS" }, + , , , , , + , , , , , + , + }; + }; + row { + top= 58; + keys { , , { , 9 , shape="LFSH" }, , + , , , , , + , , , , , + { , "RTSH", color="grey20" } + }; + }; + row { + top= 77; + keys { , , { , 9, shape="LCTL" }, + , { , "LMTA" }, + { , "SPCE" }, + { , "RMTA" }, , + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 61; + left= 352; + row { + top= 1; + keys { , , }; + }; + row { + top= 20; + keys { , , }; + }; + row { + top= 58; + left= 20; + keys { }; + }; + row { + top= 77; + keys { , , }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 61; + left= 420; + row { + top= 1; + keys { , , , }; + }; + row { + top= 20; + keys { , , , { , "KPAD", color= "grey20" } }; + }; + row { + top= 39; + keys { , , }; + }; + row { + top= 58; + keys { , , , { , "KPAD", color= "grey20" } }; + }; + row { + top= 77; + keys { { , "KP0" }, }; + }; + }; // End of "Keypad" section + + shape "LEDS" { cornerRadius= 0, { [ 78 ,21 ] } }; + shape "LED" { cornerRadius= 2, { [ 3, 6 ] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 1; + left= 218; + }; + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 10; + indicator.shape= "LED"; + indicator "CapsLock" { left= 243; }; + indicator "Compose" { left= 281; }; + indicator "ScrollLock" { left= 262; }; + indicator "NumLock" { left= 224; }; + text.top= 1; + text.color= "black"; + text "CapsLockLabel" { left= 243; text="Caps\nLock"; }; + text "ComposeLabel" { left= 281; text="Compose"; }; + text "ScrollLockLabel" { left= 262; text="Scroll\nLock"; }; + text "NumLockLabel" { left= 224; text="Num\nLock"; }; + +}; + +xkb_geometry "t6jp" { + + // This is an approximate layout for a (US/ASCII) Sun Type6 + // keyboard. I just took a similar layout (101 key PC keyboard) + // and adjusted the sizes. + + width= 515; + height= 170; + + shape "EDGE" { cornerRadius= 2, { [ 515, 170 ] } }; + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [16,17] } }; + shape "BKSP" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "TABK" { { [ 27,18] }, { [2,1], [25,17] } }; + shape "KANJ" { { [ 27,18] }, { [2,1], [25,17] } }; + shape "EXEC" { { [ 27,18] }, { [2,1], [25,17] } }; + shape "RTRN" { + approx = { [ 0, 0], [28,37] }, + { [ 0, 0], [28, 0], [28,37], + [ 5,37], [ 5,18], [ 0,18] }, + { [ 1, 1], [26, 1], [26,36], + [ 7,36], [ 7,17], [ 1,17] } + }; + shape "CAPS" { { [ 32,18] }, { [2,1], [30,17] } }; + shape "LFSH" { { [ 42,18] }, { [2,1], [40,17] } }; + shape "RTSH" { { [ 33,18] }, { [2,1], [31,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [26,17] } }; + shape "SPCE" { { [ 96,18] }, { [2,1], [94,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [16,36] } }; + shape "HELP" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "LOGO" { { [ 16,16] } }; + + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + section.left= 14; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 24; + row { + top= 1; + keys { { , "HELP" }, { , 9 }, + { , 19 }, , , , + { , 11 }, , , , + { , 11 }, , , , + { , 9 }, , , + { , 9 }, , , + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 61; + row { + top= 1; + keys { , , + { , 9}, , , , , + , , , , , + , , , + { , "BKSP", color="grey20" } + }; + }; + row { + top= 20; + keys { , , { , 9, shape="TABK" }, + , , , , , + , , , , , + , , + { , "RTRN" } + }; + }; + row { + top= 39; + keys { , , { , 9, shape="CAPS" }, + , , , , , + , , , , , + , + }; + }; + row { + top= 58; + keys { , , { , 9 , shape="LFSH" }, + , , , , , + , , , , , , + { , "RTSH", color="grey20" } + }; + }; + row { + top= 77; + keys { , , { , 9 }, + , , { , "EXEC" }, + { , "SPCE" }, { , "KANJ" }, , + , , + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 61; + left= 352; + row { + top= 1; + keys { , , }; + }; + row { + top= 20; + keys { , , }; + }; + row { + top= 58; + left= 20; + keys { }; + }; + row { + top= 77; + keys { , , }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 61; + left= 420; + row { + top= 1; + keys { , , , }; + }; + row { + top= 20; + keys { , , , { , "KPAD", color= "grey20" } }; + }; + row { + top= 39; + keys { , , }; + }; + row { + top= 58; + keys { , , , { , "KPAD", color= "grey20" } }; + }; + row { + top= 77; + keys { { , "KP0" }, }; + }; + }; // End of "Keypad" section + + shape "LEDS" { cornerRadius= 0, { [ 78 ,21 ] } }; + shape "LED" { cornerRadius= 2, { [ 3, 6 ] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 1; + left= 218; + }; + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 10; + indicator.shape= "LED"; + indicator "CapsLock" { left= 243; }; + indicator "Compose" { left= 281; }; + indicator "ScrollLock" { left= 262; }; + indicator "NumLock" { left= 224; }; + text.top= 1; + text.color= "black"; + text "CapsLockLabel" { left= 243; text="Caps\nLock"; }; + text "ComposeLabel" { left= 281; text="Compose"; }; + text "ScrollLockLabel" { left= 262; text="Scroll\nLock"; }; + text "NumLockLabel" { left= 224; text="Num\nLock"; }; + +}; + +xkb_geometry "t6unix" { + + // This is an approximate layout for a (US/ASCII) Sun Type6 + // keyboard. I just took a similar layout (101 key PC keyboard) + // and adjusted the sizes. + + width= 515; + height= 170; + + shape "EDGE" { cornerRadius= 2, { [ 515, 170 ] } }; + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [16,17] } }; + shape "BKSP" { { [ 28,18] }, { [2,1], [26,17] } }; + shape "TABK" { { [ 27,18] }, { [2,1], [25,17] } }; + shape "RTRN" { { [ 42,18] }, { [2,1], [40,17] } }; + shape "CAPS" { { [ 32,18] }, { [2,1], [30,17] } }; + shape "LFSH" { { [ 42,18] }, { [2,1], [40,17] } }; + shape "RTSH" { { [ 51,18] }, { [2,1], [49,17] } }; + shape "LCTL" { { [ 32,18] }, { [2,1], [30,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [26,17] } }; + shape "SPCE" { { [136,18] }, { [2,1], [134,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [16,36] } }; + shape "HELP" { { [ 37,18] }, { [2,1], [35,17] } }; + shape "RMTA" { { [ 28,18] }, { [2,1], [26,17] } }; + shape "LMTA" { { [ 28,18] }, { [2,1], [26,17] } }; + shape "LOGO" { { [ 16,16] } }; + + outline "Edges" { + top= 0; + left= 0; + shape= "EDGE"; + }; + + section.left= 14; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 24; + row { + top= 1; + keys { { , "HELP" }, { , 9 }, + { , 19 }, , , , + { , 11 }, , , , + { , 11 }, , , , + { , 9 }, , , + { , 9 }, , , + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 61; + row { + top= 1; + keys { , , + { , 9}, , , , , + , , , , , + , , , + , + }; + }; + row { + top= 20; + keys { , , { , 9, shape="TABK" }, + , , , , , + , , , , , + , , + { , "BKSP", color="grey20" } + }; + }; + row { + top= 39; + keys { , , { , 9, shape="CAPS" }, + , , , , , + , , , , , + , + { , "RTRN" } + }; + }; + row { + top= 58; + keys { , , { , 9 , shape="LFSH" }, + , , , , , + , , , , , + { , "RTSH", color="grey20" } + }; + }; + row { + top= 77; + keys { , , { , 9, shape="LCTL" }, + , {, "LMTA"}, + { , "SPCE" }, + {, "RMTA"}, , + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 61; + left= 352; + row { + top= 1; + keys { , , }; + }; + row { + top= 20; + keys { , , }; + }; + row { + top= 58; + left= 20; + keys { }; + }; + row { + top= 77; + keys { , , }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 61; + left= 420; + row { + top= 1; + keys { , , , }; + }; + row { + top= 20; + keys { , , , { , "KPAD", color= "grey20" } }; + }; + row { + top= 39; + keys { , , }; + }; + row { + top= 58; + keys { , , , { , "KPAD", color= "grey20" } }; + }; + row { + top= 77; + keys { { , "KP0" }, }; + }; + }; // End of "Keypad" section + + shape "LEDS" { cornerRadius= 0, { [ 78 ,21 ] } }; + shape "LED" { cornerRadius= 2, { [ 3, 6 ] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 1; + left= 218; + }; + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 10; + indicator.shape= "LED"; + indicator "CapsLock" { left= 243; }; + indicator "Compose" { left= 281; }; + indicator "ScrollLock" { left= 262; }; + indicator "NumLock" { left= 224; }; + text.top= 1; + text.color= "black"; + text "CapsLockLabel" { left= 243; text="Caps\nLock"; }; + text "ComposeLabel" { left= 281; text="Compose"; }; + text "ScrollLockLabel" { left= 262; text="Scroll\nLock"; }; + text "NumLockLabel" { left= 224; text="Num\nLock"; }; +}; + + +xkb_geometry "x86jp" { + + description= "Japanese 106 key PC-style keyboard"; + width= 470; + height= 180; + + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "BKSP" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "TABK" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "BKSL" { { [ 27,18] }, { [2,1], [ 25,17] } }; + shape "RTRN" { + { [0,0],[ 27,0],[27,37],[4,37],[4,18],[0,18] } , + { [2,1],[ 25,1],[25,36],[5,36],[5,17],[2,17] } }; + shape "CAPS" { { [ 32,18] }, { [2,1], [ 30,17] } }; + shape "LFSH" { { [ 42,18] }, { [2,1], [ 40,17] } }; + shape "RTSH" { { [ 32,18] }, { [2,1], [ 30,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "SPCE" { { [ 75,18] }, { [2,1], [ 73,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [ 35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [ 16,36] } }; + + shape "LEDS" { cornerRadius= 0, { [ 76 ,20 ] } }; + shape "LED" { cornerRadius= 0, { [ 5, 1 ] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 25; + left= 375; + color= "grey10"; + }; + + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 40; + indicator.shape= "LED"; + indicator "NumLock" { left= 379; }; + indicator "CapsLock" { left= 404; }; + indicator "ScrollLock" { left= 429; }; + text.top= 28; + text.color= "black"; + text "NumLockLabel" { left= 378; text="Num\nLock"; }; + text "CapsLockLabel" { left= 403; text="Caps\nLock"; }; + text "ScrollLockLabel" { left= 428; text="Scroll\nLock"; }; + + section.left= 19; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 25; + row { + top= 1; + keys { { , color="grey20" }, + { , 18 }, , , , + { , 11 ,color="grey20"}, {,color="grey20"}, + { , color="grey20"}, {,color="grey20"}, + { , 11 }, , , , + { , 8 }, , + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 61; + row { + top= 1; + keys { {,color="grey20"}, , , + , , , , , + , , , , , + , { , "BKSP", color="grey20" } + }; + }; + row { + top= 20; + keys { { , "TABK", color="grey20" }, + , , , , , + , , , , , + , , { , 1 ,"RTRN",color="grey20" } + }; + }; + row { + top= 39; + keys { { , "CAPS", color="grey20" }, + , , , , , + , , , , , + , + }; + }; + row { + top= 58; + keys { { , "LFSH", color="grey20" }, + , , , , , + , , , , , + , { , "RTSH", color="grey20" } + }; + }; + row { + top= 77; + key.shape= "MODK"; + key.color= "grey20"; + keys { , { , 20 },, + { , "SPCE", color="white" }, + {, "NORM"}, {, "NORM"},{, "NORM"}, { , 17 } + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 61; + left= 310; + key.color= "grey20"; + row { + top= 1; + keys { , , }; + }; + row { + top= 20; + keys { , , }; + }; + row { + top= 58; + left= 20; + keys { }; + }; + row { + top= 77; + keys { , , }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 61; + left= 375; + row { + top= 1; + key.color= "grey20"; + keys { , , , }; + }; + row { + top= 20; + keys { , , , { , "KPAD", color="grey20" } }; + }; + row { + top= 39; + keys { , , }; + }; + row { + top= 58; + keys { , , , { , "KPAD", color="grey20" } }; + }; + row { + top= 77; + keys { { , "KP0" }, }; + }; + }; // End of "Keypad" section + + alias = ; + alias = ; +}; + +xkb_geometry "x86ko" { + + description= "Korean 103 key PC-style keyboard"; + width= 470; + height= 180; + + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "BKSP" { { [ 37,18] }, { [2,1], [ 35,17] } }; + shape "TABK" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "BKSL" { { [ 27,18] }, { [2,1], [ 25,17] } }; + shape "RTRN" { { [ 42,18] }, { [2,1], [ 41,17] } }; + shape "CAPS" { { [ 32,18] }, { [2,1], [ 30,17] } }; + shape "LFSH" { { [ 42,18] }, { [2,1], [ 40,17] } }; + shape "RTSH" { { [ 51,18] }, { [2,1], [ 50,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "SPCE" { { [ 75,18] }, { [2,1], [ 73,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [ 35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [ 16,36] } }; + + shape "LEDS" { cornerRadius= 0, { [ 76 ,20 ] } }; + shape "LED" { cornerRadius= 0, { [ 5, 1 ] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 25; + left= 375; + color= "grey10"; + }; + + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 40; + indicator.shape= "LED"; + indicator "NumLock" { left= 379; }; + indicator "CapsLock" { left= 404; }; + indicator "ScrollLock" { left= 429; }; + text.top= 28; + text.color= "black"; + text "NumLockLabel" { left= 378; text="Num\nLock"; }; + text "CapsLockLabel" { left= 403; text="Caps\nLock"; }; + text "ScrollLockLabel" { left= 428; text="Scroll\nLock"; }; + + section.left= 19; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 25; + row { + top= 1; + keys { { , color="grey20" }, + { , 18 }, , , , + { , 11 ,color="grey20"}, {,color="grey20"}, + { , color="grey20"}, {,color="grey20"}, + { , 11 }, , , , + { , 8 }, , + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 61; + row { + top= 1; + keys { {,color="grey20"}, , , + , , , , , + , , , , , + { , "BKSP", color="grey20" } + }; + }; + row { + top= 20; + keys { { , "TABK", color="grey20" }, + , , , , , + , , , , , + , , {, "BKSL"} + }; + }; + row { + top= 39; + keys { { , "CAPS", color="grey20" }, + , , , , , + , , , , , + , { , "RTRN",color="grey20" } + }; + }; + row { + top= 58; + keys { { , "LFSH", color="grey20" }, + , , , , , + , , , , , + { , "RTSH", color="grey20" } + }; + }; + row { + top= 77; + key.shape= "MODK"; + key.color= "grey20"; + keys { , { , 20 },, + { , "SPCE", color="white" }, + , , { , 17 } + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 61; + left= 310; + key.color= "grey20"; + row { + top= 1; + keys { , , }; + }; + row { + top= 20; + keys { , , }; + }; + row { + top= 58; + left= 20; + keys { }; + }; + row { + top= 77; + keys { , , }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 61; + left= 375; + row { + top= 1; + key.color= "grey20"; + keys { , , , }; + }; + row { + top= 20; + keys { , , , { , "KPAD", color="grey20" } }; + }; + row { + top= 39; + keys { , , }; + }; + row { + top= 58; + keys { , , , { , "KPAD", color="grey20" } }; + }; + row { + top= 77; + keys { { , "KP0" }, }; + }; + }; // End of "Keypad" section + + alias = ; + alias = ; +}; + +xkb_geometry "x86ca" { + + description= "Canadian 103 key PC-style keyboard"; + width= 470; + height= 180; + + shape.cornerRadius= 1; + shape "NORM" { { [ 18,18] }, { [2,1], [ 16,17] } }; + shape "BKSP" { { [ 37,18] }, { [2,1], [ 35,17] } }; + shape "TABK" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "BKSL" { { [ 27,18] }, { [2,1], [ 25,17] } }; + shape "RTRN" { { [ 42,18] }, { [2,1], [ 41,17] } }; + shape "CAPS" { { [ 32,18] }, { [2,1], [ 30,17] } }; + shape "LFSH" { { [ 42,18] }, { [2,1], [ 40,17] } }; + shape "RTSH" { { [ 51,18] }, { [2,1], [ 50,17] } }; + shape "MODK" { { [ 28,18] }, { [2,1], [ 26,17] } }; + shape "SPCE" { { [ 94,18] }, { [2,1], [ 92,17] } }; + shape "KP0" { { [ 37,18] }, { [2,1], [ 35,17] } }; + shape "KPAD" { { [ 18,37] }, { [2,1], [ 16,36] } }; + + shape "LEDS" { cornerRadius= 0, { [ 76 ,20 ] } }; + shape "LED" { cornerRadius= 0, { [ 5, 1 ] } }; + solid "LedPanel" { + shape= "LEDS"; + top= 25; + left= 375; + color= "grey10"; + }; + + indicator.onColor= "green"; + indicator.offColor= "green30"; + indicator.top= 40; + indicator.shape= "LED"; + indicator "NumLock" { left= 379; }; + indicator "CapsLock" { left= 404; }; + indicator "ScrollLock" { left= 429; }; + text.top= 28; + text.color= "black"; + text "NumLockLabel" { left= 378; text="Num\nLock"; }; + text "CapsLockLabel" { left= 403; text="Caps\nLock"; }; + text "ScrollLockLabel" { left= 428; text="Scroll\nLock"; }; + + section.left= 19; + row.left= 1; + key.shape= "NORM"; + key.gap= 1; + section "Function" { + top= 25; + row { + top= 1; + keys { { , color="grey20" }, + { , 18 }, , , , + { , 11 ,color="grey20"}, {,color="grey20"}, + { , color="grey20"}, {,color="grey20"}, + { , 11 }, , , , + { , 8 }, , + }; + }; + }; // End of "Function" section + + section "Alpha" { + top= 61; + row { + top= 1; + keys { {,color="grey20"}, , , + , , , , , + , , , , , + { , "BKSP", color="grey20" } + }; + }; + row { + top= 20; + keys { { , "TABK", color="grey20" }, + , , , , , + , , , , , + , , {, "BKSL"} + }; + }; + row { + top= 39; + keys { { , "CAPS", color="grey20" }, + , , , , , + , , , , , + , { , "RTRN",color="grey20" } + }; + }; + row { + top= 58; + keys { { , "LFSH", color="grey20" }, + , , , , , + , , , , , + { , "RTSH", color="grey20" } + }; + }; + row { + top= 77; + key.shape= "MODK"; + key.color= "grey20"; + keys { {, "NORM"}, {, 19},{ , 20 }, + { , "SPCE", color="white" }, + , { , 17 } + }; + }; + }; // End of "Alpha" section + + section "Editing" { + top= 61; + left= 310; + key.color= "grey20"; + row { + top= 1; + keys { , , }; + }; + row { + top= 20; + keys { , , }; + }; + row { + top= 58; + left= 20; + keys { }; + }; + row { + top= 77; + keys { , , }; + }; + }; // End of "Editing" section + + section "Keypad" { + top= 61; + left= 375; + row { + top= 1; + key.color= "grey20"; + keys { , , , }; + }; + row { + top= 20; + keys { , , , { , "KPAD", color="grey20" } }; + }; + row { + top= 39; + keys { , , }; + }; + row { + top= 58; + keys { , , , { , "KPAD", color="grey20" } }; + }; + row { + top= 77; + keys { { , "KP0" }, }; + }; + }; // End of "Keypad" section + + alias = ; + alias = ; +}; + +xkb_geometry "type5" { + include "sun(t5)" + description= "Sun Type5 keyboard"; +}; + +xkb_geometry "type5jp" { + include "sun(t5jp)" + description= "Sun Type5 Japanese keyboard"; +}; + +xkb_geometry "type5tuv" { + include "sun(t5tuv)" + description= "Sun Type5 keyboard"; +}; + +xkb_geometry "type5unix" { + include "sun(t5unix)" + description= "Sun Type5 Unix keyboard"; +}; + +xkb_geometry "type5hobo" { + include "sun(t5hobo)" + description= "Sun Type5 Hobo keyboard"; +}; + +xkb_geometry "type5tuvhobo" { + include "sun(t5tuvhobo)" + description= "Sun Type5 Hobo keyboard"; +}; + +xkb_geometry "type5jphobo" { + include "sun(t5jphobo)" + description= "Sun Type5 Japanese Hobo keyboard"; +}; + +xkb_geometry "type6" { + include "sun(t6)" + description= "Sun Type6 keyboard (US, Korea, Taiwan)"; +}; + +xkb_geometry "type6jp" { + include "sun(t6jp)" + description= "Sun Type6 Japanese keyboard"; +}; + +xkb_geometry "type6tuv" { + include "sun(t6tuv)" + description= "Sun Type6 TUV keyboard"; +}; + +xkb_geometry "type6unix" { + include "sun(t6unix)" + description= "Sun Type6 Unix keyboard"; +}; + +xkb_geometry "x86" { + include "pc(pc101)" + description= "x86 Style Keyboard"; +}; + +xkb_geometry "MS_x86" { + include "pc(pc104)" + description= "x86 104 Key Keyboard"; +}; + +xkb_geometry "x86tuv" { + include "pc(pc102)" + description= "x86 European Style Keyboard"; +}; + + diff -ruN /opt/SUNWut.orig/lib/xkb/geometry/winbook /opt/SUNWut/lib/xkb/geometry/winbook --- /opt/SUNWut.orig/lib/xkb/geometry/winbook 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/geometry/winbook 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,144 @@ +// $Xorg: winbook,v 1.3 2000/08/17 19:54:36 cpqbld Exp $ +default xkb_geometry "XP5" { + + description= "WinBook XP5"; + width= 281; + height= 180; + + shape.cornerRadius= 1; + + shape "NORM" { + { [17,17] }, + { [ 2, 1], [ 15, 15 ] } + }; + shape "FKEY" { + { [ 15, 10 ] }, + { [ 1, 0 ], [ 14, 9.5 ] } + }; + shape "ONE" { + { [ 28, 17 ] }, + { [ 11, 0 ], [ 28, 17 ] }, + { [ 13, 1 ], [ 26, 15 ] } + }; + shape "WIDE" { // backspace, caps lock, ctrl alt ? + { [ 24.5, 17 ] }, + { [ 2, 1 ], [ 22.5, 15 ] } + }; + shape "WIDR" { // backslash, left shift + { [ 35, 17 ] }, + { [ 2, 1 ], [ 33, 15 ] } + }; + shape "RTRN" { + { [ 45, 17 ] }, + { [ 2, 1 ], [ 43, 15 ] } + }; + shape "SPCE" { + { [ 90, 17 ] }, + { [ 2, 1 ], [ 88, 15 ] } + }; + shape "STIK" { + cornerRadius= 4, + { [ 8, 8 ] } + }; + shape "BTN" { + { [ 31, 6 ] } + }; + + section.left= 2; + row.left= 1; + key.shape= "NORM"; + key.gap= 0.5; + + key.color= "grey10"; + labelColor= "white"; + baseColor= "grey20"; + + section "Whole" { + top= 10; + row { + top= 11; + key.shape= "FKEY"; + keys { + , + , , , , , , + , , , , , , + , , , + }; + }; + row { + top= 22; + keys { + { , "ONE" }, + , , , , , + , , , , , , + { , shape="WIDE" }, + + }; + }; + row { + top= 40; + keys { + , , , , , , , + , , , , , , + { , "WIDR" } + }; + }; + row { + top= 58; + keys { { , shape="WIDE" }, + , , , , , + , , , , , + , + { , shape="RTRN" } + }; + }; + row { + top= 76; + keys { + { , shape="WIDR" }, + , , , , , + , , , , , + , , + }; + }; + row { + top= 94; + keys { + { , "WIDE" }, , { , "WIDE" }, + , { , shape="SPCE" }, , , + , , + }; + }; + overlay "KPAD" { + =, =, =, =, + =, =, =, =, + =, =, =, =, + =, =, = + }; + }; // End of "Whole" section + + solid "STIK" { + color= "red"; + shape= "STIK"; + top= 81; + left= 112; + }; + + solid "BTN1" { + color= "red"; + shape= "BTN"; + top= 137; + left= 93; + }; + + solid "BTN2" { + color= "red"; + shape= "BTN"; + top= 137; + left= 127; + }; + + alias = ; + alias = ; + +}; diff -ruN /opt/SUNWut.orig/lib/xkb/geometry.dir /opt/SUNWut/lib/xkb/geometry.dir --- /opt/SUNWut.orig/lib/xkb/geometry.dir 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/geometry.dir 2008-10-04 16:20:49.000000000 +0200 @@ -0,0 +1,84 @@ +-d------ -------- sony(nwp5461) +-d------ -------- microsoft(natural) +-d------ -------- hp(pc101) +-------- -------- hp(hil) +-------- -------- hp(omnibook) +-------- -------- hp(omnibook_intl) +-------- -------- digital/lk(lk201) +-------- -------- digital/lk(lk401) +-------- -------- digital/lk(lk450) +-------- -------- digital/lk(lk401bj) +-------- -------- digital/lk(lk401jj) +--p----- -------- digital/pc(common) +--p----- -------- digital/pc(leds_on_keys) +--p----- -------- digital/pc(leds_alone) +-------- -------- digital/pc(pc101) +-------- -------- digital/pc(pc102) +-------- -------- digital/pc(pcxaj) +-------- -------- digital/unix(unix) +-------- -------- digital/unix(lk421jj) +-------- -------- ibm/thinkpad(common) +-------- -------- ibm/thinkpad(us) +-------- -------- ibm/thinkpad(intl) +-------- -------- sun(type4) +-------- -------- sun(type4tuv) +-------- -------- sun(type4_ca) +-------- -------- sun(type4jp) +-------- -------- sun(t5) +-------- -------- sun(t5tuv) +-------- -------- sun(t5jp) +-------- -------- sun(t5unix) +-------- -------- sun(t5hobo) +-------- -------- sun(t5tuvhobo) +-------- -------- sun(t5jphobo) +-------- -------- sun(t6) +-------- -------- sun(t6tuv) +-------- -------- sun(t6jp) +-------- -------- sun(t6unix) +-------- -------- sun(x86jp) +-------- -------- sun(x86ko) +-------- -------- sun(x86ca) +-------- -------- sun(type5) +-------- -------- sun(type5jp) +-------- -------- sun(type5tuv) +-------- -------- sun(type5unix) +-------- -------- sun(type5hobo) +-------- -------- sun(type5tuvhobo) +-------- -------- sun(type5jphobo) +-------- -------- sun(type6) +-------- -------- sun(type6jp) +-------- -------- sun(type6tuv) +-------- -------- sun(type6unix) +-------- -------- sun(x86) +-------- -------- sun(MS_x86) +-------- -------- sun(x86tuv) +-d------ -------- sgi/indigo(pc101) +-------- -------- sgi/indigo(pc102) +-d------ -------- sgi/indy(pc101) +-------- -------- sgi/indy(pc102) +-------- -------- sgi/indy(jp106) +-d------ -------- sgi/O2(pc101) +-------- -------- sgi/O2(pc102) +-------- -------- sgi/O2(jp106) +-d------ -------- chicony(us) +-d------ -------- kinesis(model100) +-d------ -------- fujitsu(138) +-------- -------- fujitsu(140) +-d------ -------- nec(pc98) +-d------ -------- ataritt(us) +-------- -------- ataritt(de) +-d------ -------- everex(STEPnote) +-d------ -------- dell(dell101) +-d------ -------- northgate(omnikey101) +-d------ -------- macintosh(macintosh) +-d------ -------- keytronic(FlexPro) +-d------ -------- amiga(usa1) +-------- -------- amiga(de) +-d------ -------- winbook(XP5) +-d------ -------- pc(pc101) +-------- -------- pc(pc102) +-------- -------- pc(pc104) +-------- -------- pc(pc105) +-------- -------- pc(jp106) +-------- -------- pc(abnt2) +-------- -------- pc(pc86) diff -ruN /opt/SUNWut.orig/lib/xkb/keycodes/README /opt/SUNWut/lib/xkb/keycodes/README --- /opt/SUNWut.orig/lib/xkb/keycodes/README 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keycodes/README 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,10 @@ +The keycodes component of a keyboard mapping specifies the range and +interpretation of the raw keycodes reported by the device. It sets the keycodes +symbolic name, the minimum and maximum legal codes for the keyboard, and the +symbolic name for each key. The keycodes component might also contain aliases +for some keys, symbolic names for some indicators and a description of which +indicators are physically present. + + + +/* $XFree86$ */ diff -ruN /opt/SUNWut.orig/lib/xkb/keycodes/aliases /opt/SUNWut/lib/xkb/keycodes/aliases --- /opt/SUNWut.orig/lib/xkb/keycodes/aliases 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keycodes/aliases 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,101 @@ + +// keycode aliases for phonetic keyboard maps +// +// $XFree86$ + +default +xkb_keycodes "qwerty" { + + alias = ; + alias = ; + alias = ; + alias = ; + alias = ; + alias = ; + alias = ; + alias = ; + alias = ; + alias = ; + + alias = ; + alias = ; + alias = ; + alias = ; + alias = ; + alias = ; + alias = ; + alias = ; + alias = ; + + alias = ; + alias = ; + alias = ; + alias = ; + alias = ; + alias = ; + alias = ; +}; + +xkb_keycodes "azerty" { + + alias = ; + alias = ; + alias = ; + alias = ; + alias = ; + alias = ; + alias = ; + alias = ; + alias = ; + alias = ; + + alias = ; + alias = ; + alias = ; + alias = ; + alias = ; + alias = ; + alias = ; + alias = ; + alias = ; + alias = ; + + alias = ; + alias = ; + alias = ; + alias = ; + alias = ; + alias = ; +}; + +xkb_keycodes "qwertz" { + + alias = ; + alias = ; + alias = ; + alias = ; + alias = ; + alias = ; + alias = ; + alias = ; + alias = ; + alias = ; + + alias = ; + alias = ; + alias = ; + alias = ; + alias = ; + alias = ; + alias = ; + alias = ; + alias = ; + + alias = ; + alias = ; + alias = ; + alias = ; + alias = ; + alias = ; + alias = ; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/keycodes/amiga /opt/SUNWut/lib/xkb/keycodes/amiga --- /opt/SUNWut.orig/lib/xkb/keycodes/amiga 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keycodes/amiga 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,231 @@ +// $Xorg: amiga,v 1.3 2000/08/17 19:54:37 cpqbld Exp $ + + + +// $XFree86: xc/programs/xkbcomp/keycodes/amiga,v 3.2 1997/10/26 13:25:35 dawes Exp $ + +default xkb_keycodes "usa1" { + + minimum= 8; + maximum= 111; + + = 77; + = 88; + = 89; + = 90; + = 91; + = 92; + = 93; + = 94; + = 95; + = 96; + = 97; + + = 8; + = 9; + = 10; + = 11; + = 12; + = 13; + = 14; + = 15; + = 16; + = 17; + = 18; + = 19; + = 20; + = 21; + = 73; + + = 74; + = 24; + = 25; + = 26; + = 27; + = 28; + = 29; + = 30; + = 31; + = 32; + = 33; + = 34; + = 35; + = 76; + + = 107; + = 106; + = 40; + = 41; + = 42; + = 43; + = 44; + = 45; + = 46; + = 47; + = 48; + = 49; + = 50; + + = 104; + = 57; + = 58; + = 59; + = 60; + = 61; + = 62; + = 63; + = 64; + = 65; + = 66; + = 105; + + = 108; + = 110; + = 72; + = 111; + = 109; + + = 78; + = 103; + = 84; + = 87; + = 85; + = 86; + + = 98; + = 99; + = 100; + = 101; + + = 69; + = 70; + = 71; + = 82; + + = 53; + = 54; + = 55; + = 102; + + = 37; + = 38; + = 39; + + = 23; + = 68; + = 75; +}; + +xkb_keycodes "de" { + + minimum= 8; + maximum= 111; + + = 77; + = 88; + = 89; + = 90; + = 91; + = 92; + = 93; + = 94; + = 95; + = 96; + = 97; + + = 8; + = 9; + = 10; + = 11; + = 12; + = 13; + = 14; + = 15; + = 16; + = 17; + = 18; + = 19; + = 20; + = 21; + = 73; + + = 74; + = 24; + = 25; + = 26; + = 27; + = 28; + = 29; + = 30; + = 31; + = 32; + = 33; + = 34; + = 35; + = 76; + + = 107; + = 106; + = 40; + = 41; + = 42; + = 43; + = 44; + = 45; + = 46; + = 47; + = 48; + = 49; + = 50; + = 51; + + = 104; + = 56; + = 57; + = 58; + = 59; + = 60; + = 61; + = 62; + = 63; + = 64; + = 65; + = 66; + = 105; + + = 108; + = 110; + = 72; + = 111; + = 109; + + = 78; + = 103; + = 84; + = 87; + = 85; + = 86; + + = 98; + = 99; + = 100; + = 101; + + = 69; + = 70; + = 71; + = 82; + + = 53; + = 54; + = 55; + = 102; + + = 37; + = 38; + = 39; + + = 23; + = 68; + = 75; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/keycodes/ataritt /opt/SUNWut/lib/xkb/keycodes/ataritt --- /opt/SUNWut.orig/lib/xkb/keycodes/ataritt 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keycodes/ataritt 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,123 @@ +// $Xorg: ataritt,v 1.3 2000/08/17 19:54:37 cpqbld Exp $ + + + +// $XFree86: xc/programs/xkbcomp/keycodes/ataritt,v 3.1 1997/10/26 13:25:35 dawes Exp $ + +default xkb_keycodes "us" { + + minimum= 8; + maximum= 134; + + = 9; + = 10; + = 11; + = 12; + = 13; + = 14; + = 15; + = 16; + = 17; + = 18; + = 19; + = 20; + = 21; + = 49; + = 22; + + = 23; + = 24; + = 25; + = 26; + = 27; + = 28; + = 29; + = 30; + = 31; + = 32; + = 33; + = 34; + = 35; + = 36; + = 91; + + = 37; + = 38; + = 39; + = 40; + = 41; + = 42; + = 43; + = 44; + = 45; + = 46; + = 47; + = 48; + = 51; + + = 50; + = 52; + = 53; + = 54; + = 55; + = 56; + = 57; + = 58; + = 59; + = 60; + = 61; + = 62; + + = 64; + = 65; + = 66; + + = 67; + = 68; + = 69; + = 70; + = 71; + = 72; + = 73; + = 74; + = 75; + = 76; + + = 106; + = 105; + = 90; + = 79; + = 80; + = 83; + = 88; + = 85; + + = 107; + = 108; + = 109; + = 110; + + = 111; + = 112; + = 113; + = 82; + + = 114; + = 115; + = 116; + = 86; + + = 117; + = 118; + = 119; + + = 120; + = 121; + = 122; +}; + +xkb_keycodes "de" { + include "ataritt(us)" + + = 104; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/keycodes/digital/lk /opt/SUNWut/lib/xkb/keycodes/digital/lk --- /opt/SUNWut.orig/lib/xkb/keycodes/digital/lk 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keycodes/digital/lk 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,271 @@ +// $Xorg: lk,v 1.3 2000/08/17 19:54:38 cpqbld Exp $ +// +//Copyright (c) 1996 Digital Equipment Corporation +// +//Permission is hereby granted, free of charge, to any person obtaining +//a copy of this software and associated documentation files (the +//"Software"), to deal in the Software without restriction, including +//without limitation the rights to use, copy, modify, merge, publish, +//distribute, sublicense, and sell copies of the Software, and to +//permit persons to whom the Software is furnished to do so, subject to +//the following conditions: +// +//The above copyright notice and this permission notice shall be included +//in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +//OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL DIGITAL EQUIPMENT CORPORATION BE LIABLE FOR ANY CLAIM, +//DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR +//OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR +//THE USE OR OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of the Digital Equipment +//Corporation shall not be used in advertising or otherwise to promote +//the sale, use or other dealings in this Software without prior written +//authorization from Digital Equipment Corporation. +// +// HISTORY +// Log +// Revision 1.2 1996/06/18 09:13:22 erik +// use flags correctly, assorted cleanups and consortium fixes +// +// Revision 1.1.6.2 1995/08/07 17:40:34 William_Walker +// Upgrade XKB to protocol 0.62 (dual submit from decx11) +// [1995/08/06 14:06:25 William_Walker] +// +// Revision 1.1.2.4 1995/08/05 15:25:55 William_Walker +// Upgrade to XKB protocol 0.62 +// [1995/08/05 14:39:58 William_Walker] +// +// Revision 1.1.2.3 1995/06/27 12:17:31 William_Walker +// Rename to ISO9995 compliant . +// [1995/06/26 20:24:04 William_Walker] +// +// Revision 1.1.2.2 1995/06/05 19:21:28 William_Walker +// New file. I love keymaps. +// [1995/06/05 18:07:29 William_Walker] +// +// EndLog +// +// @(#)RCSfile: lk Revision: /main/3 (DEC) Date: 1996/01/24 12:13:31 +// +xkb_keycodes "lk_common" { + // "Function" keys + = 86; + = 87; + = 88; + = 89; + = 90; + = 100; + = 101; + = 102; + = 103; + = 104; + = 113; + = 114; + + = 170; + = 167; + = 169; + = 168; + + // "Keypad" keys + = 157; + = 158; + = 159; + = 153; + = 154; + = 155; + = 150; + = 151; + = 152; + = 149; + = 146; + = 148; + + // "Alphanumeric" keys + = 191; + = 192; + = 197; + = 203; + = 208; + = 214; + = 219; + = 224; + = 229; + = 234; + = 239; + = 249; + = 245; + = 188; + + = 190; + = 193; + = 198; + = 204; + = 209; + = 215; + = 220; + = 225; + = 230; + = 235; + = 240; + = 250; + = 246; + = 189; + + = 175; + = 176; + = 194; + = 199; + = 205; + = 210; + = 216; + = 221; + = 226; + = 231; + = 236; + = 242; + = 251; + + = 174; + = 195; + = 200; + = 206; + = 211; + = 217; + = 222; + = 227; + = 232; + = 237; + = 243; + = 171; + + = 212; + + = 255; // Support R5 Lock Down Modifiers + + alias = ; +}; + +xkb_keycodes "lkx01" { + include "digital/lk(lk_common)" + = 201; + = 115; + = 116; + = 128; + = 129; + = 130; + = 131; + = 124; + = 125; + = 138; + = 139; + = 140; + = 141; + = 142; + = 143; + = 161; + = 162; + = 163; + = 164; + = 160; + = 156; + = 247; + = 177; +}; + +xkb_keycodes "lk201" { + include "digital/lk(lkx01)" + indicator 4 = "Scroll Lock"; + indicator 3 = "Caps Lock"; + indicator 2 = "Compose"; + indicator 1 = "Wait"; +}; + +xkb_keycodes "lk421" { + include "digital/lk(lkx01)" + = 172; + = 178; + = 173; +}; + +xkb_keycodes "lk401" { + include "digital/lk(lk421)" + indicator 4 = "Scroll Lock"; + indicator 3 = "Caps Lock"; +}; + +xkb_keycodes "lk44x" { + include "digital/lk(lk_common)" + = 85; + = 115; + = 116; + = 124; + = 138; + = 139; + = 140; + = 141; + = 142; + = 143; + = 161; + = 162; + = 163; + = 164; + = 156; + = 172; + = 178; + = 173; +}; + +xkb_keycodes "lk443" { + include "digital/lk(lk44x)" + = 247; + indicator 3 = "Caps Lock"; + indicator 4 = "Scroll Lock"; + indicator 5 = "Num Lock"; +}; + +xkb_keycodes "lk444" { + include "digital/lk(lk44x)" + = 201; + = 247; + indicator 3 = "Caps Lock"; + indicator 4 = "Scroll Lock"; + indicator 5 = "Num Lock"; +}; + +// LK201-LT = lk201 +// LK421-AJ = lk421 +AB11 +// LK421-JJ = lk421aj+MUHE+KANJ+HIRA +// LK401-AJ = lk401 +// LK401-BJ = lk401 +MUHE+KANJ+HIRA +// LK401-JJ = lk401bj+AB11 +// LK401-LT = lk401 +// LK441-LT = lk443 + +xkb_keycodes "lk421aj" { + include "digital/lk(lk421)" + = 252; +}; + +xkb_keycodes "lk421jj" { + include "digital/lk(lk421aj)" + = 94; + = 95; + = 97; +}; + +xkb_keycodes "lk401bj" { + include "digital/lk(lk401)" + = 94; + = 95; + = 97; +}; + +xkb_keycodes "lk401jj" { + include "digital/lk(lk401bj)" + = 252; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/keycodes/digital/pc /opt/SUNWut/lib/xkb/keycodes/digital/pc --- /opt/SUNWut.orig/lib/xkb/keycodes/digital/pc 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keycodes/digital/pc 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,280 @@ +// $Xorg: pc,v 1.3 2000/08/17 19:54:38 cpqbld Exp $ +// +//Copyright (c) 1996 Digital Equipment Corporation +// +//Permission is hereby granted, free of charge, to any person obtaining +//a copy of this software and associated documentation files (the +//"Software"), to deal in the Software without restriction, including +//without limitation the rights to use, copy, modify, merge, publish, +//distribute, sublicense, and sell copies of the Software, and to +//permit persons to whom the Software is furnished to do so, subject to +//the following conditions: +// +//The above copyright notice and this permission notice shall be included +//in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +//OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL DIGITAL EQUIPMENT CORPORATION BE LIABLE FOR ANY CLAIM, +//DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR +//OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR +//THE USE OR OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of the Digital Equipment +//Corporation shall not be used in advertising or otherwise to promote +//the sale, use or other dealings in this Software without prior written +//authorization from Digital Equipment Corporation. +// +// HISTORY +// Log +// Revision 1.2 1996/06/18 09:13:25 erik +// use flags correctly, assorted cleanups and consortium fixes +// +// Revision 1.1.6.3 1995/10/25 21:00:14 William_Walker +// Add pc104-key support +// [1995/10/23 15:46:21 William_Walker] +// +// Revision 1.1.6.2 1995/08/07 17:40:37 William_Walker +// Upgrade XKB to protocol 0.62 (dual submit from decx11) +// [1995/08/06 14:06:28 William_Walker] +// +// Revision 1.1.2.4 1995/08/05 15:25:56 William_Walker +// Upgrade to XKB protocol 0.62 +// [1995/08/05 14:40:02 William_Walker] +// +// Revision 1.1.2.3 1995/06/27 12:17:32 William_Walker +// Rename to ISO9995 compliant . +// [1995/06/26 20:24:07 William_Walker] +// +// Revision 1.1.2.2 1995/06/05 19:21:31 William_Walker +// New file. I love keymaps. +// [1995/06/05 18:07:34 William_Walker] +// +// EndLog +// +// @(#)RCSfile: pc Revision: /main/3 (DEC) Date: 1996/01/24 12:13:36 +// +xkb_keycodes "pc_common" { + // "Function" keys + = 9; + = 15; + = 23; + = 31; + = 39; + = 47; + = 55; + = 63; + = 71; + = 79; + = 86; + = 94; + + // "Editing" keys + + = 99; + = 97; + = 96; + = 106; + + // "Keypad" keys + = 108; + = 117; + = 125; + + = 107; + = 115; + = 116; + + = 105; + = 114; + = 122; + = 121; + + = 112; + = 113; + + // "Alphanumeric" keys + = 22; + = 30; + = 38; + = 37; + = 46; + = 54; + = 61; + = 62; + = 70; + = 69; + = 78; + = 85; + = 102; + + = 13; + = 21; + = 29; + = 36; + = 45; + = 44; + = 53; + = 60; + = 67; + = 68; + = 77; + = 84; + = 91; + + = 20; + = 28; + = 27; + = 35; + = 43; + = 52; + = 51; + = 59; + = 66; + = 75; + = 76; + = 82; + = 90; + + = 18; + = 26; + = 34; + = 33; + = 42; + = 50; + = 49; + = 58; + = 65; + = 73; + = 74; + = 89; + + = 17; + = 25; + = 41; + = 57; + + = 255; // Support R5 Lock Down Modifiers + +}; + +xkb_keycodes "pc10x" { + include "digital/pc(pc_common)" + = 8; + = 14; + = 87; + = 95; + = 98; + = 103; + = 110; + = 111; + = 100; + = 101; + = 109; + = 118; + = 119; + = 126; + = 132; + = 124; + = 88; + + alias = ; + + indicator 3 = "Caps Lock"; + indicator 4 = "Scroll Lock"; +}; + +xkb_keycodes "pc101" { + include "digital/pc(pc10x)" + = 92; + indicator 5 = "Num Lock"; +}; + + +xkb_keycodes "pc102" { + include "digital/pc(pc10x)" + = 19; + = 83; + indicator 5 = "Num Lock"; +}; + +xkb_keycodes "pc104" { + include "digital/pc(pc101)" + = 139; + = 140; + = 141; +}; + +xkb_keycodes "lk411_common" { + include "digital/pc(pc_common)" + = 8; + = 14; + = 24; + = 10; + = 16; + = 87; + = 95; + = 98; + = 11; + = 12; + = 110; + = 103; + = 100; + = 101; + = 111; + = 109; + = 118; + = 119; + = 126; + = 132; + = 19; + = 124; + = 40; + = 88; + + alias = ; + + indicator 3 = "Caps Lock"; + indicator 4 = "Scroll Lock"; +}; + +xkb_keycodes "lk411" { + include "digital/pc(lk411_common)" + = 92; +}; + +xkb_keycodes "lk450" { + include "digital/pc(lk411)" + indicator 2 = "Compose"; + indicator 1 = "Wait"; +}; + +// Japanese variants +// +// PCXAJ-AA = pc+BKSL+AC12+AB11+MUHE+KANJ+HIRA+indicator +// LK411-AJ = lk411+MUHE+KANJ+HIRA +// LK411-JJ = lk411+BKSL+AZ01+MUHE+KANJ+HIRA +// LK411-LT = lk411 + +xkb_keycodes "pcxajaa" { + include "digital/pc(pc10x)" + = 93; + = 83; + = 81; + = 133; + = 134; + = 135; + indicator 5 = "Group 2"; +}; + +xkb_keycodes "lk411jj" { + include "digital/pc(lk411_common)" + = 81; + = 83; + = 133; + = 134; + = 135; +}; + + diff -ruN /opt/SUNWut.orig/lib/xkb/keycodes/fujitsu /opt/SUNWut/lib/xkb/keycodes/fujitsu --- /opt/SUNWut.orig/lib/xkb/keycodes/fujitsu 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keycodes/fujitsu 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,187 @@ +// $Xorg: fujitsu,v 1.4 2001/02/09 02:05:52 xorgcvs Exp $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +default xkb_keycodes "138" { + + minimum= 8; + maximum= 156; + + = 37; + = 38; + = 39; + = 40; + = 41; + = 42; + = 43; + = 44; + = 45; + = 46; + = 47; + = 48; + = 49; + = 50; + = 51; + + = 61; + = 62; + = 63; + = 64; + = 65; + = 66; + = 67; + = 68; + = 69; + = 70; + = 71; + = 72; + = 73; + + = 84; + = 85; + = 86; + = 87; + = 88; + = 89; + = 90; + = 91; + = 92; + = 93; + = 94; + = 95; + = 96; + = 97; + + = 107; + = 108; + = 109; + = 110; + = 111; + = 112; + = 113; + = 114; + = 115; + = 116; + = 117; + = 52; + = 118; + + = 127; + = 27; + = 128; + = 125; + = 129; + = 10; + = 130; + = 23; + = 75; + = 119; + = 56; + + = 13; + = 14; + = 16; + = 18; + = 20; + = 22; + = 24; + = 25; + = 26; + = 15; + = 17; + = 19; + = 137; + = 138; + = 139; + = 140; + = 141; + = 142; + = 143; + = 144; + = 145; + = 146; + = 147; + = 148; + = 153; + = 154; + = 155; + = 156; + = 149; + = 150; + = 151; + = 152; + + = 34; + = 59; + = 81; + = 105; + = 126; + + = 9; + = 30; + = 21; + = 29; + + = 82; + = 83; + = 12; + = 35; + = 32; + = 36; + = 28; + = 74; + = 60; + = 33; + = 103; + = 57; + = 80; + = 11; + + = 55; + = 54; + = 133; + = 79; + + = 76; + = 77; + = 78; + = 53; + + = 99; + = 100; + = 101; + = 58; + + = 120; + = 121; + = 122; + = 98; + + = 102; + = 31; + + = 123; + = 124; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/keycodes/hp /opt/SUNWut/lib/xkb/keycodes/hp --- /opt/SUNWut.orig/lib/xkb/keycodes/hp 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keycodes/hp 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,271 @@ +// $Xorg: hp,v 1.4 2001/02/09 02:05:52 xorgcvs Exp $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +default xkb_keycodes "hp-101" { + + = 23; + = 31; + = 39; + = 47; + = 46; + = 55; + = 63; + = 70; + = 71; + = 79; + = 78; + = 87; + = 94; + = 111; + + = 22; + = 30; + = 38; + = 45; + = 54; + = 53; + = 62; + = 69; + = 76; + = 77; + = 86; + = 93; + = 100; + = 101; + + = 29; + = 37; + = 36; + = 44; + = 52; + = 61; + = 60; + = 68; + = 75; + = 84; + = 85; + = 91; + = 99; + + = 27; + = 35; + = 43; + = 42; + = 51; + = 59; + = 58; + = 67; + = 74; + = 82; + = 83; + = 98; + + = 26; + = 34; + = 50; + = 66; + = 97; + + = 17; + = 16; + = 24; + = 32; + = 40; + = 48; + = 56; + = 64; + = 72; + = 80; + = 88; + = 95; + = 103; + + = 96; + = 104; + = 107; + + = 112; + = 119; + = 120; + = 109; + = 110; + = 118; + + = 108; + = 106; + = 105; + = 115; + + = 127; + = 128; + = 135; + = 141; + + = 117; + = 126; + = 134; + = 133; + + = 116; + = 124; + = 125; + + = 114; + = 123; + = 131; + = 130; + + = 121; + = 122; + + indicator 1 = "Caps Lock"; + indicator 2 = "Num Lock"; + indicator 3 = "Scroll Lock"; +}; + +xkb_keycodes "hil" { + + = 71; + = 70; + = 69; + = 68; + = 67; + = 66; + = 65; + = 64; + = 96; + = 97; + = 98; + = 99; + = 100; + = 101; + + = 63; + = 62; + = 61; + = 60; + = 59; + = 58; + = 57; + = 56; + = 104; + = 105; + = 106; + = 107; + = 108; + = 109; + + = 55; + = 53; + = 52; + = 51; + = 50; + = 49; + = 48; + = 112; + = 113; + = 114; + = 115; + = 116; + = 117; + + = 13; + = 36; + = 35; + = 34; + = 33; + = 32; + = 128; + = 120; + = 121; + = 122; + = 123; + = 12; + + = 14; + = 11; + = 129; + = 10; + = 87; + + = 39; + = 15; + = 86; + = 84; + = 83; + = 82; + = 81; + = 80; + = 88; + = 89; + = 90; + = 91; + = 92; + = 45; + = 41; + = 43; + = 47; + = 94; + = 95; + + = 102; + = 103; + = 110; + = 111; + + = 118; + = 119; + = 127; + = 125; + + = 134; + = 132; + = 133; + = 135; + + = 25; + = 29; + = 27; + = 31; + + = 21; + = 17; + = 19; + = 23; + + = 16; + = 18; + = 20; + = 22; + + = 24; + = 26; + = 28; + = 46; + + = 30; + = 44; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/keycodes/ibm /opt/SUNWut/lib/xkb/keycodes/ibm --- /opt/SUNWut.orig/lib/xkb/keycodes/ibm 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keycodes/ibm 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,151 @@ +// $Xorg: ibm,v 1.4 2001/02/09 02:05:52 xorgcvs Exp $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +xkb_keycodes "rs6k-101" { + + = 9; + = 10; + = 11; + = 12; + = 13; + = 14; + = 15; + = 16; + = 17; + = 18; + = 19; + = 20; + = 21; + = 23; + + = 24; + = 25; + = 26; + = 27; + = 28; + = 29; + = 30; + = 31; + = 32; + = 33; + = 34; + = 35; + = 36; + = 37; + + = 38; + = 39; + = 40; + = 41; + = 42; + = 43; + = 44; + = 45; + = 46; + = 47; + = 48; + = 49; + = 51; + + = 52; + = 54; + = 55; + = 56; + = 57; + = 58; + = 59; + = 60; + = 61; + = 62; + = 63; + = 65; + + = 66; + = 68; + = 69; + = 70; + = 72; + + = 118; + = 120; + = 121; + = 122; + = 123; + = 124; + = 125; + = 126; + = 127; + = 128; + = 129; + = 130; + = 131; + + = 132; + = 133; + = 134; + + = 83; + = 88; + = 93; + = 84; + = 89; + = 94; + + = 91; + = 87; + = 92; + = 97; + + = 98; + = 103; + = 108; + = 113; + + = 99; + = 104; + = 109; + = 114; + + = 100; + = 105; + = 110; + + = 101; + = 106; + = 111; + = 116; + + = 107; + = 112; + + indicator 1 = "Caps Lock"; + indicator 2 = "Num Lock"; + indicator 3 = "Scroll Lock"; +}; +xkb_keycodes "rs6k-102" { + include "ibm(rs6k-101)" + = 53; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/keycodes/macintosh /opt/SUNWut/lib/xkb/keycodes/macintosh --- /opt/SUNWut.orig/lib/xkb/keycodes/macintosh 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keycodes/macintosh 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,161 @@ +// $XConsortium: macintosh /main/10 1996/01/24 12:17:35 kaleb $ +// +//Copyright (c) 1996 X Consortium +// +//Permission is hereby granted, free of charge, to any person obtaining +//a copy of this software and associated documentation files (the +//"Software"), to deal in the Software without restriction, including +//without limitation the rights to use, copy, modify, merge, publish, +//distribute, sublicense, and/or sell copies of the Software, and to +//permit persons to whom the Software is furnished to do so, subject to +//the following conditions: +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE X CONSORTIUM BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of the X Consortium shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from the X Consortium. +// +// $XFree86: xc/programs/xkbcomp/keycodes/macintosh,v 1.4 2001/10/02 19:57:00 alanh Exp $ +// +default xkb_keycodes "macintosh" { + + minimum= 8; + maximum= 134; + + = 61; + = 58; + = 26; + = 27; + = 28; + = 29; + = 31; + = 30; + = 34; + = 36; + = 33; + = 37; + = 35; + = 32; + = 59; + + = 56; + = 20; + = 21; + = 22; + = 23; + = 25; + = 24; + = 40; + = 42; + = 39; + = 43; + = 41; + = 38; + = 50; + + = 65; + = 8; + = 9; + = 10; + = 11; + = 13; + = 12; + = 46; + = 48; + = 45; + = 49; + = 47; + = 44; + + = 18; + = 14; + = 15; + = 16; + = 17; + = 19; + = 53; + = 54; + = 51; + = 55; + = 52; + + = 57; + + = 62; // Left Control + = 63; // Left Option + = 64; // Left Shift + = 66; // Left Command +// = 131; // Right Shift +// = 132; // Right Command +// = 133; // Right Control +// = 134; // Right Option + + = 130; + = 128; + = 107; + = 126; + = 104; + = 105; + = 106; + = 108; + = 109; + = 117; + = 111; + = 119; + + = 113; + = 115; + = 121; + + = 122; + = 123; + = 124; + = 125; + = 127; + = 129; + + = 70; + = 67; + = 69; + = 68; + + = 79; + = 89; + = 83; + = 75; + + = 97; + = 99; + = 100; + = 86; + + = 94; + = 95; + = 96; + = 77; + + = 91; + = 92; + = 93; + = 84; + + = 90; + = 73; + + indicator 3 = "Scroll Lock"; + indicator 2 = "Num Lock"; + indicator 1 = "Caps Lock"; + + alias = ; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/keycodes/powerpcps2 /opt/SUNWut/lib/xkb/keycodes/powerpcps2 --- /opt/SUNWut.orig/lib/xkb/keycodes/powerpcps2 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keycodes/powerpcps2 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,134 @@ +// $XConsortium: xfree86 /main/4 1996/08/31 12:16:59 kaleb $ +// $XFree86: xc/programs/xkbcomp/keycodes/xfree86,v 3.3.2.1 1999/06/21 09:45:28 hohndel Exp $ +default xkb_keycodes "powerpcps2" { + + minimum= 8; + maximum= 135; + + = 49; + = 10; + = 11; + = 12; + = 13; + = 14; + = 15; + = 16; + = 17; + = 18; + = 19; + = 20; + = 21; + = 22; + + = 23; + = 24; + = 25; + = 26; + = 27; + = 28; + = 29; + = 30; + = 31; + = 32; + = 33; + = 34; + = 35; + = 36; + + = 66; + = 38; + = 39; + = 40; + = 41; + = 42; + = 43; + = 44; + = 45; + = 46; + = 47; + = 48; + + = 50; + = 52; + = 53; + = 54; + = 55; + = 56; + = 57; + = 58; + = 59; + = 60; + = 61; + = 62; + = 51; + = 94; + + = 64; + = 37; + = 65; + = 105; + = 108; + // Microsoft keyboard extra keys + = 133; + = 134; + = 135; + + = 9; + = 67; + = 68; + = 69; + = 70; + = 71; + = 72; + = 73; + = 74; + = 75; + = 76; + = 95; + = 96; + + = 107; + = 78; + = 127; + + = 118; + = 110; + = 112; + = 119; + = 115; + = 117; + + = 111; + = 113; + = 116; + = 114; + + = 77; + = 106; + = 63; + = 82; + + = 79; + = 80; + = 81; + = 86; + + = 83; + = 84; + = 85; + + = 87; + = 88; + = 89; + = 104; + + = 90; + = 91; + + indicator 1 = "Caps Lock"; + indicator 2 = "Num Lock"; + indicator 3 = "Scroll Lock"; + + alias = ; +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/keycodes/sgi/indigo /opt/SUNWut/lib/xkb/keycodes/sgi/indigo --- /opt/SUNWut.orig/lib/xkb/keycodes/sgi/indigo 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keycodes/sgi/indigo 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,140 @@ +// $Xorg: indigo,v 1.3 2000/08/17 19:54:39 cpqbld Exp $ +default xkb_keycodes "pc101" { + minimum= 10; + maximum= 118; + + = 62; + = 15; + = 21; + = 22; + = 29; + = 30; + = 37; + = 38; + = 45; + = 46; + = 53; + = 54; + = 61; + = 68; + + = 16; + = 17; + = 23; + = 24; + = 31; + = 32; + = 39; + = 40; + = 47; + = 48; + = 55; + = 56; + = 63; + = 58; + + = 11; + = 18; + = 19; + = 25; + = 26; + = 33; + = 34; + = 41; + = 42; + = 49; + = 50; + = 57; + + = 13; + = 27; + = 28; + = 35; + = 36; + = 43; + = 44; + = 51; + = 52; + = 59; + = 60; + = 12; + = 64; + + = 91; + = 10; + = 90; + = 93; + = 92; + + = 14; + = 94; + = 95; + = 96; + = 97; + = 98; + = 99; + = 100; + = 101; + = 102; + = 103; + = 104; + = 105; + + = 106; + = 107; + = 108; + + = 109; + = 110; + = 111; + = 69; + = 112; + = 113; + + = 88; + = 80; + = 81; + = 87; + + = 114; + = 115; + = 116; + = 83; + + = 74; + = 75; + = 82; + = 117; + + = 70; + = 76; + = 77; + + = 65; + = 71; + = 72; + = 89; + + = 66; + = 73; + + alias = ; + alias = ; + alias = ; + alias = ; + alias = ; + alias = ; + alias = ; + + virtual indicator 1 = "L1"; + virtual indicator 2 = "L2"; + virtual indicator 3 = "L3"; + virtual indicator 4 = "L4"; + indicator 5 = "Caps Lock"; + indicator 6 = "Num Lock"; + indicator 7 = "Scroll Lock"; +}; +xkb_keycodes "pc102" { + include "sgi/indigo(pc101)" + = 118; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/keycodes/sgi/indy /opt/SUNWut/lib/xkb/keycodes/sgi/indy --- /opt/SUNWut.orig/lib/xkb/keycodes/sgi/indy 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keycodes/sgi/indy 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,203 @@ +// $Xorg: indy,v 1.3 2000/08/17 19:54:39 cpqbld Exp $ +default xkb_keycodes "universal" { + minimum= 15; + maximum= 149; + include "sgi/indy(pc105)" + alternate = 91; + alternate = 100; + alternate = 101; +}; +xkb_keycodes "pc101" { + minimum= 15; + maximum= 149; + + = 22; + = 30; + = 38; + = 46; + = 45; + = 54; + = 62; + = 69; + = 70; + = 78; + = 77; + = 86; + = 93; + = 110; + + = 21; + = 29; + = 37; + = 44; + = 53; + = 52; + = 61; + = 68; + = 75; + = 76; + = 85; + = 92; + = 99; + = 98; + + = 28; + = 36; + = 35; + = 43; + = 51; + = 60; + = 59; + = 67; + = 74; + = 83; + = 84; + = 90; + + = 26; + = 34; + = 42; + = 41; + = 50; + = 58; + = 57; + = 66; + = 73; + = 81; + = 82; + = 97; + = 100; + + = 33; + = 25; + = 49; + = 96; + = 65; + + = 16; + = 15; + = 23; + = 31; + = 39; + = 47; + = 55; + = 63; + = 71; + = 79; + = 87; + = 94; + = 102; + + = 95; + = 103; + = 106; + + = 111; + = 118; + = 119; + = 108; + = 109; + = 117; + + = 107; + = 105; + = 104; + = 114; + + = 126; + = 127; + = 134; + = 140; + + = 116; + = 125; + = 133; + = 132; + + = 115; + = 123; + = 124; + + = 113; + = 122; + = 130; + = 129; + + = 120; + = 121; + + alias = ; + alias = ; + alias = ; + alias = ; + alias = ; + alias = ; + alias = ; + + virtual indicator 1 = "L1"; + virtual indicator 2 = "L2"; + virtual indicator 3 = "L3"; + virtual indicator 4 = "L4"; + indicator 5 = "Caps Lock"; + indicator 6 = "Num Lock"; + indicator 7 = "Scroll Lock"; + +}; +xkb_keycodes "pc102" { + = 91; + = 27; + augment "sgi/indy(pc101)" + maximum= 149; + minimum= 15; +}; +xkb_keycodes "pc104" { + include "sgi/indy(pc101)" + minimum= 15; + maximum= 149; + + // These key names are here to support so-called "Windows95" + // keyboards like the Microsoft Natural keyboard. + = 147; + = 148; + = 149; +}; +xkb_keycodes "pc105" { + = 27; + augment "sgi/indy(pc104)" + minimum= 15; + maximum= 149; +}; +xkb_keycodes "jp106" { + = 22; + = 89; + = 91; + = 141; + = 142; + = 143; + alias = ; + alias = ; + alias = ; + augment "sgi/indy(pc101)" + minimum= 15; + maximum= 149; +}; +// can be combined with any other "indy" keycode +// description to add virtual keys which can be +// used to implement an overlay-based numeric +// keypad. +partial hidden xkb_keycodes "overlayKeypad" { + = 17; + = 18; + = 19; + = 146; + = 145; + = 144; + = 136; + = 137; + = 138; + = 135; + = 139; +}; +partial hidden xkb_keycodes "shiftLock" { + indicator 5 = "Shift Lock"; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/keycodes/sgi/iris /opt/SUNWut/lib/xkb/keycodes/sgi/iris --- /opt/SUNWut.orig/lib/xkb/keycodes/sgi/iris 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keycodes/sgi/iris 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,11 @@ +// $Xorg: iris,v 1.3 2000/08/17 19:54:39 cpqbld Exp $ +default xkb_keycodes "iris" { + include "sgi/indigo(pc101)" + indicator 1 = "L1"; + indicator 2 = "L2"; + indicator 3 = "L3"; + indicator 4 = "L4"; + indicator 5 = "Caps Lock"; + indicator 6 = "Num Lock"; + indicator 7 = "Scroll Lock"; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/keycodes/sony /opt/SUNWut/lib/xkb/keycodes/sony --- /opt/SUNWut.orig/lib/xkb/keycodes/sony 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keycodes/sony 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,142 @@ +// $Xorg: sony,v 1.4 2001/02/09 02:05:52 xorgcvs Exp $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +xkb_keycodes "nwp5461" { + + = 18; + = 19; + = 20; + = 21; + = 22; + = 23; + = 24; + = 25; + = 26; + = 27; + = 28; + = 29; + = 30; + = 31; + = 32; + + = 33; + = 34; + = 35; + = 36; + = 37; + = 38; + = 39; + = 40; + = 41; + = 42; + = 43; + = 44; + = 45; + = 46; + + = 47; + = 48; + = 49; + = 50; + = 51; + = 52; + = 53; + = 54; + = 55; + = 56; + = 57; + = 58; + = 59; + = 60; + + = 61; + = 62; + = 63; + = 64; + = 65; + = 66; + = 67; + = 68; + = 69; + = 70; + = 71; + = 72; + = 73; + + = 74; + = 75; + = 76; + = 77; + = 78; + = 81; + + = 8; + = 9; + = 10; + = 11; + = 12; + = 13; + = 14; + = 15; + = 16; + = 17; + = 111; + = 112; + + = 113; + = 114; + = 115; + = 116; + = 117; + + = 109; + = 95; + = 98; + = 99; + = 100; + + = 107; + = 108; + = 89; + + = 82; + = 83; + = 84; + = 85; + + = 86; + = 87; + = 88; + = 93; + + = 90; + = 91; + = 92; + = 97; + + = 94; + = 96; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/keycodes/sun /opt/SUNWut/lib/xkb/keycodes/sun --- /opt/SUNWut.orig/lib/xkb/keycodes/sun 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keycodes/sun 2008-06-18 23:52:46.000000000 +0200 @@ -0,0 +1,835 @@ +// $TOG: sun /main/12 1998/02/10 13:44:20 kaleb $ +// +//Copyright 1996, 1998 The Open Group +// +//All Rights Reserved. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +default xkb_keycodes "type4" { + + minimum= 8; + maximum= 132; + + = 36; + = 37; + = 38; + = 39; + = 40; + = 41; + = 42; + = 43; + = 44; + = 45; + = 46; + = 47; + = 48; + = 49; + = 50; + + = 60; + = 61; + = 62; + = 63; + = 64; + = 65; + = 66; + = 67; + = 68; + = 69; + = 70; + = 71; + = 72; + = 73; + + = 83; + = 84; + = 85; + = 86; + = 87; + = 88; + = 89; + = 90; + = 91; + = 92; + = 93; + = 94; + = 95; + = 96; + + = 106; + = 107; + = 108; + = 109; + = 110; + = 111; + = 112; + = 113; + = 114; + = 115; + = 116; + = 117; + = 118; + + = 125; + = 126; + = 26; + = 127; + = 128; + = 129; + = 74; + = 20; + alias = ; + + = 12; + = 13; + = 15; + = 17; + = 19; + = 21; + = 23; + = 24; + = 25; + = 14; + = 16; + = 18; + + = 8; + = 10; + = 32; + = 33; + = 56; + = 58; + = 79; + = 80; + = 102; + = 104; + + = 29; + = 30; + = 28; + + = 105; + = 52; + = 53; + = 54; + = 78; + + = 75; + = 76; + = 77; + = 132; + + = 98; + = 99; + = 100; + + = 119; + = 120; + = 121; + = 97; + + = 101; + = 57; + indicator 4 = "Caps Lock"; + indicator 3 = "Compose"; + indicator 2 = "Scroll Lock"; + indicator 1 = "Num Lock"; +}; + +xkb_keycodes "type5" { + + minimum= 8; + maximum= 132; + + = 36; + = 37; + = 38; + = 39; + = 40; + = 41; + = 42; + = 43; + = 44; + = 45; + = 46; + = 47; + = 48; + = 49; + = 50; + + = 60; + = 61; + = 62; + = 63; + = 64; + = 65; + = 66; + = 67; + = 68; + = 69; + = 70; + = 71; + = 72; + = 73; + = 74; + = 20; + alias = ; + + = 83; + = 84; + = 85; + = 86; + = 87; + = 88; + = 89; + = 90; + = 91; + = 92; + = 93; + = 94; + = 95; + = 96; + + = 106; + = 107; + = 108; + = 109; + = 110; + = 111; + = 112; + = 113; + = 114; + = 115; + = 116; + = 117; + + = 26; + = 126; + = 127; + = 128; + = 129; + + = 12; + = 13; + = 15; + = 17; + = 19; + = 21; + = 23; + = 24; + = 25; + = 14; + = 16; + = 18; + = 8; + = 10; + = 32; + = 33; + = 56; + = 58; + = 79; + = 80; + = 102; + = 104; + + = 29; + = 30; + = 28; + + = 105; + = 53; + = 54; + = 78; + + = 75; + = 76; + = 77; + = 132; + + = 98; + = 99; + = 100; + + = 119; + = 120; + = 121; + = 97; + + = 101; + = 57; + + = 27; + = 31; + = 34; + = 35; + + = 51; + = 59; + = 81; + = 103; + = 130; + = 125; + + = 52; + = 9; + = 11; + = 55; + indicator 4 = "Caps Lock"; + indicator 3 = "Compose"; + indicator 2 = "Scroll Lock"; + indicator 1 = "Num Lock"; +}; + +xkb_keycodes "type4tuv" { + include "sun(type4)" + = 131; + = 22; +}; + +xkb_keycodes "type4_ca" { + include "sun(type4)" + = 131; +}; + +xkb_keycodes "type4_jp" { + include "sun(type4)" + = 122; + = 123; + = 124; + = 22; + alias = ; +}; + +xkb_keycodes "type5tuv" { + include "sun(type5)" + = 131; +}; + +xkb_keycodes "type5_jp" { + include "sun(type5)" + = 122; + = 123; + = 124; + = 118; +}; + +xkb_keycodes "type5hobo" { + + minimum= 8; + maximum= 132; + + = 36; + = 37; + = 38; + = 39; + = 40; + = 41; + = 42; + = 43; + = 44; + = 45; + = 46; + = 47; + = 48; + = 49; + = 50; + + = 60; + = 61; + = 62; + = 63; + = 64; + = 65; + = 66; + = 67; + = 68; + = 69; + = 70; + = 71; + = 72; + = 73; + = 74; + = 20; + alias = ; + + = 83; + = 84; + = 85; + = 86; + = 87; + = 88; + = 89; + = 90; + = 91; + = 92; + = 93; + = 94; + = 95; + = 96; + + = 106; + = 107; + = 108; + = 109; + = 110; + = 111; + = 112; + = 113; + = 114; + = 115; + = 116; + = 117; + + = 26; + = 126; + = 127; + = 128; + = 129; + + = 12; + = 13; + = 15; + = 17; + = 19; + = 21; + = 23; + = 24; + = 25; + = 14; + = 16; + = 18; + = 8; + = 10; + = 32; + = 33; + = 56; + = 58; + = 79; + = 80; + = 102; + = 104; + + = 29; + = 30; + = 28; + + = 105; +// = 53; +// = 54; +// = 78; + +// = 75; +// = 76; +// = 77; +// = 132; + +// = 98; +// = 99; +// = 100; + +// = 119; +// = 120; +// = 121; +// = 97; + +// = 101; +// = 57; + + = 27; + = 31; + = 34; + = 35; + + = 51; + = 59; + = 81; + = 103; + = 130; + = 125; + + = 52; + = 9; + = 11; + = 55; + indicator 4 = "Caps Lock"; + indicator 3 = "Compose"; + indicator 2 = "Scroll Lock"; + indicator 1 = "Num Lock"; +}; + +xkb_keycodes "type5tuvhobo" { + include "sun(type5hobo)" + = 131; + +}; + +xkb_keycodes "type5_jphobo" { + include "sun(type5hobo)" + = 122; + = 123; + = 124; + = 118; +}; + +xkb_keycodes "type6" { + include "sun(type5)" +}; + +xkb_keycodes "type6tuv" { + include "sun(type5tuv)" +}; + +xkb_keycodes "type6unix" { + include "sun(type5)" +}; + +xkb_keycodes "type6_jp" { + include "sun(type5_jp)" +}; + +xkb_keycodes "type6_usb" { + include "usb(101)" + = 121; + = 124; + = 125; + = 122; + = 126; + = 123; + = 128; + = 120; + = 129; + = 130; + = 127; + = 131; + = 133; + = 132; + = 106; + = 105; + alias = ; + + = 231; + = 235; + indicator 4 = "Caps Lock"; + indicator 3 = "Compose"; + indicator 2 = "Scroll Lock"; + indicator 1 = "Num Lock"; +}; + +xkb_keycodes "type6tuv_usb" { + include "sun(type6_usb)" + = 104; + = 54; +}; + +xkb_keycodes "type6_jp_usb" { + include "sun(type6_usb)" + = 143; + = 142; + = 140; + = 139; +}; + +xkb_keycodes "x86" { + + = 9; + = 10; + = 11; + = 12; + = 13; + = 14; + = 15; + = 16; + = 17; + = 18; + = 19; + = 20; + = 21; + = 23; + + = 24; + = 25; + = 26; + = 27; + = 28; + = 29; + = 30; + = 31; + = 32; + = 33; + = 34; + = 35; + = 36; + = 37; + + = 38; + = 39; + = 40; + = 41; + = 42; + = 43; + = 44; + = 45; + = 46; + = 47; + = 48; + = 49; + = 51; + + = 52; + = 54; + = 55; + = 56; + = 57; + = 58; + = 59; + = 60; + = 61; + = 62; + = 63; + = 65; + + = 66; + = 68; + = 69; + = 70; + = 72; + + = 118; + = 120; + = 121; + = 122; + = 123; + = 124; + = 125; + = 126; + = 127; + = 128; + = 129; + = 130; + = 131; + + = 132; + = 133; + = 134; + + = 83; + = 88; + = 93; + = 84; + = 89; + = 94; + + = 91; + = 87; + = 92; + = 97; + + = 98; + = 103; + = 108; + = 113; + + = 99; + = 104; + = 109; + = 114; + + = 100; + = 105; + = 110; + + = 101; + = 106; + = 111; + = 116; + + = 107; + = 112; + + indicator 1 = "Caps Lock"; + indicator 2 = "Num Lock"; + indicator 3 = "Scroll Lock"; +}; + +xkb_keycodes "type5x86" { + + minimum= 8; + maximum= 132; + + = 36; + = 37; + = 38; + = 39; + = 40; + = 41; + = 42; + = 43; + = 44; + = 45; + = 46; + = 47; + = 48; + = 49; + = 73; + + = 60; + = 61; + = 62; + = 63; + = 64; + = 65; + = 66; + = 67; + = 68; + = 69; + = 70; + = 71; + = 72; + = 125; + = 129; + alias = ; + + = 83; + = 26; + = 84; + = 85; + = 86; + = 87; + = 88; + = 89; + = 90; + = 91; + = 92; + = 93; + = 94; + = 95; + = 96; + + = 106; + = 107; + = 108; + = 109; + = 110; + = 111; + = 112; + = 113; + = 114; + = 115; + = 116; + = 117; + + = 127; + = 126; + = 128; + + = 12; + = 13; + = 15; + = 17; + = 19; + = 21; + = 23; + = 24; + = 25; + = 14; + = 16; + = 18; + + = 29; + = 30; + = 8; + + = 105; + = 53; + = 54; + = 78; + + = 75; + = 76; + = 77; + = 132; + + = 98; + = 99; + = 100; + + = 119; + = 120; + = 121; + = 97; + + = 101; + = 57; + + = 27; + = 31; + = 34; + = 35; + + = 32; + = 104; + = 33; + = 58; + = 80; + indicator 4 = "Caps Lock"; + indicator 3 = "Compose"; + indicator 2 = "Scroll Lock"; + indicator 1 = "Num Lock"; +}; + +xkb_keycodes "x86jp" { + include "sun(x86)" + + = 141; + = 22; + alias = ; + = 139; + = 140; + // = 140; + = 64; +}; + +xkb_keycodes "x86ko" { + include "sun(x86)" + + = 158; + = 159; +}; + +xkb_keycodes "x86tuv" { + include "sun(x86)" + = 53; +}; + +xkb_keycodes "MS_x86" { + include "sun(x86)" + = 67; + = 71; + = 73; +}; + +xkb_keycodes "x86ca" { + include "sun(x86)" + = 67; +}; + + + + + + diff -ruN /opt/SUNWut.orig/lib/xkb/keycodes/usb /opt/SUNWut/lib/xkb/keycodes/usb --- /opt/SUNWut.orig/lib/xkb/keycodes/usb 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keycodes/usb 2008-06-18 23:52:46.000000000 +0200 @@ -0,0 +1,132 @@ + +// keycodes are not biased to meet the X minimum keycode + +// USB + +default xkb_keycodes "basic" { + + minimum= 8; + maximum= 235; + + = 34; + = 35; + = 36; + = 37; + = 38; + = 39; + = 40; + = 41; + = 42; + = 43; + = 49; + = 50; + + = 24; + = 30; + = 12; + = 25; + = 27; + = 32; + = 28; + = 16; + = 22; + = 23; + = 51; + = 52; + + = 8; + = 26; + = 11; + = 13; + = 14; + = 15; + = 17; + = 18; + = 19; + = 55; + = 56; + + = 33; + = 31; + = 10; + = 29; + = 9; + = 21; + = 20; + = 58; + = 59; + = 60; + + = 44; + = 45; + = 46; + = 47; + = 53; + = 57; + + = 229; + = 228; + = 230; + = 48; + = 234; +// = 232; + = 233; +}; + +xkb_keycodes "84" { + include "usb(basic)" + = 61; + = 62; + = 63; + = 64; + = 65; + = 66; + = 67; + = 68; + = 69; + = 70; + = 71; + = 75; + = 89; + = 90; + = 91; + = 93; + = 94; + = 95; + = 96; + = 97; + = 98; + = 99; + = 100; + = 101; + = 102; + = 103; +}; + +xkb_keycodes "101" { + include "usb(84)" + = 72; + = 73; + = 74; + = 76; + = 77; + = 78; + = 79; + = 80; + = 81; + = 82; + = 83; + = 84; + = 85; + = 86; + = 87; + = 88; + = 92; +}; + +xkb_keycodes "104" { + include "usb(101)" + = 231; + = 235; + = 105; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/keycodes/xfree86 /opt/SUNWut/lib/xkb/keycodes/xfree86 --- /opt/SUNWut.orig/lib/xkb/keycodes/xfree86 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keycodes/xfree86 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,413 @@ +// $XdotOrg: xc/programs/xkbcomp/keycodes/xfree86,v 1.2 2004/04/23 19:54:51 eich Exp $ +// $Xorg: xfree86,v 1.3 2000/08/17 19:54:37 cpqbld Exp $ + + + + +// $XFree86: xc/programs/xkbcomp/keycodes/xfree86,v 3.28 2003/11/21 04:46:42 dawes Exp $ + +// "standard" XFree86 codes +// It seems that the "default" must be the first entry in the file. + +default xkb_keycodes "xfree86" { + include "xfree86(basic)" + = 51; + = 94; +}; + +xkb_keycodes "basic" { + + minimum= 8; + maximum= 255; + + = 49; + = 10; + = 11; + = 12; + = 13; + = 14; + = 15; + = 16; + = 17; + = 18; + = 19; + = 20; + = 21; + = 22; + + = 23; + = 24; + = 25; + = 26; + = 27; + = 28; + = 29; + = 30; + = 31; + = 32; + = 33; + = 34; + = 35; + = 36; + + = 66; + = 38; + = 39; + = 40; + = 41; + = 42; + = 43; + = 44; + = 45; + = 46; + = 47; + = 48; + + = 50; + = 52; + = 53; + = 54; + = 55; + = 56; + = 57; + = 58; + = 59; + = 60; + = 61; + = 62; + + = 64; + = 37; + = 65; + = 109; + = 113; + // Microsoft keyboard extra keys + = 115; + = 116; + = 117; + + = 9; + = 67; + = 68; + = 69; + = 70; + = 71; + = 72; + = 73; + = 74; + = 75; + = 76; + = 95; + = 96; + + = 111; + = 92; + = 78; + = 110; + = 114; + + = 106; + = 97; + = 99; + = 107; + = 103; + = 105; + + = 98; + = 100; + = 104; + = 102; + + = 77; + = 112; + = 63; + = 82; + + = 79; + = 80; + = 81; + = 86; + + = 83; + = 84; + = 85; + + = 87; + = 88; + = 89; + = 108; + + = 90; + = 91; + = 126; + + = 118; + = 119; + = 120; + = 121; + = 122; + = 123; + + // Keys that are generated on Japanese keyboards + + alias = ; // Hankaku_Zenkaku toggle + = 208; // Hiragana_Katakana toggle + = 211; // backslash/underscore + = 129; // Henkan + = 131; // Muhenkan + = 133; // Yen + + // Keys that are generated on Korean keyboards + + alias = ; // Hangul Latin toggle + alias = ; // Hangul to Hanja conversion + + // Extended keys that may be generated on "Internet" keyboards. + // These are not standardised, hence the meaningless names. + // The entries commented out are never generated because the raw codes + // in those positions are already used for well-defined keys. + + alias = ; + = 130; + alias = ; + = 132; + alias = ; + = 134; + = 135; + = 136; + = 137; + = 138; + = 139; + = 140; + = 141; + = 142; + = 143; + = 144; + = 145; + = 146; + = 147; + = 148; + = 149; + = 150; + = 151; + = 152; + = 153; + = 154; + = 155; + // = 156; + // = 157; + = 158; + = 159; + = 160; + = 161; + = 162; + = 163; + = 164; + = 165; + = 166; + = 167; + = 168; + = 169; + // = 170; + = 171; + = 172; + = 173; + = 174; + = 175; + = 176; + = 177; + = 178; + = 179; + = 180; + // = 181; + // = 182; + // = 183; + // = 184; + = 185; + = 186; + = 187; + = 188; + // = 189; + // = 190; + // = 191; + // = 192; + // = 193; + = 194; + = 195; + = 196; + = 197; + // = 198; + // = 199; + // = 200; + // = 201; + = 202; + // = 203; + // = 204; + // = 205; + // = 206; + // = 207; + // = 208; + // = 209; + // = 210; + // = 211; + = 212; + = 213; + = 214; + = 215; + = 216; + = 217; + = 218; + // = 219; + // = 220; + // = 221; + = 222; + = 223; + = 224; + = 225; + = 226; + = 227; + = 228; + = 229; + = 230; + = 231; + = 232; + = 233; + = 234; + = 235; + = 236; + = 237; + = 238; + = 239; + = 240; + = 241; + = 242; + = 243; + = 244; + = 245; + = 246; + = 247; + = 248; + = 249; + = 250; + = 251; + = 252; + = 253; + = 254; + = 255; + + // Codes generated for scancodes 0x59-0x5f, 0x62-0x76 + = 157; // + = 170; // + = 181; // + alias = ; + = 182; // + = 183; // + = 184; // + = 189; // + = 190; // + = 191; // + = 192; // + = 193; // + = 198; // + = 199; // + = 200; // + = 201; // + = 203; // + = 204; // + = 205; // + = 206; // + = 207; // + alias = ; // + = 209; // + = 210; // + alias = ; // + = 219; // + = 220; // + = 221; // + + // Solaris compatibility + + alias = ; + alias = ; + alias = ; + alias = ; + alias = ; + alias = ; + alias = ; + alias = ; + alias = ; + alias = ; + alias = ; + alias = ; + alias = ; + alias = ; + alias = ; + alias = ; + alias = ; + alias = ; + + // Other codes never generated. The XFree86 ddx never generates + // these codes. + // Thus we can use them as fake keys + = 93; // + = 124; // + = 125; // + = 156; // + = 127; // + = 128; // + + indicator 1 = "Caps Lock"; + indicator 2 = "Num Lock"; + indicator 3 = "Scroll Lock"; + + alias = ; +}; + +// What keyboard is this? + +xkb_keycodes "102" { + include "xfree86(xfree86)" + + // There will be warnings from xkbcomp because of multiple definitions. + + = 122; + = 123; + + = 121; + = 118; + + = 131; + = 135; + = 119; + = 129; + = 130; + = 134; + + = 128; + = 132; + = 120; + = 133; + + = 125; + + = 124; +}; + + +// For japanese 106 keyboard. by tsuka(tsuka@kawalab.dnj.ynu.ac.jp) +// +// All of the keycodes here are now in the basic "xfree86" set. +// +xkb_keycodes "jp106" { + include "xfree86(basic)" + = 51; +}; + + +// For brazilian ABNT2 keyboard. by Ricardo Y. Igarashi(iga@that.com.br) +xkb_keycodes "abnt2" { + include "xfree86(basic)" + = 94; + = 51; + = 134; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/keycodes/xfree98 /opt/SUNWut/lib/xkb/keycodes/xfree98 --- /opt/SUNWut.orig/lib/xkb/keycodes/xfree98 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keycodes/xfree98 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,155 @@ +// $Xorg: xfree98,v 1.4 2001/02/09 02:05:52 xorgcvs Exp $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +// $XFree86: xc/programs/xkbcomp/keycodes/xfree98,v 3.6 2001/01/17 23:45:51 dawes Exp $ +// +default xkb_keycodes "pc98" { + + minimum= 8; + maximum= 134; + + = 8; + = 9; + = 10; + = 11; + = 12; + = 13; + = 14; + = 15; + = 16; + = 17; + = 18; + = 19; + = 20; + = 21; + = 22; + + = 23; + = 24; + = 25; + = 26; + = 27; + = 28; + = 29; + = 30; + = 31; + = 32; + = 33; + = 34; + = 35; + = 36; + + = 124; + = 121; + = 37; + = 38; + = 39; + = 40; + = 41; + = 42; + = 43; + = 44; + = 45; + = 46; + = 47; + = 48; + + = 120; + = 49; + = 50; + = 51; + = 52; + = 53; + = 54; + = 55; + = 56; + = 57; + = 58; + = 59; + + = 122; + = 123; + = 89; + = 60; + = 61; + + = 104; + = 105; + = 106; + = 107; + = 108; + = 109; + = 110; + = 111; + = 112; + = 113; + = 114; + = 115; + = 90; + = 91; + = 92; + = 93; + = 94; + + + = 64; + = 65; + = 63; + = 62; + = 66; + = 67; + = 68; + = 69; + + = 70; + = 71; + + = 72; + = 73; + + = 74; + = 75; + = 76; + = 77; + + = 78; + = 79; + = 80; + = 81; + + = 82; + = 83; + = 84; + = 85; + + = 86; + = 87; + = 88; + + indicator 1 = "Caps Lock"; + indicator 2 = "Kana"; +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/keycodes.dir /opt/SUNWut/lib/xkb/keycodes.dir --- /opt/SUNWut.orig/lib/xkb/keycodes.dir 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keycodes.dir 2008-10-04 16:20:49.000000000 +0200 @@ -0,0 +1,82 @@ +-------- -------- sony(nwp5461) +-d------ -------- usb(basic) +-------- -------- usb(84) +-------- -------- usb(101) +-------- -------- usb(104) +-d------ -------- hp(hp-101) +-------- -------- hp(hil) +-------- -------- digital/lk(lk_common) +-------- -------- digital/lk(lkx01) +-------- -------- digital/lk(lk201) +-------- -------- digital/lk(lk421) +-------- -------- digital/lk(lk401) +-------- -------- digital/lk(lk44x) +-------- -------- digital/lk(lk443) +-------- -------- digital/lk(lk444) +-------- -------- digital/lk(lk421aj) +-------- -------- digital/lk(lk421jj) +-------- -------- digital/lk(lk401bj) +-------- -------- digital/lk(lk401jj) +-------- -------- digital/pc(pc_common) +-------- -------- digital/pc(pc10x) +-------- -------- digital/pc(pc101) +-------- -------- digital/pc(pc102) +-------- -------- digital/pc(pc104) +-------- -------- digital/pc(lk411_common) +-------- -------- digital/pc(lk411) +-------- -------- digital/pc(lk450) +-------- -------- digital/pc(pcxajaa) +-------- -------- digital/pc(lk411jj) +-d------ -------- xfree86(xfree86) +-------- -------- xfree86(basic) +-------- -------- xfree86(102) +-------- -------- xfree86(jp106) +-------- -------- xfree86(abnt2) +-------- -------- ibm(rs6k-101) +-------- -------- ibm(rs6k-102) +-d------ -------- powerpcps2(powerpcps2) +-d------ -------- aliases(qwerty) +-------- -------- aliases(azerty) +-------- -------- aliases(qwertz) +-d------ -------- sun(type4) +-------- -------- sun(type5) +-------- -------- sun(type4tuv) +-------- -------- sun(type4_ca) +-------- -------- sun(type4_jp) +-------- -------- sun(type5tuv) +-------- -------- sun(type5_jp) +-------- -------- sun(type5hobo) +-------- -------- sun(type5tuvhobo) +-------- -------- sun(type5_jphobo) +-------- -------- sun(type6) +-------- -------- sun(type6tuv) +-------- -------- sun(type6unix) +-------- -------- sun(type6_jp) +-------- -------- sun(type6_usb) +-------- -------- sun(type6tuv_usb) +-------- -------- sun(type6_jp_usb) +-------- -------- sun(x86) +-------- -------- sun(type5x86) +-------- -------- sun(x86jp) +-------- -------- sun(x86ko) +-------- -------- sun(x86tuv) +-------- -------- sun(MS_x86) +-------- -------- sun(x86ca) +-d------ -------- sgi/iris(iris) +-d------ -------- sgi/indigo(pc101) +-------- -------- sgi/indigo(pc102) +-d------ -------- sgi/indy(universal) +-------- -------- sgi/indy(pc101) +-------- -------- sgi/indy(pc102) +-------- -------- sgi/indy(pc104) +-------- -------- sgi/indy(pc105) +-------- -------- sgi/indy(jp106) +h-p----- -------- sgi/indy(overlayKeypad) +h-p----- -------- sgi/indy(shiftLock) +-d------ -------- fujitsu(138) +-d------ -------- ataritt(us) +-------- -------- ataritt(de) +-d------ -------- xfree98(pc98) +-d------ -------- macintosh(macintosh) +-d------ -------- amiga(usa1) +-------- -------- amiga(de) diff -ruN /opt/SUNWut.orig/lib/xkb/keymap/README /opt/SUNWut/lib/xkb/keymap/README --- /opt/SUNWut.orig/lib/xkb/keymap/README 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keymap/README 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,8 @@ +The keymap component provides a way how to set up one pre-defined keyboard +mapping from a given set. It has been obsoleted by 'rules' component which +is simplier and more flexible. The directory is preserved for compatibility +reasons. Avoid using it if it is possible. + + + +/* $XFree86$ */ diff -ruN /opt/SUNWut.orig/lib/xkb/keymap/amiga /opt/SUNWut/lib/xkb/keymap/amiga --- /opt/SUNWut.orig/lib/xkb/keymap/amiga 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keymap/amiga 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,22 @@ +// $Xorg: amiga,v 1.3 2000/08/17 19:54:40 cpqbld Exp $ + + + + +// $XFree86: xc/programs/xkbcomp/keymap/amiga,v 3.2 1997/10/26 13:25:36 dawes Exp $ + +default xkb_keymap "usa1" { + xkb_keycodes { include "amiga(usa1)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "amiga(usa1)" }; + xkb_geometry { include "amiga(usa1)" }; +}; + +xkb_keymap "de" { + xkb_keycodes { include "amiga(de)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "amiga(de)" }; + xkb_geometry { include "amiga(de)" }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/keymap/ataritt /opt/SUNWut/lib/xkb/keymap/ataritt --- /opt/SUNWut.orig/lib/xkb/keymap/ataritt 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keymap/ataritt 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,21 @@ +// $Xorg: ataritt,v 1.3 2000/08/17 19:54:40 cpqbld Exp $ + + + + +// $XFree86: xc/programs/xkbcomp/keymap/ataritt,v 3.1 1997/10/26 13:25:37 dawes Exp $ + +default xkb_keymap "us" { + xkb_keycodes { include "ataritt(us)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "ataritt(us)" }; + xkb_geometry { include "ataritt(us)" }; +}; +xkb_keymap "de" { + xkb_keycodes { include "ataritt(de)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "ataritt(de)" }; + xkb_geometry { include "ataritt(de)" }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/keymap/digital/us /opt/SUNWut/lib/xkb/keymap/digital/us --- /opt/SUNWut.orig/lib/xkb/keymap/digital/us 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keymap/digital/us 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,188 @@ +// $Xorg: us,v 1.3 2000/08/17 19:54:40 cpqbld Exp $ +// +//Copyright (c) 1996 Digital Equipment Corporation +// +//Permission is hereby granted, free of charge, to any person obtaining +//a copy of this software and associated documentation files (the +//"Software"), to deal in the Software without restriction, including +//without limitation the rights to use, copy, modify, merge, publish, +//distribute, sublicense, and sell copies of the Software, and to +//permit persons to whom the Software is furnished to do so, subject to +//the following conditions: +// +//The above copyright notice and this permission notice shall be included +//in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +//OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL DIGITAL EQUIPMENT CORPORATION BE LIABLE FOR ANY CLAIM, +//DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR +//OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR +//THE USE OR OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of the Digital Equipment +//Corporation shall not be used in advertising or otherwise to promote +//the sale, use or other dealings in this Software without prior written +//authorization from Digital Equipment Corporation. +// +// HISTORY +// Log: us,v +// Revision 1.3 1996/06/18 09:14:51 erik +// use flags correctly, assorted cleanups and consortium fixes +// +// Revision 1.1.6.2 1995/10/25 21:00:53 William_Walker +// Add pc104-key support +// [1995/10/23 15:46:24 William_Walker] +// +// Revision 1.1.2.6 1995/06/27 12:18:05 William_Walker +// Add LK201 and LK450 support as well as TW and DP variants. +// [1995/06/26 20:26:19 William_Walker] +// +// Revision 1.1.2.5 1995/06/05 19:23:12 William_Walker +// New file. I love keymaps. +// [1995/06/05 18:14:04 William_Walker] +// +// EndLog +// +// @(#)RCSfile: us,v Revision: 1.3 (DEC) Date: 1996/02/02 14:21:15 +// + +// ************************************************************** +// * * +// * Keymaps for en_US.ISO8859-1 - English for U.S. * +// * * +// ************************************************************** + +xkb_keymap "lk201" { + xkb_keycodes { include "digital/lk(lk201)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "digital/us(vt105)" }; + xkb_geometry { description = "Digital US LK201"; + include "digital/lk(lk201)" }; +}; + +xkb_keymap "lk401" { + xkb_keycodes { include "digital/lk(lk401)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "digital/us(vt108)" }; + xkb_geometry { description = "Digital US LK401"; + include "digital/lk(lk401)" }; +}; + +xkb_keymap "lk411" { + xkb_keycodes { include "digital/pc(lk411)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "digital/us(vt108)" }; + xkb_geometry { description = "Digital US LK411"; + include "digital/lk(lk401)" }; +}; + +xkb_keymap "lk421" { + xkb_keycodes { include "digital/lk(lk421)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "digital/us(unix)" }; + xkb_geometry { description = "Digital US LK421"; + include "digital/unix(unix)" }; +}; + +xkb_keymap "lk441" { + xkb_keycodes { include "digital/lk(lk443)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "digital/us(lk44x)" }; + xkb_geometry { description = "Digital US LK441"; + include "digital/pc(pc101)" + include "digital/pc(leds_alone)" }; +}; + +xkb_keymap "lk443" { + xkb_keycodes { include "digital/lk(lk443)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "digital/us(lk44x)" }; + xkb_geometry { description = "Digital US LK443"; + include "digital/pc(pc101)" + include "digital/pc(leds_alone)" }; +}; + +xkb_keymap "lk44x" { + xkb_keycodes { include "digital/lk(lk443)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "digital/us(lk44x)" }; + xkb_geometry { description = "Digital US LK443"; + include "digital/pc(pc101)" + include "digital/pc(leds_alone)" }; +}; + +xkb_keymap "lk450" { + xkb_keycodes { include "digital/pc(lk450)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "digital/us(vt108)" }; + xkb_geometry { description = "Digital US LK450"; + include "digital/lk(lk450)" }; +}; + +xkb_keymap "pcxalaa" { + xkb_keycodes { include "digital/pc(pc101)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "digital/us(pcxalaa)" }; + xkb_geometry { description = "Digital US PCXAL-AA"; + include "digital/pc(pc101)" + include "digital/pc(leds_alone)" }; +}; + +xkb_keymap "pcxalfa" { + xkb_keycodes { include "digital/pc(pc101)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "digital/us(pcxalfa)" }; + xkb_geometry { description = "Digital US PCXAL-FA"; + include "digital/pc(pc101)" + include "digital/pc(leds_on_keys)" }; +}; + +xkb_keymap "pcxalga" { + xkb_keycodes { include "digital/pc(pc101)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "digital/us(pcxalga)" }; + xkb_geometry { description = "Digital US PCXAL-GA"; + include "digital/pc(pc101)" + include "digital/pc(leds_alone)" }; +}; + +xkb_keymap "pcxalka" { + xkb_keycodes { include "digital/pc(pc101)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "digital/us(pcxalka)" }; + xkb_geometry { description = "Digital US PCXAL-KA"; + include "digital/pc(pc101)" + include "digital/pc(leds_alone)" }; +}; + +xkb_keymap "pcxal" { + xkb_keycodes { include "digital/pc(pc101)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "digital/us(pcxal)" }; + xkb_geometry { description = "Digital US PCXAL"; + include "digital/pc(pc101)" + include "digital/pc(leds_alone)" }; +}; + +xkb_keymap "mnk" { + xkb_keycodes { include "digital/pc(pc104)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "digital/us(pc104)" }; + xkb_geometry { include "microsoft" }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/keymap/macintosh /opt/SUNWut/lib/xkb/keymap/macintosh --- /opt/SUNWut.orig/lib/xkb/keymap/macintosh 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keymap/macintosh 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,17 @@ +// $XConsortium: macintosh /main/11 1996/03/07 13:42:13 kaleb $ +// $XFree86: xc/programs/xkbcomp/keymap/macintosh,v 1.1 1999/05/23 05:27:51 dawes Exp $ +default xkb_keymap "macintosh" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "macintosh/us(extended)" }; + xkb_geometry { include "macintosh" }; +}; + +xkb_keymap "macintosh_old" { + xkb_keycodes { include "macintosh" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "macintosh/us(extended)" }; + xkb_geometry { include "macintosh" }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/keymap/sgi/be /opt/SUNWut/lib/xkb/keymap/sgi/be --- /opt/SUNWut.orig/lib/xkb/keymap/sgi/be 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keymap/sgi/be 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,34 @@ +// $Xorg: be,v 1.3 2000/08/17 19:54:40 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal)+be" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_nodeadkeys" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal_nodeadkeys)+be(nodeadkeys)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc102)+be" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_nodeadkeys" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102_nodeadkeys)+be(nodeadkeys)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/keymap/sgi/bg /opt/SUNWut/lib/xkb/keymap/sgi/bg --- /opt/SUNWut.orig/lib/xkb/keymap/sgi/bg 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keymap/sgi/bg 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,19 @@ +// $Xorg: bg,v 1.3 2000/08/17 19:54:40 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "us(pc_universal)+bg+group(shift_toggle)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "us(pc102)+bg+group(shift_toggle)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/keymap/sgi/ca /opt/SUNWut/lib/xkb/keymap/sgi/ca --- /opt/SUNWut.orig/lib/xkb/keymap/sgi/ca 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keymap/sgi/ca 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,33 @@ +// $Xorg: ca,v 1.3 2000/08/17 19:54:40 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal)+ca" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_nodeadkeys" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal_nodeadkeys)+ca(nodeadkeys)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc102)+ca" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_nodeadkeys" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102_nodeadkeys)+ca(nodeadkeys)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/keymap/sgi/cz /opt/SUNWut/lib/xkb/keymap/sgi/cz --- /opt/SUNWut.orig/lib/xkb/keymap/sgi/cz 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keymap/sgi/cz 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,21 @@ +// $Xorg: cs,v 1.3 2000/08/17 19:54:40 cpqbld Exp $ +// +// +// +// $XFree86$ + +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc_universal)+cz" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc102)+cz" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/keymap/sgi/cz_qwerty /opt/SUNWut/lib/xkb/keymap/sgi/cz_qwerty --- /opt/SUNWut.orig/lib/xkb/keymap/sgi/cz_qwerty 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keymap/sgi/cz_qwerty 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,21 @@ +// $Xorg: cs,v 1.3 2000/08/17 19:54:40 cpqbld Exp $ +// +// +// +// $XFree86$ + +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc_universal)+cz_qwerty" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc102)+cz_qwerty" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/keymap/sgi/de /opt/SUNWut/lib/xkb/keymap/sgi/de --- /opt/SUNWut.orig/lib/xkb/keymap/sgi/de 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keymap/sgi/de 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,34 @@ +// $Xorg: de,v 1.3 2000/08/17 19:54:40 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal)+de" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_nodeadkeys" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal_nodeadkeys)+de(nodeadkeys)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc102)+de" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_nodeadkeys" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102_nodeadkeys)+de(nodeadkeys)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/keymap/sgi/de_CH /opt/SUNWut/lib/xkb/keymap/sgi/de_CH --- /opt/SUNWut.orig/lib/xkb/keymap/sgi/de_CH 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keymap/sgi/de_CH 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,34 @@ +// $Xorg: de_CH,v 1.3 2000/08/17 19:54:40 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal)+de_CH" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_nodeadkeys" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal_nodeadkeys)+de_CH(nodeadkeys)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc102)+de_CH" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_nodeadkeys" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102_nodeadkeys)+de_CH(nodeadkeys)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/keymap/sgi/dk /opt/SUNWut/lib/xkb/keymap/sgi/dk --- /opt/SUNWut.orig/lib/xkb/keymap/sgi/dk 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keymap/sgi/dk 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,34 @@ +// $Xorg: dk,v 1.3 2000/08/17 19:54:40 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal)+dk" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_nodeadkeys" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal_nodeadkeys)+dk(nodeadkeys)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc102)+dk" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_nodeadkeys" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102_nodeadkeys)+dk(nodeadkeys)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/keymap/sgi/dvorak /opt/SUNWut/lib/xkb/keymap/sgi/dvorak --- /opt/SUNWut.orig/lib/xkb/keymap/sgi/dvorak 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keymap/sgi/dvorak 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,15 @@ +// $Xorg: dvorak,v 1.3 2000/08/17 19:54:40 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc_universal)+dvorak" }; + xkb_geometry { include "sgi/indy(pc101)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc101)+dvorak" }; + xkb_geometry { include "sgi/indigo(pc101)" }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/keymap/sgi/en_US /opt/SUNWut/lib/xkb/keymap/sgi/en_US --- /opt/SUNWut.orig/lib/xkb/keymap/sgi/en_US 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keymap/sgi/en_US 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,58 @@ +// $Xorg: en_US,v 1.3 2000/08/17 19:54:40 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal)" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_nodeadkeys" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal_nodeadkeys)" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy101" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal)" }; + xkb_geometry { include "sgi/indy(pc101)" }; +}; +xkb_keymap "indy101_nodeadkeys" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal_nodeadkeys)" }; + xkb_geometry { include "sgi/indy(pc101)" }; +}; +xkb_keymap "indy104" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal)" }; + xkb_geometry { include "microsoft(natural)" }; +}; +xkb_keymap "indy104_nodeadkeys" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal_nodeadkeys)" }; + xkb_geometry { include "microsoft(natural)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc102)" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_nodeadkeys" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc102_nodeadkeys)" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/keymap/sgi/es /opt/SUNWut/lib/xkb/keymap/sgi/es --- /opt/SUNWut.orig/lib/xkb/keymap/sgi/es 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keymap/sgi/es 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,34 @@ +// $Xorg: es,v 1.3 2000/08/17 19:54:40 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal)+es" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_nodeadkeys" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal_nodeadkeys)+es(nodeadkeys)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc102)+es" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_nodeadkeys" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102_nodeadkeys)+es(nodeadkeys)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/keymap/sgi/fi /opt/SUNWut/lib/xkb/keymap/sgi/fi --- /opt/SUNWut.orig/lib/xkb/keymap/sgi/fi 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keymap/sgi/fi 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,34 @@ +// $Xorg: fi,v 1.3 2000/08/17 19:54:40 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal)+fi" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_nodeadkeys" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal_nodeadkeys)+fi(nodeadkeys)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc102)+fi" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_nodeadkeys" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102_nodeadkeys)+fi(nodeadkeys)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/keymap/sgi/fr /opt/SUNWut/lib/xkb/keymap/sgi/fr --- /opt/SUNWut.orig/lib/xkb/keymap/sgi/fr 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keymap/sgi/fr 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,34 @@ +// $Xorg: fr,v 1.3 2000/08/17 19:54:40 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal)+fr" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_nodeadkeys" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal_nodeadkeys)+fr(nodeadkeys)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc102)+fr" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_nodeadkeys" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102_nodeadkeys)+fr(nodeadkeys)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/keymap/sgi/fr_CH /opt/SUNWut/lib/xkb/keymap/sgi/fr_CH --- /opt/SUNWut.orig/lib/xkb/keymap/sgi/fr_CH 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keymap/sgi/fr_CH 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,34 @@ +// $Xorg: fr_CH,v 1.3 2000/08/17 19:54:40 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal)+fr_CH" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_nodeadkeys" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal_nodeadkeys)+fr_CH(nodeadkeys)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc102)+fr_CH" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_nodeadkeys" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102_nodeadkeys)+fr_CH(nodeadkeys)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/keymap/sgi/gb /opt/SUNWut/lib/xkb/keymap/sgi/gb --- /opt/SUNWut.orig/lib/xkb/keymap/sgi/gb 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keymap/sgi/gb 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,34 @@ +// $Xorg: gb,v 1.3 2000/08/17 19:54:40 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal)+gb" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_nodeadkeys" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal_nodeadkeys)+gb(nodeadkeys)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc102)+gb" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_nodeadkeys" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102_nodeadkeys)+gb(nodeadkeys)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/keymap/sgi/hu /opt/SUNWut/lib/xkb/keymap/sgi/hu --- /opt/SUNWut.orig/lib/xkb/keymap/sgi/hu 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keymap/sgi/hu 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,105 @@ +// $Xorg: hu,v 1.3 2000/08/17 19:54:41 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal)+hu(basic)" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_toggle" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal)+hu(basic)+group(toggle)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_shift_toggle" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal)+hu(basic)+group(shift_toggle)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_ctrl_shift_toggle" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal)+hu(basic)+group(ctrl_shift_toggle)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_ctrl_alt_toggle" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal)+hu(basic)+group(ctrl_alt_toggle)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_caps_toggle" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal)+hu(basic)+group(caps_toggle)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc102)+hu(basic)" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_toggle" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102)+hu(basic)+group(toggle)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_shift_toggle" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102)+hu(basic)+group(shift_toggle)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_ctrl_shift_toggle" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102)+hu(basic)+group(ctrl_shift_toggle)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_ctrl_alt_toggle" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102)+hu(basic)+group(ctrl_alt_toggle)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_caps_toggle" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102)+hu(basic)+group(caps_toggle)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/keymap/sgi/it /opt/SUNWut/lib/xkb/keymap/sgi/it --- /opt/SUNWut.orig/lib/xkb/keymap/sgi/it 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keymap/sgi/it 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,34 @@ +// $Xorg: it,v 1.3 2000/08/17 19:54:41 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal)+it" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_nodeadkeys" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal_nodeadkeys)+it(nodeadkeys)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc102)+it" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_nodeadkeys" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102_nodeadkeys)+it(nodeadkeys)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/keymap/sgi/jp /opt/SUNWut/lib/xkb/keymap/sgi/jp --- /opt/SUNWut.orig/lib/xkb/keymap/sgi/jp 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keymap/sgi/jp 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,8 @@ +// $Xorg: jp,v 1.3 2000/08/17 19:54:41 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(jp106)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc101)+sgi/jp" }; + xkb_geometry { include "sgi/indy(jp106)" }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/keymap/sgi/no /opt/SUNWut/lib/xkb/keymap/sgi/no --- /opt/SUNWut.orig/lib/xkb/keymap/sgi/no 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keymap/sgi/no 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,34 @@ +// $Xorg: no,v 1.3 2000/08/17 19:54:41 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal)+no" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_nodeadkeys" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal_nodeadkeys)+no(nodeadkeys)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc102)+no" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_nodeadkeys" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102_nodeadkeys)+no(nodeadkeys)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/keymap/sgi/pl /opt/SUNWut/lib/xkb/keymap/sgi/pl --- /opt/SUNWut.orig/lib/xkb/keymap/sgi/pl 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keymap/sgi/pl 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,29 @@ +// $Xorg: pl,v 1.3 2000/08/17 19:54:41 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc_universal)+pl" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_nodeadkeys" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc_universal)+pl(nodeadkeys)" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc102)+pl" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_nodeadkeys" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc102)+pl(nodeadkeys)" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/keymap/sgi/pt /opt/SUNWut/lib/xkb/keymap/sgi/pt --- /opt/SUNWut.orig/lib/xkb/keymap/sgi/pt 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keymap/sgi/pt 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,34 @@ +// $Xorg: pt,v 1.3 2000/08/17 19:54:41 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal)+pt" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_nodeadkeys" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal_nodeadkeys)+pt(nodeadkeys)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc102)+pt" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_nodeadkeys" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102_nodeadkeys)+pt(nodeadkeys)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/keymap/sgi/ru /opt/SUNWut/lib/xkb/keymap/sgi/ru --- /opt/SUNWut.orig/lib/xkb/keymap/sgi/ru 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keymap/sgi/ru 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,105 @@ +// $Xorg: ru,v 1.3 2000/08/17 19:54:41 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal)+ru(basic)" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_toggle" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal)+ru(basic)+group(toggle)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_shift_toggle" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal)+ru(basic)+group(shift_toggle)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_ctrl_shift_toggle" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal)+ru(basic)+group(ctrl_shift_toggle)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_ctrl_alt_toggle" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal)+ru(basic)+group(ctrl_alt_toggle)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_caps_toggle" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal)+ru(basic)+group(caps_toggle)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc102)+ru(basic)" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_toggle" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102)+ru(basic)+group(toggle)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_shift_toggle" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102)+ru(basic)+group(shift_toggle)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_ctrl_shift_toggle" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102)+ru(basic)+group(ctrl_shift_toggle)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_ctrl_alt_toggle" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102)+ru(basic)+group(ctrl_alt_toggle)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_caps_toggle" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102)+ru(basic)+group(caps_toggle)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/keymap/sgi/se /opt/SUNWut/lib/xkb/keymap/sgi/se --- /opt/SUNWut.orig/lib/xkb/keymap/sgi/se 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keymap/sgi/se 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,34 @@ +// $Xorg: se,v 1.3 2000/08/17 19:54:41 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc_universal)+se" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indy_nodeadkeys" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal_nodeadkeys)+se(nodeadkeys)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc102)+se" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; +xkb_keymap "indigo_nodeadkeys" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc102_nodeadkeys)+se(nodeadkeys)" + }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/keymap/sgi/sk /opt/SUNWut/lib/xkb/keymap/sgi/sk --- /opt/SUNWut.orig/lib/xkb/keymap/sgi/sk 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keymap/sgi/sk 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,21 @@ +// $Xorg: cs,v 1.3 2000/08/17 19:54:40 cpqbld Exp $ +// +// +// +// $XFree86$ + +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc_universal)+sk" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc102)+sk" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/keymap/sgi/sk_qwerty /opt/SUNWut/lib/xkb/keymap/sgi/sk_qwerty --- /opt/SUNWut.orig/lib/xkb/keymap/sgi/sk_qwerty 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keymap/sgi/sk_qwerty 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,21 @@ +// $Xorg: cs,v 1.3 2000/08/17 19:54:40 cpqbld Exp $ +// +// +// +// $XFree86$ + +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc_universal)+sk_qwerty" }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc102)+sk_qwerty" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/keymap/sgi/th /opt/SUNWut/lib/xkb/keymap/sgi/th --- /opt/SUNWut.orig/lib/xkb/keymap/sgi/th 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keymap/sgi/th 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,17 @@ +// $Xorg: th,v 1.3 2000/08/17 19:54:41 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { + include "en_US(pc_universal)+th+group(shift_toggle)" + }; + xkb_geometry { include "sgi/indy(pc102)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc102)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc102)+th+group(shift_toggle)" }; + xkb_geometry { include "sgi/indigo(pc102)" }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/keymap/sgi/us /opt/SUNWut/lib/xkb/keymap/sgi/us --- /opt/SUNWut.orig/lib/xkb/keymap/sgi/us 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keymap/sgi/us 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,43 @@ +// $Xorg: us,v 1.3 2000/08/17 19:54:41 cpqbld Exp $ +default xkb_keymap "indy" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc_universal)" }; + xkb_geometry { include "sgi/indy(pc101)" }; +}; +xkb_keymap "indy101_euro" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc_universal)" }; + xkb_geometry { include "sgi/indy(pc101)" }; +}; +xkb_keymap "indy_compose" { + xkb_keycodes { include "sgi/indy(universal)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc_universal)" }; + xkb_geometry { include "sgi/indy(pc101)" }; +}; +xkb_keymap "indigo" { + xkb_keycodes { include "sgi/indigo(pc101)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc101)" }; + xkb_geometry { include "sgi/indigo(pc101)" }; +}; +xkb_keymap "indigo_compose" { + xkb_keycodes { include "sgi/indigo(pc101)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc101compose)" }; + xkb_geometry { include "sgi/indigo(pc101)" }; +}; +xkb_keymap "indigo101_compose" { + xkb_keycodes { include "sgi/indigo(pc101)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc101euro)" }; + xkb_geometry { include "sgi/indigo(pc101)" }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/keymap/sony /opt/SUNWut/lib/xkb/keymap/sony --- /opt/SUNWut.orig/lib/xkb/keymap/sony 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keymap/sony 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,33 @@ +// $Xorg: sony,v 1.4 2001/02/09 02:05:52 xorgcvs Exp $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +xkb_keymap "news5000-nwp5461" { + xkb_keycodes { include "sony(nwp5461)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sony/us(nwp5461)" }; + xkb_geometry { include "sony(nwp5461)" }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/keymap/sun/all /opt/SUNWut/lib/xkb/keymap/sun/all --- /opt/SUNWut.orig/lib/xkb/keymap/sun/all 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keymap/sun/all 2008-06-18 23:52:46.000000000 +0200 @@ -0,0 +1,1092 @@ +// x86 KEYBOARDS +// +// Generally, x86 keyboards fall into either pc101 (101-key) or pc102 +// (102-key European) categories. Symbol tables are typically formed by +// augmenting sun/us(pc101) or sun/us(pc102) with the "extra" symbols +// from the type5 definition. Geometries and keycodes for many of +// these fall under sun(x86) or sun(x86tuv). +// +// USB KEYBOARDS +// +// Only the keycodes (scancodes) change in the Universal Serial Bus +// keyboard definitions. Symbols are kept the same as in the type5 +// case. The USB HID spec is confusing on this point, but the +// scancodes described in it relate to physical keys, not symbols, as +// it might lead one to believe. +// +// HOBO KEYBOARDS +// +// Hobo keyboards are derived from type5 keyboards, which in turn, +// are all derived from the type5 US keyboard. Use the +// appropriate set of keycodes and geometry (either type5hobo or +// type5tuvhobo) and select the symbol set sun/us(type5hobo) to +// replace sun/us(type5). For example, Sweden5_Hobo: +// +// xkb_keymap "Sweden5_Hobo" { +// xkb_keycodes { include "sun(type5tuvhobo)" }; +// xkb_types { include "default" }; +// xkb_compatibility { include "default" }; +// xkb_symbols { include "sun/us(type5hobo)+sun/se(type5)"}; +// xkb_geometry { include "sun(type5tuvhobo)" }; +// }; +// +// Doing it this way allows all the symbol changes for a particular +// type5 keyboard to hold for a Hobo keyboard; both keyboards, in +// this case, would use sun/se(type5) to augment the symbols in the +// US keboard definition. + +xkb_keymap "Belgian6" { + xkb_keycodes { include "sun(type6tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+be" }; + xkb_geometry { include "sun(type6tuv)" }; +}; + +xkb_keymap "Belgian6_usb" { + xkb_keycodes { include "sun(type6tuv_usb)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+be" }; + xkb_geometry { include "sun(type6tuv)" }; +}; + +xkb_keymap "Canada4" { + xkb_keycodes { include "sun(type4_ca)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/ca(type4)" }; + xkb_geometry { include "sun(type4_ca)" }; +}; + +xkb_keymap "Canada_Fr5" { + xkb_keycodes { include "sun(type5tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/ca(type5)"}; + xkb_geometry { include "sun(type5tuv)" }; +}; + +xkb_keymap "Canada_Fr5_Hobo" { + xkb_keycodes { include "sun(type5tuvhobo)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5hobo)+sun/ca(type5)"}; + xkb_geometry { include "sun(type5tuvhobo)" }; +}; + +xkb_keymap "Canada_Fr5_TBITS5" { + xkb_keycodes { include "sun(type5tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/ca(type5tbits5)"}; + xkb_geometry { include "sun(type5tuv)" }; +}; + +xkb_keymap "Canada_Fr_x86" { + xkb_keycodes { include "sun(x86ca)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(pc101)+sun/ca(x86)"}; + xkb_geometry { include "sun(x86ca)" }; +}; + +xkb_keymap "Switzer_Fr4" { + xkb_keycodes { include "sun(type4tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/sw(type4fr)" }; + xkb_geometry { include "sun(type4tuv)" }; +}; + +xkb_keymap "Switzer_Fr5" { + xkb_keycodes { include "sun(type5tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/sw(type5fr)" }; + xkb_geometry { include "sun(type5tuv)" }; +}; + +xkb_keymap "Switzer_Fr5_Hobo" { + xkb_keycodes { include "sun(type5tuvhobo)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5hobo)+sun/sw(type5fr)"}; + xkb_geometry { include "sun(type5tuvhobo)" }; +}; + +xkb_keymap "Switzer_Fr6" { + xkb_keycodes { include "sun(type6tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/sw(type5fr)"}; + xkb_geometry { include "sun(type6tuv)" }; +}; + +xkb_keymap "Switzer_Fr6_usb" { + xkb_keycodes { include "sun(type6tuv_usb)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/sw(type5fr)"}; + xkb_geometry { include "sun(type6tuv)" }; +}; + +xkb_keymap "Switzer_Fr_x86" { + xkb_keycodes { include "sun(x86tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(pc102)+sun/sw(type5fr)"}; + xkb_geometry { include "sun(x86tuv)" }; +}; + +xkb_keymap "Switzer_Ge4" { + xkb_keycodes { include "sun(type4tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/sw(type4de)" }; + xkb_geometry { include "sun(type4tuv)" }; +}; + +xkb_keymap "Switzer_Ge5" { + xkb_keycodes { include "sun(type5tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/sw(type5de)"}; + xkb_geometry { include "sun(type5tuv)" }; +}; + +xkb_keymap "Switzer_Ge5_Hobo" { + xkb_keycodes { include "sun(type5tuvhobo)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5hobo)+sun/sw(type5de)"}; + xkb_geometry { include "sun(type5tuvhobo)" }; +}; + +xkb_keymap "Switzer_Ge6" { + xkb_keycodes { include "sun(type6tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/sw(type5de)"}; + xkb_geometry { include "sun(type6tuv)" }; +}; + +xkb_keymap "Switzer_Ge6_usb" { + xkb_keycodes { include "sun(type6tuv_usb)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/sw(type5de)"}; + xkb_geometry { include "sun(type6tuv)" }; +}; + +xkb_keymap "Switzer_Ge_x86" { + xkb_keycodes { include "sun(x86tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(pc102)+sun/sw(type5de)"}; + xkb_geometry { include "sun(x86tuv)" }; +}; + +xkb_keymap "Czech5" { + xkb_keycodes { include "sun(type5tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/cz(type5)" }; + xkb_geometry { include "sun(type5tuv)" }; +}; + + +xkb_keymap "Germany4" { + xkb_keycodes { include "sun(type4tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/de(type4)" }; + xkb_geometry { include "sun(type4tuv)" }; +}; + +xkb_keymap "Germany5" { + xkb_keycodes { include "sun(type5tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+de" }; + xkb_geometry { include "sun(type5tuv)" }; +}; + +xkb_keymap "Germany5_Hobo" { + xkb_keycodes { include "sun(type5tuvhobo)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5hobo)+de"}; + xkb_geometry { include "sun(type5tuvhobo)" }; +}; + +xkb_keymap "Germany6" { + xkb_keycodes { include "sun(type6tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+de" }; + xkb_geometry { include "sun(type6tuv)" }; +}; + +xkb_keymap "Germany6_usb" { + xkb_keycodes { include "sun(type6tuv_usb)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+de" }; + xkb_geometry { include "sun(type6tuv)" }; +}; + +xkb_keymap "Germany_x86" { + xkb_keycodes { include "sun(x86tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(pc102)+de"}; + xkb_geometry { include "sun(x86tuv)" }; +}; + +xkb_keymap "Denmark4" { + xkb_keycodes { include "sun(type4tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/dk(type4)" }; + xkb_geometry { include "sun(type4tuv)" }; +}; + +xkb_keymap "Denmark5" { + xkb_keycodes { include "sun(type5tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/dk(type5)" }; + xkb_geometry { include "sun(type5tuv)" }; +}; + +xkb_keymap "Denmark5_Hobo" { + xkb_keycodes { include "sun(type5tuvhobo)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5hobo)+sun/dk(type5)" }; + xkb_geometry { include "sun(type5tuvhobo)" }; +}; + +xkb_keymap "Denmark6" { + xkb_keycodes { include "sun(type6tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/dk(type5)" }; + xkb_geometry { include "sun(type6tuv)" }; +}; + +xkb_keymap "Denmark6_usb" { + xkb_keycodes { include "sun(type6tuv_usb)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/dk(type5)" }; + xkb_geometry { include "sun(type6tuv)" }; +}; + +xkb_keymap "Denmark_x86" { + xkb_keycodes { include "sun(x86tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(pc102)+sun/dk(type5)" }; + xkb_geometry { include "sun(x86tuv)" }; +}; + +xkb_keymap "SpainLatAm4" { + xkb_keycodes { include "sun(type4tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/es(type4)" }; + xkb_geometry { include "sun(type4tuv)" }; +}; + +xkb_keymap "Spain5" { + xkb_keycodes { include "sun(type5tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/es(type5)" }; + xkb_geometry { include "sun(type5tuv)" }; +}; + +xkb_keymap "Spain5_Hobo" { + xkb_keycodes { include "sun(type5tuvhobo)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5hobo)+sun/es(type5)"}; + xkb_geometry { include "sun(type5tuvhobo)" }; +}; + +xkb_keymap "Spain6" { + xkb_keycodes { include "sun(type6tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/es(type5)" }; + xkb_geometry { include "sun(type6tuv)" }; +}; + +xkb_keymap "Spain6_usb" { + xkb_keycodes { include "sun(type6tuv_usb)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/es(type5)" }; + xkb_geometry { include "sun(type6tuv)" }; +}; + +xkb_keymap "Spain_x86" { + xkb_keycodes { include "sun(x86tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(pc102)+sun/es(type5)" }; + xkb_geometry { include "sun(x86tuv)" }; +}; + + +xkb_keymap "Finnish6" { + xkb_keycodes { include "sun(type6tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/fi"}; + xkb_geometry { include "sun(type6tuv)" }; +}; + +xkb_keymap "Finnish6_usb" { + xkb_keycodes { include "sun(type6tuv_usb)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/fi"}; + xkb_geometry { include "sun(type6tuv)" }; +}; + + +xkb_keymap "FranceBelg4" { + xkb_keycodes { include "sun(type4tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/fr(type4)" }; + xkb_geometry { include "sun(type4tuv)" }; +}; + +xkb_keymap "France5" { + xkb_keycodes { include "sun(type5tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/fr(type5)" }; + xkb_geometry { include "sun(type5tuv)" }; +}; + +xkb_keymap "France5_Hobo" { + xkb_keycodes { include "sun(type5tuvhobo)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5hobo)+sun/fr(type5)"}; + xkb_geometry { include "sun(type5tuvhobo)" }; +}; + +xkb_keymap "France6" { + xkb_keycodes { include "sun(type6tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/fr(type5)" }; + xkb_geometry { include "sun(type6tuv)" }; +}; + +xkb_keymap "France6_usb" { + xkb_keycodes { include "sun(type6tuv_usb)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/fr(type5)" }; + xkb_geometry { include "sun(type6tuv)" }; +}; + +xkb_keymap "France_x86" { + xkb_keycodes { include "sun(x86tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(pc102)+sun/fr(type5)" }; + xkb_geometry { include "sun(x86tuv)" }; +}; + +xkb_keymap "Greece5" { + xkb_keycodes { include "sun(type5tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/gr(type5)" }; + xkb_geometry { include "sun(type5tuv)" }; +}; + + +xkb_keymap "Hungary5" { + xkb_keycodes { include "sun(type5tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5basic)+sun/hu(type5)" }; + xkb_geometry { include "sun(type5tuv)" }; +}; + + +xkb_keymap "Italy4" { + xkb_keycodes { include "sun(type4tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/it(type4)" }; + xkb_geometry { include "sun(type4tuv)" }; +}; + +xkb_keymap "Italy5" { + xkb_keycodes { include "sun(type5tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/it(type5)" }; + xkb_geometry { include "sun(type5tuv)" }; +}; + +xkb_keymap "Italy5_Hobo" { + xkb_keycodes { include "sun(type5tuvhobo)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5hobo)+sun/it(type5)"}; + xkb_geometry { include "sun(type5tuvhobo)" }; +}; + +xkb_keymap "Italy6" { + xkb_keycodes { include "sun(type6tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/it(type5)" }; + xkb_geometry { include "sun(type6tuv)" }; +}; + +xkb_keymap "Italy6_usb" { + xkb_keycodes { include "sun(type6tuv_usb)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/it(type5)" }; + xkb_geometry { include "sun(type6tuv)" }; +}; + +xkb_keymap "Italy_x86" { + xkb_keycodes { include "sun(x86tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(pc102)+sun/it(type5)" }; + xkb_geometry { include "sun(x86tuv)" }; +}; + +xkb_keymap "Japan4" { + xkb_keycodes { include "sun(type4_jp)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/jp(type4)" }; + xkb_geometry { include "sun(type4jp)" }; +}; + +xkb_keymap "Japan5" { + xkb_keycodes { include "sun(type5_jp)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/jp(type5)" }; + xkb_geometry { include "sun(type5jp)" }; +}; + +xkb_keymap "Japan5_Hobo" { + xkb_keycodes { include "sun(type5_jphobo)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/jp(type5hobo)" }; + xkb_geometry { include "sun(type5jphobo)" }; +}; + +xkb_keymap "Japan6" { + xkb_keycodes { include "sun(type6_jp)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/jp(type5)" }; + xkb_geometry { include "sun(type6jp)" }; +}; + +xkb_keymap "Japan6_usb" { + xkb_keycodes { include "sun(type6_jp_usb)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/jp(type5)" }; + xkb_geometry { include "sun(type6jp)" }; +}; + +xkb_keymap "Japan_x86" { + xkb_keycodes { include "sun(x86jp)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/jp(x86)" }; + xkb_geometry { include "sun(x86jp)" }; +}; + +xkb_keymap "J3100" { + xkb_keycodes { include "sun(x86tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/jp(J3100)" }; + xkb_geometry { include "sun(x86tuv)" }; +}; + +xkb_keymap "Japan_Muhenkan_x86" { + xkb_keycodes { include "sun(x86jp)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/jp(Muhenkan_x86)" }; + xkb_geometry { include "sun(x86jp)" }; +}; + +xkb_keymap "Korea4" { + xkb_keycodes { include "sun(type4)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/ko(type4)" }; + xkb_geometry { include "sun(type4)" }; +}; + +xkb_keymap "Korea5" { + xkb_keycodes { include "sun(type5)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/ko(type5)" }; + xkb_geometry { include "sun(type5)" }; +}; + +xkb_keymap "Korea5_Hobo" { + xkb_keycodes { include "sun(type5hobo)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5hobo)+sun/ko(type5)"}; + xkb_geometry { include "sun(type5hobo)" }; +}; + +xkb_keymap "Korea6" { + xkb_keycodes { include "sun(type6)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/ko(type5)" }; + xkb_geometry { include "sun(type6)" }; +}; + +xkb_keymap "Korea6_usb" { + xkb_keycodes { include "sun(type6_usb)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/ko(type5)" }; + xkb_geometry { include "sun(type6)" }; +}; + +xkb_keymap "Korea_x86" { + xkb_keycodes { include "sun(x86ko)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(pc101)+sun/ko(type5)" }; + xkb_geometry { include "sun(x86ko)" }; +}; + +xkb_keymap "Lithuania5" { + xkb_keycodes { include "sun(type5tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5basic)+sun/lt(type5)" }; + xkb_geometry { include "sun(type5tuv)" }; +}; + + +xkb_keymap "Latvia5" { + xkb_keycodes { include "sun(type5tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5basic)+sun/lv(type5)" }; + xkb_geometry { include "sun(type5tuv)" }; +}; + +xkb_keymap "MS_US101A_x86" { + xkb_keycodes { include "sun(MS_x86)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(pc104)" }; + xkb_geometry { include "sun(MS_x86)" }; +}; + +xkb_keymap "Netherland4" { + xkb_keycodes { include "sun(type4tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/nl(type4)" }; + xkb_geometry { include "sun(type4tuv)" }; +}; + +xkb_keymap "Netherland5" { + xkb_keycodes { include "sun(type5tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+nl" }; + xkb_geometry { include "sun(type5tuv)" }; +}; + +xkb_keymap "Netherland5_Hobo" { + xkb_keycodes { include "sun(type5tuvhobo)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5hobo)+nl" }; + xkb_geometry { include "sun(type5tuvhobo)" }; +}; + +xkb_keymap "Netherland6" { + xkb_keycodes { include "sun(type6tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+nl" }; + xkb_geometry { include "sun(type6tuv)" }; +}; + +xkb_keymap "Netherland6_usb" { + xkb_keycodes { include "sun(type6tuv_usb)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+nl" }; + xkb_geometry { include "sun(type6tuv)" }; +}; + +xkb_keymap "Netherland_x86" { + xkb_keycodes { include "sun(x86tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(pc102)+nl" }; + xkb_geometry { include "sun(x86tuv)" }; +}; + +xkb_keymap "Norway4" { + xkb_keycodes { include "sun(type4tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/no(type4)" }; + xkb_geometry { include "sun(type4tuv)" }; +}; + +xkb_keymap "Norway5" { + xkb_keycodes { include "sun(type5tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/no(type5)"}; + xkb_geometry { include "sun(type5tuv)" }; +}; + +xkb_keymap "Norway5_Hobo" { + xkb_keycodes { include "sun(type5tuvhobo)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5hobo)+sun/no(type5)"}; + xkb_geometry { include "sun(type5tuvhobo)" }; +}; + +xkb_keymap "Norway6" { + xkb_keycodes { include "sun(type6tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/no(type5)" }; + xkb_geometry { include "sun(type6tuv)" }; +}; + +xkb_keymap "Norway6_usb" { + xkb_keycodes { include "sun(type6tuv_usb)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/no(type5)" }; + xkb_geometry { include "sun(type6tuv)" }; +}; + +xkb_keymap "Norway_x86" { + xkb_keycodes { include "sun(x86tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(pc102)+sun/no(type5)" }; + xkb_geometry { include "sun(x86tuv)" }; +}; + +xkb_keymap "Poland5" { + xkb_keycodes { include "sun(type5tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/pl" }; + xkb_geometry { include "sun(type5tuv)" }; +}; + +xkb_keymap "Portugal4" { + xkb_keycodes { include "sun(type4tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/pt(type4)" }; + xkb_geometry { include "sun(type4tuv)" }; +}; + +xkb_keymap "Portugal5" { + xkb_keycodes { include "sun(type5tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/pt(type5)" }; + xkb_geometry { include "sun(type5tuv)" }; +}; + +xkb_keymap "Portugal5_Hobo" { + xkb_keycodes { include "sun(type5tuvhobo)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5hobo)+sun/pt(type5)"}; + xkb_geometry { include "sun(type5tuvhobo)" }; +}; + +xkb_keymap "Portugal6" { + xkb_keycodes { include "sun(type6tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/pt(type5)" }; + xkb_geometry { include "sun(type6tuv)" }; +}; + +xkb_keymap "Portugal6_usb" { + xkb_keycodes { include "sun(type6tuv_usb)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/pt(type5)" }; + xkb_geometry { include "sun(type6tuv)" }; +}; + +xkb_keymap "Portugal_x86" { + xkb_keycodes { include "sun(x86tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(pc102)+sun/pt(type5)" }; + xkb_geometry { include "sun(x86tuv)" }; +}; + +// xkb_keymap "Russia4" { +// xkb_keycodes { include "sun(type4)" }; +// xkb_types { include "default" }; +// xkb_compatibility { include "default" }; +// xkb_symbols { include "sun/ru" }; +// xkb_geometry { include "sun(type4)" }; +// }; + +xkb_keymap "Russia5" { + xkb_keycodes { include "sun(type5tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/ru"}; + xkb_geometry { include "sun(type5tuv)" }; +}; + +xkb_keymap "Russia6" { + xkb_keycodes { include "sun(type6tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/ru"}; + xkb_geometry { include "sun(type6tuv)" }; +}; + +xkb_keymap "Russia6_usb" { + xkb_keycodes { include "sun(type6tuv_usb)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/ru"}; + xkb_geometry { include "sun(type6tuv)" }; +}; + +xkb_keymap "SwedenFin4" { + xkb_keycodes { include "sun(type4tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/se(type4)" }; + xkb_geometry { include "sun(type4tuv)" }; +}; + +xkb_keymap "Sweden5" { + xkb_keycodes { include "sun(type5tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/se(type5)"}; + xkb_geometry { include "sun(type5tuv)" }; +}; + +xkb_keymap "Sweden5_Hobo" { + xkb_keycodes { include "sun(type5tuvhobo)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5hobo)+sun/se(type5)"}; + xkb_geometry { include "sun(type5tuvhobo)" }; +}; + +xkb_keymap "Sweden6" { + xkb_keycodes { include "sun(type6tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/se(type5)" }; + xkb_geometry { include "sun(type6tuv)" }; +}; + +xkb_keymap "Sweden6_usb" { + xkb_keycodes { include "sun(type6tuv_usb)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/se(type5)" }; + xkb_geometry { include "sun(type6tuv)" }; +}; + +xkb_keymap "Sweden_x86" { + xkb_keycodes { include "sun(x86tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(pc102)+sun/se(type5)" }; + xkb_geometry { include "sun(x86tuv)" }; +}; + +xkb_keymap "Turkey5" { + xkb_keycodes { include "sun(type5tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/tr" }; + xkb_geometry { include "sun(type5tuv)" }; +}; + +xkb_keymap "Turkey6" { + xkb_keycodes { include "sun(type6tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/tr"}; + xkb_geometry { include "sun(type6tuv)" }; +}; + +xkb_keymap "Turkey6_usb" { + xkb_keycodes { include "sun(type6tuv_usb)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/tr"}; + xkb_geometry { include "sun(type6tuv)" }; +}; + +xkb_keymap "TurkeyQ6" { + xkb_keycodes { include "sun(type6tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/tr(type6Q)"}; + xkb_geometry { include "sun(type6tuv)" }; +}; + +xkb_keymap "TurkeyQ6_usb" { + xkb_keycodes { include "sun(type6tuv_usb)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/tr(type6Q)"}; + xkb_geometry { include "sun(type6tuv)" }; +}; + +xkb_keymap "TurkeyF6" { + xkb_keycodes { include "sun(type6tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/tr(type6F)"}; + xkb_geometry { include "sun(type6)" }; +}; + +xkb_keymap "TurkeyF6_usb" { + xkb_keycodes { include "sun(type6tuv_usb)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/tr(type6F)"}; + xkb_geometry { include "sun(type6)" }; +}; + +xkb_keymap "Taiwan4" { + xkb_keycodes { include "sun(type4)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/tw(type4)" }; + xkb_geometry { include "sun(type4)" }; +}; + +xkb_keymap "Taiwan5" { + xkb_keycodes { include "sun(type5)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/tw(type5)" }; + xkb_geometry { include "sun(type5)" }; +}; + +xkb_keymap "Taiwan5_Hobo" { + xkb_keycodes { include "sun(type5hobo)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5hobo)+sun/tw(type5)" }; + xkb_geometry { include "sun(type5hobo)" }; +}; + +xkb_keymap "Taiwan6" { + xkb_keycodes { include "sun(type6)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/tw(type5)" }; + xkb_geometry { include "sun(type6)" }; +}; + +xkb_keymap "Taiwan6_usb" { + xkb_keycodes { include "sun(type6_usb)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/tw(type5)" }; + xkb_geometry { include "sun(type6)" }; +}; + +xkb_keymap "Taiwan_x86" { + xkb_keycodes { include "sun(x86)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc101)" }; + xkb_geometry { include "sun(x86)" }; +}; + +xkb_keymap "UK4" { + xkb_keycodes { include "sun(type4)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/gb(type4)" }; + xkb_geometry { include "sun(type4)" }; +}; + +xkb_keymap "UK5" { + xkb_keycodes { include "sun(type5tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/gb(type5)" }; + xkb_geometry { include "sun(type5tuv)" }; +}; + +xkb_keymap "UK5_Hobo" { + xkb_keycodes { include "sun(type5tuvhobo)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5hobo)+sun/gb(type5)" }; + xkb_geometry { include "sun(type5tuvhobo)" }; +}; + +xkb_keymap "UK6" { + xkb_keycodes { include "sun(type6tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type6)+sun/gb(type5)" }; + xkb_geometry { include "sun(type6tuv)" }; +}; + +xkb_keymap "UK6_usb" { + xkb_keycodes { include "sun(type6tuv_usb)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type6)+sun/gb(type5)" }; + xkb_geometry { include "sun(type6tuv)" }; +}; + +xkb_keymap "UK_x86" { + xkb_keycodes { include "sun(x86tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(pc102)+gb" }; + xkb_geometry { include "sun(x86tuv)" }; +}; + +xkb_keymap "US101A_PC" { + xkb_keycodes { include "sun(type5x86)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(pc101)+sun/us(pc101currency)"}; + xkb_geometry { include "sun(x86)" }; +}; + +xkb_keymap "US101A_Sun" { + xkb_keycodes { include "sun(type5x86)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(pc101)+sun/us(US101A_Sun)" }; + xkb_geometry { include "sun(x86)" }; +}; + +xkb_keymap "US101A_x86" { + xkb_keycodes { include "sun(x86)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc101)" }; + xkb_geometry { include "sun(x86)" }; +}; + +xkb_keymap "US4" { + xkb_keycodes { include "sun(type4)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type4)" }; + xkb_geometry { include "sun(type4)" }; +}; + +xkb_keymap "US5" { + xkb_keycodes { include "sun(type5)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)" }; + xkb_geometry { include "sun(type5)" }; +}; + +xkb_keymap "US5_Hobo" { + xkb_keycodes { include "sun(type5hobo)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5hobo)" }; + xkb_geometry { include "sun(type5hobo)" }; +}; + +xkb_keymap "US_UNIX5" { + xkb_keycodes { include "sun(type5)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)" }; + xkb_geometry { include "sun(type5unix)" }; +}; + +xkb_keymap "US_UNIX5_Hobo" { + // Same as US5_Hobo + xkb_keycodes { include "sun(type5hobo)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5hobo)" }; + xkb_geometry { include "sun(type5hobo)" }; +}; + +xkb_keymap "US6" { + xkb_keycodes { include "sun(type6)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type6)" }; + xkb_geometry { include "sun(type6)" }; +}; + +xkb_keymap "US6_usb" { + xkb_keycodes { include "sun(type6_usb)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type6)" }; + xkb_geometry { include "sun(type6)" }; +}; + +xkb_keymap "US_UNIX6" { + xkb_keycodes { include "sun(type6)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type6)" }; + xkb_geometry { include "sun(type6unix)" }; +}; + +xkb_keymap "US_UNIX6_usb" { + xkb_keycodes { include "sun(type6_usb)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type6)" }; + xkb_geometry { include "sun(type6unix)" }; +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/keymap/sun/ca /opt/SUNWut/lib/xkb/keymap/sun/ca --- /opt/SUNWut.orig/lib/xkb/keymap/sun/ca 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keymap/sun/ca 2008-06-18 23:52:46.000000000 +0200 @@ -0,0 +1,25 @@ + +xkb_keymap "Canada4" { + xkb_keycodes { include "sun(type4tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/ca(type4)" }; + xkb_geometry { include "sun(type4tuv)" }; +}; + +xkb_keymap "Canada_Fr5" { + xkb_keycodes { include "sun(type5tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+ca" }; + xkb_geometry { include "sun(type5tuv)" }; +}; + +xkb_keymap "Canada_Fr5_Hobo" { + xkb_keycodes { include "sun(type5tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+ca" }; + xkb_geometry { include "sun(type5tuv)" }; +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/keymap/sun/ch /opt/SUNWut/lib/xkb/keymap/sun/ch --- /opt/SUNWut.orig/lib/xkb/keymap/sun/ch 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keymap/sun/ch 2008-06-18 23:52:46.000000000 +0200 @@ -0,0 +1,81 @@ + +xkb_keymap "Switzer_Fr4" { + xkb_keycodes { include "sun(type4tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type4)+fr" }; + xkb_geometry { include "sun(type4tuv)" }; +}; + +xkb_keymap "Switzer_Fr5" { + xkb_keycodes { include "sun(type5tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+fr" }; + xkb_geometry { include "sun(type5tuv)" }; +}; + +xkb_keymap "Switzer_Fr5_Hobo" { + xkb_keycodes { include "sun(type5tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+fr" }; + xkb_geometry { include "sun(type5tuv)" }; +}; + +xkb_keymap "Switzer_Fr6" { + xkb_keycodes { include "sun(type6tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/sw(type5fr)"}; + xkb_geometry { include "sun(type6tuv)" }; +}; + +xkb_keymap "Switzer_Fr6_usb" { + xkb_keycodes { include "sun(type6tuv_usb)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/sw(type5fr)"}; + xkb_geometry { include "sun(type6tuv)" }; +}; + +xkb_keymap "Switzer_Ge4" { + xkb_keycodes { include "sun(type4tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type4)+de" }; + xkb_geometry { include "sun(type4tuv)" }; +}; + +xkb_keymap "Switzer_Ge5" { + xkb_keycodes { include "sun(type5tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+de" }; + xkb_geometry { include "sun(type5tuv)" }; +}; + +xkb_keymap "Switzer_Ge5_Hobo" { + xkb_keycodes { include "sun(type5tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+de" }; + xkb_geometry { include "sun(type5tuv)" }; +}; + +xkb_keymap "Switzer_Ge6" { + xkb_keycodes { include "sun(type6tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/sw(type5de)"}; + xkb_geometry { include "sun(type6tuv)" }; +}; + +xkb_keymap "Switzer_Ge6_usb" { + xkb_keycodes { include "sun(type6tuv_usb)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/sw(type5de)"}; + xkb_geometry { include "sun(type6tuv)" }; +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/keymap/sun/cz /opt/SUNWut/lib/xkb/keymap/sun/cz --- /opt/SUNWut.orig/lib/xkb/keymap/sun/cz 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keymap/sun/cz 2008-06-18 23:52:46.000000000 +0200 @@ -0,0 +1,9 @@ + +xkb_keymap "Czech5" { + xkb_keycodes { include "sun(type5tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+cz" }; + xkb_geometry { include "sun(type5tuv)" }; +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/keymap/sun/de /opt/SUNWut/lib/xkb/keymap/sun/de --- /opt/SUNWut.orig/lib/xkb/keymap/sun/de 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keymap/sun/de 2008-06-18 23:52:47.000000000 +0200 @@ -0,0 +1,64 @@ +// $TOG: de /main/3 1998/02/10 13:44:36 kaleb $ +// +//Copyright 1996, 1998 The Open Group +// +//All Rights Reserved. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// + +xkb_keymap "Germany4" { + xkb_keycodes { include "sun(type4tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type4)+de" }; + xkb_geometry { include "sun(type4tuv)" }; +}; + +xkb_keymap "Germany5" { + xkb_keycodes { include "sun(type5tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+de" }; + xkb_geometry { include "sun(type5tuv)" }; +}; + +xkb_keymap "Germany5_Hobo" { + xkb_keycodes { include "sun(type5tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+de" }; + xkb_geometry { include "sun(type5tuv)" }; +}; + +xkb_keymap "Germany6" { + xkb_keycodes { include "sun(type6tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+de" }; + xkb_geometry { include "sun(type6tuv)" }; +}; + +xkb_keymap "Germany6_usb" { + xkb_keycodes { include "sun(type6tuv_usb)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+de" }; + xkb_geometry { include "sun(type6tuv)" }; +}; + + diff -ruN /opt/SUNWut.orig/lib/xkb/keymap/sun/dk /opt/SUNWut/lib/xkb/keymap/sun/dk --- /opt/SUNWut.orig/lib/xkb/keymap/sun/dk 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keymap/sun/dk 2008-06-18 23:52:47.000000000 +0200 @@ -0,0 +1,41 @@ + +xkb_keymap "Denmark4" { + xkb_keycodes { include "sun(type4tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type4)+dk" }; + xkb_geometry { include "sun(type4tuv)" }; +}; + +xkb_keymap "Denmark5" { + xkb_keycodes { include "sun(type5tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+dk" }; + xkb_geometry { include "sun(type5tuv)" }; +}; + +xkb_keymap "Denmark5_Hobo" { + xkb_keycodes { include "sun(type5tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+dk" }; + xkb_geometry { include "sun(type5tuv)" }; +}; + +xkb_keymap "Denmark6" { + xkb_keycodes { include "sun(type6tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/dk(type5)" }; + xkb_geometry { include "sun(type6tuv)" }; +}; + +xkb_keymap "Denmark6_usb" { + xkb_keycodes { include "sun(type6tuv_usb)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/dk(type5)" }; + xkb_geometry { include "sun(type6tuv)" }; +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/keymap/sun/es /opt/SUNWut/lib/xkb/keymap/sun/es --- /opt/SUNWut.orig/lib/xkb/keymap/sun/es 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keymap/sun/es 2008-06-18 23:52:47.000000000 +0200 @@ -0,0 +1,41 @@ + +xkb_keymap "SpainLatAm4" { + xkb_keycodes { include "sun(type4tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type4)+es" }; + xkb_geometry { include "sun(type4tuv)" }; +}; + +xkb_keymap "Spain5" { + xkb_keycodes { include "sun(type5tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+es" }; + xkb_geometry { include "sun(type5tuv)" }; +}; + +xkb_keymap "Spain5_Hobo" { + xkb_keycodes { include "sun(type5tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+es" }; + xkb_geometry { include "sun(type5tuv)" }; +}; + +xkb_keymap "Spain6" { + xkb_keycodes { include "sun(type6tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/es(type5)" }; + xkb_geometry { include "sun(type6tuv)" }; +}; + +xkb_keymap "Spain6_usb" { + xkb_keycodes { include "sun(type6tuv_usb)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/es(type5)" }; + xkb_geometry { include "sun(type6tuv)" }; +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/keymap/sun/fi /opt/SUNWut/lib/xkb/keymap/sun/fi --- /opt/SUNWut.orig/lib/xkb/keymap/sun/fi 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keymap/sun/fi 2008-06-18 23:52:47.000000000 +0200 @@ -0,0 +1,17 @@ + +xkb_keymap "Finnish6" { + xkb_keycodes { include "sun(type6)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/fi"}; + xkb_geometry { include "sun(type6tuv)" }; +}; + +xkb_keymap "Finnish6_usb" { + xkb_keycodes { include "sun(type6tuv_usb)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/fi"}; + xkb_geometry { include "sun(type6tuv)" }; +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/keymap/sun/fr /opt/SUNWut/lib/xkb/keymap/sun/fr --- /opt/SUNWut.orig/lib/xkb/keymap/sun/fr 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keymap/sun/fr 2008-06-18 23:52:47.000000000 +0200 @@ -0,0 +1,42 @@ + +xkb_keymap "FranceBelg4" { + xkb_keycodes { include "sun(type4tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type4)+fr" }; + xkb_geometry { include "sun(type4tuv)" }; +}; + +xkb_keymap "France5" { + xkb_keycodes { include "sun(type5tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+fr" }; + xkb_geometry { include "sun(type5tuv)" }; +}; + +xkb_keymap "France5_Hobo" { + xkb_keycodes { include "sun(type5tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+fr" }; + xkb_geometry { include "sun(type5tuv)" }; +}; + +xkb_keymap "France6" { + xkb_keycodes { include "sun(type6tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/fr(type5)" }; + xkb_geometry { include "sun(type6tuv)" }; +}; + +xkb_keymap "France6_usb" { + xkb_keycodes { include "sun(type6tuv_usb)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/fr(type5)" }; + xkb_geometry { include "sun(type6tuv)" }; +}; + + diff -ruN /opt/SUNWut.orig/lib/xkb/keymap/sun/gr /opt/SUNWut/lib/xkb/keymap/sun/gr --- /opt/SUNWut.orig/lib/xkb/keymap/sun/gr 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keymap/sun/gr 2008-06-18 23:52:47.000000000 +0200 @@ -0,0 +1,9 @@ + +xkb_keymap "Greece5" { + xkb_keycodes { include "sun(type5tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/gr(type5)" }; + xkb_geometry { include "sun(type5tuv)" }; +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/keymap/sun/hu /opt/SUNWut/lib/xkb/keymap/sun/hu --- /opt/SUNWut.orig/lib/xkb/keymap/sun/hu 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keymap/sun/hu 2008-06-18 23:52:47.000000000 +0200 @@ -0,0 +1,9 @@ + +xkb_keymap "Hungary5" { + xkb_keycodes { include "sun(type5tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5basic)+sun/hu(type5)" }; + xkb_geometry { include "sun(type5tuv)" }; +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/keymap/sun/it /opt/SUNWut/lib/xkb/keymap/sun/it --- /opt/SUNWut.orig/lib/xkb/keymap/sun/it 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keymap/sun/it 2008-06-18 23:52:47.000000000 +0200 @@ -0,0 +1,42 @@ + +xkb_keymap "Italy4" { + xkb_keycodes { include "sun(type4tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type4)+it" }; + xkb_geometry { include "sun(type4tuv)" }; +}; + +xkb_keymap "Italy5" { + xkb_keycodes { include "sun(type5tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+it" }; + xkb_geometry { include "sun(type5tuv)" }; +}; + +xkb_keymap "Italy5_Hobo" { + xkb_keycodes { include "sun(type5tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+it" }; + xkb_geometry { include "sun(type5tuv)" }; +}; + +xkb_keymap "Italy6" { + xkb_keycodes { include "sun(type6tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/it(type5)" }; + xkb_geometry { include "sun(type6tuv)" }; +}; + +xkb_keymap "Italy6_usb" { + xkb_keycodes { include "sun(type6tuv_usb)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/it(type5)" }; + xkb_geometry { include "sun(type6tuv)" }; +}; + + diff -ruN /opt/SUNWut.orig/lib/xkb/keymap/sun/jp /opt/SUNWut/lib/xkb/keymap/sun/jp --- /opt/SUNWut.orig/lib/xkb/keymap/sun/jp 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keymap/sun/jp 2008-06-18 23:52:48.000000000 +0200 @@ -0,0 +1,42 @@ + +xkb_keymap "Japan4" { + xkb_keycodes { include "sun(type4jp)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/jp(type4)" }; + xkb_geometry { include "sun(type4jp)" }; +}; + +xkb_keymap "Japan5" { + xkb_keycodes { include "sun(type5_jp)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/jp(type5)" }; + xkb_geometry { include "sun(type5jp)" }; +}; + +xkb_keymap "Japan5_Hobo" { + xkb_keycodes { include "sun(type5_jp)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/jp(type5)" }; + xkb_geometry { include "sun(type5jp)" }; +}; + +xkb_keymap "Japan6" { + xkb_keycodes { include "sun(type6_jp)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/jp(type5)" }; + xkb_geometry { include "sun(type6jp)" }; +}; + +xkb_keymap "Japan6_usb" { + xkb_keycodes { include "sun(type6_jp_usb)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/jp(type5)" }; + xkb_geometry { include "sun(type6jp)" }; +}; + + diff -ruN /opt/SUNWut.orig/lib/xkb/keymap/sun/ko /opt/SUNWut/lib/xkb/keymap/sun/ko --- /opt/SUNWut.orig/lib/xkb/keymap/sun/ko 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keymap/sun/ko 2008-06-18 23:52:48.000000000 +0200 @@ -0,0 +1,41 @@ + +xkb_keymap "Korea4" { + xkb_keycodes { include "sun(type4)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/ko(type4)" }; + xkb_geometry { include "sun(type4)" }; +}; + +xkb_keymap "Korea5" { + xkb_keycodes { include "sun(type5)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/ko(type5)" }; + xkb_geometry { include "sun(type5)" }; +}; + +xkb_keymap "Korea5_Hobo" { + xkb_keycodes { include "sun(type5p)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/ko(type5)" }; + xkb_geometry { include "sun(type5)" }; +}; + +xkb_keymap "Korea6" { + xkb_keycodes { include "sun(type6)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/ko(type5)" }; + xkb_geometry { include "sun(type6)" }; +}; + +xkb_keymap "Korea6_usb" { + xkb_keycodes { include "sun(type6_usb)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/ko(type5)" }; + xkb_geometry { include "sun(type6)" }; +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/keymap/sun/lt /opt/SUNWut/lib/xkb/keymap/sun/lt --- /opt/SUNWut.orig/lib/xkb/keymap/sun/lt 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keymap/sun/lt 2008-06-18 23:52:48.000000000 +0200 @@ -0,0 +1,9 @@ + +xkb_keymap "Lithuania5" { + xkb_keycodes { include "sun(type5tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5basic)+sun/lt(type5)" }; + xkb_geometry { include "sun(type5tuv)" }; +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/keymap/sun/lv /opt/SUNWut/lib/xkb/keymap/sun/lv --- /opt/SUNWut.orig/lib/xkb/keymap/sun/lv 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keymap/sun/lv 2008-06-18 23:52:48.000000000 +0200 @@ -0,0 +1,9 @@ + +xkb_keymap "Latvia5" { + xkb_keycodes { include "sun(type5tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5basic)+sun/lv(type5)" }; + xkb_geometry { include "sun(type5tuv)" }; +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/keymap/sun/nl /opt/SUNWut/lib/xkb/keymap/sun/nl --- /opt/SUNWut.orig/lib/xkb/keymap/sun/nl 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keymap/sun/nl 2008-06-18 23:52:48.000000000 +0200 @@ -0,0 +1,42 @@ + +xkb_keymap "Netherland4" { + xkb_keycodes { include "sun(type4tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type4)+nl" }; + xkb_geometry { include "sun(type4tuv)" }; +}; + +xkb_keymap "Netherland5" { + xkb_keycodes { include "sun(type5tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+nl" }; + xkb_geometry { include "sun(type5tuv)" }; +}; + +xkb_keymap "Netherland5_Hobo" { + xkb_keycodes { include "sun(type5tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+nl" }; + xkb_geometry { include "sun(type5tuv)" }; +}; + +xkb_keymap "Netherland6" { + xkb_keycodes { include "sun(type6tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+nl" }; + xkb_geometry { include "sun(type6tuv)" }; +}; + +xkb_keymap "Netherland6_usb" { + xkb_keycodes { include "sun(type6tuv_usb)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+nl" }; + xkb_geometry { include "sun(type6tuv)" }; +}; + + diff -ruN /opt/SUNWut.orig/lib/xkb/keymap/sun/no /opt/SUNWut/lib/xkb/keymap/sun/no --- /opt/SUNWut.orig/lib/xkb/keymap/sun/no 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keymap/sun/no 2008-06-18 23:52:48.000000000 +0200 @@ -0,0 +1,42 @@ + +xkb_keymap "Norway4" { + xkb_keycodes { include "sun(type4tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type4)+no" }; + xkb_geometry { include "sun(type4tuv)" }; +}; + +xkb_keymap "Norway5" { + xkb_keycodes { include "sun(type5tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+no" }; + xkb_geometry { include "sun(type5tuv)" }; +}; + +xkb_keymap "Norway5_Hobo" { + xkb_keycodes { include "sun(type5tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+no" }; + xkb_geometry { include "sun(type5tuv)" }; +}; + +xkb_keymap "Norway6" { + xkb_keycodes { include "sun(type6tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/no(type5)" }; + xkb_geometry { include "sun(type6tuv)" }; +}; + +xkb_keymap "Norway6_usb" { + xkb_keycodes { include "sun(type6tuv_usb)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/no(type5)" }; + xkb_geometry { include "sun(type6tuv)" }; +}; + + diff -ruN /opt/SUNWut.orig/lib/xkb/keymap/sun/pl /opt/SUNWut/lib/xkb/keymap/sun/pl --- /opt/SUNWut.orig/lib/xkb/keymap/sun/pl 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keymap/sun/pl 2008-06-18 23:52:48.000000000 +0200 @@ -0,0 +1,9 @@ + +xkb_keymap "Poland5" { + xkb_keycodes { include "sun(type5tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/pl" }; + xkb_geometry { include "sun(type5tuv)" }; +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/keymap/sun/pt /opt/SUNWut/lib/xkb/keymap/sun/pt --- /opt/SUNWut.orig/lib/xkb/keymap/sun/pt 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keymap/sun/pt 2008-06-18 23:52:48.000000000 +0200 @@ -0,0 +1,42 @@ + +xkb_keymap "Portugal4" { + xkb_keycodes { include "sun(type4tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type4)+pt" }; + xkb_geometry { include "sun(type4tuv)" }; +}; + +xkb_keymap "Portugal5" { + xkb_keycodes { include "sun(type5tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+pt" }; + xkb_geometry { include "sun(type5tuv)" }; +}; + +xkb_keymap "Portugal5_Hobo" { + xkb_keycodes { include "sun(type5tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+pt" }; + xkb_geometry { include "sun(type5tuv)" }; +}; + +xkb_keymap "Portugal6" { + xkb_keycodes { include "sun(type6tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/pt(type5)" }; + xkb_geometry { include "sun(type6tuv)" }; +}; + +xkb_keymap "Portugal6_usb" { + xkb_keycodes { include "sun(type6tuv_usb)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/pt(type5)" }; + xkb_geometry { include "sun(type6tuv)" }; +}; + + diff -ruN /opt/SUNWut.orig/lib/xkb/keymap/sun/ru /opt/SUNWut/lib/xkb/keymap/sun/ru --- /opt/SUNWut.orig/lib/xkb/keymap/sun/ru 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keymap/sun/ru 2008-06-18 23:52:48.000000000 +0200 @@ -0,0 +1,34 @@ + +xkb_keymap "Russia4" { + xkb_keycodes { include "sun(type4)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/ru" }; + xkb_geometry { include "sun(type4)" }; +}; + +xkb_keymap "Russia5" { + xkb_keycodes { include "sun(type5tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/ru" }; + xkb_geometry { include "sun(type5tuv)" }; +}; + +xkb_keymap "Russia6" { + xkb_keycodes { include "sun(type6tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/ru"}; + xkb_geometry { include "sun(type6tuv)" }; +}; + +xkb_keymap "Russia6_usb" { + xkb_keycodes { include "sun(type6tuv_usb)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/ru"}; + xkb_geometry { include "sun(type6tuv)" }; +}; + + diff -ruN /opt/SUNWut.orig/lib/xkb/keymap/sun/se /opt/SUNWut/lib/xkb/keymap/sun/se --- /opt/SUNWut.orig/lib/xkb/keymap/sun/se 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keymap/sun/se 2008-06-18 23:52:48.000000000 +0200 @@ -0,0 +1,42 @@ + +xkb_keymap "Sweden4" { + xkb_keycodes { include "sun(type4tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type4)+se" }; + xkb_geometry { include "sun(type4tuv)" }; +}; + +xkb_keymap "Sweden5" { + xkb_keycodes { include "sun(type5tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+se" }; + xkb_geometry { include "sun(type5tuv)" }; +}; + +xkb_keymap "Sweden5_Hobo" { + xkb_keycodes { include "sun(type5tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sde" }; + xkb_geometry { include "sun(type5tuv)" }; +}; + +xkb_keymap "Sweden6" { + xkb_keycodes { include "sun(type6tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/se(type5)" }; + xkb_geometry { include "sun(type6tuv)" }; +}; + +xkb_keymap "Sweden6_usb" { + xkb_keycodes { include "sun(type6tuv_usb)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/se(type5)" }; + xkb_geometry { include "sun(type6tuv)" }; +}; + + diff -ruN /opt/SUNWut.orig/lib/xkb/keymap/sun/tr /opt/SUNWut/lib/xkb/keymap/sun/tr --- /opt/SUNWut.orig/lib/xkb/keymap/sun/tr 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keymap/sun/tr 2008-06-18 23:52:48.000000000 +0200 @@ -0,0 +1,58 @@ + +xkb_keymap "Turkey5" { + xkb_keycodes { include "sun(type5tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/tr(type5)" }; + xkb_geometry { include "sun(type5tuv)" }; +}; + +xkb_keymap "Turkey6" { + xkb_keycodes { include "sun(type6tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/tr"}; + xkb_geometry { include "sun(type6tuv)" }; +}; + +xkb_keymap "Turkey6_usb" { + xkb_keycodes { include "sun(type6tuv_usb)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/tr"}; + xkb_geometry { include "sun(type6tuv)" }; +}; + +xkb_keymap "TurkeyQ6" { + xkb_keycodes { include "sun(type6tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/tr(type6Q)"}; + xkb_geometry { include "sun(type6tuv)" }; +}; + +xkb_keymap "TurkeyQ6_usb" { + xkb_keycodes { include "sun(type6tuv_usb)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/tr(type6Q)"}; + xkb_geometry { include "sun(type6tuv)" }; +}; + +xkb_keymap "TurkeyF6" { + xkb_keycodes { include "sun(type6tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/tr(type6F)"}; + xkb_geometry { include "sun(type6)" }; +}; + +xkb_keymap "TurkeyF6_usb" { + xkb_keycodes { include "sun(type6tuv_usb)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/tr(type6F)"}; + xkb_geometry { include "sun(type6)" }; +}; + + diff -ruN /opt/SUNWut.orig/lib/xkb/keymap/sun/tw /opt/SUNWut/lib/xkb/keymap/sun/tw --- /opt/SUNWut.orig/lib/xkb/keymap/sun/tw 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keymap/sun/tw 2008-06-18 23:52:48.000000000 +0200 @@ -0,0 +1,42 @@ + +xkb_keymap "Taiwan4" { + xkb_keycodes { include "sun(type4tw)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/tw(type4)" }; + xkb_geometry { include "sun(type4tw)" }; +}; + +xkb_keymap "Taiwan5" { + xkb_keycodes { include "sun(type5_tw)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/tw(type5)" }; + xkb_geometry { include "sun(type5tw)" }; +}; + +xkb_keymap "Taiwan5_Hobo" { + xkb_keycodes { include "sun(type5_tw)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/tw(type5)" }; + xkb_geometry { include "sun(type5tw)" }; +}; + +xkb_keymap "Taiwan6" { + xkb_keycodes { include "sun(type6)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/tw(type5)" }; + xkb_geometry { include "sun(type6)" }; +}; + +xkb_keymap "Taiwan6_usb" { + xkb_keycodes { include "sun(type6_usb)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+sun/tw(type5)" }; + xkb_geometry { include "sun(type6)" }; +}; + + diff -ruN /opt/SUNWut.orig/lib/xkb/keymap/sun/uk /opt/SUNWut/lib/xkb/keymap/sun/uk --- /opt/SUNWut.orig/lib/xkb/keymap/sun/uk 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keymap/sun/uk 2008-06-18 23:52:48.000000000 +0200 @@ -0,0 +1,42 @@ + +xkb_keymap "UK4" { + xkb_keycodes { include "sun(type4)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type4)+gb" }; + xkb_geometry { include "sun(type4)" }; +}; + +xkb_keymap "UK5" { + xkb_keycodes { include "sun(type5tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+gb" }; + xkb_geometry { include "sun(type5tuv)" }; +}; + +xkb_keymap "UK5_Hobo" { + xkb_keycodes { include "sun(type5tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)+gb" }; + xkb_geometry { include "sun(type5tuv)" }; +}; + +xkb_keymap "UK6" { + xkb_keycodes { include "sun(type6tuv)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type6)+sun/gb(type5)" }; + xkb_geometry { include "sun(type6tuv)" }; +}; + +xkb_keymap "UK6_usb" { + xkb_keycodes { include "sun(type6tuv_usb)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type6)+sun/gb(type5)" }; + xkb_geometry { include "sun(type6tuv)" }; +}; + + diff -ruN /opt/SUNWut.orig/lib/xkb/keymap/sun/us /opt/SUNWut/lib/xkb/keymap/sun/us --- /opt/SUNWut.orig/lib/xkb/keymap/sun/us 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keymap/sun/us 2008-06-18 23:52:48.000000000 +0200 @@ -0,0 +1,95 @@ +// $TOG: us /main/3 1998/02/10 13:44:40 kaleb $ +// +//Copyright 1996, 1998 The Open Group +// +//All Rights Reserved. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// + +xkb_keymap "US4" { + xkb_keycodes { include "sun(type4)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type4)" }; + xkb_geometry { include "sun(type4)" }; +}; + +xkb_keymap "US5" { + xkb_keycodes { include "sun(type5)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)" }; + xkb_geometry { include "sun(type5)" }; +}; + +xkb_keymap "US5_Hobo" { + xkb_keycodes { include "sun(type5)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)" }; + xkb_geometry { include "sun(type5)" }; +}; + +xkb_keymap "US_UNIX5" { + xkb_keycodes { include "sun(type5)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)" }; + xkb_geometry { include "sun(type5unix)" }; +}; + +xkb_keymap "US_UNIX5_Hobo" { + xkb_keycodes { include "sun(type5)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type5)" }; + xkb_geometry { include "sun(type5unix)" }; +}; + +xkb_keymap "US6" { + xkb_keycodes { include "sun(type6)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type6)" }; + xkb_geometry { include "sun(type6)" }; +}; + +xkb_keymap "US6_usb" { + xkb_keycodes { include "sun(type6_usb)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type6)" }; + xkb_geometry { include "sun(type6)" }; +}; + +xkb_keymap "US_UNIX6" { + xkb_keycodes { include "sun(type6)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type6)" }; + xkb_geometry { include "sun(type6unix)" }; +}; + +xkb_keymap "US_UNIX6_usb" { + xkb_keycodes { include "sun(type6_usb)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "sun/us(type6)" }; + xkb_geometry { include "sun(type6unix)" }; +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/keymap/xfree86 /opt/SUNWut/lib/xkb/keymap/xfree86 --- /opt/SUNWut.orig/lib/xkb/keymap/xfree86 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keymap/xfree86 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,362 @@ +// $XFree86: xc/programs/xkbcomp/keymap/xfree86,v 3.30 2003/04/03 16:34:49 dawes Exp $ + + +default xkb_keymap "us" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc105)" }; + xkb_geometry { include "pc" }; +}; + +// "ar" addition by Arabeyes Team, +xkb_keymap "ar" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+ar" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "be" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+be" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "bg" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+bg" }; + xkb_geometry { include "pc(pc102)" }; +}; +// us_intl and br by Ricardo Y. Igarashi (iga@that.com.br) +xkb_keymap "br" { + xkb_keycodes { include "xfree86(abnt2)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc101)+br" }; + xkb_geometry { include "pc(abnt2)" }; +}; +// cz and sk keymaps by Kamil Toman (ktoman@email.cz) +// are designed to replace old czechoslovakian and czsk keyboards +// and their prog variants. Those are now obsolete and should not be used anymore. +xkb_keymap "cz" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+cz" }; + xkb_geometry { include "pc" }; +}; +xkb_keymap "cz_qwerty" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+cz_qwerty" }; + xkb_geometry { include "pc" }; +}; +xkb_keymap "de" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+de" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "de_CH" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+de_CH" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "dk" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+dk" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "dvorak" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+dvorak" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "en_US" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)" }; + xkb_geometry { include "pc" }; +}; +xkb_keymap "es" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+es" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "fr" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+fr" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "fr-latin9" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+fr-latin9" }; + xkb_geometry { include "pc" }; +}; +xkb_keymap "fr_CA" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+ca" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "fr_CH" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+fr_CH" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "gb" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+gb" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "hr" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+hr" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "it" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+it" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "jp106" { + xkb_keycodes { include "xfree86(jp106)" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "jp(jp106)" }; + xkb_geometry { include "pc(jp106)" }; +}; +xkb_keymap "lt" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+lt" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "lt_std" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+lt_std" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "lv" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+lv" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "mk" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+mk" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "mt" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+mt" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "mt_us" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+mt_us" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "no" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+no" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "pl" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+pl" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "pt" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+pt" }; + xkb_geometry { include "pc(pc102)" }; +}; +// ro: additions by Cristian Gafton, +xkb_keymap "ro" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc101)+ro(pc101)" }; + xkb_geometry { include "pc(pc101)" }; +}; +xkb_keymap "ro_microsoft" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+ro(pc105)" }; + xkb_geometry { include "pc(pc105)" }; +}; +xkb_keymap "ru" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+ru" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "se_FI" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+fi" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "se_SE" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+se" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "sl" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+si" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "sl_SI" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+si" }; + xkb_geometry { include "pc(pc102)" }; +}; +// cz and sk keymaps by Kamil Toman (ktoman@email.cz) +// are designed to replace old czechoslovakian and czsk keyboards +// and their prog variants. Those are now obsolete and should not be used anymore. +xkb_keymap "sk" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+sk" }; + xkb_geometry { include "pc" }; +}; +xkb_keymap "sk_qwerty" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+sk_qwerty" }; + xkb_geometry { include "pc" }; +}; +// Additions by Emil Soleyman-Zomalan, +xkb_keymap "syr" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+syr" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "th" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+th" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "th_tis" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+th_tis" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "th_pat" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+th_pat" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "tr" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+tr" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "uk" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+uk)" }; + xkb_geometry { include "pc(pc102)" }; +}; +xkb_keymap "us_flexpro" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc105)" }; + xkb_geometry { include "keytronic(FlexPro)" }; +}; +// us_intl and br by Ricardo Y. Igarashi (iga@that.com.br) +// us_intl means standard us keyboard plus dead_keys symbols +// these keyboards are very popular in Brazil +xkb_keymap "us_intl" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc101)+us_intl" }; + xkb_geometry { include "pc" }; +}; +xkb_keymap "us_microsoft" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "us(pc105)" }; + xkb_geometry { include "microsoft" }; +}; + +xkb_keymap "uz" { + xkb_keycodes { include "xfree86" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "en_US(pc105)+uz" }; + xkb_geometry { include "pc(pc102)" }; +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/keymap/xfree98 /opt/SUNWut/lib/xkb/keymap/xfree98 --- /opt/SUNWut.orig/lib/xkb/keymap/xfree98 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keymap/xfree98 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,35 @@ +// $Xorg: xfree98,v 1.4 2001/02/09 02:05:52 xorgcvs Exp $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +// $XFree86: xc/programs/xkbcomp/keymap/xfree98,v 3.6 2001/01/17 23:45:53 dawes Exp $ + +default xkb_keymap "jp" { + xkb_keycodes { include "xfree98" }; + xkb_types { include "default" }; + xkb_compatibility { include "default" }; + xkb_symbols { include "nec/jp(pc98)" }; + xkb_geometry { include "nec(pc98)" }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/keymap.dir /opt/SUNWut/lib/xkb/keymap.dir --- /opt/SUNWut.orig/lib/xkb/keymap.dir 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/keymap.dir 2008-10-04 16:20:49.000000000 +0200 @@ -0,0 +1,420 @@ +-------- -------- sony(news5000-nwp5461) +-------- -------- digital/us(lk201) +-------- -------- digital/us(lk401) +-------- -------- digital/us(lk411) +-------- -------- digital/us(lk421) +-------- -------- digital/us(lk441) +-------- -------- digital/us(lk443) +-------- -------- digital/us(lk44x) +-------- -------- digital/us(lk450) +-------- -------- digital/us(pcxalaa) +-------- -------- digital/us(pcxalfa) +-------- -------- digital/us(pcxalga) +-------- -------- digital/us(pcxalka) +-------- -------- digital/us(pcxal) +-------- -------- digital/us(mnk) +-d------ -------- xfree86(us) +-------- -------- xfree86(ar) +-------- -------- xfree86(be) +-------- -------- xfree86(bg) +-------- -------- xfree86(br) +-------- -------- xfree86(cz) +-------- -------- xfree86(cz_qwerty) +-------- -------- xfree86(de) +-------- -------- xfree86(de_CH) +-------- -------- xfree86(dk) +-------- -------- xfree86(dvorak) +-------- -------- xfree86(en_US) +-------- -------- xfree86(es) +-------- -------- xfree86(fr) +-------- -------- xfree86(fr-latin9) +-------- -------- xfree86(fr_CA) +-------- -------- xfree86(fr_CH) +-------- -------- xfree86(gb) +-------- -------- xfree86(hr) +-------- -------- xfree86(it) +-------- -------- xfree86(jp106) +-------- -------- xfree86(lt) +-------- -------- xfree86(lt_std) +-------- -------- xfree86(lv) +-------- -------- xfree86(mk) +-------- -------- xfree86(mt) +-------- -------- xfree86(mt_us) +-------- -------- xfree86(no) +-------- -------- xfree86(pl) +-------- -------- xfree86(pt) +-------- -------- xfree86(ro) +-------- -------- xfree86(ro_microsoft) +-------- -------- xfree86(ru) +-------- -------- xfree86(se_FI) +-------- -------- xfree86(se_SE) +-------- -------- xfree86(sl) +-------- -------- xfree86(sl_SI) +-------- -------- xfree86(sk) +-------- -------- xfree86(sk_qwerty) +-------- -------- xfree86(syr) +-------- -------- xfree86(th) +-------- -------- xfree86(th_tis) +-------- -------- xfree86(th_pat) +-------- -------- xfree86(tr) +-------- -------- xfree86(uk) +-------- -------- xfree86(us_flexpro) +-------- -------- xfree86(us_intl) +-------- -------- xfree86(us_microsoft) +-------- -------- xfree86(uz) +-------- -------- sun/ko(Korea4) +-------- -------- sun/ko(Korea5) +-------- -------- sun/ko(Korea5_Hobo) +-------- -------- sun/ko(Korea6) +-------- -------- sun/ko(Korea6_usb) +-------- -------- sun/nl(Netherland4) +-------- -------- sun/nl(Netherland5) +-------- -------- sun/nl(Netherland5_Hobo) +-------- -------- sun/nl(Netherland6) +-------- -------- sun/nl(Netherland6_usb) +-------- -------- sun/dk(Denmark4) +-------- -------- sun/dk(Denmark5) +-------- -------- sun/dk(Denmark5_Hobo) +-------- -------- sun/dk(Denmark6) +-------- -------- sun/dk(Denmark6_usb) +-------- -------- sun/pt(Portugal4) +-------- -------- sun/pt(Portugal5) +-------- -------- sun/pt(Portugal5_Hobo) +-------- -------- sun/pt(Portugal6) +-------- -------- sun/pt(Portugal6_usb) +-------- -------- sun/tr(Turkey5) +-------- -------- sun/tr(Turkey6) +-------- -------- sun/tr(Turkey6_usb) +-------- -------- sun/tr(TurkeyQ6) +-------- -------- sun/tr(TurkeyQ6_usb) +-------- -------- sun/tr(TurkeyF6) +-------- -------- sun/tr(TurkeyF6_usb) +-------- -------- sun/de(Germany4) +-------- -------- sun/de(Germany5) +-------- -------- sun/de(Germany5_Hobo) +-------- -------- sun/de(Germany6) +-------- -------- sun/de(Germany6_usb) +-------- -------- sun/gr(Greece5) +-------- -------- sun/ca(Canada4) +-------- -------- sun/ca(Canada_Fr5) +-------- -------- sun/ca(Canada_Fr5_Hobo) +-------- -------- sun/lv(Latvia5) +-------- -------- sun/us(US4) +-------- -------- sun/us(US5) +-------- -------- sun/us(US5_Hobo) +-------- -------- sun/us(US_UNIX5) +-------- -------- sun/us(US_UNIX5_Hobo) +-------- -------- sun/us(US6) +-------- -------- sun/us(US6_usb) +-------- -------- sun/us(US_UNIX6) +-------- -------- sun/us(US_UNIX6_usb) +-------- -------- sun/fi(Finnish6) +-------- -------- sun/fi(Finnish6_usb) +-------- -------- sun/uk(UK4) +-------- -------- sun/uk(UK5) +-------- -------- sun/uk(UK5_Hobo) +-------- -------- sun/uk(UK6) +-------- -------- sun/uk(UK6_usb) +-------- -------- sun/jp(Japan4) +-------- -------- sun/jp(Japan5) +-------- -------- sun/jp(Japan5_Hobo) +-------- -------- sun/jp(Japan6) +-------- -------- sun/jp(Japan6_usb) +-------- -------- sun/hu(Hungary5) +-------- -------- sun/all(Belgian6) +-------- -------- sun/all(Belgian6_usb) +-------- -------- sun/all(Canada4) +-------- -------- sun/all(Canada_Fr5) +-------- -------- sun/all(Canada_Fr5_Hobo) +-------- -------- sun/all(Canada_Fr5_TBITS5) +-------- -------- sun/all(Canada_Fr_x86) +-------- -------- sun/all(Switzer_Fr4) +-------- -------- sun/all(Switzer_Fr5) +-------- -------- sun/all(Switzer_Fr5_Hobo) +-------- -------- sun/all(Switzer_Fr6) +-------- -------- sun/all(Switzer_Fr6_usb) +-------- -------- sun/all(Switzer_Fr_x86) +-------- -------- sun/all(Switzer_Ge4) +-------- -------- sun/all(Switzer_Ge5) +-------- -------- sun/all(Switzer_Ge5_Hobo) +-------- -------- sun/all(Switzer_Ge6) +-------- -------- sun/all(Switzer_Ge6_usb) +-------- -------- sun/all(Switzer_Ge_x86) +-------- -------- sun/all(Czech5) +-------- -------- sun/all(Germany4) +-------- -------- sun/all(Germany5) +-------- -------- sun/all(Germany5_Hobo) +-------- -------- sun/all(Germany6) +-------- -------- sun/all(Germany6_usb) +-------- -------- sun/all(Germany_x86) +-------- -------- sun/all(Denmark4) +-------- -------- sun/all(Denmark5) +-------- -------- sun/all(Denmark5_Hobo) +-------- -------- sun/all(Denmark6) +-------- -------- sun/all(Denmark6_usb) +-------- -------- sun/all(Denmark_x86) +-------- -------- sun/all(SpainLatAm4) +-------- -------- sun/all(Spain5) +-------- -------- sun/all(Spain5_Hobo) +-------- -------- sun/all(Spain6) +-------- -------- sun/all(Spain6_usb) +-------- -------- sun/all(Spain_x86) +-------- -------- sun/all(Finnish6) +-------- -------- sun/all(Finnish6_usb) +-------- -------- sun/all(FranceBelg4) +-------- -------- sun/all(France5) +-------- -------- sun/all(France5_Hobo) +-------- -------- sun/all(France6) +-------- -------- sun/all(France6_usb) +-------- -------- sun/all(France_x86) +-------- -------- sun/all(Greece5) +-------- -------- sun/all(Hungary5) +-------- -------- sun/all(Italy4) +-------- -------- sun/all(Italy5) +-------- -------- sun/all(Italy5_Hobo) +-------- -------- sun/all(Italy6) +-------- -------- sun/all(Italy6_usb) +-------- -------- sun/all(Italy_x86) +-------- -------- sun/all(Japan4) +-------- -------- sun/all(Japan5) +-------- -------- sun/all(Japan5_Hobo) +-------- -------- sun/all(Japan6) +-------- -------- sun/all(Japan6_usb) +-------- -------- sun/all(Japan_x86) +-------- -------- sun/all(J3100) +-------- -------- sun/all(Japan_Muhenkan_x86) +-------- -------- sun/all(Korea4) +-------- -------- sun/all(Korea5) +-------- -------- sun/all(Korea5_Hobo) +-------- -------- sun/all(Korea6) +-------- -------- sun/all(Korea6_usb) +-------- -------- sun/all(Korea_x86) +-------- -------- sun/all(Lithuania5) +-------- -------- sun/all(Latvia5) +-------- -------- sun/all(MS_US101A_x86) +-------- -------- sun/all(Netherland4) +-------- -------- sun/all(Netherland5) +-------- -------- sun/all(Netherland5_Hobo) +-------- -------- sun/all(Netherland6) +-------- -------- sun/all(Netherland6_usb) +-------- -------- sun/all(Netherland_x86) +-------- -------- sun/all(Norway4) +-------- -------- sun/all(Norway5) +-------- -------- sun/all(Norway5_Hobo) +-------- -------- sun/all(Norway6) +-------- -------- sun/all(Norway6_usb) +-------- -------- sun/all(Norway_x86) +-------- -------- sun/all(Poland5) +-------- -------- sun/all(Portugal4) +-------- -------- sun/all(Portugal5) +-------- -------- sun/all(Portugal5_Hobo) +-------- -------- sun/all(Portugal6) +-------- -------- sun/all(Portugal6_usb) +-------- -------- sun/all(Portugal_x86) +-------- -------- sun/all(Russia5) +-------- -------- sun/all(Russia6) +-------- -------- sun/all(Russia6_usb) +-------- -------- sun/all(SwedenFin4) +-------- -------- sun/all(Sweden5) +-------- -------- sun/all(Sweden5_Hobo) +-------- -------- sun/all(Sweden6) +-------- -------- sun/all(Sweden6_usb) +-------- -------- sun/all(Sweden_x86) +-------- -------- sun/all(Turkey5) +-------- -------- sun/all(Turkey6) +-------- -------- sun/all(Turkey6_usb) +-------- -------- sun/all(TurkeyQ6) +-------- -------- sun/all(TurkeyQ6_usb) +-------- -------- sun/all(TurkeyF6) +-------- -------- sun/all(TurkeyF6_usb) +-------- -------- sun/all(Taiwan4) +-------- -------- sun/all(Taiwan5) +-------- -------- sun/all(Taiwan5_Hobo) +-------- -------- sun/all(Taiwan6) +-------- -------- sun/all(Taiwan6_usb) +-------- -------- sun/all(Taiwan_x86) +-------- -------- sun/all(UK4) +-------- -------- sun/all(UK5) +-------- -------- sun/all(UK5_Hobo) +-------- -------- sun/all(UK6) +-------- -------- sun/all(UK6_usb) +-------- -------- sun/all(UK_x86) +-------- -------- sun/all(US101A_PC) +-------- -------- sun/all(US101A_Sun) +-------- -------- sun/all(US101A_x86) +-------- -------- sun/all(US4) +-------- -------- sun/all(US5) +-------- -------- sun/all(US5_Hobo) +-------- -------- sun/all(US_UNIX5) +-------- -------- sun/all(US_UNIX5_Hobo) +-------- -------- sun/all(US6) +-------- -------- sun/all(US6_usb) +-------- -------- sun/all(US_UNIX6) +-------- -------- sun/all(US_UNIX6_usb) +-------- -------- sun/pl(Poland5) +-------- -------- sun/lt(Lithuania5) +-------- -------- sun/ch(Switzer_Fr4) +-------- -------- sun/ch(Switzer_Fr5) +-------- -------- sun/ch(Switzer_Fr5_Hobo) +-------- -------- sun/ch(Switzer_Fr6) +-------- -------- sun/ch(Switzer_Fr6_usb) +-------- -------- sun/ch(Switzer_Ge4) +-------- -------- sun/ch(Switzer_Ge5) +-------- -------- sun/ch(Switzer_Ge5_Hobo) +-------- -------- sun/ch(Switzer_Ge6) +-------- -------- sun/ch(Switzer_Ge6_usb) +-------- -------- sun/it(Italy4) +-------- -------- sun/it(Italy5) +-------- -------- sun/it(Italy5_Hobo) +-------- -------- sun/it(Italy6) +-------- -------- sun/it(Italy6_usb) +-------- -------- sun/fr(FranceBelg4) +-------- -------- sun/fr(France5) +-------- -------- sun/fr(France5_Hobo) +-------- -------- sun/fr(France6) +-------- -------- sun/fr(France6_usb) +-------- -------- sun/es(SpainLatAm4) +-------- -------- sun/es(Spain5) +-------- -------- sun/es(Spain5_Hobo) +-------- -------- sun/es(Spain6) +-------- -------- sun/es(Spain6_usb) +-------- -------- sun/cz(Czech5) +-------- -------- sun/se(Sweden4) +-------- -------- sun/se(Sweden5) +-------- -------- sun/se(Sweden5_Hobo) +-------- -------- sun/se(Sweden6) +-------- -------- sun/se(Sweden6_usb) +-------- -------- sun/no(Norway4) +-------- -------- sun/no(Norway5) +-------- -------- sun/no(Norway5_Hobo) +-------- -------- sun/no(Norway6) +-------- -------- sun/no(Norway6_usb) +-------- -------- sun/tw(Taiwan4) +-------- -------- sun/tw(Taiwan5) +-------- -------- sun/tw(Taiwan5_Hobo) +-------- -------- sun/tw(Taiwan6) +-------- -------- sun/tw(Taiwan6_usb) +-------- -------- sun/ru(Russia4) +-------- -------- sun/ru(Russia5) +-------- -------- sun/ru(Russia6) +-------- -------- sun/ru(Russia6_usb) +-d------ -------- sgi/sk_qwerty(indy) +-------- -------- sgi/sk_qwerty(indigo) +-d------ -------- sgi/dk(indy) +-------- -------- sgi/dk(indy_nodeadkeys) +-------- -------- sgi/dk(indigo) +-------- -------- sgi/dk(indigo_nodeadkeys) +-d------ -------- sgi/pt(indy) +-------- -------- sgi/pt(indy_nodeadkeys) +-------- -------- sgi/pt(indigo) +-------- -------- sgi/pt(indigo_nodeadkeys) +-d------ -------- sgi/de(indy) +-------- -------- sgi/de(indy_nodeadkeys) +-------- -------- sgi/de(indigo) +-------- -------- sgi/de(indigo_nodeadkeys) +-d------ -------- sgi/cz_qwerty(indy) +-------- -------- sgi/cz_qwerty(indigo) +-d------ -------- sgi/sk(indy) +-------- -------- sgi/sk(indigo) +-d------ -------- sgi/th(indy) +-------- -------- sgi/th(indigo) +-d------ -------- sgi/en_US(indy) +-------- -------- sgi/en_US(indy_nodeadkeys) +-------- -------- sgi/en_US(indy101) +-------- -------- sgi/en_US(indy101_nodeadkeys) +-------- -------- sgi/en_US(indy104) +-------- -------- sgi/en_US(indy104_nodeadkeys) +-------- -------- sgi/en_US(indigo) +-------- -------- sgi/en_US(indigo_nodeadkeys) +-d------ -------- sgi/be(indy) +-------- -------- sgi/be(indy_nodeadkeys) +-------- -------- sgi/be(indigo) +-------- -------- sgi/be(indigo_nodeadkeys) +-d------ -------- sgi/ca(indy) +-------- -------- sgi/ca(indy_nodeadkeys) +-------- -------- sgi/ca(indigo) +-------- -------- sgi/ca(indigo_nodeadkeys) +-d------ -------- sgi/de_CH(indy) +-------- -------- sgi/de_CH(indy_nodeadkeys) +-------- -------- sgi/de_CH(indigo) +-------- -------- sgi/de_CH(indigo_nodeadkeys) +-d------ -------- sgi/us(indy) +-------- -------- sgi/us(indy101_euro) +-------- -------- sgi/us(indy_compose) +-------- -------- sgi/us(indigo) +-------- -------- sgi/us(indigo_compose) +-------- -------- sgi/us(indigo101_compose) +-d------ -------- sgi/fi(indy) +-------- -------- sgi/fi(indy_nodeadkeys) +-------- -------- sgi/fi(indigo) +-------- -------- sgi/fi(indigo_nodeadkeys) +-d------ -------- sgi/jp(indy) +-d------ -------- sgi/hu(indy) +-------- -------- sgi/hu(indy_toggle) +-------- -------- sgi/hu(indy_shift_toggle) +-------- -------- sgi/hu(indy_ctrl_shift_toggle) +-------- -------- sgi/hu(indy_ctrl_alt_toggle) +-------- -------- sgi/hu(indy_caps_toggle) +-------- -------- sgi/hu(indigo) +-------- -------- sgi/hu(indigo_toggle) +-------- -------- sgi/hu(indigo_shift_toggle) +-------- -------- sgi/hu(indigo_ctrl_shift_toggle) +-------- -------- sgi/hu(indigo_ctrl_alt_toggle) +-------- -------- sgi/hu(indigo_caps_toggle) +-d------ -------- sgi/gb(indy) +-------- -------- sgi/gb(indy_nodeadkeys) +-------- -------- sgi/gb(indigo) +-------- -------- sgi/gb(indigo_nodeadkeys) +-d------ -------- sgi/dvorak(indy) +-------- -------- sgi/dvorak(indigo) +-d------ -------- sgi/pl(indy) +-------- -------- sgi/pl(indy_nodeadkeys) +-------- -------- sgi/pl(indigo) +-------- -------- sgi/pl(indigo_nodeadkeys) +-d------ -------- sgi/it(indy) +-------- -------- sgi/it(indy_nodeadkeys) +-------- -------- sgi/it(indigo) +-------- -------- sgi/it(indigo_nodeadkeys) +-d------ -------- sgi/fr(indy) +-------- -------- sgi/fr(indy_nodeadkeys) +-------- -------- sgi/fr(indigo) +-------- -------- sgi/fr(indigo_nodeadkeys) +-d------ -------- sgi/bg(indy) +-------- -------- sgi/bg(indigo) +-d------ -------- sgi/fr_CH(indy) +-------- -------- sgi/fr_CH(indy_nodeadkeys) +-------- -------- sgi/fr_CH(indigo) +-------- -------- sgi/fr_CH(indigo_nodeadkeys) +-d------ -------- sgi/es(indy) +-------- -------- sgi/es(indy_nodeadkeys) +-------- -------- sgi/es(indigo) +-------- -------- sgi/es(indigo_nodeadkeys) +-d------ -------- sgi/cz(indy) +-------- -------- sgi/cz(indigo) +-d------ -------- sgi/se(indy) +-------- -------- sgi/se(indy_nodeadkeys) +-------- -------- sgi/se(indigo) +-------- -------- sgi/se(indigo_nodeadkeys) +-d------ -------- sgi/no(indy) +-------- -------- sgi/no(indy_nodeadkeys) +-------- -------- sgi/no(indigo) +-------- -------- sgi/no(indigo_nodeadkeys) +-d------ -------- sgi/ru(indy) +-------- -------- sgi/ru(indy_toggle) +-------- -------- sgi/ru(indy_shift_toggle) +-------- -------- sgi/ru(indy_ctrl_shift_toggle) +-------- -------- sgi/ru(indy_ctrl_alt_toggle) +-------- -------- sgi/ru(indy_caps_toggle) +-------- -------- sgi/ru(indigo) +-------- -------- sgi/ru(indigo_toggle) +-------- -------- sgi/ru(indigo_shift_toggle) +-------- -------- sgi/ru(indigo_ctrl_shift_toggle) +-------- -------- sgi/ru(indigo_ctrl_alt_toggle) +-------- -------- sgi/ru(indigo_caps_toggle) +-d------ -------- ataritt(us) +-------- -------- ataritt(de) +-d------ -------- xfree98(jp) +-d------ -------- macintosh(macintosh) +-------- -------- macintosh(macintosh_old) +-d------ -------- amiga(usa1) +-------- -------- amiga(de) diff -ruN /opt/SUNWut.orig/lib/xkb/rules/README /opt/SUNWut/lib/xkb/rules/README --- /opt/SUNWut.orig/lib/xkb/rules/README 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/rules/README 2006-04-18 08:31:54.000000000 +0200 @@ -0,0 +1,6 @@ +This directory lists sets of rules which can be used to obtain an exact XKB +configuration. + + + +/* $XFree86$ */ diff -ruN /opt/SUNWut.orig/lib/xkb/rules/sgi /opt/SUNWut/lib/xkb/rules/sgi --- /opt/SUNWut.orig/lib/xkb/rules/sgi 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/rules/sgi 2006-04-18 08:31:54.000000000 +0200 @@ -0,0 +1,73 @@ +// $Xorg: sgi,v 1.3 2000/08/17 19:54:41 cpqbld Exp $ + +! option = symbols + grp:switch = +group(switch) + grp:toggle = +group(toggle) + grp:shift_toggle = +group(shift_toggle) + grp:ctrl_shift_toggle = +group(ctrl_shift_toggle) + grp:ctrl_alt_toggle = +group(ctrl_alt_toggle) + grp:caps_toggle = +group(caps_toggle) + ctrl:nocaps = +ctrl(nocaps) + ctrl:swapcaps = +ctrl(swapcaps) + ctrl:ctrl_ac = +ctrl(ctrl_ac) + ctrl:ctrl_aa = +ctrl(ctrl_aa) + keypad:overlay = +keypad(overlay) + keypad:overlay1 = +keypad(overlay) + keypad:overlay2 = +keypad(overlay) + lock:shift = +lock(shift) + pc104:altmeta = +pc104(altmeta) + pc104:compose = +pc104(compose) + +! option = keycodes + lock:shift = +sgi/indy(shiftLock) + +! option = keycodes compat + keypad:overlay = +sgi/indy(overlayKeypad) +keypad(overlay) + keypad:overlay1 = +sgi/indy(overlayKeypad) +keypad(overlay1) + keypad:overlay2 = +sgi/indy(overlayKeypad) +keypad(overlay2) + +! model layout = keycodes geometry + indy us = sgi/indy(universal) sgi/indy(pc101) + indy intl = sgi/indy(universal) sgi/indy(pc101) + indy dvorak = sgi/indy(universal) sgi/indy(pc101) + indigo us = sgi/indigo(pc101) sgi/indigo(pc101) + indigo intl = sgi/indigo(pc101) sgi/indigo(pc101) + indigo dvorak = sgi/indigo(pc101) sgi/indigo(pc101) + indy jp = sgi/indy(jp106) sgi/indy(jp106) + +! model = keycodes geometry + indy = sgi/indy(universal) sgi/indy(pc102) + indy101 = sgi/indy(universal) sgi/indy(pc101) + indy102 = sgi/indy(universal) sgi/indy(pc102) + indy104 = sgi/indy(universal) microsoft(natural) + indy105 = sgi/indy(universal) microsoft(natural) + indy106 = sgi/indy(jp106) sgi/indy(jp106) + indigo = sgi/indigo(pc102) sgi/indigo(pc102) + indigo102 = sgi/indigo(pc102) sgi/indigo(pc102) + microsoft = sgi/indy(universal) microsoft(natural) + kinesis = sgi/indy(universal) kinesis + dell101 = sgi/indy(universal) dell(dell101) + flexpro = sgi/indy(universal) keytronic(FlexPro) + omnikey101 = sgi/indy(universal) northgate(omnikey101) + pc101 = sgi/indy(universal) pc(pc101) + pc102 = sgi/indy(universal) pc(pc102) + jp106 = sgi/indy(jp106) pc(jp106) + digital101 = sgi/indy(universal) digital/pc(pc101) + digital102 = sgi/indy(universal) digital/pc(pc102) + digitalpcxaj = sgi/indy(jp106) digital/pc(pcxaj) + +! model variant = symbols + * nodeadkeys = en_US(pc_universal%_v)+%l%(v) + +! model layout = symbols + * us = us(pc_universal) + * jp = us(pc101)+sgi/%l%(v) + * intl = us(pc_universal_compose) + * en_US = en_US(pc_universal) + * * = en_US(pc_universal)+%l%(v) + +! layout = compat + jp = complete+japan + +! model layout = compat types + * * = complete complete diff -ruN /opt/SUNWut.orig/lib/xkb/rules/sgi.lst /opt/SUNWut/lib/xkb/rules/sgi.lst --- /opt/SUNWut.orig/lib/xkb/rules/sgi.lst 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/rules/sgi.lst 2006-04-18 08:31:54.000000000 +0200 @@ -0,0 +1,82 @@ +// $Xorg: sgi.lst,v 1.3 2000/08/17 19:54:41 cpqbld Exp $ + + + + +// $XFree86: xc/programs/xkbcomp/rules/sgi.lst,v 3.6 2001/05/18 23:35:34 dawes Exp $ + +! model + indy SGI O2, Indigo^2 or Indy + indy101 SGI O2, Indigo^2 or Indy (101-key US) + indy102 SGI O2, Indigo^2 or Indy (102-key European) + indy104 Generic 104-key PC + indy105 Generic 105-key PC + indy106 SGI O2, Indigo^2 or Indy (106-key Japanese) + indigo SGI Indigo + indigo102 SGI Indigo (102-key European) + dell101 Dell 101-key PC + flexpro Keytronic FlexPro + jp106 Generic 106-key Japanese PC + microsoft Microsoft Natural + omnikey101 Northgate OmniKey 101 + pc101 Generic 101-key PC + pc102 Generic 102-key (European) PC + +! layout + be Belgian + bg Bulgarian + ca Canadian + cz Czech + cz_qwerty Czech (qwerty) + de German + de_CH Swiss German + dvorak Dvorak (US) + dk Danish + en_US US/English w/ISO9995-3 + es Spanish + fi Finnish + fr French + fr_CH Swiss French + gb United Kingdom + hu Hungarian + it Italian + intl US w/Compose Key + jp Japanese + no Norwegian + pl Polish + pt Portuguese + ru Russian + se Swedish + sk Slovak + sk_qwerty Slovak (qwerty) + th Thai + us US/ASCII + tr Turkish + +! variant + nodeadkeys Eliminate dead keys from European keyboards + typewriter Cyrillic layout similar to manual typewriters + phonetic Cyrillic layout similar to US/ASCII layout + +! option + grp Group Shift/Lock behavior + grp:switch Right Alt key switches group while held down + grp:toggle Pressing Right Alt key toggles group + grp:shift_toggle Pressing both shift keys together toggles group + grp:ctrl_shift_toggle Pressing shift and control together toggles group + grp:ctrl_alt_toggle Pressing alt and control together toggles group + grp:caps_toggle Caps Lock key toggles group + ctrl Control Key Position + ctrl:nocaps Replace Caps Lock with another control key + ctrl:swapcaps Swap positions of control and Caps Lock + ctrl:ctrl_ac Control key is left of the 'A' key + ctrl:ctrl_aa Control key is at the left of the bottom row + keypad Specify behavior of the numeric keypad + keypad:overlay Use default Overlay instead of modifier for keypad + keypad:overlay1 Use Overlay1 instead of modifier for keypad + keypad:overlay2 Use Overlay2 instead of modifier for keypad + lock Specify behavior of the lock key + lock:shift Key is shift lock + lock:caps Key is captals lock + lock:group Key is group lock + diff -ruN /opt/SUNWut.orig/lib/xkb/rules/sun /opt/SUNWut/lib/xkb/rules/sun --- /opt/SUNWut.orig/lib/xkb/rules/sun 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/rules/sun 2008-06-18 23:52:48.000000000 +0200 @@ -0,0 +1,75 @@ +// Copyright 2004 Sun Microsystems, Inc. All rights reserved. +// Use is subject to license terms. +// ident "@(#)sun 1.2 04/03/26 SMI" +// +// $XFree86: xc/programs/xkbcomp/rules/sun,v 3.2 2003/08/09 14:30:49 pascal Exp $ + +! model = keycodes geometry + type4 = sun(type4) sun(type4) + type4_ca = sun(type4_ca) sun(type4_ca) + type4_jp = sun(type4_jp) sun(type4jp) + type4_euro = sun(type4tuv) sun(type4tuv) + type5 = sun(type5) sun(type5) + type5_euro = sun(type5tuv) sun(type5tuv) + type5_jp = sun(type5_jp) sun(type5jp) + type5_unix = sun(type5) sun(type5unix) + type5_hobo = sun(type5hobo) sun(type5hobo) + type5_euro_hobo = sun(type5tuvhobo) sun(type5tuvhobo) + type5_jp_hobo = sun(type5_jphobo) sun(type5jphobo) + type5_unix_hobo = sun(type5hobo) sun(type5hobo) + type6 = sun(type6) sun(type6) + type6_euro = sun(type6tuv) sun(type6tuv) + type6_jp = sun(type6_jp) sun(type6jp) + type6_unix = sun(type6unix) sun(type6unix) + type6_usb = sun(type6_usb) sun(type6) + type6_euro_usb = sun(type6tuv_usb) sun(type6tuv) + type6_jp_usb = sun(type6_jp_usb) sun(type6jp) + type6_unix_usb = sun(type6_usb) sun(type6unix) + +! model layout = symbols + type4 us = sun/us(type4) + type5 us = sun/us(type5) + type5_hobo us = sun/us(type5hobo) + type5_unix us = sun/us(type5) + type6 us = sun/us(type6) + type6_unix us = sun/us(type6) + type6_usb us = sun/us(type6) + type4 en_US = sun/us(type4)+iso9995-3(basic) + type5 en_US = sun/us(type5)+iso9995-3(basic) + type5_unix en_US = sun/us(type5)+iso9995-3(basic) + type6 en_US = sun/us(type6)+iso9995-3(basic) + type6_unix en_US = sun/us(type6)+iso9995-3(basic) + type6_usb en_US = sun/us(type6)+iso9995-3(basic) + type4_ca ca = sun/ca(type4) + type4_jp jp = sun/jp(type4) + type5_jp jp = sun/jp(type5) + type5_jp_hobo jp = sun/jp(type5hobo) + type6_jp jp = sun/jp(type5) + type6_jp_usb jp = sun/jp(type5) + type4 * = sun/us(type4)+%l%(v) + type4_euro * = sun/us(type4)+%l%(v) + type5_hobo * = sun/us(type5hobo)+%l%(v) + type5_euro_hobo * = sun/us(type5hobo)+%l%(v) + type5 * = sun/us(type5)+%l%(v) + type5_euro * = sun/us(type5)+%l%(v) + type6 * = sun/us(type6)+%l%(v) + type6_euro * = sun/us(type6)+%l%(v) + +! model layout = compat types + * * = complete complete + +! option = symbols + grp:switch = +group(switch) + grp:toggle = +group(toggle) + grp:shift_toggle = +group(shift_toggle) + grp:ctrl_shift_toggle = +group(ctrl_shift_toggle) + grp:ctrl_alt_toggle = +group(ctrl_alt_toggle) + grp:caps_toggle = +group(caps_toggle) + ctrl:nocaps = +ctrl(nocaps) + ctrl:swapcaps = +ctrl(swapcaps) + ctrl:ctrl_ac = +ctrl(ctrl_ac) + ctrl:ctrl_aa = +ctrl(ctrl_aa) + keypad:overlay = +keypad(overlay) + keypad:overlay1 = +keypad(overlay) + keypad:overlay2 = +keypad(overlay) + lock:shift = +lock(shift) diff -ruN /opt/SUNWut.orig/lib/xkb/rules/sun.lst /opt/SUNWut/lib/xkb/rules/sun.lst --- /opt/SUNWut.orig/lib/xkb/rules/sun.lst 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/rules/sun.lst 2008-06-18 23:52:49.000000000 +0200 @@ -0,0 +1,92 @@ +// Copyright 2004 Sun Microsystems, Inc. All rights reserved. +// Use is subject to license terms. +// ident "@(#)sun.lst 1.2 04/03/26 SMI" +// +// $XFree86: xc/programs/xkbcomp/rules/sun.lst,v 3.6 2003/08/09 14:30:49 pascal Exp $ + +! model + type4 Sun Type 4 + type4_ca Sun Type 4 Canadian + type4_jp Sun Type 4 Japanese + type4_euro Sun Type 4 European + type5 Sun Type 5 + type5_euro Sun Type 5 European + type5_jp Sun Type 5 Japanese + type5_unix Sun Type 5 Unix + type5_hobo Sun Type 5 Compact + type5_euro_hobo Sun Type 5 Compact European + type5_jp_hobo Sun Type 5 Compact Japanese + type6 Sun Type 6 + type6_euro Sun Type 6 European + type6_jp Sun Type 6 Japanese + type6_unix Sun Type 6 Unix + type6_usb Sun Type 6 USB + type6_euro_usb Sun Type 6 USB European + type6_jp_usb Sun Type 6 USB Japanese + type6_unix_usb Sun Type 6 USB Unix + +! layout + ar Arabic + be Belgian + bg Bulgarian + ca Canadian + cz Czech + de German + de_CH Swiss German + dvorak Dvorak (US) + dk Danish + ee Estonian + en_US US/English w/ISO9995-3 + es Spanish + fi Finnish + fr French + fr_BE French Belgium + fr_CA Canadaian French + fr_CH Swiss French + gb United Kingdom + gr Greek + hu Hungarian + it Italian + intl US w/Compose Key + jp Japanese + ko Korean + lt Lithuania + lv Latvia + nl Netherlands + no Norwegian + pl Polish + pt Portuguese + ru Russian + se Swedish + sk Slovak + th Thai + tr Turkish + tw Taiwan + uk United Kingdom + us US/ASCII + us_unix US/UNIX + + +! variant + nodeadkeys Eliminate dead keys from European keyboards + typewriter Cyrillic layout similar to manual typewriters + phonetic Cyrillic layout similar to US/ASCII layout + +! option + grp Group Shift/Lock behavior + grp:switch Right Alt key switches group while held down + grp:toggle Pressing Right Alt key toggles group + grp:shift_toggle Pressing both shift keys together toggles group + grp:ctrl_shift_toggle Pressing shift and control together toggles group + grp:ctrl_alt_toggle Pressing alt and control together toggles group + grp:caps_toggle Caps Lock key toggles group + ctrl Control Key Position + ctrl:nocaps Replace Caps Lock with another control key + ctrl:swapcaps Swap positions of control and Caps Lock + ctrl:ctrl_ac Control key is left of the 'A' key + ctrl:ctrl_aa Control key is at the left of the bottom row + lock Specify behavior of the lock key + lock:shift Key is shift lock + lock:caps Key is captals lock + lock:group Key is group lock + diff -ruN /opt/SUNWut.orig/lib/xkb/rules/xfree98 /opt/SUNWut/lib/xkb/rules/xfree98 --- /opt/SUNWut.orig/lib/xkb/rules/xfree98 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/rules/xfree98 2006-04-18 08:31:54.000000000 +0200 @@ -0,0 +1,29 @@ +// +// Rules for resolving XKB components for use with XFree86 +// Copyright 1996 by Joseph Moss +// +// $XFree86: xc/programs/xkbcomp/rules/xfree86,v 3.5 1996/12/17 21:03:59 dawes Exp $ +// + +! model = keycodes geometry + pc98 = xfree98(pc98) nec(pc98) + jp106 = xfree98(jp106) pc(jp106) + +! model layout = symbols + pc98 nec/jp = nec/jp(pc98) + jp106 jp = jp + +! model layout = compat types + * * = complete complete + +! option = symbols + grp:switch = +group(switch) + grp:toggle = +group(toggle) + grp:shift_toggle = +group(shift_toggle) + grp:ctrl_shift_toggle = +group(ctrl_shift_toggle) + grp:ctrl_alt_toggle = +group(ctrl_alt_toggle) + ctrl:nocaps = +ctrl(nocaps) + ctrl:swapcaps = +ctrl(swapcaps) + ctrl:ctrl_ac = +ctrl(ctrl_ac) + ctrl:ctrl_aa = +ctrl(ctrl_aa) + diff -ruN /opt/SUNWut.orig/lib/xkb/rules/xfree98.lst /opt/SUNWut/lib/xkb/rules/xfree98.lst --- /opt/SUNWut.orig/lib/xkb/rules/xfree98.lst 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/rules/xfree98.lst 2006-04-18 08:31:54.000000000 +0200 @@ -0,0 +1,30 @@ +// +// Rules descriptions for XFree86 +// Copyright 1996 by Joseph Moss +// +// $XFree86: xc/programs/xkbcomp/rules/xfree86.lst,v 3.3 1996/12/18 03:30:14 dawes Exp $ + +! model + pc98 PC-98 series standard + jp106 Japanese 106-key + +! layout + pc98 PC98 + jp Japanese + +! variant + nodeadkeys Eliminate dead keys + +! option + grp Group Shift/Lock behavior + grp:switch R-Alt switches group while pressed + grp:toggle Right Alt key changes group + grp:shift_toggle Both Shift keys together change group + grp:ctrl_shift_toggle Control+Shift changes group + grp:ctrl_alt_toggle Alt+Control changes group + ctrl Control Key Position + ctrl:nocaps Make CapsLock an additional Control + ctrl:swapcaps Swap Control and Caps Lock + ctrl:ctrl_ac Control key at left of 'A' + ctrl:ctrl_aa Control key at bottom left + diff -ruN /opt/SUNWut.orig/lib/xkb/rules/xkb.dtd /opt/SUNWut/lib/xkb/rules/xkb.dtd --- /opt/SUNWut.orig/lib/xkb/rules/xkb.dtd 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/rules/xkb.dtd 2006-04-18 08:31:54.000000000 +0200 @@ -0,0 +1,42 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff -ruN /opt/SUNWut.orig/lib/xkb/rules/xml2lst.pl /opt/SUNWut/lib/xkb/rules/xml2lst.pl --- /opt/SUNWut.orig/lib/xkb/rules/xml2lst.pl 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/rules/xml2lst.pl 2006-04-18 08:31:54.000000000 +0200 @@ -0,0 +1,288 @@ +#!/usr/bin/perl + +# converts the .xml file to the old format .lst file +# +# Usage: +# +# perl xml2lst.pl [lang] < filename.xml > filename.lst +# +# author Ivan Pascal + +if (@ARGV) { + $lang = shift @ARGV; +} else { + $lang = ''; +} + +$doc = new_document( 0, ''); +parse('', $doc); + +($reg) = node_by_name($doc, '/xkbConfigRegistry'); +@models = node_by_name($reg, 'modelList/model/configItem'); +@layouts = node_by_name($reg, 'layoutList/layout/configItem'); +@options = node_by_name($reg, 'optionList/group/configItem'); + +print "! model\n"; +for $i (@models) { + ($name) = node_by_name($i, 'name'); + @desc = node_by_name($i, 'description'); + $descr = with_attribute(\@desc, 'xml:lang='.$lang); + if (! defined $descr) { + $descr = with_attribute(\@desc, 'xml:lang='); + } + printf(" %-15s %s\n", text_child($name), text_child($descr)); +} + +print "\n! layout\n"; +for $i (@layouts) { + ($name) = node_by_name($i, 'name'); + @desc = node_by_name($i, 'description'); + $descr = with_attribute(\@desc, 'xml:lang='.$lang); + if (! defined $descr ) { + $descr = with_attribute(\@desc, 'xml:lang='); + } + printf(" %-15s %s\n", text_child($name), text_child($descr)); +} + +print "\n! variant\n"; +for $l (@layouts) { + ($lname) = node_by_name($l, 'name'); + @variants = node_by_name($l, '../variantList/variant/configItem'); + for $v (@variants) { + ($name) = node_by_name($v, 'name'); + @desc = node_by_name($v, 'description'); + $descr = with_attribute(\@desc, 'xml:lang='.$lang); + if (! defined $descr) { + $descr = with_attribute(\@desc, 'xml:lang='); + } + printf(" %-15s %s: %s\n", + text_child($name), text_child($lname), text_child($descr)); + } +} + +print "\n! options\n"; +for $g (@options) { + ($name) = node_by_name($g, 'name'); + @desc = node_by_name($g, 'description'); + $descr = with_attribute(\@desc, 'xml:lang='.$lang); + if (! defined $descr) { + $descr = with_attribute(\@desc, 'xml:lang='); + } + printf(" %-20s %s\n", text_child($name), text_child($descr)); + + @opts = node_by_name($g, '../option/configItem'); + for $o (@opts) { + ($name) = node_by_name($o, 'name'); + @desc = node_by_name($o, 'description'); + $descr = with_attribute(\@desc, 'xml:lang='.$lang); + if (! defined $descr) { + $descr = with_attribute(\@desc, 'xml:lang='); + } + printf(" %-20s %s\n", + text_child($name), text_child($descr)); + } +} + +sub with_attribute { + local ($nodelist, $attrexpr) = @_; + local ($attr, $value) = split (/=/, $attrexpr); + local ($node, $attrvalue); + if (defined $value && $value ne '') { + $value =~ s/"//g; + foreach $node (@{$nodelist}) { + $attrvalue = node_attribute($node, $attr); + if (defined $attrvalue && $attrvalue eq $value) { + return $node; + } + } + } else { + foreach $node (@{$nodelist}) { + if (! defined node_attribute($node, $attr)) { + return $node; + } + } + } + undef; +} + +# Subroutines + +sub parse { + local $intag = 0; + my (@node_stack, $parent); + $parent = @_[1]; + local ($tag, $text); + + while (<>) { + chomp; + @str = split /([<>])/; + shift @str if ($str[0] eq '' || $str[0] =~ /^[ \t]*$/); + + while (scalar @str) { + $token = shift @str; + if ($token eq '<') { + $intag = 1; + if (defined $text) { + add_text_node($parent, $text); + undef $text; + } + } elsif ($token eq '>') { + $intag = 0; + if ($tag =~ /^\/(.*)/) { # close tag + $parent = pop @node_stack; + } elsif ($tag =~ /^([^\/]*)\/$/) { + empty_tag($parent, $1); + } else { + if (defined ($node = open_tag($parent, $tag))) { + push @node_stack, $parent; + $parent = $node; + } + } + undef $tag; + } else { + if ($intag == 1) { + if (defined $tag) { + $tag .= ' '. $token; + } else { + $tag = $token; + } + } else { + if (defined $text) { + $text .= "\n" . $token; + } else { + $text = $token; + } + } + } + } + } +} + +sub new_document { + $doc = new_node( 0, '', 'DOCUMENT'); + $doc->{CHILDREN} = []; + return $doc; +} + +sub new_node { + local ($parent_node, $tag, $type) = @_; + + my %node; + $node{PARENT} = $parent_node; + $node{TYPE} = $type; + + if ($type eq 'COMMENT' || $type eq 'TEXT') { + $node{TEXT} = $tag; + $node{NAME} = $type; + return \%node; + } + + local ($tname, $attr) = split(' ', $tag, 2); + $node{NAME} = $tname; + + if (defined $attr && $attr ne '') { + my %attr_table; + local @attr_list = split ( /"/, $attr); + local ($name, $value); + while (scalar @attr_list) { + $name = shift @attr_list; + $name =~ s/[ =]//g; + next if ($name eq ''); + $value = shift @attr_list; + $attr_table{$name} =$value; + } + $node{ATTRIBUTES} = \%attr_table; + } + return \%node; +} + +sub add_node { + local ($parent_node, $node) = @_; + push @{$parent_node->{CHILDREN}}, $node; + + local $tname = $node->{NAME}; + if (defined $parent_node->{$tname}) { + push @{$parent_node->{$tname}}, $node + } else { + $parent_node->{$tname} = [ $node ]; + } +} + +sub empty_tag { + local ($parent_node, $tag) = @_; + local $node = new_node($parent_node, $tag, 'EMPTY'); + add_node($parent_node, $node); +} + +sub open_tag { + local ($parent_node, $tag) = @_; + local $node; + + if ($tag =~ /^\?.*/ || $tag =~ /^\!.*/) { + $node = new_node($parent_node, $tag, 'COMMENT'); + add_node($parent_node, $node); + undef; return; + } else { + $node = new_node($parent_node, $tag, 'NODE'); + $node->{CHILDREN} = []; + add_node($parent_node, $node); + return $node; + } +} + +sub add_text_node { + local ($parent_node, $text) = @_; + local $node = new_node($parent_node, $text, 'TEXT'); + add_node($parent_node, $node); +} + +sub node_by_name { + local ($node, $name) = @_; + local ($tagname, $path) = split(/\//, $name, 2); + + my @nodelist; + + if ($tagname eq '') { + while ($node->{PARENT} != 0) { + $node = $node->{PARENT}; + } + sublist_by_name($node, $path, \@nodelist); + } else { + sublist_by_name($node, $name, \@nodelist); + } + return @nodelist; +} + +sub sublist_by_name { + local ($node, $name, $res) = @_; + local ($tagname, $path) = split(/\//, $name, 2); + + if (! defined $path) { + push @{$res}, (@{$node->{$tagname}}); + return; + } + + if ($tagname eq '..' && $node->{PARENT} != 0) { + $node = $node->{PARENT}; + sublist_by_name($node, $path, $res); + } else { + local $n; + for $n (@{$node->{$tagname}}) { + sublist_by_name($n, $path, $res); + } + } +} + +sub node_attribute { + local $node = @_[0]; + if (defined $node->{ATTRIBUTES}) { + return $node->{ATTRIBUTES}{@_[1]}; + } + undef; +} + +sub text_child { + local ($node) = @_; + local ($child) = node_by_name($node, 'TEXT'); + return $child->{TEXT}; +} diff -ruN /opt/SUNWut.orig/lib/xkb/rules/xorg /opt/SUNWut/lib/xkb/rules/xorg --- /opt/SUNWut.orig/lib/xkb/rules/xorg 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/rules/xorg 2006-04-18 08:31:54.000000000 +0200 @@ -0,0 +1,960 @@ +// $XdotOrg$ + +// +// Rules for resolving XKB components for use with XFree86 +// Copyright 1996 by Joseph Moss +// +// 2002 Modifier: Ivan Pascal The XFree86 Project +// $XFree86: xc/programs/xkbcomp/rules/xfree86,v 3.79 2004/01/09 00:16:01 dawes Exp $ +// +// If you want non-latin layouts implicitly include the en_US layout +// uncomment lines below +//! $nonlatin = am ara bg by dev el ge il \ +// ir iu kan lo mk mm ml ori ru sr syr th \ +// tj ua + +! $pcmodels = pc101 pc102 pc104 pc105 +! $maclaptop = ibook powerbook +! $mac = macintosh macintosh_old ibook powerbook + +! $azerty = be fr +! $qwertz = al cz de hr hu ro si sk + +! $inetkbds = a4techKB21 a4techKBS8 acer_tm_800 acpi airkey azonaRF2300 \ + brother \ + btc5113rf btc5126t btc9000 btc9000a btc9001ah btc5090\ + cherryblue cherrybluea cherryblueb \ + chicony chicony9885 \ + compaqeak8 compaqik7 compaqik13 compaqik18 cymotionlinux \ + armada presario ipaq \ + dell inspiron dtk2000 \ + dexxa diamond genius geniuscomfy2 \ + ennyah_dkb1008 gyration \ + hpi6 hp2501 hp2505 hp5181 hpxe3gc hpxe3gf hpxe4xxx hpzt11xx \ + hp500fa hp5xx hp5185 \ + honeywell_euroboard \ + rapidaccess rapidaccess2 rapidaccess2a \ + ltcd logiaccess logicdp logicdpa logicdit logicink logiciink \ + logiinkse logiinkseusb logiitc logiik itouch logiultrax \ + mx1998 mx2500 mx2750 \ + microsoftinet microsoftpro microsoftprousb microsoftprooem microsoftprose \ + microsoftoffice microsoftmult \ + oretec \ + propeller scorpius \ + qtronix \ + samsung4500 samsung4510 \ + sk1300 sk2500 sk6200 sk7100 sp_inet \ + sven symplon toshiba_s3000 trust trustda yahoo + +! model = keycodes + macintosh_old = macintosh + powerpcps2 = powerpcps2 + pc98 = xfree98(pc98) + abnt2 = xfree86(abnt2) + jp106 = xfree86(jp106) + evdev = evdev + * = xfree86 + +! layout[1] = keycodes + $azerty = +aliases(azerty) + $qwertz = +aliases(qwertz) + * = +aliases(qwerty) + +! layout = keycodes + $azerty = +aliases(azerty) + $qwertz = +aliases(qwertz) + * = +aliases(qwerty) + +! model = geometry + microsoft = microsoft(natural) + microsoftpro = microsoft(natural) + microsoftprousb = microsoft(natural) + microsoftprose = microsoft(natural) + dell101 = dell(dell101) + flexpro = keytronic(FlexPro) + hp6000 = hp(omnibook) + omnikey101 = northgate(omnikey101) + thinkpad = ibm/thinkpad(common) + $pcmodels = pc(%m) + jp106 = pc(jp106) + everex = everex(STEPnote) + winbook = winbook(XP5) + pc98 = nec(pc98) + abnt2 = pc(abnt2) + $mac = macintosh(macintosh) + * = pc(pc104) + +! model layout variant = symbols + $pcmodels ben basic = pc/pc(%m)+pc/in(ben) + * ben basic = pc/pc(pc105)+pc/in(ben) + $pcmodels ben probhat = pc/pc(%m)+pc/in(ben_probhat) + * ben probhat = pc/pc(pc105)+pc/in(ben_probhat) + $pcmodels dev basic = pc/pc(%m)+pc/in(deva) + * dev basic = pc/pc(pc105)+pc/in(deva) + $pcmodels dvorak gb = pc/pc(%m)+pc/gb(dvorak) + * dvorak gb = pc/pc(pc105)+pc/gb(dvorak) + $pcmodels dvorak fr = pc/pc(%m)+pc/fr(dvorak) + * dvorak fr = pc/pc(pc105)+pc/fr(dvorak) + $pcmodels dvorak no = pc/pc(%m)+pc/no(dvorak) + * dvorak no = pc/pc(pc105)+pc/no(dvorak) + $pcmodels dvorak se = pc/pc(%m)+pc/se(dvorak) + * dvorak se = pc/pc(pc105)+pc/se(dvorak) + $pcmodels dvorak basic = pc/pc(%m)+pc/us(dvorak) + * dvorak basic = pc/pc(pc105)+pc/us(dvorak) + $pcmodels dvorak pl_basic = pc/pc(%m)+pc/pl(dvorak) + * dvorak pl_basic = pc/pc(pc105)+pc/pl(dvorak) + $pcmodels dvorak pl = pc/pc(%m)+pc/pl(dvorak_quotes) + * dvorak pl = pc/pc(pc105)+pc/pl(dvorak_quotes) + $pcmodels dvorak pl_altquotes = pc/pc(%m)+pc/pl(dvorak_altquotes) + * dvorak pl_altquotes = pc/pc(pc105)+pc/pl(dvorak_altquotes) + $pcmodels dz basic = pc/pc(%m)+pc/bt(basic) + * dz basic = pc/pc(pc105)+pc/bt(basic) + $pcmodels guj basic = pc/pc(%m)+pc/in(guj) + * guj basic = pc/pc(pc105)+pc/in(guj) + $pcmodels gur basic = pc/pc(%m)+pc/in(guru) + * gur basic = pc/pc(pc105)+pc/in(guru) + $pcmodels ie laptop = pc/pc(%m)+pc/ie(basic) + * ie laptop = pc/pc(pc105)+pc/ie(basic) + $pcmodels ie CloGaelachLaptop = pc/pc(%m)+pc/ie(CloGaelach) + * ie CloGaelachLaptop = pc/pc(pc105)+pc/ie(CloGaelach) + $pcmodels iu basic = pc/pc(%m)+pc/ca(ike) + * iu basic = pc/pc(pc105)+pc/ca(ike) + $pcmodels lo basic = pc/pc(%m)+pc/la(basic) + * lo basic = pc/pc(pc105)+pc/la(basic) + $pcmodels kan basic = pc/pc(%m)+pc/in(kan) + * kan basic = pc/pc(pc105)+pc/in(kan) + $pcmodels mal basic = pc/pc(%m)+pc/in(mal) + * mal basic = pc/pc(pc105)+pc/in(mal) + $pcmodels mal mlplusnum = pc/pc(%m)+pc/in(mal) + * mal mlplusnum = pc/pc(pc105)+pc/in(mal) + $pcmodels ogham basic = pc/pc(%m)+pc/ie(ogam) + * ogham basic = pc/pc(pc105)+pc/ie(ogam) + $pcmodels ogham laptop = pc/pc(%m)+pc/ie(ogam) + * ogham laptop = pc/pc(pc105)+pc/ie(ogam) + $pcmodels ogham is434 = pc/pc(%m)+pc/ie(ogam_is434) + * ogham is434 = pc/pc(pc105)+pc/ie(ogam_is434) + $pcmodels ogham is434laptop = pc/pc(%m)+pc/ie(ogam_is434) + * ogham is434laptop = pc/pc(pc105)+pc/ie(ogam_is434) + $pcmodels ori basic = pc/pc(%m)+pc/in(ori) + * ori basic = pc/pc(pc105)+pc/in(ori) + $pcmodels sapmi basic = pc/pc(%m)+pc/no(smi) + * sapmi basic = pc/pc(pc105)+pc/no(smi) + $pcmodels sapmi nodeadkeys = pc/pc(%m)+pc/no(smi_nodeadkeys) + * sapmi nodeadkeys = pc/pc(pc105)+pc/no(smi_nodeadkeys) + $pcmodels sapmi sefi = pc/pc(%m)+pc/fi(smi) + * sapmi sefi = pc/pc(pc105)+pc/fi(smi) + $pcmodels sin phonetic-static = pc/pc(%m)+pc/in(sin_phonetic) + * sin phonetic-static = pc/pc(pc105)+pc/in(sin_phonetic) + $pcmodels syr basic = pc/pc(%m)+pc/sy(syc) + * syr basic = pc/pc(pc105)+pc/sy(syc) + $pcmodels syr phonetic = pc/pc(%m)+pc/sy(syc_phonetic) + * syr phonetic = pc/pc(pc105)+pc/sy(syc_phonetic) + $pcmodels tam INSCRIPT = pc/pc(%m)+pc/in(tam) + * tam INSCRIPT = pc/pc(pc105)+pc/in(tam) + $pcmodels tam UNI = pc/pc(%m)+pc/in(tam_unicode) + * tam UNI = pc/pc(pc105)+pc/in(tam_unicode) + $pcmodels tam TAB = pc/pc(%m)+pc/in(tam_TAB) + * tam TAB = pc/pc(pc105)+pc/in(tam_TAB) + $pcmodels tam TSCII = pc/pc(%m)+pc/in(tam_TSCII) + * tam TSCII = pc/pc(pc105)+pc/in(tam_TSCII) + $pcmodels tel basic = pc/pc(%m)+pc/in(tel) + * tel basic = pc/pc(pc105)+pc/in(tel) + $pcmodels yu basic = pc/pc(%m)+pc/srp(latin) + * yu basic = pc/pc(pc105)+pc/srp(latin) + $pcmodels yu unicode = pc/pc(%m)+pc/srp(latinunicode) + * yu unicode = pc/pc(pc105)+pc/srp(latinunicode) + $pcmodels yu yz = pc/pc(%m)+pc/srp(latinyz) + * yu yz = pc/pc(pc105)+pc/srp(latinyz) + $pcmodels yu unicodeyz = pc/pc(%m)+pc/srp(latinunicodeyz) + * yu unicodeyz = pc/pc(pc105)+pc/srp(latinunicodeyz) + $maclaptop * nodeadkeys = macintosh/us(extended)+macintosh/%l%(v)+apple(laptop_bad_switch) + $mac * nodeadkeys = macintosh/us(extended)+macintosh/%l%(v) + +! model layout = symbols + $pcmodels ar = pc/pc(%m)+pc/ara + * ar = pc/pc(pc105)+pc/ara + $pcmodels ben = pc/pc(%m)+pc/in(ben) + * ben = pc/pc(pc105)+pc/in(ben) + $pcmodels bs = pc/pc(%m)+pc/ba + * bs = pc/pc(pc105)+pc/ba + $pcmodels dev = pc/pc(%m)+pc/in(deva) + * dev = pc/pc(pc105)+pc/in(deva) + $pcmodels dvorak = pc/pc(%m)+pc/us(dvorak) + * dvorak = pc/pc(pc105)+pc/us(dvorak) + $pcmodels dz = pc/pc(%m)+pc/bt + * dz = pc/pc(pc105)+pc/bt + $pcmodels el = pc/pc(%m)+pc/gr + * el = pc/pc(pc105)+pc/gr + $pcmodels ge_la = pc/pc(%m)+pc/ge + * ge_la = pc/pc(pc105)+pc/ge + $pcmodels ge_ru = pc/pc(%m)+pc/ge(ru) + * ge_ru = pc/pc(pc105)+pc/ge(ru) + $pcmodels guj = pc/pc(%m)+pc/in(guj) + * guj = pc/pc(pc105)+pc/in(guj) + $pcmodels gur = pc/pc(%m)+pc/in(guru) + * gur = pc/pc(pc105)+pc/in(guru) + $pcmodels iu = pc/pc(%m)+pc/ca(ike) + * iu = pc/pc(pc105)+pc/ca(ike) + $pcmodels lo = pc/pc(%m)+pc/la + * lo = pc/pc(pc105)+pc/la + $pcmodels kan = pc/pc(%m)+pc/in(kan) + * kan = pc/pc(pc105)+pc/in(kan) + $pcmodels mi = pc/pc(%m)+pc/mao + * mi = pc/pc(pc105)+pc/mao + $pcmodels mk = pc/pc(%m)+pc/mkd + * mk = pc/pc(pc105)+pc/mkd + $pcmodels ml = pc/pc(%m)+pc/in(mal) + * ml = pc/pc(pc105)+pc/in(mal) + $pcmodels ogham = pc/pc(%m)+pc/ie(ogam) + * ogham = pc/pc(pc105)+pc/ie(ogam) + $pcmodels ori = pc/pc(%m)+pc/ie(ori) + * ori = pc/pc(pc105)+pc/ie(ori) + $pcmodels sapmi = pc/pc(%m)+pc/no(smi) + * sapmi = pc/pc(pc105)+pc/no(smi) + $pcmodels sr = pc/pc(%m)+pc/srp + * sr = pc/pc(pc105)+pc/srp + $pcmodels syr = pc/pc(%m)+pc/sy(syc) + * syr = pc/pc(pc105)+pc/sy(syc) + $pcmodels tel = pc/pc(%m)+pc/in(tel) + * tel = pc/pc(pc105)+pc/in(tel) + $pcmodels tml = pc/pc(%m)+pc/in(tam) + * tml = pc/pc(pc105)+pc/in(tam) + $pcmodels yu = pc/pc(%m)+pc/srp + * yu = pc/pc(pc105)+pc/srp + $pcmodels ben(basic) = pc/pc(%m)+pc/in(ben) + * ben(basic) = pc/pc(pc105)+pc/in(ben) + $pcmodels ben(probhat) = pc/pc(%m)+pc/in(ben_probhat) + * ben(probhat) = pc/pc(pc105)+pc/in(ben_probhat) + $pcmodels dev(basic) = pc/pc(%m)+pc/in(deva) + * dev(basic) = pc/pc(pc105)+pc/in(deva) + $pcmodels dvorak(gb) = pc/pc(%m)+pc/gb(dvorak) + * dvorak(gb) = pc/pc(pc105)+pc/gb(dvorak) + $pcmodels dvorak(fr) = pc/pc(%m)+pc/fr(dvorak) + * dvorak(fr) = pc/pc(pc105)+pc/fr(dvorak) + $pcmodels dvorak(no) = pc/pc(%m)+pc/no(dvorak) + * dvorak(no) = pc/pc(pc105)+pc/no(dvorak) + $pcmodels dvorak(se) = pc/pc(%m)+pc/se(dvorak) + * dvorak(se) = pc/pc(pc105)+pc/se(dvorak) + $pcmodels dvorak(basic) = pc/pc(%m)+pc/us(dvorak) + * dvorak(basic) = pc/pc(pc105)+pc/us(dvorak) + $pcmodels dvorak(pl_basic) = pc/pc(%m)+pc/pl(dvorak) + * dvorak(pl_basic) = pc/pc(pc105)+pc/pl(dvorak) + $pcmodels dvorak(pl) = pc/pc(%m)+pc/pl(dvorak_quotes) + * dvorak(pl) = pc/pc(pc105)+pc/pl(dvorak_quotes) + $pcmodels dvorak(pl_altquotes) = pc/pc(%m)+pc/pl(dvorak_altquotes) + * dvorak(pl_altquotes) = pc/pc(pc105)+pc/pl(dvorak_altquotes) + $pcmodels dz(basic) = pc/pc(%m)+pc/bt(basic) + * dz(basic) = pc/pc(pc105)+pc/bt(basic) + $pcmodels guj(basic) = pc/pc(%m)+pc/in(guj) + * guj(basic) = pc/pc(pc105)+pc/in(guj) + $pcmodels gur(basic) = pc/pc(%m)+pc/in(guru) + * gur(basic) = pc/pc(pc105)+pc/in(guru) + $pcmodels ie(laptop) = pc/pc(%m)+pc/ie(basic) + * ie(laptop) = pc/pc(pc105)+pc/ie(basic) + $pcmodels ie(CloGaelachLaptop) = pc/pc(%m)+pc/ie(CloGaelach) + * ie(CloGaelachLaptop) = pc/pc(pc105)+pc/ie(CloGaelach) + $pcmodels iu(basic) = pc/pc(%m)+pc/ca(ike) + * iu(basic) = pc/pc(pc105)+pc/ca(ike) + $pcmodels lo(basic) = pc/pc(%m)+pc/la(basic) + * lo(basic) = pc/pc(pc105)+pc/la(basic) + $pcmodels kan(basic) = pc/pc(%m)+pc/in(kan) + * kan(basic) = pc/pc(pc105)+pc/in(kan) + $pcmodels mal(basic) = pc/pc(%m)+pc/in(mal) + * mal(basic) = pc/pc(pc105)+pc/in(mal) + $pcmodels mal(mlplusnum) = pc/pc(%m)+pc/in(mal) + * mal(mlplusnum) = pc/pc(pc105)+pc/in(mal) + $pcmodels ogham(basic) = pc/pc(%m)+pc/ie(ogam) + * ogham(basic) = pc/pc(pc105)+pc/ie(ogam) + $pcmodels ogham(laptop) = pc/pc(%m)+pc/ie(ogam) + * ogham(laptop) = pc/pc(pc105)+pc/ie(ogam) + $pcmodels ogham(is434) = pc/pc(%m)+pc/ie(ogam_is434) + * ogham(is434) = pc/pc(pc105)+pc/ie(ogam_is434) + $pcmodels ogham(is434laptop) = pc/pc(%m)+pc/ie(ogam_is434) + * ogham(is434laptop) = pc/pc(pc105)+pc/ie(ogam_is434) + $pcmodels ori(basic) = pc/pc(%m)+pc/in(ori) + * ori(basic) = pc/pc(pc105)+pc/in(ori) + $pcmodels sapmi(basic) = pc/pc(%m)+pc/no(smi) + * sapmi(basic) = pc/pc(pc105)+pc/no(smi) + $pcmodels sapmi(nodeadkeys) = pc/pc(%m)+pc/no(smi_nodeadkeys) + * sapmi(nodeadkeys) = pc/pc(pc105)+pc/no(smi_nodeadkeys) + $pcmodels sapmi(sefi) = pc/pc(%m)+pc/fi(smi) + * sapmi(sefi) = pc/pc(pc105)+pc/fi(smi) + $pcmodels sin(phonetic-static) = pc/pc(%m)+pc/in(sin_phonetic) + * sin(phonetic-static) = pc/pc(pc105)+pc/in(sin_phonetic) + $pcmodels syr(basic) = pc/pc(%m)+pc/sy(syc) + * syr(basic) = pc/pc(pc105)+pc/sy(syc) + $pcmodels syr(phonetic) = pc/pc(%m)+pc/sy(syc_phonetic) + * syr(phonetic) = pc/pc(pc105)+pc/sy(syc_phonetic) + $pcmodels tam(INSCRIPT) = pc/pc(%m)+pc/in(tam) + * tam(INSCRIPT) = pc/pc(pc105)+pc/in(tam) + $pcmodels tam(UNI) = pc/pc(%m)+pc/in(tam_unicode) + * tam(UNI) = pc/pc(pc105)+pc/in(tam_unicode) + $pcmodels tam(TAB) = pc/pc(%m)+pc/in(tam_TAB) + * tam(TAB) = pc/pc(pc105)+pc/in(tam_TAB) + $pcmodels tam(TSCII) = pc/pc(%m)+pc/in(tam_TSCII) + * tam(TSCII) = pc/pc(pc105)+pc/in(tam_TSCII) + $pcmodels tel(basic) = pc/pc(%m)+pc/in(tel) + * tel(basic) = pc/pc(pc105)+pc/in(tel) + $pcmodels yu(basic) = pc/pc(%m)+pc/srp(latin) + * yu(basic) = pc/pc(pc105)+pc/srp(latin) + $pcmodels yu(unicode) = pc/pc(%m)+pc/srp(latinunicode) + * yu(unicode) = pc/pc(pc105)+pc/srp(latinunicode) + $pcmodels yu(yz) = pc/pc(%m)+pc/srp(latinyz) + * yu(yz) = pc/pc(pc105)+pc/srp(latinyz) + $pcmodels yu(unicodeyz) = pc/pc(%m)+pc/srp(latinunicodeyz) + * yu(unicodeyz) = pc/pc(pc105)+pc/srp(latinunicodeyz) + pc98 nec/jp = nec/jp(pc98) + abnt2 br = pc/pc(pc104)+pc/br + $maclaptop us = macintosh/us(extended)+apple(laptop_bad_switch) + $maclaptop en_US = macintosh/us(extended)+apple(laptop_bad_switch) + $maclaptop * = macintosh/us(extended)+apple(laptop_bad_switch)+macintosh/%l%(v) + $mac us = macintosh/us(extended) + $mac en_US = macintosh/us(extended) + $mac * = macintosh/us(extended)+macintosh/%l%(v) + $pcmodels intl = us(%mcompose) + * intl = us(pc104compose) + * jp = pc/pc(pc102)+pc/jp(latin)+pc/jp:2 + $pcmodels $nonlatin = pc/pc(%m)+pc/us+pc/%l%(v):2 + $pcmodels * = pc/pc(%m)+pc/%l%(v) + * $nonlatin = pc/pc(pc105)+pc/us+pc/%l%(v):2 + * * = pc/pc(pc105)+pc/%l%(v) + +! model layout[1] = symbols + $pcmodels ar = pc/pc(%m)+pc/ara%(v[1]) + * ar = pc/pc(pc105)+pc/ara%(v[1]) + $pcmodels ben = pc/pc(%m)+pc/in(ben)%(v[1]) + * ben = pc/pc(pc105)+pc/in(ben)%(v[1]) + $pcmodels bs = pc/pc(%m)+pc/ba%(v[1]) + * bs = pc/pc(pc105)+pc/ba%(v[1]) + $pcmodels dev = pc/pc(%m)+pc/in(deva)%(v[1]) + * dev = pc/pc(pc105)+pc/in(deva)%(v[1]) + $pcmodels dvorak = pc/pc(%m)+pc/us(dvorak)%(v[1]) + * dvorak = pc/pc(pc105)+pc/us(dvorak)%(v[1]) + $pcmodels dz = pc/pc(%m)+pc/bt%(v[1]) + * dz = pc/pc(pc105)+pc/bt%(v[1]) + $pcmodels el = pc/pc(%m)+pc/gr%(v[1]) + * el = pc/pc(pc105)+pc/gr%(v[1]) + $pcmodels ge_la = pc/pc(%m)+pc/ge%(v[1]) + * ge_la = pc/pc(pc105)+pc/ge%(v[1]) + $pcmodels ge_ru = pc/pc(%m)+pc/ge(ru)%(v[1]) + * ge_ru = pc/pc(pc105)+pc/ge(ru)%(v[1]) + $pcmodels guj = pc/pc(%m)+pc/in(guj)%(v[1]) + * guj = pc/pc(pc105)+pc/in(guj)%(v[1]) + $pcmodels gur = pc/pc(%m)+pc/in(guru)%(v[1]) + * gur = pc/pc(pc105)+pc/in(guru)%(v[1]) + $pcmodels iu = pc/pc(%m)+pc/ca(ike)%(v[1]) + * iu = pc/pc(pc105)+pc/ca(ike)%(v[1]) + $pcmodels lo = pc/pc(%m)+pc/la%(v[1]) + * lo = pc/pc(pc105)+pc/la%(v[1]) + $pcmodels kan = pc/pc(%m)+pc/in(kan)%(v[1]) + * kan = pc/pc(pc105)+pc/in(kan)%(v[1]) + $pcmodels mi = pc/pc(%m)+pc/mao%(v[1]) + * mi = pc/pc(pc105)+pc/mao%(v[1]) + $pcmodels mk = pc/pc(%m)+pc/mkd%(v[1]) + * mk = pc/pc(pc105)+pc/mkd%(v[1]) + $pcmodels ml = pc/pc(%m)+pc/in(mal)%(v[1]) + * ml = pc/pc(pc105)+pc/in(mal)%(v[1]) + $pcmodels ogham = pc/pc(%m)+pc/ie(ogam)%(v[1]) + * ogham = pc/pc(pc105)+pc/ie(ogam)%(v[1]) + $pcmodels ori = pc/pc(%m)+pc/ie(ori)%(v[1]) + * ori = pc/pc(pc105)+pc/ie(ori)%(v[1]) + $pcmodels sapmi = pc/pc(%m)+pc/no(smi)%(v[1]) + * sapmi = pc/pc(pc105)+pc/no(smi)%(v[1]) + $pcmodels sr = pc/pc(%m)+pc/srp%(v[1]) + * sr = pc/pc(pc105)+pc/srp%(v[1]) + $pcmodels syr = pc/pc(%m)+pc/sy(syc)%(v[1]) + * syr = pc/pc(pc105)+pc/sy(syc)%(v[1]) + $pcmodels tel = pc/pc(%m)+pc/in(tel)%(v[1]) + * tel = pc/pc(pc105)+pc/in(tel)%(v[1]) + $pcmodels tml = pc/pc(%m)+pc/in(tam)%(v[1]) + * tml = pc/pc(pc105)+pc/in(tam)%(v[1]) + $pcmodels yu = pc/pc(%m)+pc/srp%(v[1]) + * yu = pc/pc(pc105)+pc/srp%(v[1]) + $pcmodels ben(basic) = pc/pc(%m)+pc/in(ben) + * ben(basic) = pc/pc(pc105)+pc/in(ben) + $pcmodels ben(probhat) = pc/pc(%m)+pc/in(ben_probhat) + * ben(probhat) = pc/pc(pc105)+pc/in(ben_probhat) + $pcmodels dev(basic) = pc/pc(%m)+pc/in(deva) + * dev(basic) = pc/pc(pc105)+pc/in(deva) + $pcmodels dvorak(gb) = pc/pc(%m)+pc/gb(dvorak) + * dvorak(gb) = pc/pc(pc105)+pc/gb(dvorak) + $pcmodels dvorak(fr) = pc/pc(%m)+pc/fr(dvorak) + * dvorak(fr) = pc/pc(pc105)+pc/fr(dvorak) + $pcmodels dvorak(no) = pc/pc(%m)+pc/no(dvorak) + * dvorak(no) = pc/pc(pc105)+pc/no(dvorak) + $pcmodels dvorak(se) = pc/pc(%m)+pc/se(dvorak) + * dvorak(se) = pc/pc(pc105)+pc/se(dvorak) + $pcmodels dvorak(basic) = pc/pc(%m)+pc/us(dvorak) + * dvorak(basic) = pc/pc(pc105)+pc/us(dvorak) + $pcmodels dvorak(pl_basic) = pc/pc(%m)+pc/pl(dvorak) + * dvorak(pl_basic) = pc/pc(pc105)+pc/pl(dvorak) + $pcmodels dvorak(pl) = pc/pc(%m)+pc/pl(dvorak_quotes) + * dvorak(pl) = pc/pc(pc105)+pc/pl(dvorak_quotes) + $pcmodels dvorak(pl_altquotes) = pc/pc(%m)+pc/pl(dvorak_altquotes) + * dvorak(pl_altquotes) = pc/pc(pc105)+pc/pl(dvorak_altquotes) + $pcmodels dz(basic) = pc/pc(%m)+pc/bt(basic) + * dz(basic) = pc/pc(pc105)+pc/bt(basic) + $pcmodels guj(basic) = pc/pc(%m)+pc/in(guj) + * guj(basic) = pc/pc(pc105)+pc/in(guj) + $pcmodels gur(basic) = pc/pc(%m)+pc/in(guru) + * gur(basic) = pc/pc(pc105)+pc/in(guru) + $pcmodels ie(laptop) = pc/pc(%m)+pc/ie(basic) + * ie(laptop) = pc/pc(pc105)+pc/ie(basic) + $pcmodels ie(CloGaelachLaptop) = pc/pc(%m)+pc/ie(CloGaelach) + * ie(CloGaelachLaptop) = pc/pc(pc105)+pc/ie(CloGaelach) + $pcmodels iu(basic) = pc/pc(%m)+pc/ca(ike) + * iu(basic) = pc/pc(pc105)+pc/ca(ike) + $pcmodels lo(basic) = pc/pc(%m)+pc/la(basic) + * lo(basic) = pc/pc(pc105)+pc/la(basic) + $pcmodels kan(basic) = pc/pc(%m)+pc/in(kan) + * kan(basic) = pc/pc(pc105)+pc/in(kan) + $pcmodels mal(basic) = pc/pc(%m)+pc/in(mal) + * mal(basic) = pc/pc(pc105)+pc/in(mal) + $pcmodels mal(mlplusnum) = pc/pc(%m)+pc/in(mal) + * mal(mlplusnum) = pc/pc(pc105)+pc/in(mal) + $pcmodels ogham(basic) = pc/pc(%m)+pc/ie(ogam) + * ogham(basic) = pc/pc(pc105)+pc/ie(ogam) + $pcmodels ogham(laptop) = pc/pc(%m)+pc/ie(ogam) + * ogham(laptop) = pc/pc(pc105)+pc/ie(ogam) + $pcmodels ogham(is434) = pc/pc(%m)+pc/ie(ogam_is434) + * ogham(is434) = pc/pc(pc105)+pc/ie(ogam_is434) + $pcmodels ogham(is434laptop) = pc/pc(%m)+pc/ie(ogam_is434) + * ogham(is434laptop) = pc/pc(pc105)+pc/ie(ogam_is434) + $pcmodels ori(basic) = pc/pc(%m)+pc/in(ori) + * ori(basic) = pc/pc(pc105)+pc/in(ori) + $pcmodels sapmi(basic) = pc/pc(%m)+pc/no(smi) + * sapmi(basic) = pc/pc(pc105)+pc/no(smi) + $pcmodels sapmi(nodeadkeys) = pc/pc(%m)+pc/no(smi_nodeadkeys) + * sapmi(nodeadkeys) = pc/pc(pc105)+pc/no(smi_nodeadkeys) + $pcmodels sapmi(sefi) = pc/pc(%m)+pc/fi(smi) + * sapmi(sefi) = pc/pc(pc105)+pc/fi(smi) + $pcmodels sin(phonetic-static) = pc/pc(%m)+pc/in(sin_phonetic) + * sin(phonetic-static) = pc/pc(pc105)+pc/in(sin_phonetic) + $pcmodels syr(basic) = pc/pc(%m)+pc/sy(syc) + * syr(basic) = pc/pc(pc105)+pc/sy(syc) + $pcmodels syr(phonetic) = pc/pc(%m)+pc/sy(syc_phonetic) + * syr(phonetic) = pc/pc(pc105)+pc/sy(syc_phonetic) + $pcmodels tam(INSCRIPT) = pc/pc(%m)+pc/in(tam) + * tam(INSCRIPT) = pc/pc(pc105)+pc/in(tam) + $pcmodels tam(UNI) = pc/pc(%m)+pc/in(tam_unicode) + * tam(UNI) = pc/pc(pc105)+pc/in(tam_unicode) + $pcmodels tam(TAB) = pc/pc(%m)+pc/in(tam_TAB) + * tam(TAB) = pc/pc(pc105)+pc/in(tam_TAB) + $pcmodels tam(TSCII) = pc/pc(%m)+pc/in(tam_TSCII) + * tam(TSCII) = pc/pc(pc105)+pc/in(tam_TSCII) + $pcmodels tel(basic) = pc/pc(%m)+pc/in(tel) + * tel(basic) = pc/pc(pc105)+pc/in(tel) + $pcmodels yu(basic) = pc/pc(%m)+pc/srp(latin) + * yu(basic) = pc/pc(pc105)+pc/srp(latin) + $pcmodels yu(unicode) = pc/pc(%m)+pc/srp(latinunicode) + * yu(unicode) = pc/pc(pc105)+pc/srp(latinunicode) + $pcmodels yu(yz) = pc/pc(%m)+pc/srp(latinyz) + * yu(yz) = pc/pc(pc105)+pc/srp(latinyz) + $pcmodels yu(unicodeyz) = pc/pc(%m)+pc/srp(latinunicodeyz) + * yu(unicodeyz) = pc/pc(pc105)+pc/srp(latinunicodeyz) + $pcmodels * = pc/pc(%m)+pc/%l[1]%(v[1]) + * * = pc/pc(pc105)+pc/%l[1]%(v[1]) + +! model layout[1] variant[1] = symbols + $pcmodels ben basic = pc/pc(%m)+pc/in(ben) + * ben basic = pc/pc(pc105)+pc/in(ben) + $pcmodels ben probhat = pc/pc(%m)+pc/in(ben_probhat) + * ben probhat = pc/pc(pc105)+pc/in(ben_probhat) + $pcmodels dev basic = pc/pc(%m)+pc/in(deva) + * dev basic = pc/pc(pc105)+pc/in(deva) + $pcmodels dvorak gb = pc/pc(%m)+pc/gb(dvorak) + * dvorak gb = pc/pc(pc105)+pc/gb(dvorak) + $pcmodels dvorak fr = pc/pc(%m)+pc/fr(dvorak) + * dvorak fr = pc/pc(pc105)+pc/fr(dvorak) + $pcmodels dvorak no = pc/pc(%m)+pc/no(dvorak) + * dvorak no = pc/pc(pc105)+pc/no(dvorak) + $pcmodels dvorak se = pc/pc(%m)+pc/se(dvorak) + * dvorak se = pc/pc(pc105)+pc/se(dvorak) + $pcmodels dvorak basic = pc/pc(%m)+pc/us(dvorak) + * dvorak basic = pc/pc(pc105)+pc/us(dvorak) + $pcmodels dvorak pl_basic = pc/pc(%m)+pc/pl(dvorak) + * dvorak pl_basic = pc/pc(pc105)+pc/pl(dvorak) + $pcmodels dvorak pl = pc/pc(%m)+pc/pl(dvorak_quotes) + * dvorak pl = pc/pc(pc105)+pc/pl(dvorak_quotes) + $pcmodels dvorak pl_altquotes = pc/pc(%m)+pc/pl(dvorak_altquotes) + * dvorak pl_altquotes = pc/pc(pc105)+pc/pl(dvorak_altquotes) + $pcmodels dz basic = pc/pc(%m)+pc/bt(basic) + * dz basic = pc/pc(pc105)+pc/bt(basic) + $pcmodels guj basic = pc/pc(%m)+pc/in(guj) + * guj basic = pc/pc(pc105)+pc/in(guj) + $pcmodels gur basic = pc/pc(%m)+pc/in(guru) + * gur basic = pc/pc(pc105)+pc/in(guru) + $pcmodels ie laptop = pc/pc(%m)+pc/ie(basic) + * ie laptop = pc/pc(pc105)+pc/ie(basic) + $pcmodels ie CloGaelachLaptop = pc/pc(%m)+pc/ie(CloGaelach) + * ie CloGaelachLaptop = pc/pc(pc105)+pc/ie(CloGaelach) + $pcmodels iu basic = pc/pc(%m)+pc/ca(ike) + * iu basic = pc/pc(pc105)+pc/ca(ike) + $pcmodels lo basic = pc/pc(%m)+pc/la(basic) + * lo basic = pc/pc(pc105)+pc/la(basic) + $pcmodels kan basic = pc/pc(%m)+pc/in(kan) + * kan basic = pc/pc(pc105)+pc/in(kan) + $pcmodels mal basic = pc/pc(%m)+pc/in(mal) + * mal basic = pc/pc(pc105)+pc/in(mal) + $pcmodels mal mlplusnum = pc/pc(%m)+pc/in(mal) + * mal mlplusnum = pc/pc(pc105)+pc/in(mal) + $pcmodels ogham basic = pc/pc(%m)+pc/ie(ogam) + * ogham basic = pc/pc(pc105)+pc/ie(ogam) + $pcmodels ogham laptop = pc/pc(%m)+pc/ie(ogam) + * ogham laptop = pc/pc(pc105)+pc/ie(ogam) + $pcmodels ogham is434 = pc/pc(%m)+pc/ie(ogam_is434) + * ogham is434 = pc/pc(pc105)+pc/ie(ogam_is434) + $pcmodels ogham is434laptop = pc/pc(%m)+pc/ie(ogam_is434) + * ogham is434laptop = pc/pc(pc105)+pc/ie(ogam_is434) + $pcmodels ori basic = pc/pc(%m)+pc/in(ori) + * ori basic = pc/pc(pc105)+pc/in(ori) + $pcmodels sapmi basic = pc/pc(%m)+pc/no(smi) + * sapmi basic = pc/pc(pc105)+pc/no(smi) + $pcmodels sapmi nodeadkeys = pc/pc(%m)+pc/no(smi_nodeadkeys) + * sapmi nodeadkeys = pc/pc(pc105)+pc/no(smi_nodeadkeys) + $pcmodels sapmi sefi = pc/pc(%m)+pc/fi(smi) + * sapmi sefi = pc/pc(pc105)+pc/fi(smi) + $pcmodels sin phonetic-static = pc/pc(%m)+pc/in(sin_phonetic) + * sin phonetic-static = pc/pc(pc105)+pc/in(sin_phonetic) + $pcmodels syr basic = pc/pc(%m)+pc/sy(syc) + * syr basic = pc/pc(pc105)+pc/sy(syc) + $pcmodels syr phonetic = pc/pc(%m)+pc/sy(syc_phonetic) + * syr phonetic = pc/pc(pc105)+pc/sy(syc_phonetic) + $pcmodels tam INSCRIPT = pc/pc(%m)+pc/in(tam) + * tam INSCRIPT = pc/pc(pc105)+pc/in(tam) + $pcmodels tam UNI = pc/pc(%m)+pc/in(tam_unicode) + * tam UNI = pc/pc(pc105)+pc/in(tam_unicode) + $pcmodels tam TAB = pc/pc(%m)+pc/in(tam_TAB) + * tam TAB = pc/pc(pc105)+pc/in(tam_TAB) + $pcmodels tam TSCII = pc/pc(%m)+pc/in(tam_TSCII) + * tam TSCII = pc/pc(pc105)+pc/in(tam_TSCII) + $pcmodels tel basic = pc/pc(%m)+pc/in(tel) + * tel basic = pc/pc(pc105)+pc/in(tel) + $pcmodels yu basic = pc/pc(%m)+pc/srp(latin) + * yu basic = pc/pc(pc105)+pc/srp(latin) + $pcmodels yu unicode = pc/pc(%m)+pc/srp(latinunicode) + * yu unicode = pc/pc(pc105)+pc/srp(latinunicode) + $pcmodels yu yz = pc/pc(%m)+pc/srp(latinyz) + * yu yz = pc/pc(pc105)+pc/srp(latinyz) + $pcmodels yu unicodeyz = pc/pc(%m)+pc/srp(latinunicodeyz) + * yu unicodeyz = pc/pc(pc105)+pc/srp(latinunicodeyz) + +! layout[2] = symbols + ar = +pc/ara%(v[2]):2 + ben = +pc/in(ben):2 + bs = +pc/ba%(v[2]):2 + dev = +pc/in(deva):2 + dvorak = +pc/us(dvorak):2 + dz = +pc/bt%(v[2]):2 + el = +pc/gr%(v[2]):2 + ge_la = +pc/ge%(v[2]):2 + ge_ru = +pc/ge(ru):2 + guj = +pc/in(guj):2 + gur = +pc/in(guru):2 + iu = +pc/ca(ike):2 + lo = +pc/la%(v[2]):2 + kan = +pc/in(kan):2 + mi = +pc/mao%(v[2]):2 + mk = +pc/mkd%(v[2]):2 + ml = +pc/in(mal):2 + ogham = +pc/ie(ogam):2 + ori = +pc/ie(ori):2 + sapmi = +pc/no(smi):2 + sr = +pc/srp%(v[2]):2 + syr = +pc/sy(syc):2 + tel = +pc/in(tel):2 + tml = +pc/in(tam):2 + yu = +pc/srp%(v[2]):2 + ben(basic) = +pc/in(ben):2 + ben(probhat) = +pc/in(ben_probhat):2 + dev(basic) = +pc/in(deva):2 + dvorak(gb) = +pc/gb(dvorak):2 + dvorak(fr) = +pc/fr(dvorak):2 + dvorak(no) = +pc/no(dvorak):2 + dvorak(se) = +pc/se(dvorak):2 + dvorak(basic) = +pc/us(dvorak):2 + dvorak(pl_basic) = +pc/pl(dvorak):2 + dvorak(pl) = +pc/pl(dvorak_quotes):2 + dvorak(pl_altquotes) = +pc/pl(dvorak_altquotes):2 + dz(basic) = +pc/bt(basic):2 + guj(basic) = +pc/in(guj):2 + gur(basic) = +pc/in(guru):2 + ie(laptop) = +pc/ie(basic):2 + ie(CloGaelachLaptop) = +pc/ie(CloGaelach):2 + iu(basic) = +pc/ca(ike):2 + lo(basic) = +pc/la(basic):2 + kan(basic) = +pc/in(kan):2 + mal(basic) = +pc/in(mal):2 + mal(mlplusnum) = +pc/in(mal):2 + ogham(basic) = +pc/ie(ogam):2 + ogham(laptop) = +pc/ie(ogam):2 + ogham(is434) = +pc/ie(ogam_is434):2 + ogham(is434laptop) = +pc/ie(ogam_is434):2 + ori(basic) = +pc/in(ori):2 + sapmi(basic) = +pc/no(smi):2 + sapmi(nodeadkeys) = +pc/no(smi_nodeadkeys):2 + sapmi(sefi) = +pc/fi(smi):2 + sin(phonetic-static) = +pc/in(sin_phonetic):2 + syr(basic) = +pc/sy(syc):2 + syr(phonetic) = +pc/sy(syc_phonetic):2 + tam(INSCRIPT) = +pc/in(tam):2 + tam(UNI) = +pc/in(tam_unicode):2 + tam(TAB) = +pc/in(tam_TAB):2 + tam(TSCII) = +pc/in(tam_TSCII):2 + tel(basic) = +pc/in(tel):2 + yu(basic) = +pc/srp(latin):2 + yu(unicode) = +pc/srp(latinunicode):2 + yu(yz) = +pc/srp(latinyz):2 + yu(unicodeyz) = +pc/srp(latinunicodeyz):2 + * = +pc/%l[2]%(v[2]):2 + +! layout[3] = symbols + ar = +pc/ara%(v[3]):3 + ben = +pc/in(ben)%(v[3]):3 + bs = +pc/ba%(v[3]):3 + dev = +pc/in(deva)%(v[3]):3 + dvorak = +pc/us(dvorak)%(v[3]):3 + dz = +pc/bt%(v[3]):3 + el = +pc/gr%(v[3]):3 + ge_la = +pc/ge%(v[3]):3 + ge_ru = +pc/ge(ru)%(v[3]):3 + guj = +pc/in(guj)%(v[3]):3 + gur = +pc/in(guru)%(v[3]):3 + iu = +pc/ca(ike)%(v[3]):3 + lo = +pc/la%(v[3]):3 + kan = +pc/in(kan)%(v[3]):3 + mi = +pc/mao%(v[3]):3 + mk = +pc/mkd%(v[3]):3 + ml = +pc/in(mal)%(v[3]):3 + ogham = +pc/ie(ogam)%(v[3]):3 + ori = +pc/ie(ori)%(v[3]):3 + sapmi = +pc/no(smi)%(v[3]):3 + sr = +pc/srp%(v[3]):3 + syr = +pc/sy(syc)%(v[3]):3 + tel = +pc/in(tel)%(v[3]):3 + tml = +pc/in(tam)%(v[3]):3 + yu = +pc/srp%(v[3]):3 + ben(basic) = +pc/in(ben):3 + ben(probhat) = +pc/in(ben_probhat):3 + dev(basic) = +pc/in(deva):3 + dvorak(gb) = +pc/gb(dvorak):3 + dvorak(fr) = +pc/fr(dvorak):3 + dvorak(no) = +pc/no(dvorak):3 + dvorak(se) = +pc/se(dvorak):3 + dvorak(basic) = +pc/us(dvorak):3 + dvorak(pl_basic) = +pc/pl(dvorak):3 + dvorak(pl) = +pc/pl(dvorak_quotes):3 + dvorak(pl_altquotes) = +pc/pl(dvorak_altquotes):3 + dz(basic) = +pc/bt(basic):3 + guj(basic) = +pc/in(guj):3 + gur(basic) = +pc/in(guru):3 + ie(laptop) = +pc/ie(basic):3 + ie(CloGaelachLaptop) = +pc/ie(CloGaelach):3 + iu(basic) = +pc/ca(ike):3 + lo(basic) = +pc/la(basic):3 + kan(basic) = +pc/in(kan):3 + mal(basic) = +pc/in(mal):3 + mal(mlplusnum) = +pc/in(mal):3 + ogham(basic) = +pc/ie(ogam):3 + ogham(laptop) = +pc/ie(ogam):3 + ogham(is434) = +pc/ie(ogam_is434):3 + ogham(is434laptop) = +pc/ie(ogam_is434):3 + ori(basic) = +pc/in(ori):3 + sapmi(basic) = +pc/no(smi):3 + sapmi(nodeadkeys) = +pc/no(smi_nodeadkeys):3 + sapmi(sefi) = +pc/fi(smi):3 + sin(phonetic-static) = +pc/in(sin_phonetic):3 + syr(basic) = +pc/sy(syc):3 + syr(phonetic) = +pc/sy(syc_phonetic):3 + tam(INSCRIPT) = +pc/in(tam):3 + tam(UNI) = +pc/in(tam_unicode):3 + tam(TAB) = +pc/in(tam_TAB):3 + tam(TSCII) = +pc/in(tam_TSCII):3 + tel(basic) = +pc/in(tel):3 + yu(basic) = +pc/srp(latin):3 + yu(unicode) = +pc/srp(latinunicode):3 + yu(yz) = +pc/srp(latinyz):3 + yu(unicodeyz) = +pc/srp(latinunicodeyz):3 + * = +pc/%l[3]%(v[3]):3 + +! layout[4] = symbols + ar = +pc/ara%(v[4]):4 + ben = +pc/in(ben)%(v[4]):4 + bs = +pc/ba%(v[4]):4 + dev = +pc/in(deva)%(v[4]):4 + dvorak = +pc/us(dvorak)%(v[4]):4 + dz = +pc/bt%(v[4]):4 + el = +pc/gr%(v[4]):4 + ge_la = +pc/ge%(v[4]):4 + ge_ru = +pc/ge(ru)%(v[4]):4 + guj = +pc/in(guj)%(v[4]):4 + gur = +pc/in(guru)%(v[4]):4 + iu = +pc/ca(ike)%(v[4]):4 + lo = +pc/la%(v[4]):4 + kan = +pc/in(kan)%(v[4]):4 + mi = +pc/mao%(v[4]):4 + mk = +pc/mkd%(v[4]):4 + ml = +pc/in(mal)%(v[4]):4 + ogham = +pc/ie(ogam)%(v[4]):4 + ori = +pc/ie(ori)%(v[4]):4 + sapmi = +pc/no(smi)%(v[4]):4 + sr = +pc/srp%(v[4]):4 + syr = +pc/sy(syc)%(v[4]):4 + tel = +pc/in(tel)%(v[4]):4 + tml = +pc/in(tam)%(v[4]):4 + yu = +pc/srp%(v[4]):4 + ben(basic) = +pc/in(ben):4 + ben(probhat) = +pc/in(ben_probhat):4 + dev(basic) = +pc/in(deva):4 + dvorak(gb) = +pc/gb(dvorak):4 + dvorak(fr) = +pc/fr(dvorak):4 + dvorak(no) = +pc/no(dvorak):4 + dvorak(se) = +pc/se(dvorak):4 + dvorak(basic) = +pc/us(dvorak):4 + dvorak(pl_basic) = +pc/pl(dvorak):4 + dvorak(pl) = +pc/pl(dvorak_quotes):4 + dvorak(pl_altquotes) = +pc/pl(dvorak_altquotes):4 + dz(basic) = +pc/bt(basic):4 + guj(basic) = +pc/in(guj):4 + gur(basic) = +pc/in(guru):4 + ie(laptop) = +pc/ie(basic):4 + ie(CloGaelachLaptop) = +pc/ie(CloGaelach):4 + iu(basic) = +pc/ca(ike):4 + lo(basic) = +pc/la(basic):4 + kan(basic) = +pc/in(kan):4 + mal(basic) = +pc/in(mal):4 + mal(mlplusnum) = +pc/in(mal):4 + ogham(basic) = +pc/ie(ogam):4 + ogham(laptop) = +pc/ie(ogam):4 + ogham(is434) = +pc/ie(ogam_is434):4 + ogham(is434laptop) = +pc/ie(ogam_is434):4 + ori(basic) = +pc/in(ori):4 + sapmi(basic) = +pc/no(smi):4 + sapmi(nodeadkeys) = +pc/no(smi_nodeadkeys):4 + sapmi(sefi) = +pc/fi(smi):4 + sin(phonetic-static) = +pc/in(sin_phonetic):4 + syr(basic) = +pc/sy(syc):4 + syr(phonetic) = +pc/sy(syc_phonetic):4 + tam(INSCRIPT) = +pc/in(tam):4 + tam(UNI) = +pc/in(tam_unicode):4 + tam(TAB) = +pc/in(tam_TAB):4 + tam(TSCII) = +pc/in(tam_TSCII):4 + tel(basic) = +pc/in(tel):4 + yu(basic) = +pc/srp(latin):4 + yu(unicode) = +pc/srp(latinunicode):4 + yu(yz) = +pc/srp(latinyz):4 + yu(unicodeyz) = +pc/srp(latinunicodeyz):4 + * = +pc/%l[4]%(v[4]):4 + +! layout[2] variant[2] = symbols + ben basic = +pc/in(ben):2 + ben probhat = +pc/in(ben_probhat):2 + dev basic = +pc/in(deva):2 + dvorak gb = +pc/gb(dvorak):2 + dvorak fr = +pc/fr(dvorak):2 + dvorak no = +pc/no(dvorak):2 + dvorak se = +pc/se(dvorak):2 + dvorak basic = +pc/us(dvorak):2 + dvorak pl_basic = +pc/pl(dvorak):2 + dvorak pl = +pc/pl(dvorak_quotes):2 + dvorak pl_altquotes = +pc/pl(dvorak_altquotes):2 + dz basic = +pc/bt(basic):2 + guj basic = +pc/in(guj):2 + gur basic = +pc/in(guru):2 + ie laptop = +pc/ie(basic):2 + ie CloGaelachLaptop = +pc/ie(CloGaelach):2 + iu basic = +pc/ca(ike):2 + lo basic = +pc/la(basic):2 + kan basic = +pc/in(kan):2 + mal basic = +pc/in(mal):2 + mal mlplusnum = +pc/in(mal):2 + ogham basic = +pc/ie(ogam):2 + ogham laptop = +pc/ie(ogam):2 + ogham is434 = +pc/ie(ogam_is434):2 + ogham is434laptop = +pc/ie(ogam_is434):2 + ori basic = +pc/in(ori):2 + sapmi basic = +pc/no(smi):2 + sapmi nodeadkeys = +pc/no(smi_nodeadkeys):2 + sapmi sefi = +pc/fi(smi):2 + sin phonetic-static = +pc/in(sin_phonetic):2 + syr basic = +pc/sy(syc):2 + syr phonetic = +pc/sy(syc_phonetic):2 + tam INSCRIPT = +pc/in(tam):2 + tam UNI = +pc/in(tam_unicode):2 + tam TAB = +pc/in(tam_TAB):2 + tam TSCII = +pc/in(tam_TSCII):2 + tel basic = +pc/in(tel):2 + yu basic = +pc/srp(latin):2 + yu unicode = +pc/srp(latinunicode):2 + yu yz = +pc/srp(latinyz):2 + yu unicodeyz = +pc/srp(latinunicodeyz):2 + +! layout[3] variant[3] = symbols + ben basic = +pc/in(ben):3 + ben probhat = +pc/in(ben_probhat):3 + dev basic = +pc/in(deva):3 + dvorak gb = +pc/gb(dvorak):3 + dvorak fr = +pc/fr(dvorak):3 + dvorak no = +pc/no(dvorak):3 + dvorak se = +pc/se(dvorak):3 + dvorak basic = +pc/us(dvorak):3 + dvorak pl_basic = +pc/pl(dvorak):3 + dvorak pl = +pc/pl(dvorak_quotes):3 + dvorak pl_altquotes = +pc/pl(dvorak_altquotes):3 + dz basic = +pc/bt(basic):3 + guj basic = +pc/in(guj):3 + gur basic = +pc/in(guru):3 + ie laptop = +pc/ie(basic):3 + ie CloGaelachLaptop = +pc/ie(CloGaelach):3 + iu basic = +pc/ca(ike):3 + lo basic = +pc/la(basic):3 + kan basic = +pc/in(kan):3 + mal basic = +pc/in(mal):3 + mal mlplusnum = +pc/in(mal):3 + ogham basic = +pc/ie(ogam):3 + ogham laptop = +pc/ie(ogam):3 + ogham is434 = +pc/ie(ogam_is434):3 + ogham is434laptop = +pc/ie(ogam_is434):3 + ori basic = +pc/in(ori):3 + sapmi basic = +pc/no(smi):3 + sapmi nodeadkeys = +pc/no(smi_nodeadkeys):3 + sapmi sefi = +pc/fi(smi):3 + sin phonetic-static = +pc/in(sin_phonetic):3 + syr basic = +pc/sy(syc):3 + syr phonetic = +pc/sy(syc_phonetic):3 + tam INSCRIPT = +pc/in(tam):3 + tam UNI = +pc/in(tam_unicode):3 + tam TAB = +pc/in(tam_TAB):3 + tam TSCII = +pc/in(tam_TSCII):3 + tel basic = +pc/in(tel):3 + yu basic = +pc/srp(latin):3 + yu unicode = +pc/srp(latinunicode):3 + yu yz = +pc/srp(latinyz):3 + yu unicodeyz = +pc/srp(latinunicodeyz):3 + +! layout[4] variant[4] = symbols + ben basic = +pc/in(ben):4 + ben probhat = +pc/in(ben_probhat):4 + dev basic = +pc/in(deva):4 + dvorak gb = +pc/gb(dvorak):4 + dvorak fr = +pc/fr(dvorak):4 + dvorak no = +pc/no(dvorak):4 + dvorak se = +pc/se(dvorak):4 + dvorak basic = +pc/us(dvorak):4 + dvorak pl_basic = +pc/pl(dvorak):4 + dvorak pl = +pc/pl(dvorak_quotes):4 + dvorak pl_altquotes = +pc/pl(dvorak_altquotes):4 + dz basic = +pc/bt(basic):4 + guj basic = +pc/in(guj):4 + gur basic = +pc/in(guru):4 + ie laptop = +pc/ie(basic):4 + ie CloGaelachLaptop = +pc/ie(CloGaelach):4 + iu basic = +pc/ca(ike):4 + lo basic = +pc/la(basic):4 + kan basic = +pc/in(kan):4 + mal basic = +pc/in(mal):4 + mal mlplusnum = +pc/in(mal):4 + ogham basic = +pc/ie(ogam):4 + ogham laptop = +pc/ie(ogam):4 + ogham is434 = +pc/ie(ogam_is434):4 + ogham is434laptop = +pc/ie(ogam_is434):4 + ori basic = +pc/in(ori):4 + sapmi basic = +pc/no(smi):4 + sapmi nodeadkeys = +pc/no(smi_nodeadkeys):4 + sapmi sefi = +pc/fi(smi):4 + sin phonetic-static = +pc/in(sin_phonetic):4 + syr basic = +pc/sy(syc):4 + syr phonetic = +pc/sy(syc_phonetic):4 + tam INSCRIPT = +pc/in(tam):4 + tam UNI = +pc/in(tam_unicode):4 + tam TAB = +pc/in(tam_TAB):4 + tam TSCII = +pc/in(tam_TSCII):4 + tel basic = +pc/in(tel):4 + yu basic = +pc/srp(latin):4 + yu unicode = +pc/srp(latinunicode):4 + yu yz = +pc/srp(latinyz):4 + yu unicodeyz = +pc/srp(latinunicodeyz):4 + +! model = symbols + $inetkbds = +inet(%m) + +! model layout = compat + pc98 nec/jp = pc98(basic) + * * = complete + +! model layout[1] = compat + * * = complete + +! model = types + * = complete + +! option = symbols + grp:switch = +group(switch) + grp:lswitch = +group(lswitch) + grp:win_switch = +group(win_switch) + grp:lwin_switch = +group(lwin_switch) + grp:rwin_switch = +group(rwin_switch) + grp:toggle = +group(toggle) + grp:shifts_toggle = +group(shifts_toggle) + grp:ctrls_toggle = +group(ctrls_toggle) + grp:alts_toggle = +group(alts_toggle) + grp:ctrl_shift_toggle = +group(ctrl_shift_toggle) + grp:caps_toggle = +group(caps_toggle) + grp:shift_caps_toggle = +group(shift_caps_toggle) + grp:ctrl_alt_toggle = +group(ctrl_alt_toggle) + grp:alt_shift_toggle = +group(alt_shift_toggle) + grp:menu_toggle = +group(menu_toggle) + grp:lwin_toggle = +group(lwin_toggle) + grp:rwin_toggle = +group(rwin_toggle) + grp:sclk_toggle = +group(sclk_toggle) + grp:lshift_toggle = +group(lshift_toggle) + grp:rshift_toggle = +group(rshift_toggle) + grp:lctrl_toggle = +group(lctrl_toggle) + grp:rctrl_toggle = +group(rctrl_toggle) + grp:lalt_toggle = +group(lalt_toggle) + lv3:switch = +level3(switch) + lv3:ralt_switch = +level3(ralt_switch) + lv3:lalt_switch = +level3(lalt_switch) + lv3:ralt_switch_multikey = +level3(ralt_switch_multikey) + lv3:alt_switch = +level3(alt_switch) + lv3:menu_switch = +level3(menu_switch) + lv3:win_switch = +level3(win_switch) + lv3:lwin_switch = +level3(lwin_switch) + lv3:rwin_switch = +level3(rwin_switch) + caps:capslock = +capslock(capslock) + caps:shiftlock = +capslock(shiftlock) + caps:grouplock = +capslock(grouplock) + ctrl:nocaps = +ctrl(nocaps) + ctrl:swapcaps = +ctrl(swapcaps) + ctrl:ctrl_ac = +ctrl(ctrl_ac) + ctrl:ctrl_aa = +ctrl(ctrl_aa) + ctrl:ctrl_ra = +ctrl(ctrl_ra) + altwin:menu = +altwin(menu) + altwin:meta_alt = +altwin(meta_alt) + altwin:meta_win = +altwin(meta_win) + altwin:left_meta_win = +altwin(left_meta_win) + altwin:super_win = +altwin(super_win) + altwin:hyper_win = +altwin(hyper_win) + altwin:alt_super_win = +altwin(alt_super_win) + compose:ralt = +compose(ralt) + compose:rwin = +compose(rwin) + compose:menu = +compose(menu) + compose:rctrl = +compose(rctrl) + compose:caps = +compose(caps) + srvrkeys:none = +srvr_ctrl(no_srvr_keys) + eurosign:e = +eurosign(e) + eurosign:5 = +eurosign(5) + eurosign:2 = +eurosign(2) + +! option = compat + grp_led:num = +lednum(group_lock) + grp_led:caps = +ledcaps(group_lock) + grp_led:scroll = +ledscroll(group_lock) + grp:caps_toggle = +ledcaps(group_lock) + +! option = types + caps:internal = +caps(internal) + caps:internal_nocancel = +caps(internal_nocancel) + caps:shift = +caps(shift) + caps:shift_nocancel = +caps(shift_nocancel) + numpad:microsoft = +numpad(microsoft) diff -ruN /opt/SUNWut.orig/lib/xkb/rules/xorg-it.lst /opt/SUNWut/lib/xkb/rules/xorg-it.lst --- /opt/SUNWut.orig/lib/xkb/rules/xorg-it.lst 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/rules/xorg-it.lst 2006-04-18 08:31:54.000000000 +0200 @@ -0,0 +1,50 @@ +// $Xorg: xfree86-it.lst,v 1.3 2000/08/17 19:54:42 cpqbld Exp $ + +// +// Elenco dei modelli e dei lingauggi +// Copyright 1996 by Joseph Moss +// + +! model + microsoft Microsoft Natural + dell101 Dell 101-key PC + flexpro Keytronic FlexPro + omnikey101 Northgate OmniKey 101 + pc101 101-key PC Generico + pc102 102-key (Intl) PC Generico + pc104 104-key PC Generico + pc105 105-key (Intl) PC Generico + jp106 106-key Giapponese + everex Everex STEPnote + winbook Winbook Modello XP5 + pc98 PC-98xx Series + +! layout + us Inglese Statunitense + en_US U.S. Inglese + ISO9995-3 + be Belga + bg Bulgaro + ca Canadese + cz Ceco + cz_qwerty Ceco (qwerty) + de Tedesco + de_CH Tedesco Svizzero + dk Danese + es Spagnolo + fi Finlandese + fr Francese + fr_CH Francese Svizzero + gb Regno Unito + hu Ungherese + hu_qwerty Ungherese (qwerty) + it Italiano + jp Giapponese + no Norvegese + pl Polacco + pt Portoghese + ru Russo + se Svedese + sk Slovacco + sk_qwerty Slovacco (qwerty) + th Tailandese + nec/jp nec/jp(pc98) diff -ruN /opt/SUNWut.orig/lib/xkb/rules/xorg.lst /opt/SUNWut/lib/xkb/rules/xorg.lst --- /opt/SUNWut.orig/lib/xkb/rules/xorg.lst 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/rules/xorg.lst 2006-04-18 08:31:54.000000000 +0200 @@ -0,0 +1,413 @@ +// $XdotOrg: xc/programs/xkbcomp/rules/xorg.lst,v 1.2 2004/04/23 19:54:52 eich Exp $ +// $Xorg: xfree86.lst,v 1.3 2000/08/17 19:54:42 cpqbld Exp $ + +! model + pc101 Generic 101-key PC + pc102 Generic 102-key (Intl) PC + pc104 Generic 104-key PC + pc105 Generic 105-key (Intl) PC + dell101 Dell 101-key PC + everex Everex STEPnote + flexpro Keytronic FlexPro + microsoft Microsoft Natural + omnikey101 Northgate OmniKey 101 + winbook Winbook Model XP5 + jp106 Japanese 106-key + pc98 PC-98xx Series + a4techKB21 A4Tech KB-21 + a4techKBS8 A4Tech KBS-8 + abnt2 Brazilian ABNT2 + airkey Acer AirKey V + acpi ACPI Standard + azonaRF2300 Azona RF2300 wireless Internet Keyboard + scorpius Advance Scorpius KI + brother Brother Internet Keyboard + btc5113rf BTC 5113RF Multimedia + btc5126t BTC 5126T + btc9000 BTC 9000 + btc9000a BTC 9000A + btc9001ah BTC 9001AH + btc5090 BTC 5090 + cherryblue Cherry Blue Line CyBo@rd + cherryblueb Cherry CyMotion Master XPress + cherrybluea Cherry Blue Line CyBo@rd (alternate option) + chicony Chicony Internet Keyboard + chicony9885 Chicony KB-9885 + compaqeak8 Compaq Easy Access Keyboard + compaqik7 Compaq Internet Keyboard (7 keys) + compaqik13 Compaq Internet Keyboard (13 keys) + compaqik18 Compaq Internet Keyboard (18 keys) + cymotionlinux Cherry CyMotion Master Linux + armada Laptop/notebook Compaq (eg. Armada) Laptop Keyboard + presario Laptop/notebook Compaq (eg. Presario) Internet Keyboard + ipaq Compaq iPaq Keyboard + dell Dell + inspiron Laptop/notebook Dell Inspiron 8xxx + dexxa Dexxa Wireless Desktop Keyboard + diamond Diamond 9801 / 9802 series + dtk2000 DTK2000 + ennyah_dkb1008 Ennyah DKB-1008 + genius Genius Comfy KB-16M / Genius MM Keyboard KWD-910 + geniuscomfy2 Genius Comfy KB-21e-Scroll + gyration Gyration + hpi6 Hewlett-Packard Internet Keyboard + hp2501 Hewlett-Packard SK-2501 Multimedia Keyboard + hp2505 Hewlett-Packard SK-2505 Internet Keyboard + hpxe3gc Hewlett-Packard Omnibook XE3 GC + hpxe3gf Hewlett-Packard Omnibook XE3 GF + hpxt1000 Hewlett-Packard Omnibook XT1000 + hpzt11xx Hewlett-Packard Pavilion ZT11xx + hp500fa Hewlett-Packard Omnibook 500 FA + hp5xx Hewlett-Packard Omnibook 5xx + hp6000 Hewlett-Packard Omnibook 6000/6100 + honeywell_euroboard Honeywell Euroboard + rapidaccess IBM Rapid Access + rapidaccess2 IBM Rapid Access II + rapidaccess2a IBM Rapid Access II (alternate option) + thinkpad IBM ThinkPad 560Z/600/600E/A22E + logiaccess Logitech Access Keyboard + ltcd Logitech Cordless Desktop + logicdit Logitech Cordless Desktop iTouch + logicdp Logitech Cordless Desktop Pro + logicdpa Logitech Cordless Desktop Pro (alternate option) + logicdpa2 Logitech Cordless Desktop Pro (alternate option2) + logicdo Logitech Cordless Desktop Optical + logicfn Logitech Cordless Freedom/Desktop Navigator + logicdn Logitech Cordless Desktop Navigator + logidak Logitech Deluxe Access Keyboard + logiitc Logitech iTouch Cordless Keyboard (model Y-RB6) + logiik Logitech Internet Keyboard + itouch Logitech iTouch + logiitc Logitech iTouch Cordless Keyboard (model Y-RB6) + logiik Logitech Internet Keyboard + logiink Logitech Internet Navigator Keyboard + itouchin Logitech iTouch keyboard Internet Navigator + logiultrax Logitech Ultra-X Keyboard + mx1998 Memorex MX1998 + mx2500 Memorex MX2500 EZ-Access Keyboard + mx2750 Memorex MX2750 + microsoftinet Microsoft Internet Keyboard + microsoftpro Microsoft Natural Keyboard Pro / Microsoft Internet Keyboard Pro + microsoftprousb Microsoft Natural Keyboard Pro USB / Microsoft Internet Keyboard Pro + microsoftprooem Microsoft Natural Keyboard Pro OEM + microsoftprose Microsoft Internet Keyboard Pro, Swedish + microsoftoffice Microsoft Office Keyboard + microsoftmult Microsoft Wireless Multimedia Keyboard 1.0A + oretec Oretec MCK-800 MM/Internet keyboard + propeller Propeller Voyager (KTEZ-1000) + qtronix QTronix Scorpius 98N+ + samsung4500 Samsung SDM 4500P + samsung4510 Samsung SDM 4510P + sk1300 SK-1300 + sk2500 SK-2500 + sk6200 SK-6200 + sk7100 SK-7100 + sp_inet Super Power Multimedia Keyboard + sven SVEN Ergonomic 2500 + symplon Symplon PaceBook (tablet PC) + toshiba_s3000 Toshiba Satellite S3000 + trust Trust Wireless Keyboard Classic + trustda Trust Direct Access Keyboard + yahoo Yahoo! Internet Keyboard + macintosh Macintosh + macintosh_old Macintosh Old + powerpcps2 PowerPC PS/2 + acer_tm_800 Acer TravelMate 800 + +! layout + us U.S. English + ara Arabic + al Albania + am Armenia + az Azerbaijan + by Belarus + be Belgium + bd Bangladesh + in India + ba Bosnia and Herzegovina + br Brazil + bg Bulgaria + mm Myanmar + ca Canada + hr Croatia + cz Czechia + dk Denmark + nl Netherlands + bt Bhutan + ee Estonia + ir Iran + fo Faroe Islands + fi Finland + fr France + ge Georgia + de Germany + gr Greece + hu Hungary + is Iceland + il Israel + it Italy + jp Japan + kg Kyrgyzstan + la Laos + latam Latin American + lt Lithuania + lv Latvia + mao Maori + mkd Macedonian + mt Malta + mn Mongolia + no Norway + pl Poland + pt Portugal + ro Romania + ru Russia + srp Serbian + si Slovenia + sk Slovakia + es Spain + se Sweden + ch Switzerland + sy Syria + tj Tajikistan + lk Sri Lanka + th Thailand + tr Turkish + ua Ukraine + gb United Kingdom + uz Uzbekistan + vn Vietnam + nec_vndr/jp PC-98xx Series + ie Ireland + pk Pakistan + +! variant + intl us: International (with dead keys) + alt-intl us: Alternative international (former us_intl) + dvorak us: Dvorak + rus us: Russian phonetic + azerty ara: azerty + azerty_digits ara: azerty/digits + digits ara: digits + qwerty ara: qwerty + qwerty_digits ara: qwerty/digits + phonetic am: Phonetic + cyrillic az: Cyrillic + winkeys by: Winkeys + iso-alternate be: ISO Alternate + nodeadkeys be: Eliminate dead keys + sundeadkeys be: Sun dead keys + probhat bd: Probhat + ben in: Bengali + ben_probhat in: Bengali Probhat + guj in: Gujarati + guru in: Gurmukhi + kan in: Kannada + mal in: Malayalam + ori in: Oriya + tam_unicode in: Tamil Unicode + tam_TAB in: Tamil TAB Typewriter + tam_TSCII in: Tamil TSCII Typewriter + tam in: Tamil + tel in: Telugu + urd in: Urdu + nodeadkeys br: Eliminate dead keys + phonetic bg: Phonetic + fr-dvorak ca: French Dvorak + fr-legacy ca: French (legacy) + multi ca: Multilingual + multi-2gr ca: Multilingual, second part + ike ca: Inuktitut + us hr: US keyboard with Croatian letters + bksl cz: With <\|> key + qwerty cz: qwerty + qwerty_bksl cz: qwerty, extended Backslash + nodeadkeys dk: Eliminate dead keys + nodeadkeys ee: Eliminate dead keys + nodeadkeys fo: Eliminate dead keys + nodeadkeys fi: Eliminate dead keys + smi fi: Northern Saami + nodeadkeys fr: Eliminate dead keys + sundeadkeys fr: Sun dead keys + latin9 fr: Alternative + latin9_nodeadkeys fr: Alternative, eliminate dead keys + latin9_sundeadkeys fr: Alternative, Sun dead keys + dvorak fr: Dvorak + ru ge: Russian + deadacute de: Dead acute + deadgraveacute de: Dead grave acute + nodeadkeys de: Eliminate dead keys + ro de: Romanian keyboard with German letters + ro_nodeadkeys de: Romanian keyboard with German letters, eliminate dead keys + dvorak de: Dvorak + extended gr: Extended + nodeadkeys gr: Eliminate dead keys + polytonic gr: Polytonic + standard hu: Standard + nodeadkeys hu: Eliminate dead keys + qwerty hu: qwerty + 101_qwertz_comma_dead hu: 101/qwertz/comma/Dead keys + 101_qwertz_comma_nodead hu: 101/qwertz/comma/Eliminate dead keys + 101_qwertz_dot_dead hu: 101/qwertz/dot/Dead keys + 101_qwertz_dot_nodead hu: 101/qwertz/dot/Eliminate dead keys + 101_qwerty_comma_dead hu: 101/qwerty/comma/Dead keys + 101_qwerty_comma_nodead hu: 101/qwerty/comma/Eliminate dead keys + 101_qwerty_dot_dead hu: 101/qwerty/dot/Dead keys + 101_qwerty_dot_nodead hu: 101/qwerty/dot/Eliminate dead keys + 102_qwertz_comma_dead hu: 102/qwertz/comma/Dead keys + 102_qwertz_comma_nodead hu: 102/qwertz/comma/Eliminate dead keys + 102_qwertz_dot_dead hu: 102/qwertz/dot/Dead keys + 102_qwertz_dot_nodead hu: 102/qwertz/dot/Eliminate dead keys + 102_qwerty_comma_dead hu: 102/qwerty/comma/Dead keys + 102_qwerty_comma_nodead hu: 102/qwerty/comma/Eliminate dead keys + 102_qwerty_dot_dead hu: 102/qwerty/dot/Dead keys + 102_qwerty_dot_nodead hu: 102/qwerty/dot/Eliminate dead keys + Sundeadkeys is: Sun dead keys + nodeadkeys is: Eliminate dead keys + lyx il: lyx + si1452 il: si1452 + phonetic il: Phonetic + nodeadkeys it: Eliminate dead keys + nodeadkeys latam: Eliminate dead keys + sundeadkeys latam: Sun dead keys + std lt: "Standard" + us lt: US keyboard with Lithuanian letters + apostrophe lv: Apostrophe (') variant + tilde lv: Tilde (~) variant + fkey lv: F-letter (F) variant + nodeadkeys mkd: Eliminate dead keys + us mt: US keyboard with Maltian letters + nodeadkeys no: Eliminate dead keys + dvorak no: Dvorak + smi no: Northern Saami + smi_nodeadkeys no: Northern Saami, eliminate dead keys + qwertz pl: qwertz + dvorak pl: Dvorak + dvorak_quotes pl: Dvorak, Polish quotes on quotemark key + dvorak_altquotes pl: Dvorak, Polish quotes on key "1/!" + nodeadkeys pt: Eliminate dead keys + sundeadkeys pt: Sun dead keys + us ro: US keyboard with Romanian letters + de ro: Romanian keyboard with German letters + phonetic ru: Phonetic + typewriter ru: Typewriter + winkeys ru: Winkeys + yz srp: Z and ZHE swapped + latin srp: Latin + latinunicode srp: Latin Unicode + latinyz srp: Latin qwerty + latinunicodeyz srp: Latin Unicode qwerty + alternatequotes srp: With guillemots + latinalternatequotes srp: Latin with guillemots + bksl sk: Extended Backslash + qwerty sk: qwerty + qwerty_bksl sk: qwerty, extended Backslash + nodeadkeys es: Eliminate dead keys + sundeadkeys es: Sun dead keys + dvorak es: Dvorak + nodeadkeys se: Eliminate dead keys + dvorak se: Dvorak + rus se: Russian phonetic + rus_nodeadkeys se: Russian phonetic, eliminate dead keys + smi se: Northern Saami + de_nodeadkeys ch: German, eliminate dead keys + de_sundeadkeys ch: German, Sun dead keys + fr ch: French + fr_nodeadkeys ch: French, eliminate dead keys + fr_sundeadkeys ch: French, Sun dead keys + syc sy: Syriac + syc_phonetic sy: Syriac phonetic + tam_unicode lk: Tamil Unicode + tam_TAB lk: Tamil TAB Typewriter + tam_TSCII lk: Tamil TSCII Typewriter + sin_phonetic lk: Sinhala phonetic + tis th: TIS-820.2538 + pat th: Pattachote + f tr: (F) + alt tr: Alt-Q + phonetic ua: Phonetic + typewriter ua: Typewriter + winkeys ua: Winkeys + rstu ua: Standard RSTU + rstu_ru ua: Standard RSTU on Russian layout + intl gb: International (with dead keys) + dvorak gb: Dvorak + CloGaelach ie: CloGaelach + UnicodeExpert ie: UnicodeExpert + ogam ie: Ogham + ogam_is434 ie: Ogham IS434 + +! option + grp Group Shift/Lock behavior + grp:switch R-Alt switches group while pressed. + grp:lswitch Left Alt key switches group while pressed. + grp:lwin_switch Left Win-key switches group while pressed. + grp:rwin_switch Right Win-key switches group while pressed. + grp:win_switch Both Win-keys switch group while pressed. + grp:rctrl_switch Right Ctrl key switches group while pressed. + grp:toggle Right Alt key changes group. + grp:lalt_toggle Left Alt key changes group. + grp:caps_toggle CapsLock key changes group. + grp:shift_caps_toggle Shift+CapsLock changes group. + grp:shifts_toggle Both Shift keys together change group. + grp:alts_toggle Both Alt keys together change group. + grp:ctrls_toggle Both Ctrl keys together change group. + grp:ctrl_shift_toggle Control+Shift changes group. + grp:ctrl_alt_toggle Alt+Control changes group. + grp:alt_shift_toggle Alt+Shift changes group. + grp:menu_toggle Menu key changes group. + grp:lwin_toggle Left Win-key changes group. + grp:rwin_toggle Right Win-key changes group. + grp:sclk_toggle Scroll Lock changes group + grp:lshift_toggle Left Shift key changes group. + grp:rshift_toggle Right Shift key changes group. + grp:lctrl_toggle Left Ctrl key changes group. + grp:rctrl_toggle Right Ctrl key changes group. + lv3 Third level choosers + lv3:switch Press Right Control to choose 3rd level. + lv3:menu_switch Press Menu key to choose 3rd level. + lv3:win_switch Press any of Win-keys to choose 3rd level. + lv3:lwin_switch Press Left Win-key to choose 3rd level. + lv3:rwin_switch Press Right Win-key to choose 3rd level. + lv3:alt_switch Press any of Alt keys to choose 3rd level. + lv3:lalt_switch Press Left Alt key to choose 3rd level. + lv3:ralt_switch Press Right Alt key to choose 3rd level. + lv3:ralt_switch_multikey Press Right Alt key to choose 3rd level, Shift+Right Alt key is Multi_Key + ctrl Control key position + ctrl:nocaps Make CapsLock an additional Control. + ctrl:swapcaps Swap Control and CapsLock. + ctrl:ctrl_ac Control key at left of 'A' + ctrl:ctrl_aa Control key at bottom left + ctrl:ctrl_ra Right Control key works as Right Alt. + grp_led Use keyboard LED to show alternative group. + grp_led:num NumLock LED shows alternative group. + grp_led:caps CapsLock LED shows alternative group. + grp_led:scroll ScrollLock LED shows alternative group. + caps CapsLock key behavior + caps:internal CapsLock uses internal capitalization. Shift cancels CapsLock. + caps:internal_nocancel CapsLock uses internal capitalization. Shift doesn't cancel CapsLock. + caps:shift CapsLock acts as Shift with locking. Shift cancels CapsLock. + caps:shift_nocancel CapsLock acts as Shift with locking. Shift doesn't cancel CapsLock. + caps:shift_lock CapsLock just locks the Shift modifier. + caps:capslock CapsLock toggles normal capitalization of alphabetic characters. + caps:shiftlock CapsLock toggles Shift so all keys are affected. + altwin Alt/Win key behavior + altwin:menu Add the standard behavior to Menu key. + altwin:meta_alt Alt and Meta are on the Alt keys (default). + altwin:meta_win Meta is mapped to the Win-keys. + altwin:left_meta_win Meta is mapped to the left Win-key. + altwin:super_win Super is mapped to the Win-keys (default). + altwin:hyper_win Hyper is mapped to the Win-keys. + altwin:alt_super_win Alt is mapped to the right Win-key and Super to Menu. + Compose key Compose key position + compose:ralt Right Alt is Compose. + compose:rwin Right Win-key is Compose. + compose:menu Menu is Compose. + compose:rctrl Right Ctrl is Compose. + compose:caps Caps Lock is Compose + compat Miscellaneous compatibility options + numpad:microsoft Shift with numpad keys works as in MS Windows. + srvrkeys:none Special keys (Ctrl+Alt+<key>) handled in a server. + eurosign Adding the EuroSign to certain keys + eurosign:e Add the EuroSign to the E key. + eurosign:5 Add the EuroSign to the 5 key. + eurosign:2 Add the EuroSign to the 2 key. diff -ruN /opt/SUNWut.orig/lib/xkb/rules/xorg.xml /opt/SUNWut/lib/xkb/rules/xorg.xml --- /opt/SUNWut.orig/lib/xkb/rules/xorg.xml 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/rules/xorg.xml 2006-04-18 08:31:54.000000000 +0200 @@ -0,0 +1,7947 @@ + + + + + + + pc101 + Generic 101-key PC + Generies 101-sleutel PC + Generic 101-key PC + Стандартна 101 клавишна PC клавиатура + Obecné PC 101 kláves + Generisk 101-taster PC + Τυπικός Ηλεκ. Υπολογιστής 101-πλήκτρων + Generic 101-key PC + clavier Generic 101-key PC + általános 101 gombos PC + Algemeen 101-toetsen PC + Обычный 101-клавишный PC + Urufunguzo + Všeobecná PC 101 kláves + Generic 101-key PC + Обична са 101 тастером + Allmän 101-tangenters PC + Soysal 101 tuşlu PC + Звичайна 101-клавішна для ПК + PC chung 101 phím + 通用 101 键电脑 + + + + + pc102 + Generic 102-key (Intl) PC + Generies 102-sleutel (Intl) PC + Generic 102-key (Intl) PC + Стандартна 102 клавишна PC клавиатура + Obecné PC 102 kláves (mez.) + Generisk 102-taster (Intl) PC + Τυπικός Ηλεκ. Υπολογιστής 102-πλήκτρων (Διεθνές) + Generic 102-key (Intl) PC + clavier Generic 102-key (Intl) PC + általános 102 gombos (nemzetközi) PC + Algemeen 102-toetsen (internationaal) PC + Обычный 102-клавишный PC + Urufunguzo + Všeobecná PC 102 kláves (medz.) + Generic 102-key (Intl) PC + Обична са 102 тастера (међунар.) + Allmän 102-tangenters (internationell) PC + Soysal 102 tuşlu (Uluslararası) PC + Звичайна 102-клавішна для ПК + PC chung 102 phím (Intl) + 通用 102 键(国际)电脑 + + + + + pc104 + Generic 104-key PC + Generies 104-sleutel PC + Generic 104-key PC + Стандартна 104 клавишна PC клавиатура + Obecné PC 104 kláves + Generisk 104-taster PC + Τυπικός Ηλεκ. Υπολογιστής 104-πλήκτρων + Generic 104-key PC + clavier Generic 104-key PC + általános 104 gombos PC + Algemeen 104-toetsen PC + Обычный 104-клавишный PC + Urufunguzo + Všeobecná PC 104 kláves + Generic 104-key PC + Обична са 104 тастера + Allmän 104-tangenters PC + Soysal 104 tuşlu PC + Звичайна 104-клавішна для ПК + PC chung 104 phím + 通用 104 键电脑 + + + + + pc105 + Generic 105-key (Intl) PC + Generies 105-sleutel (Intl) PC + Generic 105-key (Intl) PC + Стандартна 105 клавишна PC клавиатура + Obecné PC 105 kláves (mez.) + Generisk 105-taster (Intl) PC + Τυπικός Ηλεκ. Υπολογιστής 105-πλήκτρων (Διεθνές) + Generic 105-key (Intl) PC + clavier Generic 105-key (Intl) PC + általános 105 gombos (nemzetközi) PC + Algemeen 105-toetsen (internationaal) PC + Обычный 105-клавишный (инт.) РС + Urufunguzo + Všeobecná 105-kláv. (medzinár.) PC + Generic 105-key (Intl) PC + Обична са 105 тастера (међунар.) + Allmän 105-tangenters (internationell) PC + Soysal 105 tuşlu (uluslararası) PC + Звичайна 105-клавішна для ПК + PC chung 105 phím (Intl) + 通用 105 键(国际)电脑 + + + + + dell101 + Dell 101-key PC + Dell 101-key PC + Dell 101-key PC + 101 клавишна PC клавиатура на Dell + Dell PC 101 kláves + Dell 101-taster PC + Dell 101-key PC + clavier Dell 101-key PC + Dell 101-key PC + Dell 101-toetsen PC + Dell 101-клавишный PC + Urufunguzo + DELL PC 101 kláves + Dell 101-key PC + Dell 101-тастер PC + Dell 101-tangenters PC + Dell 101 tuşlu PC + Dell 101-клавішна для ПК + Dell PC 101 phím + Dell 101 键电脑 + + + + + everex + Everex STEPnote + Everex STEPnote + Everex STEPnote + Everex STEPnote + Everex STEPnote + Everex STEPnote + Everex STEPnote + Everex STEPnote + Everex STEPnote + Everex STEPnote + Everex STEPnote + Everex STEPnote + Everex STEPnote + Everex STEPnote + Everex STEPnote + Everex STEPnote + Everex STEPnote + Everex STEPnote + Everex STEPnote + + + + + flexpro + Keytronic FlexPro + Keytronic FlexPro + Keytronic FlexPro + Keytronic FlexPro + Keytronic FlexPro + Keytronic FlexPro + Keytronic FlexPro + Keytronic FlexPro + Keytronic FlexPro + Keytronic FlexPro + Keytronic FlexPro + Keytronic FlexPro + Keytronic FlexPro + Keytronic FlexPro + Keytronic FlexPro + Keytronic FlexPro + Keytronic FlexPro + Keytronic FlexPro + Keytronic FlexPro + + + + + microsoft + Microsoft Natural + Microsoft Natuurlik + Microsoft Natural + Microsoft Natural + Microsoft Natural + Microsoft Natural + Microsoft Natural + Microsoft Natural + Microsoft Natural + Microsoft Natural + Microsoft Natural + Microsoft Natural + Microsoft Natural + Микрософт Натурал + Microsoft Natural + Microsoft Basit + Microsoft Natural + Microsoft Natural + 微软自然键盘 + + + + + omnikey101 + Northgate OmniKey 101 + Northgate OmniKey 101 + Northgate OmniKey 101 + Northgate OmniKey 101 + Northgate OmniKey 101 + Northgate OmniKey 101 + Northgate OmniKey 101 + Northgate OmniKey 101 + Northgate OmniKey 101 + Northgate OmniKey 101 + Northgate OmniKey 101 + Northgate OmniKey 101 + Northgate OmniKey 101 + Northgate OmniKey 101 + Northgate OmniKey 101 + Northgate OmniKey 101 + Northgate OmniKey 101 + Northgate OmniKey 101 + Northgate OmniKey 101 + + + + + winbook + Winbook Model XP5 + Winbook Model XP5 + Winbook Model XP5 + Winbook Model XP5 + Winbook Model XP5 + Winbook Model XP5 + Winbook Model XP5 + Winbook Model XP5 + Winbook Model XP5 + Winbook Model XP5 + Winbook Model XP5 + Winbook Model XP5 + Winbook Model XP5 + Winbook Model XP5 + Winbook Model XP5 + Winbook Model XP5 + Winbook Model XP5 + Winbook kiểu mẫu XP5 + Winbook Model XP5 + + + + + jp106 + Japanese 106-key + Japanees 106-sleutel + Yaponca 106-düymə + японска 106 клавишна + Japonské 106 kláves + Japansk 106-taster + Japanese 106-key + Japanese 106-clés + japán 106 gombos + Japans 106-toetsen + Японская 106-клавишная + Urufunguzo + Japonskáé106 kláves + Japoneze 106-pulsantë + јапански са 106 тастера + Japansk 106-tangenters + Japonca 106 tuşlu + Японська 106-клавішна + Nhật bản 106 phím + 日语 106 键 + + + + + pc98 + PC-98xx Series + PC-98xx Reeks + PC-98xx Seriyaları + PC-98xx серии + PC-98xx řada + PC-98xx-serien + PC-98xx Series + PC-98xx Series + PC-98xx Series + PC-98xx serie + PC-98xx + Séria PC-98xx + Seritë PC-98xx + PC-98xx серија + PC-98xx-serien + PC-98xx Serisi + Моделі PC-98xx + Sê ri PC-98xx + PC-98xx 系列 + + + + + a4techKB21 + A4Tech KB-21 + A4Tech KB-21 + A4Tech KB-21 + A4Tech KB-21 + 21 + A4Tech KB-21 + + + + + a4techKBS8 + A4Tech KBS-8 + A4Tech KBS-8 + A4Tech KBS-8 + A4Tech KBS-8 + 8 + A4Tech KBS-8 + + + + + abnt2 + Brazilian ABNT2 + Braziliaans ABNT2 + Brazilya düzülüşü ABNT2 + бразилска ABNT2 + Brazilské ABNT2 + Brasiliansk ABNT2 + Brazilian ABNT2 + Brézilien ABNT2 + brazil ABNT2 + Braziliaans ABNT2 + ABNT2 + Brazílska ABNT2 + Braziliane ABNT2 + бразилски ABNT2 + Brasiliansk ABNT2 + Brazilya dili ABNT2 + Бразильська ABTN2 + ABNT2 của Bra-zil + 巴西 ABNT2 + + + + + airkey + Acer AirKey V + Acer AirKey V + Acer AirKey V + Acer AirKey V + Acer AirKey V + Acer AirKey V + Acer AirKey V + Acer AirKey V + Acer AirKey V + Acer AirKey V + V + Acer AirKey V + Acer AirKey V + Acer AirKey V + Acer AirKey V + Acer AirKey V + Acer AirKey V + Acer AirKey V + Acer AirKey V + + + + + acpi + ACPI Standard + ACPI Standaard + ACPI Standartı + Standard ACPI + ACPI-standard + ACPI Standard + norme ACPI + ACPI szabvány + ACPI standaard + Стандартная ACPI + Štandard ACPI + ACPI Standart + ACPI стандард + ACPI-standard + ACPI Standardı + Типова ACPI + ACPI Tiêu chuẩn + ACPI 标准 + + + + + azonaRF2300 + Azona RF2300 wireless Internet Keyboard + Azona RF2300 wireless Internet Keyboard + Azona RF2300 draadloos internettoetsenbord + Azona RF2300 wireless Internet Keyboard + Bàn phím không dây Internet Azona RF2300 + + + + + scorpius + Advance Scorpius KI + Advance Scorpius KI + Advance Scorpius KI + Advance Scorpius KI + Advance Scorpius KI + Advance Scorpius KI + Advance Scorpius KI + Advance Scorpius KI + Advance Scorpius KI + Advance Scorpius KI + Advance Scorpius KI + Advance Scorpius KI + Напредни Шкорпион КИ + Advance Scorpius KI + Advance Scorpius KI + Advance Scorpius KI + Nâng cao Scorpius KI + 高级 Scorpius KI + + + + + brother + Brother Internet Keyboard + Brother Internetsleutelbord + Brother Internet Keyboard + Logitech Интернет клавиатура + Brother Internet Keyboard + Brother Internet Keyboard + Brother Internet Keyboard + clavier Brother Internet + Brother Internet Keyboard + Brother internet toetsenbord + Brother Internet Keyboard + Brother Internet Keyboard + Tastiera Internet Brother + Brother Интернет тастатура + Brother Internettangentbord + Brother Örütbağ Klavyesi + Brother Internet Keyboard + Bàn phím Internet Brother + Brother 网际键盘 + + + + + btc5113rf + BTC 5113RF Multimedia + BTC 5113RF Multimedia + BTC 5113RF Multimedia + BTC 5113RF Multimedia + BTC 5113RF-multimedie + BTC 5113RF Multimedia + BTC 5113RF Multimedia + BTC 5113RF Multimedia + BTC 5113RF multimedia + BTC 5113RF Multimedia + BTC 5113RF Multimedia + BTC 5113RF Multimedia + BTC 5113RF мултимедијална + BTC 5113RF Multimedia + BTC 5113RF Çokluortam + BTC 5113RF мультимедія + BTC 5113RF Phim nhạc + BTC 5113RF 多媒体 + + + + + btc5126t + BTC 5126T + BTC 5126T + BTC 5126T + BTC 5126T + BTC 5126T + BTC 5126T + BTC 5126T + BTC 5126T + BTC 5126T + BTC 5126T + BTC 5126T + BTC 5126T + BTC 5126T + BTC 5126T + BTC 5126T + BTC 5126T + BTC 5126T + BTC 5126T + + + + + btc9000 + BTC 9000 + BTC 9000 + BTC 9000 + BTC 9000 + BTC 9000 + BTC 9000 + BTC 9000 + BTC 9000 + BTC 9000 + BTC 9000 + BTC 9000 + BTC 9000 + BTC 9000 + BTC 9000 + BTC 9000 + BTC 9000 + BTC 9000 + BTC 9000 + + + + + btc9000a + BTC 9000A + BTC 9000A + BTC 9000A + BTC 9000A + BTC 9000A + BTC 9000A + BTC 9000A + BTC 9000A + BTC 9000A + BTC 9000A + BTC 9000A + BTC 9000A + BTC 9000A + BTC 9000A + BTC 9000A + BTC 9000A + BTC 9000A + BTC 9000A + + + + + btc9001ah + BTC 9001AH + BTC 9001AH + BTC 9001AH + BTC 9001AH + BTC 9001AH + BTC 9001AH + BTC 9001AH + BTC 9001AH + BTC 9001AH + BTC·9001AH + BTC 9001AH + BTC 9001AH + BTC 9001AH + BTC 9001AH + BTC 9001AH + BTC 9001AH + BTC 9001AH + BTC 9001AH + + + + + btc5090 + BTC 5090 + BTC 5090 + BTC 5090 + BTC 5090 + BTC 5090 + BTC 5090 + BTC 5090 + BTC 5090 + BTC 5090 + BTC 5090 + BTC 5090 + BTC 5090 + BTC 5090 + BTC 5090 + BTC 5090 + BTC 5090 + BTC 5090 + BTC 5090 + + + + + cherryblue + Cherry Blue Line CyBo@rd + Cherry Blue Line CyBo@rd + Cherry Blue Line CyBo@rd + Cherry Blue Line CyBo@rd + Cherry Blue Line CyBo@rd + Cherry Blue Line CyBo@rd + Cherry Blue Line CyBo@rd + Cherry Blue Line CyBo@rd + Cherry Blue Line CyBo@rd + Cherry Blue Line CyBo@rd + Cherry Blue Line CyBo@rd + Cherry Blue Line CyBo@rd + Cherry Blue Line CyBo@rd + Cherry Blue Line CyBo@rd + Cherry Blue Line CyBo@rd + Cherry Blue Line CyBo@rd + Cherry Blue Line CyBo@rd + Cherry Blue Line CyBo@rd + + + + + cherryblueb + Cherry CyMotion Master XPress + + + + + ibm_space_saver + IBM Space Saver + + + + + cherryblueb + Cherry CyMotion Master XPress + + + + + cherrybluea + Cherry Blue Line CyBo@rd (alternate option) + Cherry Blue Line CyBo@rd (alternatief) + Cherry Blue Line CyBo@rd (alternate option) + Cherry Blue Line CyBo@rd (alternativní volba) + Cherry Blue Line CyBo@rd (alternativ) + Cherry Blue Line CyBo@rd (alternate option) + Cherry Blue Line CyBo@rd (option alternative) + Cherry Blue Line CyBo@rd (másik lehetőség) + Cherry Blue Line CyBo@rd (alternatieve optie) + Cherry Blue Line CyBo@rd (альтернативный вариант) + Ihitamo + Cherry Blue Line CyBo@rd (alternatívna voľba) + Cherry Blue Line CyBo@rd (opcioni alterno) + Cherry Blue Line CyBo@rd (друга могућност) + Cherry Blue Line CyBo@rd (alternativ) + Cherry Blue Line CyBo@rd (diğer seçenek) + Cherry Blue Line CyBo@rd (альтернативний варіант) + Cherry Blue Line CyBo@rd (luân phiên tùy chọn) + Cherry Blue Line CyBo@rd (替代选项) + + + + + chicony + Chicony Internet Keyboard + Chicony Internetsleutelbord + Chicony Internet Keyboard + Интернет клавиатура на Chicony + Chicony Internet Keyboard + Chicony Internet Keyboard + Chicony Internet Keyboard + clavier Chicony Internet + Chicony Internet Keyboard + Chicony internet toetsenbord + Chicony Internet Keyboard + Chicony Internet Keyboard + Tastiera Internet Chicony + Chicony Интернет тастатура + Chicony Internettangentbord + Chicony Örütbağ Klavyesi + Інтернет-клавіатура Chicony + Bàn phím Internet Chicony + Chicony Internet 键盘 + + + + + chicony9885 + Chicony KB-9885 + Chicony KB-9885 + Chicony KB-9885 + Chicony KB-9885 + Chicony KB-9885 + Chicony KB-9885 + Chicony KB-9885 + Chicony KB-9885 + Chicony KB-9885 + Chicony KB-9885 + Chicony KB-9885 + Chicony KB-9885 + Chicony KB-9885 + Chicony KB-9885 + Chicony KB-9885 + Chicony KB-9885 + Chicony KB-9885 + Chicony KB-9885 + + + + + compaqeak8 + Compaq Easy Access Keyboard + Compaq Easy Access Keyboard + Compaq Easy Access Keyboard + Compaq Easy Access Keyboard + Compaq Easy Access Keyboard + Compaq Easy Access Keyboard + clavier Compaq Easy Access + Compaq Easy Access Keyboard + Compaq Easy Access toetsenbord + Compaq Easy Access Keyboard + Compaq Easy Access Keyboard + Tastiera Compaq Easy Access + Compaq тастатура за лак приступ + Compaq Easy Access-tangentbord + Compaq Kolay Erişim Klavyesi + Compaq Easy Access Keyboard + Bàn phím Truy cập Dễ dàng của Compaq + Compaq Easy Access 键盘 + + + + + compaqik7 + Compaq Internet Keyboard (7 keys) + Compaq Internet Keyboard (7 sleutels) + Compaq Internet Keyboard (7 düymə) + Интернет клавиатура на Chicony + Compaq Internet Keyboard (7 kláves) + Compaq Internet Keyboard (7 taster) + Compaq Internet Keyboard (7 keys) + clavier Compaq Internet (7 clés) + Compaq Internet Keyboard (7 gombos) + Compaq internet toetsenbord (7 toetsen) + Compaq Internet Keyboard (7 клавиш) + 7 Utubuto + Compaq Internet Keyboard (7 kláves) + Tastiera Internet Compaq (7 pulsante) + Compaq Интернет тастатура (7 тастера) + Compaq Internettangentbord (7 tangenter) + Örütbağ Klavyesi (7 tuşlu) + Compaq Internet Keyboard (7 клавіш) + Bàn phím Internet Compaq (7 phím) + Compaq 网际键盘(7键) + + + + + compaqik13 + Compaq Internet Keyboard (13 keys) + Compaq Internet Keyboard (13 sleutels) + Compaq Internet Keyboard (13 düymə) + Интернет клавиатура на Chicony + Compaq Internet Keyboard (13 kláves) + Compaq Internet Keyboard (13 taster) + Compaq Internet Keyboard (13 keys) + clavier Compaq Internet (13 clés) + Compaq Internet Keyboard (13 gombos) + Compaq internet toetsenbord (13 toetsen) + Compaq Internet Keyboard (13 клавиш) + Utubuto + Compaq Internet Keyboard (13 kláves) + Tatiera Internet Compaq (13 pulsante) + Compaq Интернет тастатура (13 тастера) + Compaq Internettangentbord (13 tangenter) + Compaq Örütbağ Klavyesi (13 tuşlu) + Compaq Internet Keyboard (13 клавіш) + Bàn phím Internet Compaq (13 phím) + Compaq 网际键盘(13键) + + + + + compaqik18 + Compaq Internet Keyboard (18 keys) + Compaq Internet Keyboard (18 sleutels) + Compaq Internet Keyboard (18 düymə) + Интернет клавиатура на Chicony + Compaq Internet Keyboard (18 kláves) + Compaq Internet Keyboard (18 taster) + Compaq Internet Keyboard (18 keys) + clavier Compaq Internet (18 clés) + Compaq Internet Keyboard (18 gombos) + Compaq internet toetsenbord (18 toetsen) + Compaq Internet Keyboard (18 клавиш) + Utubuto + Compaq Internet Keyboard (18 kláves) + Tastiera Internet Compaq (18 pulsante) + Compaq Интернет тастатура (18 тастера) + Compaq Internettangentbord (18 tangenter) + Compaq Örütbağ Klavyesi (18 tuşlu) + Compaq Internet Keyboard (18 клавіш) + Bàn phím Internet Compaq (18 phím) + Compaq 网际键盘(18键) + + + + + cymotionlinux + Cherry CyMotion Master Linux + Cherry CyMotion Master Linux + + + + + armada + Laptop/notebook Compaq (eg. Armada) Laptop Keyboard + Laptop/notebook Compaq (eg. Armada) Laptop Keyboard + Laptop/notebook Compaq (məs. Armada) Laptop Klaviaturası + Laptop/notebook Compaq (např. Armada) Laptop Keyboard + Bærbar Compaq (fx Armada) Laptop Keyboard + Laptop/notebook Compaq (eg. Armada) Laptop Keyboard + clavier Laptop/notebook Compaq (ie. Armada) Laptop + Laptop/notebook Compaq (pl. Armada) Laptop Keyboard + Laptop/notebook Compaq (bijv. Armada) laptop toetsenbord + Клавиатура для компьютеров Compaq (например Armada) + Laptop/notebook Compaq (napr. Armada) Laptop Keyboard + Tastierë laptop për Laptop/notebook Compaq (p.sh. Armada) + Тастатуре преносних рачунара из Compaq-а (нпр. Armada) + Laptop-tangentbord för bärbar Compaq-dator (t.ex. Armada) + Laptop/notebook Compaq (örn. Armada) Dizüstü Klavyesi + Клавіатура для комп'ютерів Compaq (напр., Armada) + Bàn phím nhỏ gọn cho máy xách tay/notebook Compaq (ví dụ Armada) + 便携/笔记本 Compaq(如 Armada)便携键盘 + + + + + presario + Laptop/notebook Compaq (eg. Presario) Internet Keyboard + Laptop/notebook Compaq (eg. Presario) Internet Keyboard + Laptop/notebook Compaq (məs. Presario) İnternet Klaviaturası + Laptop/notebook Compaq (např. Presario) Internet Keyboard + Bærbar Compaq (fx Presario) Internet Keyboard + Laptop/notebook Compaq (eg. Presario) Internet Keyboard + clavier Laptop/notebook Compaq (ie. Presario) Internet + Laptop/notebook Compaq (pl. Presario) Internet Keyboard + Laptop/notebook Compaq (bijv. Presario) internet toetsenbord + "Интернет" клавиатура для компьютеров Compaq (например Presario) + Laptop/notebook Compaq (napr. Presario) Internet Keyboard + Tastierë për Internet për Laptop/notebook Compaq (p.sh. Presario) + Тастатуре преносних рачунара из Compaq-а (нпр. Presario) + Internettangentbord för bärbar Compaq-dator (t.ex. Presario) + Laptop/notebook Compaq (örn. Presario) Örütbağ Klavyesi + Інтернет-клавіатура для ноутбуків Compaq (напр., Presario) + Bàn phím Internet cho máy xách tay/notebook Compaq (ví dụ Presario) + 便携/笔记本 Compaq(如自由人)网际键盘 + + + + + ipaq + Compaq iPaq Keyboard + Compaq iPaq Keyboard + Compaq iPaq Keyboard + Compaq iPaq Keyboard + Compaq iPaq Keyboard + Compaq iPaq Keyboard + clavier Compaq iPaq + Compaq iPaq Keyboard + Compaq iPaq toetsenbord + Compaq iPaq Keyboard + Compaq iPaq Keyboard + Tastiera Compaq iPaq + Compaq iPaq тастатура + Compaq iPaq-tangentbord + Compaq iPaq Klavyesi + Compaq iPaq Keyboard + Bàn phím iPaq Compaq + Compaq iPaq 键盘 + + + + + dell + Dell + Dell + Dell + Dell + Dell + Dell + Dell + Dell + Dell + Dell + Dell + Dell + Dell + Dell + Dell + Dell + Dell + Dell + + + + + inspiron + Laptop/notebook Dell Inspiron 8xxx + Laptop/notebook Dell Inspiron 8xxx + Laptop/notebook Dell Inspiron 8xxx + Laptop/notebook Dell Inspiron 8xxx + Bærbar Dell Inspiron 8xxx + Laptop/notebook Dell Inspiron 8xxx + clavier Laptop/notebook Dell Inspiron 8xxx + Laptop/notebook Dell Inspiron 8xxx + Laptop/notebook Dell Inspiron 8xxx + Настольная/портативная для Dell Inspiron 8xxx + Laptop/notebook Dell Inspiron 8xxx + Laptop/notebook Dell Inspiron 8xxx + Тастатуре преносних рачунара Dell Inspiron 8xxx + Bärbar Dell Inspiron 8xxx + Laptop/notebook Dell Inspiron 8xxx + Для ноутбуків Dell Inspiron 8xxx + Laptop/notebook Dell Inspiron 8xxx + 便携/笔记本 Dell Inspiron 8xxx + + + + + dexxa + Dexxa Wireless Desktop Keyboard + Dexxa Wireless Desktop Keyboard + Dexxa Wireless Desktop Keyboard + Dexxa Wireless Desktop Keyboard + Dexxa Wireless Desktop Keyboard + Dexxa Wireless Desktop Keyboard + clavier Dexxa Wireless Desktop + Dexxa Wireless Desktop Keyboard + Dexxa Wireless Desktop toetsenbord + Dexxa Wireless Desktop Keyboard + Dexxa Wireless Desktop Keyboard + Tastierë Dexxa Wireless Desktop + Dexxa бежична тастатура + Dexxa trådlöst skrivbordstangentbord + Dexxa Kablosuz Masaüstü Klavyesi + Dexxa Wireless Desktop Keyboard + Bàn phím Không dây Dexxa cho Desktop + Dexxa 无线桌面键盘 + + + + + diamond + Diamond 9801 / 9802 series + Diamond 9801 / 9802 series + Diamond 9801 / 9802 seryaları + Diamond řada 9801 / 9802 + Diamond 9801 / 9802-serien + Diamond 9801 / 9802 series + clavier Diamond 9801 / 9802 series + Diamond 9801 / 9802 series + Diamond 9801 / 9802 serie + Модели Diamond 9801/9802 + Ibyiciro + Diamond séria 9801 / 9802 + Seritë Diamond 9801 / 9802 + Diamond 9801 / 9802 серија + Diamond 9801/9802-serien + Diamond 9801 / 9802 serileri + Моделі Diamond 9801/9802 + Sê ri Diamond 9801 / 9802 + Diamond 9801 / 9802 系列 + + + + + dtk2000 + DTK2000 + DTK2000 + DTK2000 + DTK2000 + DTK2000 + + + + + ennyah_dkb1008 + Ennyah DKB-1008 + Ennyah DKB-1008 + Ennyah DKB-1008 + Ennyah DKB-1008 + Ennyah DKB-1008 + Ennyah DKB-1008 + Ennyah DKB-1008 + Ennyah DKB-1008 + Ennyah DKB-1008 + Ennyah DKB-1008 + Ennyah DKB-1008 + Ennyah DKB-1008 + Ennyah DKB-1008 + Ennyah DKB-1008 + Ennyah DKB-1008 + Ennyah DKB-1008 + Ennyah DKB-1008 + Ennyah DKB-1008 + + + + + genius + Genius Comfy KB-16M / Genius MM Keyboard KWD-910 + Genius Comfy KB-16M / Genius MM Keyboard KWD-910 + Genius Comfy KB-16M / Genius MM Keyboard KWD-910 + Genius Comfy KB-16M / Genius MM Keyboard KWD-910 + Genius Comfy KB-16M / Genius MM Keyboard KWD-910 + Genius Comfy KB-16M / Genius MM Keyboard KWD-910 + clavier Genius Comfy KB-16M / Genius MM Keyboard KWD-910 + Genius Comfy KB-16M / Genius MM Keyboard KWD-910 + Genius Comfy KB-16M / Genius MM toetsenbord KWD-910 + Genius Comfy KB-16M / Genius MM Keyboard KWD-910 + Genius Comfy KB-16M / Genius MM Keyboard KWD-910 + Genius Comfy KB-16M / Genius MM Keyboard KWD-910 + Genius Comfy KB-16M / Genius ММ тастатура KWD-910 + Genius Comfy KB-16M / Genius MM-tangentbord KWD-910 + Genius Comfy KB-16M / Genius MM Keyboard KWD-910 + Genius Comfy KB-16M / Genius MM Keyboard KWD-910 + Genius Tiện lợi KB-16M / Bàn phím Genius MM KWD-910 + 通用 Comfy KB-16M / Genius MM 键盘 KWD-910 + + + + + geniuscomfy2 + Genius Comfy KB-21e-Scroll + Genius Comfy KB-21e-Scroll + Genius Comfy KB-21e-Scroll + Genius Comfy KB-21e-Scroll + Genius Comfy KB-21e-Scroll + + + + + gyration + Gyration + Gyration + Kroatisch + Гирашн + Sự chuyển hồi + + + + + hpi6 + Hewlett-Packard Internet Keyboard + Hewlett-Packard Internet Keyboard + Hewlett-Packard Internet Keyboard + Интернет клавиатура на Dell + Hewlett-Packard Internet Keyboard + Hewlett-Packard Internet Keyboard + Hewlett-Packard Internet Keyboard + clavier Hewlett-Packard Internet + Hewlett-Packard Internet Keyboard + Hewlett-Packard internet toetsenbord + Hewlett-Packard Internet Keyboard + Hewlett-Packard Internet Keyboard + Tastierë për Internet Hewlett-Packard + Hewlett-Packard Интернет тастатура + Hewlett-Packard Internettangentbord + Hewlett-Packard Örütbağ Klavyesi + Hewlett-Packard Internet Keyboard + Bàn phím Internet Hewlett-Packard + 惠普网际键盘 + + + + + hp2501 + Hewlett-Packard SK-2501 Multimedia Keyboard + Hewlett-Packard SK-2501 Multimedia Keyboard + Hewlett-Packard SK-2501 Multimedia Keyboard + Hewlett-Packard SK-2501 Multimedia Keyboard + Hewlett-Packard SK-2501 Multimedia Keyboard + Hewlett-Packard SK-2501 Multimedia Keyboard + clavier Hewlett-Packard SK-2501 Multimedia + Hewlett-Packard SK-2501 Multimedia Keyboard + Hewlett-Packard SK-2501 multimedia toetsenbord + Hewlett-Packard SK-2501 Multimedia Keyboard + Hewlett-Packard SK-2501 Multimedia Keyboard + Tastierë multimediale Hewlett-Packard SK-2501 + Hewlett-Packard SK-2501 мултимедијална тастатура + Hewlett-Packard SK-2501 multimediatangentbord + Hewlett-Packard SK-2501 Çokluortam Klavyesi + Hewlett-Packard SK-2501 Multimedia Keyboard + Bàn phím phim nhạc Hewlett-Packard SK-2501 + 惠普 SK-2501 多媒体键盘 + + + + + hp2505 + Hewlett-Packard SK-2505 Internet Keyboard + Hewlett-Packard SK-2505 Internet Keyboard + Hewlett-Packard SK-2505 Internet Keyboard + Интернет клавиатура на Dell + Hewlett-Packard SK-2505 Internet Keyboard + Hewlett-Packard SK-2505 Internet Keyboard + Hewlett-Packard SK-2505 Internet Keyboard + clavier Hewlett-Packard SK-2505 Internet + Hewlett-Packard SK-2505 Internet Keyboard + Hewlett-Packard SK-2505 internet toetsenbord + Hewlett-Packard SK-2505 Internet Keyboard + Hewlett-Packard SK-2505 Internet Keyboard + Tastierë për Internet Hewlett-Packard SK-2505 + Hewlett-Packard SK-2505 Интернет тастатура + Hewlett-Packard SK-2505 Internettangentbord + Hewlett-Packard SK-2505 Örütbağ Klavyesi + Hewlett-Packard SK-2505 Internet Keyboard + Bàn phím Internet Hewlett-Packard SK-2505 + 惠普 SK-2505 网际键盘 + + + + + hpxe3gc + Hewlett-Packard Omnibook XE3 GC + Hewlett-Packard Omnibook XE3 GC + Hewlett-Packard Omnibook XE3 GC + Hewlett-Packard Omnibook XE3 GC + Hewlett-Packard Omnibook XE3 GC + Hewlett-Packard Omnibook XE3 GC + clavier Hewlett-Packard Omnibook XE3 GC + Hewlett-Packard Omnibook XE3 GC + Hewlett-Packard Omnibook XE3 GC + Hewlett-Packard Omnibook XE3 GC + Hewlett-Packard Omnibook XE3 GC + Hewlett-Packard Omnibook XE3 GC + Hewlett-Packard Omnibook XE3 GC + Hewlett-Packard Omnibook XE3 GC + Hewlett-Packard Omnibook XE3 GC + Hewlett-Packard Omnibook XE3 GC + Hewlett-Packard Omnibook XE3 GC + 惠普 Omnibook XE3 GC + + + + + hpxe3gf + Hewlett-Packard Omnibook XE3 GF + Hewlett-Packard Omnibook XE3 GF + Hewlett-Packard Omnibook XE3 GF + Hewlett-Packard Omnibook XE3 GF + Hewlett-Packard Omnibook XE3 GF + Hewlett-Packard Omnibook XE3 GF + clavier Hewlett-Packard Omnibook XE3 GF + Hewlett-Packard Omnibook XE3 GF + Hewlett-Packard Omnibook XE3 GF + Hewlett-Packard Omnibook XE3 GF + Hewlett-Packard Omnibook XE3 GF + Hewlett-Packard Omnibook XE3 GF + Hewlett-Packard Omnibook XE3 GF + Hewlett-Packard Omnibook XE3 GF + Hewlett-Packard Omnibook XE3 GF + Hewlett-Packard Omnibook XE3 GF + Hewlett-Packard Omnibook XE3 GF + 惠普 Omnibook XE3 CF + + + + + hpxt1000 + Hewlett-Packard Omnibook XT1000 + Hewlett-Packard Omnibook XT1000 + Hewlett-Packard Omnibook XT1000 + Hewlett-Packard Omnibook XT1000 + Hewlett-Packard Omnibook XT1000 + Hewlett-Packard Omnibook XT1000 + clavier Hewlett-Packard Omnibook XT1000 + Hewlett-Packard Omnibook XT1000 + Hewlett-Packard Omnibook XT1000 + Hewlett-Packard Omnibook XT1000 + Hewlett-Packard Omnibook XT1000 + Hewlett-Packard Omnibook XT1000 + Hewlett-Packard Omnibook XT1000 + Hewlett-Packard Omnibook XT1000 + Hewlett-Packard Omnibook XT1000 + Hewlett-Packard Omnibook XT1000 + Hewlett-Packard Omnibook XT1000 + 惠普 Omnibook XT1000 + + + + + hpzt11xx + Hewlett-Packard Pavilion ZT11xx + Hewlett-Packard Pavilion ZT11xx + Hewlett-Packard Pavilion ZT11xx + Hewlett-Packard Pavilion ZT11xx + Hewlett-Packard Pavilion ZT11xx + Hewlett-Packard Pavilion ZT11xx + clavier Hewlett-Packard Pavilion ZT11xx + Hewlett-Packard Pavilion ZT11xx + Hewlett-Packard Pavilion ZT11xx + Hewlett-Packard Pavilion ZT11xx + Hewlett-Packard Pavilion ZT11xx + Hewlett-Packard Pavilion ZT11xx + Hewlett-Packard Pavilion ZT11xx + Hewlett-Packard Pavilion ZT11xx + Hewlett-Packard Pavilion ZT11xx + Hewlett-Packard Pavilion ZT11xx + Hewlett-Packard Pavilion ZT11xx + 惠普 Pavilion ZT11xx + + + + + hp500fa + Hewlett-Packard Omnibook 500 FA + Hewlett-Packard Omnibook 500 FA + Hewlett-Packard Omnibook 500 FA + Hewlett-Packard Omnibook 500 FA + Hewlett-Packard Omnibook 500 FA + Hewlett-Packard Omnibook 500 FA + clavier Hewlett-Packard Omnibook 500 FA + Hewlett-Packard Omnibook 500 FA + Hewlett-Packard Omnibook 500 FA + Hewlett-Packard Omnibook 500 FA + 500 + Hewlett-Packard Omnibook 500 FA + Hewlett-Packard Omnibook 500 FA + Hewlett-Packard Omnibook 500 FA + Hewlett-Packard Omnibook 500 FA + Hewlett-Packard Omnibook 500 FA + Hewlett-Packard Omnibook 500 FA + Hewlett-Packard Omnibook 500 FA + 惠普 Omnibook 500 FA + + + + + hp5xx + Hewlett-Packard Omnibook 5xx + Hewlett-Packard Omnibook 5xx + Hewlett-Packard Omnibook 5xx + Интернет клавиатура на Dell + Hewlett-Packard Omnibook 5xx + Hewlett-Packard Omnibook 5xx + Hewlett-Packard Omnibook 5xx + clavier Hewlett-Packard Omnibook 5xx + Hewlett-Packard Omnibook 5xx + Hewlett-Packard Omnibook 5xx + Hewlett-Packard·Omnibook·5xx + Hewlett-Packard Omnibook 5xx + Hewlett-Packard Omnibook 5xx + Hewlett-Packard Omnibook 5xx + Hewlett-Packard Omnibook 5xx + Hewlett-Packard Omnibook 5xx + Hewlett-Packard Omnibook 5xx + Hewlett-Packard Omnibook 5xx + 惠普 Omnibook 5xx + + + + + hp6000 + Hewlett-Packard Omnibook 6000/6100 + Hewlett-Packard Omnibook 6000/6100 + Hewlett-Packard Omnibook 6000/6100 + Hewlett-Packard Omnibook 6000/6100 + Hewlett-Packard Omnibook 6000/6100 + Hewlett-Packard Omnibook 6000/6100 + clavier Hewlett-Packard Omnibook 6000/6100 + Hewlett-Packard Omnibook 6000/6100 + Hewlett-Packard Omnibook 6000/6100 + Hewlett-Packard·Omnibook·6000/6100 + Hewlett-Packard Omnibook 6000/6100 + Hewlett-Packard Omnibook 6000/6100 + Hewlett-Packard Omnibook 6000/6100 + Hewlett-Packard Omnibook 6000/6100 + Hewlett-Packard Omnibook 6000/6100 + Hewlett-Packard Omnibook 6000/6100 + Hewlett-Packard Omnibook 6000/6100 + 惠普 Omnibook 6000/6100 + + + + + honeywell_euroboard + Honeywell Euroboard + Honeywell Euroboard + Honeywell Euroboard + Honeywell Euroboard + Honeywell Euroboard + Honeywell Euroboard + Honeywell Euroboard + Honeywell Euroboard + Honeywell Euroboard + Honeywell Euroboard + Honeywell Euroboard + Honeywell Euroboard + Honeywell Euroboard + Honeywell Euroboard + Honeywell Euroboard + Honeywell Euroboard + Honeywell Euroboard + Honeywell 欧洲键盘 + + + + + rapidaccess + IBM Rapid Access + IBM Rapid Access + IBM Rapid Access + IBM Rapid Access + IBM Rapid Access + IBM Rapid Access + IBM Rapid Access + clavier IBM Rapid Access + IBM Rapid Access + IBM Rapid Access + IBM Rapid Access + IBM Rapid Access + IBM Rapid Access + IBM Rapid Access + IBM Rapid Access + IBM Hızlı Erişim + IBM Rapid Access + Truy cập nhanh IBM + IBM Rapid Access + + + + + rapidaccess2 + IBM Rapid Access II + IBM Rapid Access II + IBM Rapid Access II + IBM Rapid Access II + IBM Rapid Access II + IBM Rapid Access II + IBM Rapid Access II + clavier IBM Rapid Access II + IBM Rapid Access II + IBM Rapid Access II + IBM Rapid Access II + IBM Rapid Access II + IBM Rapid Access II + IBM Rapid Access II + IBM Rapid Access II + IBM Hızlı Erişim II + IBM Rapid Access II + Truy cập nhanh IBM II + IBM Rapid Access II + + + + + rapidaccess2a + IBM Rapid Access II (alternate option) + IBM Rapid Access II (alternate option) + IBM Rapid Access II (alternate option) + IBM Rapid Access II + IBM Rapid Access II (alternativní volba) + IBM Rapid Access II (alternativ) + IBM Rapid Access II (alternate option) + clavier IBM Rapid Access II (option alternative) + IBM Rapid Access II (másik lehetőség) + IBM Rapid Access II (alternatieve optie) + IBM Rapid Access II (альтернативный вариант) + Ihitamo + IBM Rapid Access II (alternatívna voľba) + IBM Rapid Access II (opcioni alternativ) + IBM Rapid Access II (друга могућност) + IBM Rapid Access II (alternativ) + IBM Hızlı Erişim II (diğer seçenek) + IBM Rapid Access II (альтернативний варіант) + Truy cập nhanh IBM II (luân phiên tùy chọn) + IBM Rapid Access II(替代选项) + + + + + thinkpad + IBM ThinkPad 560Z/600/600E/A22E + IBM ThinkPad 560Z/600/600E/A22E + IBM ThinkPad 560Z/600/600E/A22E + IBM ThinkPad 560Z/600/600E/A22E + IBM ThinkPad 560Z/600/600E/A22E + IBM ThinkPad 560Z/600/600E/A22E + clavier IBM ThinkPad 560Z/600/600E/A22E + IBM ThinkPad 560Z/600/600E/A22E + IBM ThinkPad 560Z/600/600E/A22E + IBM·ThinkPad·560Z/600/600E/A22E + 600 + IBM ThinkPad 560Z/600/600E/A22E + IBM ThinkPad 560Z/600/600E/A22E + IBM ThinkPad 560Z/600/600E/A22E + IBM ThinkPad 560Z/600/600E/A22E + IBM ThinkPad 560Z/600/600E/A22E + IBM ThinkPad 560Z/600/600E/A22E + IBM ThinkPad 560Z/600/600E/A22E + IBM ThinkPad 560Z/600/600E/A22E + + + + + logiaccess + Logitech Access Keyboard + Logitech Access Keyboard + Logitech Access toetsenbord + Logitech Access Keyboard + Bàn phím Truy cập Logitech + + + + + ltcd + Logitech Cordless Desktop + Logitech Cordless Desktop + Logitech Cordless Desktop + Logitech Cordless Desktop Pro + Logitech Cordless Desktop + Logitech Cordless Desktop + Logitech Cordless Desktop + Logitech Cordless Desktop + Logitech Cordless Desktop + Logitech Cordless Desktop + Logitech Cordless Desktop + Logitech Cordless Desktop + Logitech Cordless Desktop + Logitech Cordless Desktop + Logitech Cordless Desktop + Logitech Kablosuz Masaüstü + Logitech Cordless Desktop + Logitech Cordless Desktop + 罗技无影手 + + + + + logicdit + Logitech Cordless Desktop iTouch + Logitech Cordless Desktop iTouch + Logitech Cordless Desktop iTouch + Logitech Cordless Desktop Pro + Logitech Cordless Desktop iTouch + Logitech Cordless Desktop iTouch + Logitech Cordless Desktop iTouch + Logitech Cordless Desktop iTouch + Logitech Cordless Desktop iTouch + Logitech Cordless Desktop iTouch + Logitech Cordless Desktop iTouch + Logitech Cordless Desktop iTouch + Logitech Cordless Desktop iTouch + Logitech Cordless Desktop iTouch + Logitech Cordless Desktop iTouch + Logitech Kablosuz Masaüstü iTouch + Logitech Cordless Desktop iTouch + Logitech Cordless Desktop iTouch + 罗技网际无影手 + + + + + logicdp + Logitech Cordless Desktop Pro + Logitech Cordless Desktop Pro + Logitech Cordless Desktop Pro + Logitech Cordless Desktop Pro + Logitech Cordless Desktop Pro + Logitech Cordless Desktop Pro + Logitech Cordless Desktop Pro + Logitech Cordless Desktop Pro + Logitech Cordless Desktop Pro + Logitech Cordless Desktop Pro + Logitech Cordless Desktop Pro + Logitech Cordless Desktop Pro + Logitech Cordless Desktop Pro + Logitech Cordless Desktop Pro + Logitech Cordless Desktop Pro + Logitech Kablosuz Masaüstü Pro + Logitech Cordless Desktop Pro + Logitech Cordless Desktop Pro + 罗技无影手高级版 + + + + + logicdpa + Logitech Cordless Desktop Pro (alternate option) + Logitech Cordless Desktop Pro (alternatiewe opsie) + Logitech Cordless Desktop Pro (alternate option) + Logitech Cordless Desktop Pro + Logitech Cordless Desktop Pro (alternativní volba) + Logitech Cordless Desktop Pro (alternativ) + Logitech Cordless Desktop Pro (alternate option) + Logitech Cordless Desktop Pro (option alternative) + Logitech Cordless Desktop Pro (másik lehetőség) + Logitech Cordless Desktop Pro (alternatieve optie) + Logitech Cordless Desktop Pro (альтернативный вариант) + Ihitamo + Logitech Cordless Desktop Pro (alternatívna voľba) + Logitech Cordless Desktop Pro (opcioni alternativ) + Logitech Cordless Desktop Pro (додатна могућност) + Logitech Cordless Desktop Pro (alternativ) + Logitech Kablosuz Masaüstü Pro (diğer seçenek) + Logitech Cordless Desktop Pro (альтернативний варіант) + Logitech Cordless Desktop Pro (luân phiên tùy chọn) + 罗技无影手高级版(替代选项) + + + + + logicdpa2 + Logitech Cordless Desktop Pro (alternate option2) + Logitech Cordless Desktop Pro (alternatiewe opsie2) + Logitech Cordless Desktop Pro (alternate option2) + Logitech Cordless Desktop Pro + Logitech Cordless Desktop Pro (alternativní volba 2) + Logitech Cordless Desktop Pro (alternativ 2) + Logitech Cordless Desktop Pro (alternate option2) + Logitech Cordless Desktop Pro (option2 alternative) + Logitech Cordless Desktop Pro (harmadik lehetőség) + Logitech Cordless Desktop Pro (alternatieve optie2) + Logitech Cordless Desktop Pro (альтернативный вариант 2) + Logitech Cordless Desktop Pro (alternatívna voľba2) + Logitech Cordless Desktop Pro (opcioni i dytë alternativ) + Logitech Cordless Desktop Pro (додатна могућност 2) + Logitech Cordless Desktop Pro (alternativ2) + Logitech Kablosuz Masaüstü Pro (diğer 2. seçenek) + Logitech Cordless Desktop Pro (альтернативний варіант 2) + Logitech Cordless Desktop Pro (luân phiên tùy chọn2) + 罗技无影手高级版(替代选项) + + + + + logicdo + Logitech Cordless Desktop Optical + Logitech Cordless Desktop Optical + Logitech Cordless Desktop Optical + Logitech Cordless Desktop Pro + Logitech Cordless Desktop Optical + Logitech Cordless Desktop Optical + Logitech Cordless Desktop Optical + Logitech Cordless Desktop Optical + Logitech Cordless Desktop Optical + Logitech Cordless Desktop Optisch + Logitech Cordless Desktop Optical + Logitech Cordless Desktop Optical + Logitech Cordless Desktop Optical + Logitech Cordless Desktop Optical + Logitech Cordless Desktop Optical + Logitech Kablosuz Masaüstü Optik + Logitech Cordless Desktop Optical + Logitech Cordless Desktop Optical + 罗技无影手光学组合 + + + + + logicfn + Logitech Cordless Freedom/Desktop Navigator + Logitech Cordless Freedom/Desktop Navigator + Logitech Cordless Freedom/Desktop Navigator + Logitech Cordless Desktop Pro + Logitech Cordless Freedom/Desktop Navigator + Logitech Cordless Freedom/Desktop Navigator + Logitech Cordless Freedom/Desktop Navigator + Logitech Cordless Freedom/Desktop Navigator + Logitech Cordless Freedom/Desktop Navigator + Logitech Cordless Freedom/Desktop Navigator + Logitech Cordless Freedom/Desktop Navigator + Logitech Cordless Freedom/Desktop Navigator + Logitech Cordless Freedom/Desktop Navigator + Logitech Cordless Freedom/Desktop Navigator + Logitech Cordless Freedom/Desktop Navigator + Logitech Kablosuz Özgür/Masaüstü Tarayıcı + Logitech Cordless Freedom/Desktop Navigator + Logitech Cordless Freedom/Desktop Navigator + 罗技极光无影手组合/桌面导航器 + + + + + logicdn + Logitech Cordless Desktop Navigator + Logitech Cordless Desktop Navigator + Logitech Cordless Desktop Navigator + Logitech Cordless Desktop Pro + Logitech Cordless Desktop Navigator + Logitech Cordless Desktop Navigator + Logitech Cordless Desktop Navigator + Logitech Cordless Desktop Navigator + Logitech Cordless Desktop Navigator + Logitech Cordless Desktop Navigator + Logitech Cordless Desktop Navigator + Logitech Cordless Desktop Navigator + Logitech Cordless Desktop Navigator + Logitech Cordless Desktop Navigator + Logitech Cordless Desktop Navigator + Logitech Kablosuz Masaüstü Tarayıcı + Logitech Cordless Desktop Navigator + Logitech Cordless Desktop Navigator + 罗技无影手桌面导航器 + + + + + logidak + Logitech Deluxe Access Keyboard + Logitech Deluxe Access Keyboard + Logitech Deluxe Access Keyboard + Logitech Интернет клавиатура + Logitech Deluxe Access Keyboard + Logitech Deluxe Access Keyboard + Logitech Deluxe Access Keyboard + clavier Logitech Deluxe Access + Logitech Deluxe Access Keyboard + Logitech Deluxe Access toetsenbord + Logitech Deluxe Access Keyboard + Logitech Deluxe Access Keyboard + Tastierë Logitech Deluxe Access + Logitech Deluxe Access тастатура + Logitech Deluxe Access-tangentbord + Logitech Deluxe Erişim Klavyesi + Logitech Deluxe Access Keyboard + Logitech Deluxe Access Keyboard + 罗技强手键盘 + + + + + logiitc + Logitech iTouch Cordless Keyboard (model Y-RB6) + Logitech iTouch Cordless Keyboard (model Y-RB6) + Logitech iTouch Cordless Keyboard (model Y-RB6) + Logitech iTouch Cordless Keyboard (model Y-RB6) + Logitech iTouch Cordless Keyboard (model Y-RB6) + Logitech iTouch Cordless Keyboard (model Y-RB6) + clavier Logitech iTouch Cordless (model Y-RB6) + Logitech iTouch Cordless Keyboard (model Y-RB6) + Logitech iTouch draadloos toetsenbord (model Y-RB6) + Logitech iTouch Cordless Keyboard (модель Y-RB6) + Urugero + Logitech iTouch Cordless Keyboard (model Y-RB6) + Logitech iTouch Cordless Keyboard (model Y-RB6) + Logitech iTouch Cordless тастатура (модел Y-RB6) + Logitech iTouch Cordless Keyboard (modell Y-RB6) + Logitech iTouch Kablosuz Klavyesi (model Y-RB6) + Logitech iTouch Cordless Keyboard (модель Y-RB6) + Bàn phím Không dây Logitech iTouch (mẫu mã Y-RB6) + 罗技 iTouch 无影手键盘(型号 Y-RB6) + + + + + logiik + Logitech Internet Keyboard + Logitech Internet Keyboard + Logitech Internet Keyboard + Logitech Интернет клавиатура + Logitech Internet Keyboard + Logitech Internet Keyboard + Logitech Internet Keyboard + clavier Logitech Internet + Logitech Internet Keyboard + Logitech internet toetsenbord + Logitech Internet Keyboard + Logitech Internet Keyboard + Tastierë për Internet Logitech + Logitech Интернет тастатура + Logitech Internettangentbord + Logitech Örütbağ Klavyesi + Logitech Internet Keyboard + Bàn phím Internet Logitech + 罗技网际键盘 + + + + + itouch + Logitech iTouch + Logitech iTouch + Logitech iTouch + Logitech iTouch + Logitech iTouch + Logitech iTouch + Logitech iTouch + Logitech iTouch + Logitech iTouch + Logitech iTouch + Logitech iTouch + Logitech iTouch + Logitech iTouch + Logitech iTouch + Logitech iTouch + Logitech iTouch + Logitech iTouch + Logitech iTouch + 罗技 iTouch + + + + + logiitc + Logitech iTouch Cordless Keyboard (model Y-RB6) + Logitech iTouch Cordless Keyboard (model Y-RB6) + Logitech iTouch Cordless Keyboard (model Y-RB6) + Logitech iTouch Cordless Keyboard (model Y-RB6) + Logitech iTouch Cordless Keyboard (model Y-RB6) + Logitech iTouch Cordless Keyboard (model Y-RB6) + clavier Logitech iTouch Cordless (model Y-RB6) + Logitech iTouch Cordless Keyboard (model Y-RB6) + Logitech iTouch draadloos toetsenbord (model Y-RB6) + Logitech iTouch Cordless Keyboard (модель Y-RB6) + Urugero + Logitech iTouch Cordless Keyboard (model Y-RB6) + Logitech iTouch Cordless Keyboard (model Y-RB6) + Logitech iTouch Cordless тастатура (модел Y-RB6) + Logitech iTouch Cordless Keyboard (modell Y-RB6) + Logitech iTouch Kablosuz Klavyesi (model Y-RB6) + Logitech iTouch Cordless Keyboard (модель Y-RB6) + Bàn phím Không dây Logitech iTouch (mẫu mã Y-RB6) + 罗技 iTouch 无影手键盘(型号 Y-RB6) + + + + + logiik + Logitech Internet Keyboard + Logitech Internet Keyboard + Logitech Internet Keyboard + Logitech Интернет клавиатура + Logitech Internet Keyboard + Logitech Internet Keyboard + Logitech Internet Keyboard + clavier Logitech Internet + Logitech Internet Keyboard + Logitech internet toetsenbord + Logitech Internet Keyboard + Logitech Internet Keyboard + Tastierë për Internet Logitech + Logitech Интернет тастатура + Logitech Internettangentbord + Logitech Örütbağ Klavyesi + Logitech Internet Keyboard + Bàn phím Internet Logitech + 罗技网际键盘 + + + + + logiink + Logitech Internet Navigator Keyboard + Logitech Internet Navigator Keyboard + Logitech Internet Navigator Keyboard + Logitech клавиатура за Интернет навигация + Logitech Internet Navigator Keyboard + Logitech Internet Navigator Keyboard + Logitech Internet Navigator Keyboard + clavier Logitech Internet Navigator + Logitech Internet Navigator Keyboard + Logitech Internet Navigator toetsenbord + Logitech Internet Navigator Keyboard + Logitech Internet Navigator Keyboard + Tastierë Logitech Internet Navigator + Logitech Интернет навигатор тастатура + Logitech Internet Navigator-tangentbord + Logitech Örütbağ Tarayıcı Klavyesi + Logitech Internet Navigator Keyboard + Bàn phím Logitech Internet Navigator + 罗技网际导航键盘 + + + + + itouchin + Logitech iTouch keyboard Internet Navigator + Logitech iTouch keyboard Internet Navigator + Logitech iTouch keyboard Internet Navigator + Logitech клавиатура за Интернет навигация + Logitech iTouch keyboard Internet Navigator + Logitech iTouch keyboard Internet Navigator + Logitech iTouch keyboard Internet Navigator + clavier Logitech iTouch Internet Navigator + Logitech iTouch Keyboard Internet Navigator + Logitech iTouch toetsenbord Internet Navigator + Logitech iTouch keyboard Internet Navigator + Mwandikisho + Logitech iTouch keyboard Internet Navigator + Logitech iTouch keyboard Internet Navigator + Logitech iTouch тастатура Интернет навигатор + Logitech iTouch-tangentbord Internet Navigator + Logitech iTouch klavyesi Örütbağ Tarayıcı + Logitech iTouch keyboard Internet Navigator + Logitech iTouch keyboard Internet Navigator + 罗技 iTouch 键盘网际导航器 + + + + + logiultrax + Logitech Ultra-X Keyboard + Logitech Ultra-X Keyboard + + + + + mx1998 + Memorex MX1998 + Memorex MX1998 + Memorex MX1998 + Memorex MX1998 + Memorex MX1998 + Memorex MX1998 + Memorex MX1998 + Memorex MX1998 + Memorex MX1998 + Memorex MX1998 + Memorex MX1998 + Memorex MX1998 + Memorex MX1998 + Memorex MX1998 + Memorex MX1998 + Memorex MX1998 + Memorex MX1998 + Memorex MX1998 + + + + + mx2500 + Memorex MX2500 EZ-Access Keyboard + Memorex MX2500 EZ-Access Keyboard + Memorex MX2500 EZ-Access Keyboard + Memorex MX2500 EZ-Access Keyboard + Memorex MX2500 EZ-Access Keyboard + Memorex MX2500 EZ-Access Keyboard + clavier Memorex MX2500 EZ-Access + Memorex MX2500 EZ-Access billentyűzet + Memorex MX2500 EZ-Access toetsenbord + Memorex MX2500 EZ-Access Keyboard + Memorex MX2500 EZ-Access Keyboard + Tastierë Memorex MX2500 EZ-Access + Memorex MX2500 EZ-Access тастатура + Memorex MX2500 EZ-Access-tangentbord + Memorex MX2500 EZ Erişim Klavyesi + Memorex MX2500 EZ-Access Keyboard + Bàn phím Memorex MX2500 EZ-Access + Memorex MX2500 EZ-Access 键盘 + + + + + mx2750 + Memorex MX2750 + Memorex MX2750 + Memorex MX2750 + Memorex MX2750 + Memorex MX2750 + Memorex MX2750 + Memorex MX2750 + Memorex MX2750 + Memorex MX2750 + Memorex MX2750 + Memorex MX2750 + Memorex MX2750 + Memorex MX2750 + Memorex MX2750 + Memorex MX2750 + Memorex MX2750 + Memorex MX2750 + Memorex MX2750 + + + + + microsoftinet + Microsoft Internet Keyboard + Microsoft Internetsleutelbord + Microsoft Internet Keyboard + Интернет клавиатура на Chicony + Microsoft Internet Keyboard + Microsoft Internet Keyboard + Microsoft Internet Keyboard + clavier Microsoft Internet + Microsoft Internet Keyboard + Microsoft internet toetsenbord + Microsoft Internet Keyboard + Microsoft Internet Keyboard + Tastierë Microsoft Internet + Микрософтова Интернет тастатура + Microsoft Internet Keyboard + Microsoft Örütbağ Klavyesi + Microsoft Internet Keyboard + Bàn phím Internet Microsoft + 微软网际键盘 + + + + + microsoftpro + Microsoft Natural Keyboard Pro / Microsoft Internet Keyboard Pro + Microsoft Natural Keyboard Pro / Microsoft Internet Keyboard Pro + Microsoft Natural Keyboard Pro / Microsoft Internet Keyboard Pro + Microsoft Natural Keyboard Pro / Microsoft Internet Keyboard Pro + Microsoft Natural Keyboard Pro / Microsoft Internet Keyboard Pro + Microsoft Natural Keyboard Pro / Microsoft Internet Keyboard Pro + clavier Microsoft Natural Pro / Microsoft Internet Pro + Microsoft Natural Keyboard Pro / Microsoft Internet Keyboard Pro + Microsoft Natural Keyboard Pro / Microsoft Internet Keyboard Pro + Microsoft Natural Keyboard Pro / Microsoft Internet Keyboard Pro + Microsoft Natural Keyboard Pro / Microsoft Internet Keyboard Pro + Microsoft Natural Keyboard Pro / Microsoft Internet Keyboard Pro + Микрософт Натурал тастатура Про / Микрософт Интернет тастатура Про + Microsoft Natural Keyboard Pro / Microsoft Internet Keyboard Pro + Microsoft Basit Klavye Pro / Microsoft Örütbağ Klavyesi Pro + Microsoft Natural Keyboard Pro / Microsoft Internet Keyboard Pro + Microsoft Natural Keyboard Pro / Microsoft Internet Keyboard Pro + 微软自然键盘增强版/微软网际键盘增强版 + + + + + microsoftprousb + Microsoft Natural Keyboard Pro USB / Microsoft Internet Keyboard Pro + Microsoft Natural Keyboard Pro USB / Microsoft Internet Keyboard Pro + Microsoft Natural Keyboard Pro USB / Microsoft Internet Keyboard Pro + Microsoft Natural Keyboard Pro USB / Microsoft Internet Keyboard Pro + Microsoft Natural Keyboard Pro USB / Microsoft Internet Keyboard Pro + + + + + microsoftprooem + Microsoft Natural Keyboard Pro OEM + Microsoft Natural Keyboard Pro OEM + Microsoft Natural Keyboard Pro OEM + Microsoft Natural Pro + Microsoft Natural Keyboard Pro OEM + Microsoft Natural Keyboard Pro OEM + Microsoft Natural Keyboard Pro OEM + clavier Microsoft Natural Pro OEM + Microsoft Natural Keyboard Pro OEM + Microsoft Natural Keyboard Pro OEM + Microsoft·Natural·Keyboard·Pro·OEM + Microsoft Natural Keyboard Pro OEM + Microsoft Natural Keyboard Pro OEM + Микрософт Натурал тастатура Про ОЕМ + Microsoft Natural Keyboard Pro OEM + Microsoft Basit Klavye Pro OEM + Microsoft Natural Keyboard Pro OEM + Microsoft Natural Keyboard Pro OEM + 微软自然键盘增强版 OEM + + + + + microsoftprose + Microsoft Internet Keyboard Pro, Swedish + Microsoft Internet Keyboard Pro, Sweeds + Microsoft Internet Keyboard Pro, Swedish + Интернет клавиатура на Chicony + Microsoft Internet Keyboard Pro, Švédská + Microsoft Internet Keyboard Pro, svensk + Microsoft Internet Keyboard Pro, Swedish + clavier Microsoft Internet Pro, Suédois + Microsoft Internet Keyboard Pro, svéd + Microsoft Internet Keyboard Pro, Zweeds + Microsoft Internet Keyboard Pro, шведская + Microsoft Internet Keyboard Pro, Švédska + Microsoft Internet Keyboard Pro, Suedeze + Микрософтова Интернет Про тастатура, шведски + Microsoft Internet Keyboard Pro, svensk + Microsoft Örütbağ Klavyesi Pro, İsveçce + Microsoft Internet Keyboard Pro, шведська + Bàn phím Internet Microsoft Pro, Thụy Điển + 微软网际键盘增强版，瑞典 + + + + + microsoftoffice + Microsoft Office Keyboard + Microsoft Office sleutelbord + Microsoft Office Keyboard + Microsoft Office Keyboard + Microsoft Office Keyboard + Microsoft Office Keyboard + clavier Microsoft Office + Microsoft Office billentyűzet + Microsoft Office toetsenbord + Microsoft Office Keyboard + Microsoft Office Keyboard + Tastierë Microsoft Office + Микрософтова канцеларијска тастатура + Microsoft Office-tangentbord + Microsoft Ofis Klavyesi + Microsoft Office Keyboard + Bàn phím Văn phòng Microsoft + 微软 Office 键盘 + + + + + microsoftmult + Microsoft Wireless Multimedia Keyboard 1.0A + Microsoft Wireless Multimedia Keyboard 1.0A + Microsoft draadloos multimediatoetsenbord 1.0A + Microsoft Wireless Multimedia Keyboard 1.0A + 1. + Microsoft Wireless Multimedia Keyboard 1.0A + + + + + oretec + Oretec MCK-800 MM/Internet keyboard + Oretec MCK-800 MM/Internet keyboard + Oretec MCK-800 MM/Internet keyboard + Logitech Интернет клавиатура + Oretec MCK-800 MM/Internet keyboard + Oretec MCK-800 MM/Internet keyboard + Oretec MCK-800 MM/Internet keyboard + Oretec MCK-800 MM/Internet keyboard + Oretec MCK-800 MM/Internet billentyűzet + Oretec MCK-800 MM/Internet toetsenbord + Oretec MCK-800 MM/Internet keyboard + Mwandikisho + Oretec MCK-800 MM/Internet keyboard + Tastierë Oretec MCK-800 MM/Internet + Oretec MCK-800 ММ/Интернет тастатура + Oretec MCK-800 MM/Internet-tangentbord + Oretec MCK-800 MM/Örütbağ Klavyesi + Oretec MCK-800 MM/Internet keyboard + Bàn phím Oretec MCK-800 MM/Internet + Oretec MCK-800 MM/网际键盘 + + + + + propeller + Propeller Voyager (KTEZ-1000) + Propeller Voyager (KTEZ-1000) + Propeller Voyager (KTEZ-1000) + Propeller Voyager (KTEZ-1000) + Propeller Voyager (KTEZ-1000) + Propeller Voyager (KTEZ-1000) + Propeller Voyager (KTEZ-1000) + Propeller Voyager (KTEZ-1000) + Propeller Voyager (KTEZ-1000) + Propeller Voyager (KTEZ-1000) + 1000 + Propeller Voyager (KTEZ-1000) + Propeller Voyager (KTEZ-1000) + Propeller Voyager (KTEZ-1000) + Propeller Voyager (KTEZ-1000) + Propeller Voyager (KTEZ-1000) + Propeller Voyager (KTEZ-1000) + Propeller Voyager (KTEZ-1000) + Propeller Voyager (KTEZ-1000) + + + + + qtronix + QTronix Scorpius 98N+ + QTronix Scorpius 98N+ + QTronix Scorpius 98N+ + QTronix Scorpius 98N+ + QTronix Scorpius 98N+ + QTronix Scorpius 98N+ + QTronix Scorpius 98N+ + QTronix Scorpius 98N+ + QTronix Scorpius 98N+ + QTronix Scorpius 98N+ + QTronix Scorpius 98N+ + QTronix Scorpius 98N+ + QTronix Scorpius 98N+ + QTronix Scorpius 98N+ + QTronix Scorpius 98N+ + QTronix Scorpius 98N+ + QTronix Scorpius 98N+ + QTronix Scorpius 98N+ + + + + + samsung4500 + Samsung SDM 4500P + Samsung SDM 4500P + Samsung SDM 4500P + Samsung SDM 4500P + Samsung SDM 4500P + Samsung SDM 4500P + Samsung SDM 4500P + Samsung SDM 4500P + Samsung SDM 4500P + Samsung SDM 4500P + Samsung SDM 4500P + Samsung SDM 4500P + Samsung SDM 4500P + Samsung SDM 4500P + Samsung SDM 4500P + Samsung SDM 4500P + Samsung SDM 4500P + 三星 SDM 4500P + + + + + samsung4510 + Samsung SDM 4510P + Samsung SDM 4510P + Samsung SDM 4510P + Samsung SDM 4510P + Samsung SDM 4510P + Samsung SDM 4510P + Samsung SDM 4510P + Samsung SDM 4510P + Samsung SDM 4510P + Samsung SDM 4510P + Samsung SDM 4510P + Samsung SDM 4510P + Samsung SDM 4510P + Samsung SDM 4510P + Samsung SDM 4510P + Samsung SDM 4510P + Samsung SDM 4510P + 三星 SDM 4510P + + + + + sk1300 + SK-1300 + SK-1300 + SK-1300 + SK-1300 + SK-1300 + SK-1300 + SK-1300 + SK-1300 + SK-1300 + SK-1300 + SK-1300 + SK-1300 + SK-1300 + SK-1300 + SK-1300 + SK-1300 + SK-1300 + SK-1300 + + + + + sk2500 + SK-2500 + SK-2500 + SK-2500 + SK-2500 + SK-2500 + SK-2500 + SK-2500 + SK-2500 + SK-2500 + SK-2500 + SK-2500 + SK-2500 + SK-2500 + SK-2500 + SK-2500 + SK-2500 + SK-2500 + SK-2500 + + + + + sk6200 + SK-6200 + SK-6200 + SK-6200 + SK-6200 + SK-6200 + SK-6200 + SK-6200 + SK-6200 + SK-6200 + SK-6200 + SK-6200 + SK-6200 + SK-6200 + SK-6200 + SK-6200 + SK-6200 + SK-6200 + SK-6200 + + + + + sk7100 + SK-7100 + SK-7100 + SK-7100 + SK-7100 + SK-7100 + SK-7100 + SK-7100 + SK-7100 + SK-7100 + SK-7100 + SK-7100 + SK-7100 + SK-7100 + SK-7100 + SK-7100 + SK-7100 + SK-7100 + SK-7100 + + + + + sp_inet + Super Power Multimedia Keyboard + Super Power Multimedia Keyboard + Super Power multimediatoetsenbord + Super Power Multimedia Keyboard + Bàn phím Phim nhạc Siêu Năng Lực + + + + + sven + SVEN Ergonomic 2500 + SVEN Ergonomic 2500 + SVEN Ergonomic 2500 + SVEN Ergonomic 2500 + SVEN Ergonomic 2500 + SVEN Ergonomic 2500 + SVEN Ergonomic 2500 + SVEN Ergonomic 2500 + SVEN Ergonomic 2500 + SVEN Ergonomic 2500 + SVEN Ergonomic 2500 + SVEN Ergonomic 2500 + SVEN ергономска 2500 + SVEN Ergonomic 2500 + SVEN Ergonomik 2500 + SVEN Ergonomic 2500 + SVEN Ergonomic 2500 + SVEN Ergonomic 2500 + + + + + symplon + Symplon PaceBook (tablet PC) + Symplon PaceBook (tablet PC) + Symplon PaceBook (tablet PC) + Symplon PaceBook (tablet PC) + Symplon PaceBook (tablet-pc) + Symplon PaceBook (tablet PC) + Symplon PaceBook (tablet PC) + Symplon PaceBook (tablet PC) + Symplon PaceBook (tablet PC) + Symplon PaceBook (карманный ПК) + Symplon PaceBook (tablet PC) + Symplon PaceBook (tablet PC) + Symplon PaceBook (tablet PC) + Symplon PaceBook (tablet PC) + Symplon PaceBook (tablet PC) + Symplon PaceBook (переносний ПК) + Symplon PaceBook (tablet PC) + Symplon PaceBook(平板电脑) + + + + + toshiba_s3000 + Toshiba Satellite S3000 + Toshiba Satellite S3000 + Toshiba Satellite S3000 + Toshiba Satellite S3000 + Toshiba Satellite S3000 + Toshiba Satellite S3000 + Toshiba Satellite S3000 + Toshiba Satellite S3000 + Toshiba Satellite S3000 + Toshiba Satellite S3000 + Toshiba Satellite S3000 + Toshiba Satellite S3000 + Toshiba Satellite S3000 + Toshiba Satellite S3000 + Toshiba Satellite S3000 + Toshiba Satellite S3000 + Toshiba Satellite S3000 + 东芝 Satellite S3000 + + + + + trust + Trust Wireless Keyboard Classic + Trust Wireless Keyboard Classic + Trust Wireless Keyboard Classic + Trust Wireless Keyboard Classic + Trust Wireless Keyboard Classic + Trust Wireless Keyboard Classic + clavier classique Trust Wireless + Trust Wireless Keyboard Classic + Trust Wireless Keyboard Classic + Trust Wireless Keyboard Classic + Trust Wireless Keyboard Classic + Tastierë klasike Trust Wireless + Trust класична бежична тастатура + Trust Wireless Keyboard Classic + Trust Kablosuz Klasik Klavye + Trust Wireless Keyboard Classic + Bàn Phím Cổ điển Không dây Tin tưởng + Trust 无线经典键盘 + + + + + trustda + Trust Direct Access Keyboard + Trust Direct Access Keyboard + Trust Direct Access Keyboard + Trust Direct Access Keyboard + Trust Direct Access Keyboard + Trust Direct Access Keyboard + clavier Trust Direct Access + Trust Direct Access billentyűzet + Trust Direct Access toetsenbord + Trust Direct Access Keyboard + Trust Direct Access Keyboard + Tastierë Trust Direct Access + Trust Direct Access тастатура + Trust Direct Access-tangentbord + Trust Doğrudan Erişimli Klavye + Trust Direct Access Keyboard + Bàn phím Truy cập Thẳng Tin tưởng + Trust Direct Access 键盘 + + + + + yahoo + Yahoo! Internet Keyboard + Yahoo! Internetsleutelbord + Yahoo! Internet Keyboard + Интернет клавиатура на Chicony + Yahoo! Internet Keyboard + Yahoo! Internet Keyboard + Yahoo! Internet Keyboard + clavier Yahoo! Internet + Yahoo! Internet billentyűzet + Yahoo! internet toetsenbord + Yahoo! Internet Keyboard + Yahoo! Internet Keyboard + Tastierë Yahoo! Internet + Yahoo! Интернет тастатура + Yahoo! Internettangentbord + Yahoo! Örütbağ Klavyesi + Yahoo! Internet Keyboard + Bàn phím Internet Yahoo! + 雅虎网际键盘 + + + + + macintosh + Macintosh + Macintosh + Macintosh + Macintosh + Macintosh + Macintosh + Macintosh + Macintosh + Macintosh + Macintosh + masinitoshi + Macintosh + Macintosh + Мекинтош + Macintosh + Macintosh + Macintosh + Macintosh + Macintosh + + + + + macintosh_old + Macintosh Old + Macintosh (oud) + Macintosh Old + Macintosh staré + Macintosh gammel + Macintosh Old + Macintosh ancien + Macintosh Old + Macintosh oud + Старый Macintosh + Macintosh staré + Macintosh i vjetër + Стари Мекинтош + Macintosh gammal + Eski Macintosh + Старий Macintosh + Macintosh Cũ + Macintosh 旧产品 + + + + + powerpcps2 + PowerPC PS/2 + PowerPC PS/2 + PowerPC PS/2 + PowerPC PS/2 + PowerPC PS/2 + PowerPC PS/2 + PowerPC PS/2 + PowerPC PS/2 + PowerPC PS/2 + PowerPC PS/2 + 2. + PowerPC PS/2 + PowerPC PS/2 + PowerPC PS/2 + PowerPC PS/2 + PowerPC PS/2 + PowerPC PS/2 + PowerPC PS/2 + PowerPC PS/2 + + + + + acer_tm_800 + Acer TravelMate 800 + Acer TravelMate 800 + Acer TravelMate 800 + + + + + + + us + USA + VSA + ABŞ + USA + USA + ΗΠΑ + USA + USA + USA + USA + США + Amerika + USA + USA + САД + USA + ABD + США + Mỹ + USA + U.S. English + VSA Engels + A.B.Ş. İngiliscəsi + американска английска + Anglické (US) + U.S. Engelsk + Αγγλικά ΗΠΑ + U.S. English + Anglais U.S. + amerikai angol + Amerikaans-Engels + Английская (США) + U. + U.S.A. anglické + U.S. Anglisht + амерички енглески + Engelskamerikansk + Amerikan ingilizcesi + Англійська (США) + Anh Mỹ + 美国英语 + + + + + intl + International (with dead keys) + International (with dead keys) + Internationaal (met dode toetsen) + Международная, со спец. клавишами (dead keys) + Na: Utubuto + Quốc tế (với phím chết) + + + + + alt-intl + Alternative international (former us_intl) + Alternative international (former us_intl) + Alternatief internationaal (voormalig us_intl) + Альтернативная международная (бывшая us_intl) + Mpuzamahanga + Quốc tế tương đương (cũ us_intl) + + + + + dvorak + Dvorak + Dvorak + Dvorak + Дворак + Dvorak + Dvorak + Dvorak + Dvorak + Dvorak-féle + Dvorak + Дворак + Dvorak + Dvorak + дворак + Dvorak + Dvorak + Дворак + Dvorak + Dvorak + + + + + rus + Russian phonetic + Русская фонетическая + + + + + + + ara + Ara + Αρα + Ara + Fra + Ара + Ara + Arabic + Arabies + Ərəbcə + арабска + Arabské + Arabisk + Αραβικό + Arabic + Arabe + arab + Arabisch + Арабская + Icyarabu + Arabsky + Arabe + арапски + Arabisk + Arapça + Арабська + Ả Rập + 阿拉伯 + + + + + azerty + azerty + azerty + azerty + azerty + azerty + azerty + azerty + azerty + azerty + azerty + azerty + azerty + azerty + azerty + azerty + azerty + azerty + azerty + + + + + azerty_digits + azerty/digits + azerty/syfers + azerty/ədədlər + azerty/číslice + azerty/cifre + azerty/digits + azerty/chiffres + azerty/számjegyek + azerty/cijfers + azerty/цифры + azerty/číslice + azerty/digits + azerty/цифре + azerty/siffror + azerty/rakamlar + azerty/цифри + azerty/chữ số + azerty/数字 + + + + + digits + digits + syfers + ədədlər + číslice + cifre + digits + chiffres + számjegyek + cijfers + цифры + číslice + numra + цифре + siffror + rakamlar + цифри + chữ số + 数字 + + + + + qwerty + qwerty + qwerty + qwerty + чешка (qwerty) + qwerty + qwerty + qwerty + qwerty + qwerty + qwerty + qwerty + qwerty + qwerty + qwerty + qwerty + qwerty + qwerty + qwerty + qwerty + + + + + qwerty_digits + qwerty/digits + qwerty/syfers + qwerty/ədədlər + qwerty/číslice + qwerty/cifre + qwerty/digits + qwerty/chiffres + qwerty/számjegyek + qwerty/cijfers + qwerty/цифры + qwerty/číslice + qwerty/numra + qwerty/цифре + qwerty/siffror + qwerty/rakamlar + qwerty/цифри + qwerty/chữ số + qwerty/digits + + + + + + + al + Alb + Alb + Alb + Alb + Alb + Alb + Alb + Alb + Alb + Алб + Alb + Alb + алб + Alb + Arn + Алб + Alb + Alb + Albania + Albania + Albanië + Албания + Alubaniya + Al-ba-ni-a + + + + + + am + Arm + Arm + Erm + арабска + Arm + Arm + Αρμ + Arm + Arm + Arm + Arm + Арм + Arm + Arm + јрм + Arm + Erm + Вірм + Arm + Arm + Armenia + Armenia + Armenië + Армения + Arumeniya + Ác-mê-ni + + + + + phonetic + Phonetic + Foneties + Fonetik + Fonetické + Fonetisk + Φωνητικά + Phonetic + Phonétique + fonetikus + Fonetisch + Фонетическая + Nyigamvugo: + Fonetické + Phonetic + фонетски + Fonetisk + Fonetik + Фонетична + Ngữ âm + Phonetic + + + + + + + az + Aze + Aze + Azə + Aze + Ase + Αζε + Aze + Aze + Aze + Aze + Азер + Aze + Aze + азб + Aze + Aze + Азер + Aze + Aze + Azerbaijan + Azerbaijan + Azerbeidzjan + Азербайджан + Azeribayijani + A-zéc-bai-gian + + + + + cyrillic + Cyrillic + Kirrillies + Kiril + Cyrilika + Kyrillisk + Κυριλλικά + Cyrillic + Cérillique + cirill + Cyrillisch + Кириллическая + Nyasilike + Cyrilika + Cyrillic + ћирилични + Kyrillisk + Kril + Кирилична + Cyrillic + 西里尔 + + + + + + + by + Blr + Blr + Blr + Běl + Blr + Blr + Blr + Blr + Blr + Бел + Blr + Blr + блр + Blr + Blr + Біл + Blr + Blr + Belarus + Belarus + Wit-Rusland + Беларусь + Belarusi + Bê-la-rút + + + + + winkeys + Winkeys + Winkeys + Winkeys + Winkeys + Win-taster + Winkeys + Winkeys + Winkeys + Win-toetsen + Клавиатура Windows + Win klávesy + Winkeys + Windows тастери + Wintangenter + Win tuşları + Розкладка Windows + Phím Win + Winkeys + + + + + + + be + Bel + Bel + Bel + Bel + Bel + Λευ + Bel + Bel + Bel + Bel + Бельг + Bel + Bel + блг + Bel + Bel + Бельг + Bel + Bel + Belgium + Belgium + België + Бельгия + Ububiligi + Bỉ + + + + + iso-alternate + ISO Alternate + ISO Alternatief + ISO Alternate + ISO alternativní + ISO-alternativ + ISO Alternate + ISO alternative + ISO Alternate + ISO alternatief + Дополнительная ISO + ISO alternatívne + ISO Alternative + Додатни ИСО + ISO-alternativ + ISO diğer + Додаткова ISO + ISO Xen kẽ + ISO 替代 + + + + + nodeadkeys + Eliminate dead keys + Elimineer dooie sleutels + Ölü düymələri sayma + Изключи специалните клавиши (dead keys) + Eliminovat mrtvé klávesy + Slå døde taster fra + Χωρίς νεκρά πλήκτρα + Eliminate dead keys + éliminer des clés mortes + Halott billentyűk tiltása + Dode toetsen niet doen + Исключить специальные клавиши (dead keys) + Utubuto + Eliminovať mrtvé kláves + Elemino pulsantët e vdekur + Уклони акценте + Eliminera stumma tangenter + Ölü tuşları normal yapar + Вилучити спеціальні клавіші (dead keys) + Phím chết loại trừ + 除去死键 + + + + + sundeadkeys + Sun dead keys + Sun (dooie sleutels) + Sun ölü düymələr + Изключи специалните клавиши (dead keys) + Mrtvé klávesy Sun + Sun døde taster + Sun dead keys + clés mortes Sun + Sun halott billentyűk + Sun dode toetsen + Специальные клавиши (dead keys) Sun + Utubuto + Mŕtve klávesy Sun + Pulsantë të vdekur Sun + Sun-ови акценти + Sun stumma tangenter + Sun ölü tuşlar + Спеціальні клавіші (dead keys) Sun + Phím chết Sun + Sun 死键 + + + + + + + bd + Ban + Бан + Bangladesh + Бангладеш + + + + + probhat + Probhat + Probhat + Prt + Пробат + Probhat + + + + + + + in + Ind + Инд + India + Индия + + + + + ben + Bengali + Bengaals + Benqalca + бенгалска + Bengálské + Bengali + Bengali + Bengali + bengáli + Bengaals + Бенгальская + Bengali + Bengálska + Bengali + бенгалски + Bengalisk + Bengalce + Бенгальська + Băng-gan + 孟加拉 + + + + + ben_probhat + Bengali Probhat + Бенгальская Пробат + + + + + guj + Gujarati + Gujarati + Gujaraticə + гуджарати + Gujarati + Gujarati + Gujarati + Gujarati + gudzsarati + Gujarati + Гуджарати + Gujarati + Gudžarati + Gujarati + гујарати + Gujaratisk + Batı Hint dili + Гуяраті + Gujarati + 古吉拉特 + + + + + guru + Gurmukhi + Gurmukhi + Gurmukhi + гурмуки + Gurmukhi + Gurmukhi + Gurmukhi + Gurmukhi + gurmukhi + Gurmukhi + Гурмукхи + Gurumuki + Gurmuchské + Gurmukhi + гурмуки + Gurmukhisk + Gurmukhi + Гурмукхі + Gurmukhi + 旁遮普 + + + + + kan + Kannada + Kannada + Kannada + канадска + Kannadské + Kannada + Kannada + Kannada + kannada + Kannada + Каннада + Kannada + Kannadské + Kanadeze + канада (јужна индија) + Kannada + Güney Hint dili + Канадська + Kannada + 埃纳德 + + + + + mal + Malayalam + Malayalam + Malayalamca + Malajské + Malayalam + Malayalam + Malayalam + malajalam + Malayalamees + Малайaлам + Malayalamu + Malajalamské + Malayalam + малајамски + Malayalam + Malayalam dili + Малайська + Malayalam + 马来西亚 + + + + + ori + Oriya + Oriya + Oriya + Oriya + Oriya + Oriya + Oriya + orija + Oriya + Орийя + Oriya + Oriya + Oriya + орија + Oriya + Orissa dili + Орія + Oriya + Oriya + + + + + tam_unicode + Tamil Unicode + Тамильская Unicode + + + + + tam_TAB + Tamil TAB Typewriter + Тамильская "Печатная машинка" TAB + + + + + tam_TSCII + Tamil TSCII Typewriter + Тамильская "Печатная машинка" TSCII + + + + + tam + Tamil + Tamilees + Tamilcə + тамилска + Tamilské + Tamil + Ταμίλ + Tamil + Tamoul + tamil + Tamil + Тамильская + Tamili + Tamilské + Tamil + тамил + Tamilsk + Tamil dili + Тамільська + Tamil + 泰米尔 + + + + + tel + Telugu + Telugu + Telugu + Telugu + Telugu + Τελούγκου + Telugu + Telugu + telugu + Telugu + Телугу + Tegulu + Telugské + Telugu + телугу + Telugo + Telugu dili + Телугу + Telugu + 泰卢固 + + + + + urd + Urdu + Ούρντου + Urdu + Urdu + Урду + Urudu + Ur-du + + + + + + + ba + Bih + Bih + Bih + Bos + Bih + Bih + Bih + Bih + Bih + Босн + Bih + Bih + бос + Bih + Bih + Босн + Bih + Bih + Bosnia and Herzegovina + Bosnia and Herzegovina + Bosnië-Hercegovina + Босния и Герцеговина + Bosiniya na Herizegovina + Bosnia và Herzegovina + + + + + + br + Bra + Bra + Bra + Bra + Bra + Bra + Bra + Bra + Bra + Браз + Bra + Bra + бра + Bra + Bra + Браз + Bra + Bra + Brazil + Brazil + Brazilië + Бразилия + Burezile + Bra-zil + + + + + nodeadkeys + Eliminate dead keys + Elimineer dooie sleutels + Ölü düymələri sayma + Изключи специалните клавиши (dead keys) + Eliminovat mrtvé klávesy + Slå døde taster fra + Χωρίς νεκρά πλήκτρα + Eliminate dead keys + éliminer des clés mortes + Halott billentyűk tiltása + Dode toetsen niet doen + Исключить специальные клавиши (dead keys) + Utubuto + Eliminovať mrtvé kláves + Elemino pulsantët e vdekur + Уклони акценте + Eliminera stumma tangenter + Ölü tuşları normal yapar + Вилучити спеціальні клавіші (dead keys) + Phím chết loại trừ + 除去死键 + + + + + + + bg + Bgr + Bgr + Bgr + Bul + Bgr + Bgr + Bgr + Bgr + Bgr + Болг + Bgr + Bgr + буг + Bgr + Bgr + Болг + Bgr + Bgr + Bulgaria + Bulgaria + Bulgarije + Болгария + Buligariya + Bun-ga-ri + + + + + phonetic + Phonetic + Foneties + Fonetik + Fonetické + Fonetisk + Φωνητικά + Phonetic + Phonétique + fonetikus + Fonetisch + Фонетическая + Nyigamvugo: + Fonetické + Phonetic + фонетски + Fonetisk + Fonetik + Фонетична + Ngữ âm + Phonetic + + + + + + + mm + Mmr + Mmr + Mmr + Mmr + Mmr + Mmr + Mmr + Mmr + Mmr + Мьянм + Mmr + Mmr + ммр + Mmr + Mmr + Мьянм + Mmr + Mmr + Myanmar + Myanmar + Myanmar + Мьянмар + Myanmar + Myanmar + + + + + + ca + Can + Kan + Kan + Kan + Can + Καν + Can + Can + Can + Can + Кан + Can + Can + кан + Can + Kan + Кан + Can + Can + Canada + Canada + Canada + Канада + Kanada + Ca-na-da + + + + + fr-dvorak + French Dvorak + French Dvorak + Frans-Dvorak + Французская Dvorak + Pháp Dvorak + + + + + fr-legacy + French (legacy) + French (legacy) + Frans (oud) + Французская (унаследованная) + Pháp (di sản) + + + + + multi + Multilingual + Multilingual + Meertalig + Многоязычная + Đa ngôn ngữ + + + + + multi-2gr + Multilingual, second part + Multilingual, second part + Meertalig, tweede deel + Многоязычная, вторая часть + ISEGONDA + Đa ngôn ngữ, phần hai + + + + + ike + Inuktitut + Inuktitut + İnuktitut + ескимоска + Inuitské + Inuktitut + Inuktitut + Inuktitut + inuktitut + Inuktitut + Иннуитская + Ikinukititutu + Inuktitutské + Inuktitut + инуктитут + Inuktitut + Inuktitut + Іннуітська + Inuktitut + 因纽特 + + + + + + + hr + Hrv + Hrv + Xrv + Chor + Hrv + Hrv + Hrv + Hrv + Hrv + Хорв + Chor + Hrv + хрв + Hrv + Hrv + Хорв + Hrv + Hrv + Croatia + Croatia + Kroatië + Хорватия + Korowatiya + Croátia + + + + + us + US keyboard with Croatian letters + US keyboard with Croatian letters + Amerikaans toetsenbord met Kroatische letters + Клавиатура США с хорватскими буквами + Mwandikisho Na: + Bàn phím Mỹ với các chữ cái Croát-chi-a + + + + + + + cz + Cze + Cze + Çex + чехшка + Čes + Tje + Τσε + Cze + Cze + Cze + Cze + Чех + Čes + Cze + чеш + Cze + Çek + Чес + Séc + Cze + Czechia + Czechia + Tsjechië + Чехия + Czechia + + + + + bksl + With <\|> key + + + + + qwerty + qwerty + qwerty + qwerty + чешка (qwerty) + qwerty + qwerty + qwerty + qwerty + qwerty + qwerty + qwerty + qwerty + qwerty + qwerty + qwerty + qwerty + qwerty + qwerty + qwerty + + + + + qwerty_bksl + qwerty, extended Backslash + qwerty, extended Backslash + qwerty, uitgebreide backslash + qwerty, расширенные функции Backslash + Byongerewe... + qwerty, Gạch ngược mở rộng + + + + + + + dk + Dnk + Dnk + Dnk + Dán + Dnk + Dnk + Dnk + Dnk + Dnk + Дат + Dán + Dnk + дан + Dnk + Dnk + Дат + Dnk + Dnk + Denmark + Denmark + Denemarken + Дания + Danimarike + Đan Mạch + + + + + nodeadkeys + Eliminate dead keys + Elimineer dooie sleutels + Ölü düymələri sayma + Изключи специалните клавиши (dead keys) + Eliminovat mrtvé klávesy + Slå døde taster fra + Χωρίς νεκρά πλήκτρα + Eliminate dead keys + éliminer des clés mortes + Halott billentyűk tiltása + Dode toetsen niet doen + Исключить специальные клавиши (dead keys) + Utubuto + Eliminovať mrtvé kláves + Elemino pulsantët e vdekur + Уклони акценте + Eliminera stumma tangenter + Ölü tuşları normal yapar + Вилучити спеціальні клавіші (dead keys) + Phím chết loại trừ + 除去死键 + + + + + + + nl + Nld + Nld + Nld + Nld + Hollandsk + Nld + Nld + Nld + Nld + Флам + Nld + Nld + хол + Nld + Hol + Флам + Nld + Nld + Netherlands + Netherlands + Nederland + Нидерланды + Nederilande + Hà Lan + + + + + + bt + Bhu + Бут + Bhutan + Бутан + + + + + ee + Est + Est + Est + Est + Est + Est + Est + Est + Est + Эст + Est + Est + ест + Est + Est + Ест + Est + Est + Estonia + Estonia + Estland + Эстония + Esitoniya + Ex-tô-nhia + + + + + nodeadkeys + Eliminate dead keys + Elimineer dooie sleutels + Ölü düymələri sayma + Изключи специалните клавиши (dead keys) + Eliminovat mrtvé klávesy + Slå døde taster fra + Χωρίς νεκρά πλήκτρα + Eliminate dead keys + éliminer des clés mortes + Halott billentyűk tiltása + Dode toetsen niet doen + Исключить специальные клавиши (dead keys) + Utubuto + Eliminovať mrtvé kláves + Elemino pulsantët e vdekur + Уклони акценте + Eliminera stumma tangenter + Ölü tuşları normal yapar + Вилучити спеціальні клавіші (dead keys) + Phím chết loại trừ + 除去死键 + + + + + + + ir + Irn + Irn + İrn + Irn + Irn + Irn + Irn + Irn + Irn + Перс + Irn + Irn + ирн + Irn + Irn + Перс + Irn + Irn + Iran + Iran + Iran + Иран + Iran + + + + + + fo + Fao + Fao + Fao + Fao + Fær + Fao + Fao + Fao + Fao + Фар + Fao + Fao + фар + Fao + Fao + Фарер + Fao + Fao + Faroe Islands + Faroe Islands + Faröer-eilanden + Острова Фаро + Ibirwa bya Farowe + Faroe Islands + + + + + nodeadkeys + Eliminate dead keys + Elimineer dooie sleutels + Ölü düymələri sayma + Изключи специалните клавиши (dead keys) + Eliminovat mrtvé klávesy + Slå døde taster fra + Χωρίς νεκρά πλήκτρα + Eliminate dead keys + éliminer des clés mortes + Halott billentyűk tiltása + Dode toetsen niet doen + Исключить специальные клавиши (dead keys) + Utubuto + Eliminovať mrtvé kláves + Elemino pulsantët e vdekur + Уклони акценте + Eliminera stumma tangenter + Ölü tuşları normal yapar + Вилучити спеціальні клавіші (dead keys) + Phím chết loại trừ + 除去死键 + + + + + + + fi + Fin + Fin + Fin + Fin + Fin + Φιν + Fin + Fin + Fin + Fin + Фин + Fín + Fin + фин + Fin + Fin + Фін + Fin + Fin + Finland + Finland + Finland + Финляндия + Finilande + Phần Lan + + + + + nodeadkeys + Eliminate dead keys + Elimineer dooie sleutels + Ölü düymələri sayma + Изключи специалните клавиши (dead keys) + Eliminovat mrtvé klávesy + Slå døde taster fra + Χωρίς νεκρά πλήκτρα + Eliminate dead keys + éliminer des clés mortes + Halott billentyűk tiltása + Dode toetsen niet doen + Исключить специальные клавиши (dead keys) + Utubuto + Eliminovať mrtvé kláves + Elemino pulsantët e vdekur + Уклони акценте + Eliminera stumma tangenter + Ölü tuşları normal yapar + Вилучити спеціальні клавіші (dead keys) + Phím chết loại trừ + 除去死键 + + + + + smi + Northern Saami + Northern Saami + Noord-Lapland + Северная Саамская + Sami y'Amajyaruguru + Bắc Saami + + + + + + + fr + Fra + Fra + Fra + Fra + Fra + Γαλ + Fra + Fra + Fra + Fra + Фр + Fra + Fra + фра + Fra + Fra + Фра + Fra + Fra + France + France + Frankrijk + Франция + Ubufaransa + Pháp + + + + + nodeadkeys + Eliminate dead keys + Elimineer dooie sleutels + Ölü düymələri sayma + Изключи специалните клавиши (dead keys) + Eliminovat mrtvé klávesy + Slå døde taster fra + Χωρίς νεκρά πλήκτρα + Eliminate dead keys + éliminer des clés mortes + Halott billentyűk tiltása + Dode toetsen niet doen + Исключить специальные клавиши (dead keys) + Utubuto + Eliminovať mrtvé kláves + Elemino pulsantët e vdekur + Уклони акценте + Eliminera stumma tangenter + Ölü tuşları normal yapar + Вилучити спеціальні клавіші (dead keys) + Phím chết loại trừ + 除去死键 + + + + + sundeadkeys + Sun dead keys + Sun (dooie sleutels) + Sun ölü düymələr + Изключи специалните клавиши (dead keys) + Mrtvé klávesy Sun + Sun døde taster + Sun dead keys + clés mortes Sun + Sun halott billentyűk + Sun dode toetsen + Специальные клавиши (dead keys) Sun + Utubuto + Mŕtve klávesy Sun + Pulsantë të vdekur Sun + Sun-ови акценти + Sun stumma tangenter + Sun ölü tuşlar + Спеціальні клавіші (dead keys) Sun + Phím chết Sun + Sun 死键 + + + + + latin9 + Alternative + Ενναλακτικό + Alternative + Alternatief + Альтернативная + Tương đương + + + + + latin9_nodeadkeys + Alternative, eliminate dead keys + Alternative, eliminate dead keys + Alternatief, zonder dode toetsen + Альтернативная, исключить специальные клавиши (dead keys) + Utubuto + Tương đương, phím chết loại trừ + + + + + latin9_sundeadkeys + Alternative, Sun dead keys + Alternative, Sun dead keys + Alternatief, Sun-dode toetsen + Альтернативная, специальные клавиши (dead keys) Sun + Utubuto + Tương đương, phím chết Sun + + + + + dvorak + Dvorak + Dvorak + Dvorak + Дворак + Dvorak + Dvorak + Dvorak + Dvorak + Dvorak-féle + Dvorak + Дворак + Dvorak + Dvorak + дворак + Dvorak + Dvorak + Дворак + Dvorak + Dvorak + + + + + + + ge + Geo + Geo + Gür + Gru + Geo + Geo + Geo + Geo + Geo + Груз + Gru + Geo + гру + Geo + Geo + Груз + Geo + Geo + Georgia + Georgia + Georgië + Грузия + Geworigiya + Georgia + + + + + ru + Russian + Russies + Rusca + руска + Ruské + Russisk + Ρωσσικά + Russian + Russe + orosz + Russisch + Русская + Ikirusiya + Ruské + Rusisht + руски + Rysk + Rusça + Російська + Nga + 俄语 + + + + + + + de + Deu + Deu + Deu + Něm + Tys + Deu + Deu + Deu + Deu + Нем + Nem + Deu + нем + Deu + Alm + Нім + Deu + Deu + Germany + Germany + Duitsland + Германия + Ubudage + Đức + + + + + deadacute + Dead acute + Dooie akuutaksent + Dead acute + Mrtvá čárka + Død accent + Dead acute + clé morte d'accent aigu + Halott vessző (´) ékezet + Dood acutus + Спец. символ Dead acute + Mŕtva čiarka + Fund kritik + Акутски акценат + Stum akut accent + Ölü acute (´) + Спец. символ Dead acute + Chết sâu + Dead acute + + + + + deadgraveacute + Dead grave acute + Dooie gravisaksent + Dead grave acute + Mrtvá opačná čárka + Død accent grave + Dead grave acute + clé morte d'accent grave + Halott grave (`) ékezet + Dood gravis-acutus + Спец. символ Dead grave acute + Mŕtva opačná čiarka + Fund kritik serioz + Гравис акутски акценат + Stum grav och akut accent + Ölü grave acute (`) + Спец. символ Dead grave acute + Chết non sâu + Dead grave acute + + + + + nodeadkeys + Eliminate dead keys + Elimineer dooie sleutels + Ölü düymələri sayma + Изключи специалните клавиши (dead keys) + Eliminovat mrtvé klávesy + Slå døde taster fra + Χωρίς νεκρά πλήκτρα + Eliminate dead keys + éliminer des clés mortes + Halott billentyűk tiltása + Dode toetsen niet doen + Исключить специальные клавиши (dead keys) + Utubuto + Eliminovať mrtvé kláves + Elemino pulsantët e vdekur + Уклони акценте + Eliminera stumma tangenter + Ölü tuşları normal yapar + Вилучити спеціальні клавіші (dead keys) + Phím chết loại trừ + 除去死键 + + + + + ro + Romanian keyboard with German letters + Romanian keyboard with German letters + Roemeens toetsenbord met Duitse letters + Румынская клавиатура с немецкими буквами + Mwandikisho Na: + Bàn phím Rô-ma-ni với các chữ cái Đức + + + + + ro_nodeadkeys + Romanian keyboard with German letters, eliminate dead keys + Romanian keyboard with German letters, eliminate dead keys + Roemeens toetsenbord met Duitse letters, zonder dode toetsen + Mwandikisho Na: Utubuto + Bàn phím Rô-ma-ni với các chữ cái Đức, các phím chết loại trừ + + + + + dvorak + Dvorak + Dvorak + Dvorak + Дворак + Dvorak + Dvorak + Dvorak + Dvorak + Dvorak-féle + Dvorak + Дворак + Dvorak + Dvorak + дворак + Dvorak + Dvorak + Дворак + Dvorak + Dvorak + + + + + + + gr + Gre + Ελλ + Gre + Grieks + Гре + Gre + Greece + Greece + Griekenland + Греция + Ikigereki + Hy Lạp + + + + + extended + Extended + Uitgebreide + Uzadılmış + Rozšířené + Udvidet + Extended + Étendue + Kibővített + Uitgebreid + Расширенная + cya/byagutse + Rozšírené + E zgjeruar + Проширено + Utökad + Gelişmiş + Розширена + Mở rộng + 扩展 + + + + + nodeadkeys + Eliminate dead keys + Elimineer dooie sleutels + Ölü düymələri sayma + Изключи специалните клавиши (dead keys) + Eliminovat mrtvé klávesy + Slå døde taster fra + Χωρίς νεκρά πλήκτρα + Eliminate dead keys + éliminer des clés mortes + Halott billentyűk tiltása + Dode toetsen niet doen + Исключить специальные клавиши (dead keys) + Utubuto + Eliminovať mrtvé kláves + Elemino pulsantët e vdekur + Уклони акценте + Eliminera stumma tangenter + Ölü tuşları normal yapar + Вилучити спеціальні клавіші (dead keys) + Phím chết loại trừ + 除去死键 + + + + + polytonic + Polytonic + Polytonic + Politonik + Polytónické + Polytonisk + Πολυτονικά + Polytonic + Polytonique + Polytonic + Polytonisch + Полифоническая + Polytónické + Polytonic + вишезвучни + Polytonic + Politonik + Поліфонічна + Nhiều âm + Polytonic + + + + + + + hu + Hun + Hun + Mac + Maď + Ung + Hun + Hun + Hun + Hun + Венг + Maď + Hun + мађ + Hun + Mcr + Уго + Hun + Hun + Hungary + Hungary + Hongarije + Венгрия + Hongiriya + Hungary + + + + + standard + Standard + Standaard + Standart + Standardní + Standard + Εξ ορισμού + Standard + Standard + Szabványos + Standaard + Стандартная + gisanzwe/kimenyerewe + Štandardné + Standart + стандардна + Standard + Standart + Стандартна + Tiêu chuẩn + 标准 + + + + + nodeadkeys + Eliminate dead keys + Elimineer dooie sleutels + Ölü düymələri sayma + Изключи специалните клавиши (dead keys) + Eliminovat mrtvé klávesy + Slå døde taster fra + Χωρίς νεκρά πλήκτρα + Eliminate dead keys + éliminer des clés mortes + Halott billentyűk tiltása + Dode toetsen niet doen + Исключить специальные клавиши (dead keys) + Utubuto + Eliminovať mrtvé kláves + Elemino pulsantët e vdekur + Уклони акценте + Eliminera stumma tangenter + Ölü tuşları normal yapar + Вилучити спеціальні клавіші (dead keys) + Phím chết loại trừ + 除去死键 + + + + + qwerty + qwerty + qwerty + qwerty + чешка (qwerty) + qwerty + qwerty + qwerty + qwerty + qwerty + qwerty + qwerty + qwerty + qwerty + qwerty + qwerty + qwerty + qwerty + qwerty + qwerty + + + + + + + 101_qwertz_comma_dead + 101/qwertz/comma/Dead keys + 101/qwertz/comma/Dead keys + 101/qwertz/komma/Dode toetsen + pc101, qwertz, запятая, специальные клавиши (dead keys) + Akitso Utubuto + 101/qwertz/dấu phẩy/Phím chết + + + + + 101_qwertz_comma_nodead + 101/qwertz/comma/Eliminate dead keys + 101/qwertz/comma/Eliminate dead keys + 101/qwertz/komma/Dode toetsen verwijderen + pc101, qwertz, запятая, исключить специальные клавиши (dead keys) + Akitso Utubuto + 101/qwertz/dấu phẩy/Phím chết loại trừ + + + + + 101_qwertz_dot_dead + 101/qwertz/dot/Dead keys + 101/qwertz/dot/Dead keys + 101/qwertz/punt/Dode toetsen + pc101, qwertz, точка, специальные клавиши (dead keys) + Akadomo Utubuto + 101/qwertz/dấu chấm/Phím chết + + + + + 101_qwertz_dot_nodead + 101/qwertz/dot/Eliminate dead keys + 101/qwertz/dot/Eliminate dead keys + 101/qwertz/punt/Dode toetsen verwijderen + pc101, qwertz, точка, исключить специальные клавиши (dead keys) + Akadomo Utubuto + 101/qwertz/dấu chấm/Phím chết loại trừ + + + + + 101_qwerty_comma_dead + 101/qwerty/comma/Dead keys + 101/qwerty/comma/Dead keys + 101/qwerty/komma/Dode toetsen + pc101, qwerty, запятая, специальные клавиши (dead keys) + Akitso Utubuto + 101/qwerty/dấu phẩy/Phím chết + + + + + 101_qwerty_comma_nodead + 101/qwerty/comma/Eliminate dead keys + 101/qwerty/comma/Eliminate dead keys + 101/qwerty/komma/Dode toetsen verwijderen + pc101, qwerty, запятая, исключить специальные клавиши (dead keys) + Akitso Utubuto + 101/qwerty/dấu phẩy/Phím chết loại trừ + + + + + 101_qwerty_dot_dead + 101/qwerty/dot/Dead keys + 101/qwerty/dot/Dead keys + 101/qwerty/punt/Dode toetsen + pc101, qwerty, точка, исключить специальные клавиши (dead keys) + Akadomo Utubuto + 101/qwerty/dấu chấm/Phím chết + + + + + 101_qwerty_dot_nodead + 101/qwerty/dot/Eliminate dead keys + 101/qwerty/dot/Eliminate dead keys + 101/qwerty/punt/Dode toetsen verwijderen + pc101, qwerty, точка, исключить специальные клавиши (dead keys) + Akadomo Utubuto + 101/qwerty/dấu chấm/Phím chết loại trừ + + + + + + + + 102_qwertz_comma_dead + 102/qwertz/comma/Dead keys + 102/qwertz/comma/Dead keys + 102/qwertz/komma/Dode toetsen + pc102, qwertz, запятая, специальные клавиши (dead keys) + Akitso Utubuto + 102/qwertz/dấu phẩy/Phím chết + + + + + 102_qwertz_comma_nodead + 102/qwertz/comma/Eliminate dead keys + 102/qwertz/comma/Eliminate dead keys + 102/qwertz/komma/Dode toetsen verwijderen + pc102, qwertz, запятая, исключить специальные клавиши (dead keys) + Akitso Utubuto + 102/qwertz/dấu phẩy/Phím chết loại trừ + + + + + 102_qwertz_dot_dead + 102/qwertz/dot/Dead keys + 102/qwertz/dot/Dead keys + 102/qwertz/punt/Dode toetsen + pc102, qwertz, точка, специальные клавиши (dead keys) + Akadomo Utubuto + 102/qwertz/dấu chấm/Phím chết + + + + + 102_qwertz_dot_nodead + 102/qwertz/dot/Eliminate dead keys + 102/qwertz/dot/Eliminate dead keys + 102/qwertz/punt/Dode toetsen verwijderen + pc102, qwertz, точка, исключить специальные клавиши (dead keys) + Akadomo Utubuto + 102/qwertz/dấu chấm/Phím chết loại trừ + + + + + 102_qwerty_comma_dead + 102/qwerty/comma/Dead keys + 102/qwerty/comma/Dead keys + 102/qwerty/komma/Dode toetsen + pc102, qwerty, запятая, специальные клавиши (dead keys) + Akitso Utubuto + 102/qwerty/dấu phẩy/Phím chết + + + + + 102_qwerty_comma_nodead + 102/qwerty/comma/Eliminate dead keys + 102/qwerty/comma/Eliminate dead keys + 102/qwerty/komma/Dode toetsen verwijderen + pc102, qwerty, запятая, исключить специальные клавиши (dead keys) + Akitso Utubuto + 102/qwerty/dấu phẩy/Phím chết loại trừ + + + + + 102_qwerty_dot_dead + 102/qwerty/dot/Dead keys + 102/qwerty/dot/Dead keys + 102/qwerty/punt/Dode toetsen + pc102, qwerty, точка, специальные клавиши (dead keys) + Akadomo Utubuto + 102/qwerty/dấu chấm/Phím chết + + + + + 102_qwerty_dot_nodead + 102/qwerty/dot/Eliminate dead keys + 102/qwerty/dot/Eliminate dead keys + 102/qwerty/punt/Dode toetsen verwijderen + pc102, qwerty, точка, исключить специальные клавиши (dead keys) + Akadomo Utubuto + 102/qwerty/dấu chấm/Phím chết loại trừ + + + + + + + + + is + Isl + Isl + İsl + Isl + Isl + Isl + Isl + Isl + Isl + Исл + Isl + Isl + исл + Isl + Izl + Ісл + Isl + Isl + Iceland + Iceland + IJsland + Исландия + Isilande + Iceland + + + + + Sundeadkeys + Sun dead keys + Sun (dooie sleutels) + Sun ölü düymələr + Изключи специалните клавиши (dead keys) + Mrtvé klávesy Sun + Sun døde taster + Sun dead keys + clés mortes Sun + Sun halott billentyűk + Sun dode toetsen + Специальные клавиши (dead keys) Sun + Utubuto + Mŕtve klávesy Sun + Pulsantë të vdekur Sun + Sun-ови акценти + Sun stumma tangenter + Sun ölü tuşlar + Спеціальні клавіші (dead keys) Sun + Phím chết Sun + Sun 死键 + + + + + nodeadkeys + Eliminate dead keys + Elimineer dooie sleutels + Ölü düymələri sayma + Изключи специалните клавиши (dead keys) + Eliminovat mrtvé klávesy + Slå døde taster fra + Χωρίς νεκρά πλήκτρα + Eliminate dead keys + éliminer des clés mortes + Halott billentyűk tiltása + Dode toetsen niet doen + Исключить специальные клавиши (dead keys) + Utubuto + Eliminovať mrtvé kláves + Elemino pulsantët e vdekur + Уклони акценте + Eliminera stumma tangenter + Ölü tuşları normal yapar + Вилучити спеціальні клавіші (dead keys) + Phím chết loại trừ + 除去死键 + + + + + + + il + Isr + Isr + İsr + Izr + Isr + Isr + Isr + Isr + Isr + Ивр + Izr + Isr + изр + Isr + İbr + Івр + Isr + Isr + Israel + Israel + Israël + Израиль + Isirayeli + Israel + + + + + lyx + lyx + lyx + lyx + lyx + lyx + lyx + lyx + lyx + lyx + lyx + lyx + lyx + lyx + lyx + lyx + lyx + lyx + lyx + + + + + si1452 + si1452 + si1452 + si1452 + si1452 + si1452 + si1452 + si1452 + si1452 + si1452 + si1452 + si1452 + si1452 + si1452 + si1452 + si1452 + si1452 + si1452 + si1452 + + + + + phonetic + Phonetic + Foneties + Fonetik + Fonetické + Fonetisk + Φωνητικά + Phonetic + Phonétique + fonetikus + Fonetisch + Фонетическая + Nyigamvugo: + Fonetické + Phonetic + фонетски + Fonetisk + Fonetik + Фонетична + Ngữ âm + Phonetic + + + + + + + it + Ita + Ita + İta + Ita + Ita + Ita + Ita + Ita + Ita + Ит + Tal + Ita + ита + Ita + İta + Іта + Ita + Ita + Italy + Italy + Italië + Италия + Ubutariyani + Italy + + + + + nodeadkeys + Eliminate dead keys + Elimineer dooie sleutels + Ölü düymələri sayma + Изключи специалните клавиши (dead keys) + Eliminovat mrtvé klávesy + Slå døde taster fra + Χωρίς νεκρά πλήκτρα + Eliminate dead keys + éliminer des clés mortes + Halott billentyűk tiltása + Dode toetsen niet doen + Исключить специальные клавиши (dead keys) + Utubuto + Eliminovať mrtvé kláves + Elemino pulsantët e vdekur + Уклони акценте + Eliminera stumma tangenter + Ölü tuşları normal yapar + Вилучити спеціальні клавіші (dead keys) + Phím chết loại trừ + 除去死键 + + + + + + + jp + Jpn + Jpn + Ypn + Jap + Jpn + Ιαπ + Jpn + Jpn + Jpn + Jpn + Яп + Jpn + Jpn + јпн + Jpn + Jpn + Япо + Jpn + Jpn + Japan + Japan + Japan + Япония + Ubuyapani + Nhật Bản + + + + + + kg + Kyr + Kyr + Syr + Кыр + Kyr + Kyrgyzstan + Kyrgyzstan + Kirgizië + Кыргызстан + Kirigizasitani + Kyrgyzstan + + + + + + la + Lao + Lao + Mal + Лао + Lawo + Lào + Laos + Laos + Laos + Лаос + Lào + + + + + + latam + LAm + LAm + LAm + LAm + LAm + LAm + LAm + LAm + LAm + ЛатАм + LAm + LAm + ЈАм + LAm + LAm + ЛатАм + LAm + LAm + Latin American + Latin American + Latijns-Amerika + Латиноамериканская + La tinh Mỹ + + + + + nodeadkeys + Eliminate dead keys + Elimineer dooie sleutels + Ölü düymələri sayma + Изключи специалните клавиши (dead keys) + Eliminovat mrtvé klávesy + Slå døde taster fra + Χωρίς νεκρά πλήκτρα + Eliminate dead keys + éliminer des clés mortes + Halott billentyűk tiltása + Dode toetsen niet doen + Исключить специальные клавиши (dead keys) + Utubuto + Eliminovať mrtvé kláves + Elemino pulsantët e vdekur + Уклони акценте + Eliminera stumma tangenter + Ölü tuşları normal yapar + Вилучити спеціальні клавіші (dead keys) + Phím chết loại trừ + 除去死键 + + + + + sundeadkeys + Sun dead keys + Sun (dooie sleutels) + Sun ölü düymələr + Изключи специалните клавиши (dead keys) + Mrtvé klávesy Sun + Sun døde taster + Sun dead keys + clés mortes Sun + Sun halott billentyűk + Sun dode toetsen + Специальные клавиши (dead keys) Sun + Utubuto + Mŕtve klávesy Sun + Pulsantë të vdekur Sun + Sun-ови акценти + Sun stumma tangenter + Sun ölü tuşlar + Спеціальні клавіші (dead keys) Sun + Phím chết Sun + Sun 死键 + + + + + + + lt + Ltu + Ltu + Ltu + Lit + Lit + Ltu + Ltu + Ltu + Ltu + Лит + Lit + Ltu + лтв + Ltu + Ltu + Лит + Ltu + Ltu + Lithuania + Lithuania + Litouwen + Литва + Lituwaniya + Li-tu-a-ni + + + + + std + "Standard" + "Εξ ορισμού" + "Standard" + "Standaard" + "Стандартная" + "Bisanzwe- + "Tiêu chuẩn" + + + + + us + US keyboard with Lithuanian letters + US keyboard with Lithuanian letters + Amerikaans toetsenbord met Litouwse letters + Клавиатура США с литовскими буквами + Mwandikisho Na: + Bàn phím Mỹ với các chữ cái Li-tu-a-nia + + + + + + + lv + Lva + Lva + Lva + Lot + Let + Lva + Lva + Lva + Lva + Латв + Lot + Lva + лет + Lva + Lva + Латв + Lva + Lva + Latvia + Latvia + Letland + Латвия + Lativiya + Lát-via + + + + + apostrophe + Apostrophe (') variant + Apostrophe (') variant + Вариант с апострофом (') + Phương án hô ngữ (') + + + + + tilde + Tilde (~) variant + Tilde (~) variant + Вариант с тильдой (~) + Phương án dấu sóng (~) + + + + + fkey + F-letter (F) variant + F-letter (F) variant + F-letter (F) variant + Вариант с F + Ibaruwa... + Phương án chữ cái F (F) + + + + + + + mao + Mao + Mao + Mal + Мао + Mao + Maori + Maori + Maori + Маори + Ikimawori + Maori + + + + + + mkd + Mkd + Mkd + Mkd + Mak + Mkd + Mkd + Mkd + Mkd + Mkd + Мак + Mak + Mkd + мак + Mkd + Mkd + Мкд + Mkd + Mkd + Macedonian + Masedonies + Makedonca + македонска + Makedonské + Makedonsk + Φυρομιακά + Macedonian + Macédonien + macedón + Macedonisch + Македонская + Nyamasedoniya + Macedónske + Maqedonisht + македонски + Makedonsk + Makedonya dili + Македонська + Mác-kê-đô-nhia + 马其顿 + + + + + nodeadkeys + Eliminate dead keys + Elimineer dooie sleutels + Ölü düymələri sayma + Изключи специалните клавиши (dead keys) + Eliminovat mrtvé klávesy + Slå døde taster fra + Χωρίς νεκρά πλήκτρα + Eliminate dead keys + éliminer des clés mortes + Halott billentyűk tiltása + Dode toetsen niet doen + Исключить специальные клавиши (dead keys) + Utubuto + Eliminovať mrtvé kláves + Elemino pulsantët e vdekur + Уклони акценте + Eliminera stumma tangenter + Ölü tuşları normal yapar + Вилучити спеціальні клавіші (dead keys) + Phím chết loại trừ + 除去死键 + + + + + + + mt + Mlt + Mlt + Mlt + Mlt + Mlt + Mlt + Mlt + Mlt + Mlt + Мальт + Mlt + Mlt + мал + Mlt + Mlt + Мальт + Mlt + Mlt + Malta + Malta + Malta + Мальта + Malita + Malta + + + + + us + US keyboard with Maltian letters + US keyboard with Maltian letters + Amerikaans toetsenbord met Roemeense letters + Клавиатура США с мальтийскими буквами + Mwandikisho Na: + Bàn phím Mỹ với các chữ cái Mal-chi-a + + + + + + + mn + Mng + Mng + Mng + Mng + Mng + Mng + Mng + Mng + Mng + Монг + Mng + Mng + мон + Mng + Moğ + Монг + Mng + Mng + Mongolia + Mongolia + Mongolië + Монголия + Mongoliya + Mông cổ + + + + + + no + Nor + Nor + Nor + Nor + Nor + Nor + Nor + Nor + Nor + Нор + Nor + Nor + нор + Nor + Nor + Нор + Nor + Nor + Norway + Norway + Noorwegen + Норвегия + Noruveje + Na Uy + + + + + nodeadkeys + Eliminate dead keys + Elimineer dooie sleutels + Ölü düymələri sayma + Изключи специалните клавиши (dead keys) + Eliminovat mrtvé klávesy + Slå døde taster fra + Χωρίς νεκρά πλήκτρα + Eliminate dead keys + éliminer des clés mortes + Halott billentyűk tiltása + Dode toetsen niet doen + Исключить специальные клавиши (dead keys) + Utubuto + Eliminovať mrtvé kláves + Elemino pulsantët e vdekur + Уклони акценте + Eliminera stumma tangenter + Ölü tuşları normal yapar + Вилучити спеціальні клавіші (dead keys) + Phím chết loại trừ + 除去死键 + + + + + dvorak + Dvorak + Dvorak + Dvorak + Дворак + Dvorak + Dvorak + Dvorak + Dvorak + Dvorak-féle + Dvorak + Дворак + Dvorak + Dvorak + дворак + Dvorak + Dvorak + Дворак + Dvorak + Dvorak + + + + + smi + Northern Saami + Northern Saami + Noord-Lapland + Северная Саамская + Sami y'Amajyaruguru + Bắc Saami + + + + + smi_nodeadkeys + Northern Saami, eliminate dead keys + Северная Саамская, исключить специальные клавиши (dead keys) + + + + + + + pl + Pol + Pol + Pol + полска + Pol + Pol + Πολ + Pol + Pol + Pol + Pol + Польск + Pol + Pol + пољ + Pol + Pol + Пол + Pol + Pol + Poland + Poland + Polen + Польша + Polonye + Phần Lan + + + + + qwertz + qwertz + qwertz + qwertz + qwertz + qwertz + + + + + dvorak + Dvorak + Dvorak + Dvorak + Дворак + Dvorak + Dvorak + Dvorak + Dvorak + Dvorak-féle + Dvorak + Дворак + Dvorak + Dvorak + дворак + Dvorak + Dvorak + Дворак + Dvorak + Dvorak + + + + + dvorak_quotes + Dvorak, Polish quotes on quotemark key + Dvorak, Polish quotes on quotemark key + Dvorak, польские кавычки на клавишах с кавычками + ku Urufunguzo + Dvorak, dấu ngoặc Polish trên phím đánh dấu ngoặc + + + + + dvorak_altquotes + Dvorak, Polish quotes on key "1/!" + Dvorak, Polish quotes on key "1/!" + Dvorak, польские кавычки на клавише "1/!" + ku Urufunguzo 1. + Dvorak, dấu ngoặc Polish trên phím "1/!" + + + + + + + pt + Prt + Prt + Prt + Prt + Prt + Prt + Prt + Prt + Prt + Порт + Prt + Prt + прт + Prt + Prt + Порт + Prt + Prt + Portugal + Portugal + Portugal + Португалия + Porutigali + Bồ Đào Nha + + + + + nodeadkeys + Eliminate dead keys + Elimineer dooie sleutels + Ölü düymələri sayma + Изключи специалните клавиши (dead keys) + Eliminovat mrtvé klávesy + Slå døde taster fra + Χωρίς νεκρά πλήκτρα + Eliminate dead keys + éliminer des clés mortes + Halott billentyűk tiltása + Dode toetsen niet doen + Исключить специальные клавиши (dead keys) + Utubuto + Eliminovať mrtvé kláves + Elemino pulsantët e vdekur + Уклони акценте + Eliminera stumma tangenter + Ölü tuşları normal yapar + Вилучити спеціальні клавіші (dead keys) + Phím chết loại trừ + 除去死键 + + + + + sundeadkeys + Sun dead keys + Sun (dooie sleutels) + Sun ölü düymələr + Изключи специалните клавиши (dead keys) + Mrtvé klávesy Sun + Sun døde taster + Sun dead keys + clés mortes Sun + Sun halott billentyűk + Sun dode toetsen + Специальные клавиши (dead keys) Sun + Utubuto + Mŕtve klávesy Sun + Pulsantë të vdekur Sun + Sun-ови акценти + Sun stumma tangenter + Sun ölü tuşlar + Спеціальні клавіші (dead keys) Sun + Phím chết Sun + Sun 死键 + + + + + + + ro + Rou + Rou + Rou + Rum + Rum + Rou + Rou + Rou + Rou + Рум + Rum + Rou + рум + Rou + Rou + Рум + Rou + Rou + Romania + Romania + Roemenië + Румыния + Romaniya + Rô-ma-ni + + + + + us + US keyboard with Romanian letters + VSA sleutelbord met Romeense letters + Roman hərfli ABŞ klaviaturası + Americká klávesnice s rumunskými písmeny + US-tastatur med rumænske bogstaver + US keyboard with Romanian letters + clavier US avec lettres roumaines + US billentyűzet román betűkkel + Amerikaans toetsenbord met Roemeense letters + Клавиатура США с румынскими буквами + Mwandikisho Na: + Americká klávesnica s rumunskými písmami + Tastierë US me gërma Romane + Америчка тастатура са румунским словима + USA-tangentbord med rumänska bokstäver + Romen harfleriyle amerikan klavyesi + Клавіатура США з румунськими буквами + Bàn phím Mỹ với các chữ cái Ro-ma-ni + 美国键盘，带罗马尼亚字符 + + + + + de + Romanian keyboard with German letters + Romanian keyboard with German letters + Roemeens toetsenbord met Duitse letters + Румынская клавиатура с немецкими буквами + Mwandikisho Na: + Bàn phím Rô-ma-ni với các chữ cái Đức + + + + + + + ru + Rus + Rus + Rus + Rus + Rus + Ρωσ + Rus + Rus + Rus + Rus + Рус + Rus + Rus + рус + Rus + Rus + Рос + Nga + Rus + Russia + Russia + Rusland + Россия + Nga + + + + + phonetic + Phonetic + Foneties + Fonetik + Fonetické + Fonetisk + Φωνητικά + Phonetic + Phonétique + fonetikus + Fonetisch + Фонетическая + Nyigamvugo: + Fonetické + Phonetic + фонетски + Fonetisk + Fonetik + Фонетична + Ngữ âm + Phonetic + + + + + typewriter + Typewriter + Печатная машинка + + + + + winkeys + Winkeys + Winkeys + Winkeys + Winkeys + Win-taster + Winkeys + Winkeys + Winkeys + Win-toetsen + Клавиатура Windows + Win klávesy + Winkeys + Windows тастери + Wintangenter + Win tuşları + Розкладка Windows + Phím Win + Winkeys + + + + + + + srp + Srp + Srp + Syr + Срб + Srp + Serbian + Serbies + Servcə + сръбска + Srbské + Serbisk + Serbian + Serbe + szerb + Servisch + Сербская + Ikinyaseribiya + Srbské + Sërbisht + српски + Serbisk + Sırpça + Сербська + Séc-bia + 塞尔维亚 + + + + + yz + Z and ZHE swapped + Z and ZHE swapped + Z en ZHE verwisseld + З и Ж переставлены + Na + Đổi chỗ Z và ZHE + + + + + latin + Latin + Latyns + Latın + латвийска + Latinské + Latin + Latin + Latin + latin + Latijn + Латинская + Ikiratini + Latinské + Latinishte + латинични + Latin + Latin + Латинська + La tinh + 拉丁 + + + + + latinunicode + Latin Unicode + Latin Unicode + Latijns-Unicode + Латинская Unicode + La tinh Unicode + + + + + latinyz + Latin qwerty + Latin qwerty + Latijns qwerty + Латинская qwerty + La tinh qwerty + + + + + latinunicodeyz + Latin Unicode qwerty + Latin Unicode qwerty + Latijns-Unicode qwerty + Латинская Unicode qwerty + La tinh Unicode qwerty + + + + + alternatequotes + With guillemots + With guillemots + С guillemots + Với chim guillemot + + + + + latinalternatequotes + Latin with guillemots + Latin with guillemots + Латинская с guillemots + Na: + La tinh với chim guillemot + + + + + + + si + Svn + Svn + Svn + Svn + Svn + Svn + Svn + Svn + Svn + Cловен + Svn + Svn + сло + Svn + Svn + Словен + Svn + Svn + Slovenia + Slovenia + Slovenië + Словения + Siloveniya + Slovenia + + + + + + sk + Svk + Svk + Svk + словашка + Svk + Svk + Svk + Svk + Svk + Svk + Слов + Svk + Svk + слк + Svk + Svk + Слов + Svk + Svk + Slovakia + Slovakia + Slowakije + Словакия + Silovakiya + Slovakia + + + + + bksl + Extended Backslash + Extended Backslash + Uitgebreide backslash + Расширенные функции Backslash + Gạch chéo ngược Mở rộng + + + + + qwerty + qwerty + qwerty + qwerty + чешка (qwerty) + qwerty + qwerty + qwerty + qwerty + qwerty + qwerty + qwerty + qwerty + qwerty + qwerty + qwerty + qwerty + qwerty + qwerty + qwerty + + + + + qwerty_bksl + qwerty, extended Backslash + qwerty, extended Backslash + qwerty, uitgebreide backslash + qwerty, расширенные функции Backslash + Byongerewe... + qwerty, Gạch ngược mở rộng + + + + + + + es + Esp + Esp + İsp + Špa + Esp + Esp + Esp + Esp + Esp + Исп + Špa + Esp + шпа + Esp + İsp + Ісп + Esp + Esp + Spain + Spain + Spanje + Испания + Esipanye + Tây Ban Nha + + + + + nodeadkeys + Eliminate dead keys + Elimineer dooie sleutels + Ölü düymələri sayma + Изключи специалните клавиши (dead keys) + Eliminovat mrtvé klávesy + Slå døde taster fra + Χωρίς νεκρά πλήκτρα + Eliminate dead keys + éliminer des clés mortes + Halott billentyűk tiltása + Dode toetsen niet doen + Исключить специальные клавиши (dead keys) + Utubuto + Eliminovať mrtvé kláves + Elemino pulsantët e vdekur + Уклони акценте + Eliminera stumma tangenter + Ölü tuşları normal yapar + Вилучити спеціальні клавіші (dead keys) + Phím chết loại trừ + 除去死键 + + + + + sundeadkeys + Sun dead keys + Sun (dooie sleutels) + Sun ölü düymələr + Изключи специалните клавиши (dead keys) + Mrtvé klávesy Sun + Sun døde taster + Sun dead keys + clés mortes Sun + Sun halott billentyűk + Sun dode toetsen + Специальные клавиши (dead keys) Sun + Utubuto + Mŕtve klávesy Sun + Pulsantë të vdekur Sun + Sun-ови акценти + Sun stumma tangenter + Sun ölü tuşlar + Спеціальні клавіші (dead keys) Sun + Phím chết Sun + Sun 死键 + + + + + dvorak + Dvorak + Dvorak + Dvorak + Дворак + Dvorak + Dvorak + Dvorak + Dvorak + Dvorak-féle + Dvorak + Дворак + Dvorak + Dvorak + дворак + Dvorak + Dvorak + Дворак + Dvorak + Dvorak + + + + + + + se + Swe + Swe + Swe + Švé + Sve + Σου + Swe + Sué + Swe + Swe + Швед + Swe + Swe + шве + Swe + İsve + Швед + Swe + Swe + Sweden + Sweden + Zweden + Швеция + Suwede + Thụy Điển + + + + + nodeadkeys + Eliminate dead keys + Elimineer dooie sleutels + Ölü düymələri sayma + Изключи специалните клавиши (dead keys) + Eliminovat mrtvé klávesy + Slå døde taster fra + Χωρίς νεκρά πλήκτρα + Eliminate dead keys + éliminer des clés mortes + Halott billentyűk tiltása + Dode toetsen niet doen + Исключить специальные клавиши (dead keys) + Utubuto + Eliminovať mrtvé kláves + Elemino pulsantët e vdekur + Уклони акценте + Eliminera stumma tangenter + Ölü tuşları normal yapar + Вилучити спеціальні клавіші (dead keys) + Phím chết loại trừ + 除去死键 + + + + + dvorak + Dvorak + Dvorak + Dvorak + Дворак + Dvorak + Dvorak + Dvorak + Dvorak + Dvorak-féle + Dvorak + Дворак + Dvorak + Dvorak + дворак + Dvorak + Dvorak + Дворак + Dvorak + Dvorak + + + + + rus + Russian phonetic + Русская фонетическая + + + + + rus_nodeadkeys + Russian phonetic, eliminate dead keys + Русская фонетическая, исключить специальные клавиши (dead keys) + + + + + smi + Northern Saami + Northern Saami + Noord-Lapland + Северная Саамская + Sami y'Amajyaruguru + Bắc Saami + + + + + + + ch + Che + Che + Cze + Швейц. + Che + Switzerland + Switzerland + Zwitserland + Швейцария + Ubusuwisi + Thụy Sĩ + + + + + de_nodeadkeys + German, eliminate dead keys + German, eliminate dead keys + Duits, zonder dode toetsen + Немецкая, исключить специальные клавиши (dead keys) + Utubuto + Đức, phím chết loại trừ + + + + + de_sundeadkeys + German, Sun dead keys + German, Sun dead keys + Duits, Sun-dode toetsen + Немецкая, специальные клавиши (dead keys) Sun + Utubuto + Đức, phím chết Sun + + + + + fr + French + Frans + Fransızca + френска + Francouzské + Fransk + Γαλλικά + French + Français + francia + Frans + Французская + Igifaransa + Francúzske + Frengjisht + француски + Fransk + Fransızca + Французька + Pháp + 法语 + + + + + fr_nodeadkeys + French, eliminate dead keys + French, eliminate dead keys + Frans, zonder dode toetsen + Французская, исключить специальные клавиши (dead keys) + Utubuto + Pháp, phím chết loại trừ + + + + + fr_sundeadkeys + French, Sun dead keys + French, Sun dead keys + Frans, Sun-dode toetsen + Французская, специальные клавиши (dead keys) Sun + Utubuto + Pháp, phím chết Sun + + + + + + + sy + Syr + Syr + Syr + сръбска + Syr + Syr + Συρ + Syr + Syr + Syr + Syr + Асс + Syr + Syr + сир + Syr + Sur + Сир + Syr + Syr + Syria + Сирийская + + + + + syc + Syriac + Siries + Syriac + сръбска + Syrské + Syrisk + Συριακά + Syriac + Syriac + szír + Syrisch + Сирийская + Syriac + Syrské + Siriane + сиријски + Syrisk + Suriye dili + Сирійська + Syriac + 叙利亚 + + + + + syc_phonetic + Syriac phonetic + Сирийская фонетическая + + + + + + + tj + Tjk + Tjk + Tac + таджикска + Tjk + Tjk + Tjk + Tjk + Tjk + Tjk + Тадж + Tjk + Tjk + тџк + Tjk + Tck + Тдж + Tjk + Tjk + Tajikistan + Tajikistan + Tadzjikistan + Таджикистан + Tajikisitani + Ta-zi-kix-tan + + + + + + lk + SrL + ШрЛ + Sri Lanka + Шри Ланка + + + + + tam_unicode + Tamil Unicode + Тамильская Unicode + + + + + tam_TAB + Tamil TAB Typewriter + Тамильская "Печатная машинка" TAB + + + + + tam_TSCII + Tamil TSCII Typewriter + Тамильская "Печатная машинка" TSCII + + + + + sin_phonetic + Sinhala phonetic + Синхала фонетическая + + + + + + + th + Tha + Tha + Tay + тайландска + Tha + Tha + Tha + Tha + Tha + Tha + Таи + Tha + Tha + тај + Tha + Tha + Тай + Tha + Tha + Thailand + Thailand + Thaïland + Таиланд + Tayilande + Thái Lan + + + + + tis + TIS-820.2538 + TIS-820.2538 + TIS-820.2538 + TIS-820.2538 + TIS-820.2538 + + + + + pat + Pattachote + Pattachote + Pattachote + Паттачот + + + + + + + tr + Tur + Tur + Tür + Tur + Tyr + Του + Tur + Tur + Tur + Tur + Тур + Tur + Tur + тур + Tur + Trk + Тур + Tur + Tur + Turkish + + + + + f + (F) + (F) + (F) + (F) + (F) + + + + + alt + Alt-Q + Alt-Q + Alt-Q + Alt-Q + Alt-Q + Alt-Q + + + + + + + ua + Ukr + Ukr + Ukr + Ukr + Ukr + Ουκ + Ukr + Ukr + Ukr + Ukr + Укр + Ukr + Ukr + укр + Ukr + Ukr + Укр + Ukr + Ukr + Ukraine + Ukraine + Oekraïne + Украина + Ikerene + U-cra-in + + + + + phonetic + Phonetic + Foneties + Fonetik + Fonetické + Fonetisk + Φωνητικά + Phonetic + Phonétique + fonetikus + Fonetisch + Фонетическая + Nyigamvugo: + Fonetické + Phonetic + фонетски + Fonetisk + Fonetik + Фонетична + Ngữ âm + Phonetic + + + + + typewriter + Typewriter + Печатная машинка + + + + + winkeys + Winkeys + Winkeys + Winkeys + Winkeys + Win-taster + Winkeys + Winkeys + Winkeys + Win-toetsen + Клавиатура Windows + Win klávesy + Winkeys + Windows тастери + Wintangenter + Win tuşları + Розкладка Windows + Phím Win + Winkeys + + + + + rstu + + Standard RSTU + Стандартная RSTU + + + + + rstu_ru + + Standard RSTU on Russian layout + Стандартная RSTU, русская + + + + + + + gb + GBr + GBr + GBr + VBr + GBr + GBr + GBr + GBr + GBr + Брит + VBr + GBr + вбр + GBr + GBr + Брит + GBr + GBr + United Kingdom + Vereenigde Koninkryk + Birləşik Krallıq + британска + Spojené království + United Kingdom + Ηνωμένο Βασίλειο + United Kingdom + Royaume Uni + brit angol + Verenigd Koninkrijk + Английская (Великобритания) + Ubwongereza (UK) + Spojené kráľovstvo + Mbretëria e Bashkuar + Велика Британија + Storbritannien + İngiltere + Англійська (Великобританія) + Vương Quốc Anh + 英国 + + + + + intl + International (with dead keys) + International (with dead keys) + Internationaal (met dode toetsen) + Международная, со спец. клавишами (dead keys) + Na: Utubuto + Quốc tế (với phím chết) + + + + + dvorak + Dvorak + Dvorak + Dvorak + Дворак + Dvorak + Dvorak + Dvorak + Dvorak + Dvorak-féle + Dvorak + Дворак + Dvorak + Dvorak + дворак + Dvorak + Dvorak + Дворак + Dvorak + Dvorak + + + + + + + uz + Uzb + Uzb + Özb + Uzb + Uzb + Uzb + Uzb + Uzb + Uzb + Узб + Uzb + Uzb + узб + Uzb + Özb + Узб + Uzb + Uzb + Uzbekistan + Uzbekistan + Oezbekistan + Узбекистан + Uzubekisitani + Uz-bê-kix-tan + + + + + + vn + Vnm + Vnm + Vye + Vnm + Vnm + Vnm + Vnm + Vnm + Vnm + Вьет + Vnm + Vnm + вјт + Vnm + Vnm + Вьет + Vnm + Vnm + Vietnam + Vietnam + Viëtnam + Вьетнам + Viyetinamu + Việt nam + + + + + + nec_vndr/jp + Jpn + Jpn + Ypn + Jap + Jpn + Ιαπ + Jpn + Jpn + Jpn + Jpn + Яп + Jpn + Jpn + јпн + Jpn + Jpn + Япо + Jpn + Jpn + PC-98xx Series + PC-98xx Reeks + PC-98xx Seriyaları + PC-98xx серии + PC-98xx řada + PC-98xx-serien + PC-98xx Series + PC-98xx Series + PC-98xx Series + PC-98xx serie + PC-98xx + Séria PC-98xx + Seritë PC-98xx + PC-98xx серија + PC-98xx-serien + PC-98xx Serisi + Моделі PC-98xx + Sê ri PC-98xx + PC-98xx 系列 + + + + + + ie + Irl + Irl + İrl + Irs + Irl + Irl + Irl + Irl + Irl + Ирл + Irs + Irl + ирс + Irl + İrl + Ірл + Irl + Irl + Ireland + Ireland + Ierland + Ирландия + Irilande + Ireland + + + + + CloGaelach + CloGaelach + CloGaelach + CloGaelach + CloGaelach + CloGaelach + CloGaelach + CloGaelach + CloGaelach + CloGaelach + CloGaelach + CloGaelach + CloGaelach + CloGaelach + CloGaelach + CloGaelach + CloGaelach + CloGaelach + CloGaelach + + + + + UnicodeExpert + UnicodeExpert + UnicodeExpert + UnicodeExpert + UnicodeExpert + UnicodeExpert + UnicodeExpert + UnicodeExpert + UnicodeExpert + UnicodeExpert + UnicodeExpert + UnicodeExpert + EkspertUnicode + Стручна за Уникод + UnicodeExpert + Unicode Uzman + UnicodeExpert + Unicode Chuyên môn + UnicodeExpert + + + + + ogam + Ogham + Ogham + Ogham + Oghamské + Ogham + Ogham + Ogham + ogham + Oghamees + Огхам (древнеирланская) + Ogham + Oghamské + Ogham + огам + Ogham + Ogham + Огхам (давньоірландська) + Ogham + 欧甘 + + + + + ogam_is434 + Ogham IS434 + Огхам IS434 + + + + + + + pk + Pak + Пак + Pakistan + Пакистан + + + + + + + + + + grp + Group Shift/Lock behavior + Groep Shift/Lock gedrag + Shift/Lock Qrupu Davranışı + Функции на клавишите Shift/Lock + Chování skupiny Shift/Lock + Gruppeskift/-lås-opførsel + Group Shift/Lock behaviour + comportement de groupe Shitf/Lock + Csoportváltás és -zárolás + Groepgedrag Shift/Lock + Функция смены раскладки + imyitwarire + Zoskupiť chovanie Shift/Lock + Sjellja e grupit Shift/Lock + Понашање измене/избора групе + Gruppbeteende för Skift/Lock + Shift/Lock Grubu davranışı + Функція зміни групи + Đặc điểm của nhóm Shift/Lock + 组切换/锁定行为 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + lv3 + Third level choosers + Derdevlak kiesers + Üçüncü səviyyə seçicilər + Избор на третата група + Výběr třetí úrovně + Tredje niveaus vælgere + Third level choosers + sélecteur du 3e niveau + Harmadik szintű választók + Derde niveau kiezers + Выбор 3-го уровня + urwego + Výber tretej úrovne + Zgjedhësit e nivelit të tretë + Избор трећег нивоа + Tredjenivåsväljare + 3. seviye seçiciler + Вибір 3-го рівня + Trình chọn ngôn ngữ thứ ba + 第三级选择 + + + + + + + + + + + + + + + ctrl + Control key position + Положение клавиши Control + + + + + + + + + + + grp_led + Use keyboard LED to show alternative group. + Use keyboard LED to show alternative group. + Toetsenbord LED gebruiken om alternatieve groep te tonen. + Использование клавиатурных индикаторов для отображения доп. групп. + Mwandikisho Kuri Garagaza Itsinda + Sử dụng đèn bàn phím để chỉ ra ngôn ngữ tương đương. + + + + + + + + + caps + CapsLock key behavior + CapsLock-sleutelgedrag + CapsLock düyməsinin davranışı + Поведение на Caps Lock + Chování klávesy CapsLock + Opførsel for Caps Lock-tast + Συμπεριφορά πλήκτρου Κλείδωμα Κεφαλαίων + Caps Lock key behaviour + comportement de la clé Capslock + A Caps Lock használati módja + CapsLock-toets gedrag + Клавиша Caps Lock + Urufunguzo imyitwarire + Chovanie klávesa Caps Lock + Sjellja e pulsantit CapsLock + Понашање Caps Lock тастера + Beteende för Caps Lock-tangenten + CapsLock tuşunun davranışı + Клавіша Caps Lock + Đặc điểm của phím CapsLock + CapsLock 键行为 + + + + + + + + + + + + + altwin + Alt/Win key behavior + Alt/Win-sleutel gedrag + Alt/Win düyməsinin davranışları + Функцията на Alt/Win + Chování klávesy Alt/Win + Alt/Win-tasteopførsel + Συμπεριφορά πλήκτρου Alt/Win + Alt/Win key behaviour + comportement de la clé Alt/Win + Az Alt/Win billentyűk viselkedése + Alt/Win-toets gedrag + Клавиши Alt/Win + Urufunguzo imyitwarire + Chovanie klávesu Alt/Win + Sjellja e pulsantit Alt/Win + Понашање Alt/Win тастера + Alt/Win-tangentbeteende + Alt/Win tuşu davranışı + Клавіші Alt/Win + Các làm việc của Alt/Win + Alt/Win 键行为 + + + + + + + + + + + + + Compose key + Compose key position + Положение клавиши Control + + + + + + + + + compat + Miscellaneous compatibility options + Verskeie versoenbaarheid-opsies + Müxtəlif yetişmə qabiliyyəti seçimləri + Dodatečné volby pro kompatibilitu + Diverse kompatibilitetsvalg + Miscellaneous compatibility options + diverses options de compatibilité + Egyéb kompatibilitási beállítások + Overige compatibiliteitsopties + Разные параметры совместимости + Bihuye neza Amahitamo + Dodatočné voľby pre kompatibilitu + Opcione të ndryshme kompatibiliteti + Разне могућности за сагласност + Diverse kompatibilitetsalternativ + Çeşitli uyumluluk seçenekleri + Різна параметри сумісності + Tùy chọn tương thích khác + 其它兼容选项 + + + + + + + + eurosign + Adding the EuroSign to certain keys + Adding the Euro sign to certain keys + Euro-teken aan bepaalde toetsen toevoegen + Добавить знак Евро к некоторым клавишам + i Kuri Utubuto + Thêm ký hiệu đồng Euro vào các phím chắc chắn + + + + + + + + diff -ruN /opt/SUNWut.orig/lib/xkb/semantics/basic /opt/SUNWut/lib/xkb/semantics/basic --- /opt/SUNWut.orig/lib/xkb/semantics/basic 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/semantics/basic 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,7 @@ +// $Xorg: basic,v 1.3 2000/08/17 19:54:42 cpqbld Exp $ +default xkb_semantics "basic" { + +xkb_types { include "basic" }; +xkb_compatibility { include "basic" }; + +}; diff -ruN /opt/SUNWut.orig/lib/xkb/semantics/complete /opt/SUNWut/lib/xkb/semantics/complete --- /opt/SUNWut.orig/lib/xkb/semantics/complete 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/semantics/complete 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,7 @@ +// $Xorg: complete,v 1.3 2000/08/17 19:54:42 cpqbld Exp $ +default xkb_semantics "complete" { + +xkb_types { include "complete" }; +xkb_compatibility { include "complete" }; + +}; diff -ruN /opt/SUNWut.orig/lib/xkb/semantics/default /opt/SUNWut/lib/xkb/semantics/default --- /opt/SUNWut.orig/lib/xkb/semantics/default 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/semantics/default 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,7 @@ +// $Xorg: default,v 1.3 2000/08/17 19:54:42 cpqbld Exp $ +default xkb_semantics "default" { + +xkb_types { include "default" }; +xkb_compatibility { include "default" }; + +}; diff -ruN /opt/SUNWut.orig/lib/xkb/semantics/xtest /opt/SUNWut/lib/xkb/semantics/xtest --- /opt/SUNWut.orig/lib/xkb/semantics/xtest 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/semantics/xtest 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,7 @@ +// $Xorg: xtest,v 1.3 2000/08/17 19:54:42 cpqbld Exp $ +default xkb_semantics "xtest" { + +xkb_types { include "basic" }; +xkb_compatibility { include "xtest" }; + +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/README /opt/SUNWut/lib/xkb/symbols/README --- /opt/SUNWut.orig/lib/xkb/symbols/README 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/README 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,8 @@ +The symbols component of a keyboard mapping specifies primarily the symbols +bound to each keyboard key. It affects the symbols symbolic name, a key symbol +mapping for each key, the keyboard modifier mapping, and the symbolic names for +the keyboard symbol groups. + + + +/* $XFree86$ */ diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/al /opt/SUNWut/lib/xkb/symbols/al --- /opt/SUNWut.orig/lib/xkb/symbols/al 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/al 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,108 @@ + +// albanian keyboard layout +// done by Pablo Saratxaga +// +// it seems the grave on AltGr-7 is not a dead key, I put a dead_grave +// in AltGr-Shift-7 for convenience + +partial hidden alphanumeric_keys modifier_keys +xkb_symbols "basic" { + + name[Group1]= "Albanian"; + key { [ Escape ] }; + + // Alphanumeric section + key { [ backslash, bar ] }; + key { [ 1, exclam ], + [ asciitilde, dead_tilde ] }; + key { [ 2, quotedbl ], + [ dead_caron ] }; + key { [ 3, numbersign ], + [ dead_circumflex ] }; + key { [ 4, dollar ], + [ dead_breve ] }; + key { [ 5, percent ], + [ dead_abovering ] }; + key { [ 6, asciicircum ], + [ dead_ogonek ] }; + key { [ 7, ampersand ], + [ grave, dead_grave ] }; + key { [ 8, asterisk ], + [ dead_abovedot ] }; + key { [ 9, parenleft ], + [ dead_acute ] }; + key { [ 0, parenright ], + [ dead_doubleacute ] }; + key { [ minus, underscore ], + [ dead_diaeresis ] }; + key { [ equal, plus ], + [ dead_cedilla ] }; + + key { [ q, Q ], + [ backslash ] }; + key { [ w, W ], + [ bar ] }; + key { [ e, E ], + [ EuroSign ] }; + key { [ r, R ] }; + key { [ t, T ] }; + key { [ z, Z ] }; + key { [ u, U ] }; + key { [ i, I ] }; + key { [ o, O ] }; + key { [ p, P ] }; + key { [ ccedilla, Ccedilla ], + [ division ] }; + key { [ at, apostrophe ], + [ multiply ] }; + + key { [ a, A ] }; + key { [ s, S ], + [ dstroke ] }; + key { [ d, D ], + [ Dstroke ] }; + key { [ f, F ], + [ bracketleft ] }; + key { [ g, G ], + [ bracketright ] }; + key { [ h, H ] }; + key { [ j, J ] }; + key { [ k, K ], + [ lstroke ] }; + key { [ l, L ], + [ Lstroke ] }; + key { [ ediaeresis, Ediaeresis ], + [ dollar ] }; + key { [ bracketleft, braceleft ], + [ ssharp ] }; + key { [ bracketright, braceright ], + [ currency ] }; + + key { [ y, Y ] }; + key { [ x, X ] }; + key { [ c, C ] }; + key { [ v, V ], + [ at ] }; + key { [ b, B ], + [ braceleft ] }; + key { [ n, N ], + [ braceright ] }; + key { [ m, M ], + [ section ] }; + key { [ comma, semicolon ], + [ less ] }; + key { [ period, colon ], + [ greater ] }; + key { [ slash, question ] }; + + key { [ Mode_switch ] }; + key { [ Multi_key ] }; + // End alphanumeric section + + // begin modifier mappings + modifier_map Shift { Shift_L }; + modifier_map Lock { Caps_Lock }; + modifier_map Control{ Control_L }; + +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/altwin /opt/SUNWut/lib/xkb/symbols/altwin --- /opt/SUNWut.orig/lib/xkb/symbols/altwin 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/altwin 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,59 @@ +// $XdotOrg: xc/programs/xkbcomp/symbols/altwin,v 1.5 2003/12/03 14:09:08 pascal Exp $ +// $XFree86: xc/programs/xkbcomp/symbols/altwin,v 1.4 2001/10/10 19:18:32 herrb Exp $ + +partial modifier_keys +xkb_symbols "meta_alt" { + key { [ Alt_L, Meta_L ] }; + key { [ Alt_R, Meta_R ] }; + modifier_map Mod1 { Alt_L, Alt_R, Meta_L, Meta_R }; +// modifier_map Mod4 {}; +}; + +partial modifier_keys +xkb_symbols "meta_win" { + key { [ Alt_L, Alt_L ] }; + key { [ Alt_R, Alt_R ] }; + key { [ Meta_L ] }; + key { [ Meta_R ] }; + modifier_map Mod1 { Alt_L, Alt_R }; + modifier_map Mod4 { , Meta_L, Meta_R }; +}; + +partial modifier_keys +xkb_symbols "left_meta_win" { + key { [ Alt_L, Alt_L ] }; + key { [ Meta_L ] }; + modifier_map Mod1 { Alt_L }; + modifier_map Mod4 { , Meta_L }; +}; + +partial modifier_keys +xkb_symbols "super_win" { + key { [ Super_L ] }; + key { [ Super_R ] }; + modifier_map Mod4 { Super_L, Super_R }; +}; + +partial modifier_keys +xkb_symbols "hyper_win" { + key { [ Hyper_L ] }; + key { [ Hyper_R ] }; + modifier_map Mod4 { Hyper_L, Hyper_R }; +}; + +// Use Menu for the menu key +partial modifier_keys +xkb_symbols "menu" { + key { [ Menu ] }; +}; + +// Layout for Tux key caps with additional right Alt key +partial modifier_keys +xkb_symbols "alt_super_win" { + key { [ Alt_L, Meta_L ] }; + key { [ Alt_R, Meta_R ] }; + key { [ Super_L ] }; + key { [ Super_R ] }; + modifier_map Mod1 { Alt_L, Alt_R, Meta_L, Meta_R }; + modifier_map Mod4 { Super_L, Super_R }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/am /opt/SUNWut/lib/xkb/symbols/am --- /opt/SUNWut.orig/lib/xkb/symbols/am 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/am 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,183 @@ +// $XConsortium: am /main/3 1997/12/18 12:40:12 rch $ +// +// $XFree86: xc/programs/xkbcomp/symbols/am,v 1.4 2002/06/04 22:50:58 dawes Exp $ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + // Describes the differences between a very simple en_US + // keyboard and a very simple Armenian keyboard + + name[Group1]= "US/ASCII"; + name[Group2]= "Armenian"; + + // Alphanumeric section + key { [ ], [ 0x100055d, 0x100055c ] }; + key { [ ], [ question, 0x100058a ] }; + key { [ ], [ guillemotright, guillemotleft ] }; + + key { [ ], [ 0x1000586, 0x1000556 ] }; + key { [ ], [ 0x1000571, 0x1000541 ] }; + key { [ ], [ 0x1002013, 0x1002014 ] }; + key { [ ], [ comma, dollar ] }; + key { [ ], [ 0x1000589, 0x1002026 ] }; + key { [ ], [ 0x100055e, percent ] }; + key { [ ], [ period, 0x1000587 ] }; + key { [ ], [ 0x100055b, 0x10002bc ] }; + key { [ ], [ parenright, parenleft ] }; + key { [ ], [ 0x1000585, 0x1000555 ] }; + key { [ ], [ 0x1000567, 0x1000537 ] }; + key { [ ], [ 0x1000572, 0x1000542 ] }; + + key { [ ], [ 0x1000573, 0x1000543 ] }; + key { [ ], [ 0x1000583, 0x1000553 ] }; + key { [ ], [ 0x1000562, 0x1000532 ] }; + key { [ ], [ 0x100057d, 0x100054d ] }; + key { [ ], [ 0x1000574, 0x1000544 ] }; + key { [ ], [ 0x1000578, 0x1000548 ] }; + key { [ ], [ 0x1000582, 0x1000552 ] }; + key { [ ], [ 0x100056f, 0x100053f ] }; + key { [ ], [ 0x1000568, 0x1000538 ] }; + key { [ ], [ 0x1000569, 0x1000539 ] }; + key { [ ], [ 0x100056e, 0x100053e ] }; + key { [ ], [ 0x1000581, 0x1000551 ] }; + + key { [ ], [ 0x100057b, 0x100054b ] }; + key { [ ], [ 0x100057e, 0x100054e ] }; + key { [ ], [ 0x1000563, 0x1000533 ] }; + key { [ ], [ 0x1000565, 0x1000535 ] }; + key { [ ], [ 0x1000561, 0x1000531 ] }; + key { [ ], [ 0x1000576, 0x1000546 ] }; + key { [ ], [ 0x100056b, 0x100053b ] }; + key { [ ], [ 0x100057f, 0x100054f ] }; + key { [ ], [ 0x1000570, 0x1000540 ] }; + key { [ ], [ 0x100057a, 0x100054a ] }; + key { [ ], [ 0x1000580, 0x1000550 ] }; + + key { [ ], [ 0x100056a, 0x100053a ] }; + key { [ ], [ 0x1000564, 0x1000534 ] }; + key { [ ], [ 0x1000579, 0x1000549 ] }; + key { [ ], [ 0x1000575, 0x1000545 ] }; + key { [ ], [ 0x1000566, 0x1000536 ] }; + key { [ ], [ 0x100056c, 0x100053c ] }; + key { [ ], [ 0x1000584, 0x1000554 ] }; + key { [ ], [ 0x100056d, 0x100053d ] }; + key { [ ], [ 0x1000577, 0x1000547 ] }; + key { [ ], [ 0x100057c, 0x100054c ] }; + + // Begin modifier mappings + + modifier_map Shift { Shift_L }; + modifier_map Lock { Caps_Lock, ISO_Lock }; + modifier_map Control{ Control_L }; + modifier_map Mod3 { Mode_switch }; +}; + +xkb_symbols "old" { + include "am(basic)" + + key { [ ], [ 0x1002026, 0x1000587 ] }; + + key { [ ], [ 0x1000573, 0x1000543 ] }; + key { [ ], [ 0x100057b, 0x100054b ] }; + key { [ ], [ 0x100056a, 0x100053a ] }; + key { [ ], [ 0x1000571, 0x1000541 ] }; + key { [ ], [ 0x1000575, 0x1000545 ] }; + key { [ ], [ 0x100057c, 0x100054c ] }; + key { [ ], [ 0x1000580, 0x1000550 ] }; + key { [ ], [ 0x1000581, 0x1000551 ] }; + key { [ ], [ 0x1000567, 0x1000537 ] }; + key { [ ], [ 0x1000572, 0x1000542 ] }; + key { [ ], [ 0x1002013, 0x1002014 ] }; + key { [ ], [ parenleft, parenright] }; + + key { [ ], [ 0x1000583, 0x1000553 ] }; + key { [ ], [ 0x1000562, 0x1000532 ] }; + key { [ ], [ 0x100057d, 0x100054d ] }; + key { [ ], [ 0x1000574, 0x1000544 ] }; + key { [ ], [ 0x1000578, 0x1000548 ] }; + key { [ ], [ 0x1000582, 0x1000552 ] }; + key { [ ], [ 0x100056f, 0x100053f ] }; + key { [ ], [ 0x1000568, 0x1000538 ] }; + key { [ ], [ 0x1000569, 0x1000539 ] }; + key { [ ], [ 0x100056e, 0x100053e ] }; + key { [ ], [ 0x1000585, 0x1000555 ] }; + key { [ ], [ 0x1000586, 0x1000556 ] }; + + key { [ ], [ 0x100057e, 0x100054e ] }; + key { [ ], [ 0x1000563, 0x1000533 ] }; + key { [ ], [ 0x1000565, 0x1000535 ] }; + key { [ ], [ 0x1000561, 0x1000531 ] }; + key { [ ], [ 0x1000576, 0x1000546 ] }; + key { [ ], [ 0x100056b, 0x100053b ] }; + key { [ ], [ 0x100057f, 0x100054f ] }; + key { [ ], [ 0x1000570, 0x1000540 ] }; + key { [ ], [ 0x100057a, 0x100054a ] }; + key { [ ], [ 0x1000589, 0x100058a ] }; + key { [ ], [ 0x100055b, 0x10002bc ] }; + + key { [ ], [ 0x1000564, 0x1000534 ] }; + key { [ ], [ 0x1000579, 0x1000549 ] }; + key { [ ], [ 0x1000566, 0x1000536 ] }; + key { [ ], [ 0x100056c, 0x100053c ] }; + key { [ ], [ 0x1000584, 0x1000554 ] }; + key { [ ], [ 0x100056d, 0x100053d ] }; + key { [ ], [ 0x1000577, 0x1000547 ] }; + key { [ ], [ comma, guillemotleft ] }; + key { [ ], [ period, guillemotright ] }; + key { [ ], [ 0x100055e, 0x100055e ] }; + +}; + +xkb_symbols "phonetic" { + include "am(old)" + + key { [ ], [ 0x1000577, 0x1000547 ] }; + + key { [ ], [ 0x1000567, 0x1000537 ] }; + key { [ ], [ 0x1000569, 0x1000539 ] }; + key { [ ], [ 0x1000583, 0x1000553 ] }; + key { [ ], [ 0x100057b, 0x100054b ] }; + key { [ ], [ parenright, parenleft ] }; + key { [ ], [ 0x1000587, percent ] }; + key { [ ], [ 0x100057c, 0x100054c ] }; + key { [ ], [ 0x1000579, 0x1000549 ] }; + key { [ ], [ 0x1000573, 0x1000543 ] }; + key { [ ], [ 0x100056a, 0x100053a ] }; + + key { [ ], [ 0x1000584, 0x1000554 ] }; + key { [ ], [ 0x1000578, 0x1000548 ] }; + key { [ ], [ 0x1000565, 0x1000535 ] }; + key { [ ], [ 0x1000580, 0x1000550 ] }; + key { [ ], [ 0x100057f, 0x100054f ] }; + key { [ ], [ 0x1000568, 0x1000538 ] }; + key { [ ], [ 0x1000582, 0x1000552 ] }; + key { [ ], [ 0x100056b, 0x100053b ] }; + key { [ ], [ 0x1000585, 0x1000555 ] }; + key { [ ], [ 0x100057a, 0x100054a ] }; + key { [ ], [ 0x100056d, 0x100053d ] }; + key { [ ], [ 0x100056e, 0x100053e ] }; + + key { [ ], [ 0x1000561, 0x1000531 ] }; + key { [ ], [ 0x100057d, 0x100054d ] }; + key { [ ], [ 0x1000564, 0x1000534 ] }; + key { [ ], [ 0x1000586, 0x1000556 ] }; + key { [ ], [ 0x1000563, 0x1000533 ] }; + key { [ ], [ 0x1000570, 0x1000540 ] }; + key { [ ], [ 0x1000575, 0x1000545 ] }; + key { [ ], [ 0x100056f, 0x100053f ] }; + key { [ ], [ 0x100056c, 0x100053c ] }; + key { [ ], [ 0x1000589, 0x1002026 ] }; + + key { [ ], [ 0x1000566, 0x1000536 ] }; + key { [ ], [ 0x1000572, 0x1000542 ] }; + key { [ ], [ 0x1000581, 0x1000551 ] }; + key { [ ], [ 0x100057e, 0x100054e ] }; + key { [ ], [ 0x1000562, 0x1000532 ] }; + key { [ ], [ 0x1000576, 0x1000546 ] }; + key { [ ], [ 0x1000574, 0x1000544 ] }; + key { [ ], [ slash , 0x100055e ] }; + +}; + + diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/apple /opt/SUNWut/lib/xkb/symbols/apple --- /opt/SUNWut.orig/lib/xkb/symbols/apple 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/apple 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,60 @@ +// +// Keyboard modification for Apple keyboards +// +// $XFree86: $ + +partial default modifier_keys +xkb_symbols "extended" { + + key { [ KP_Equal ] }; + +// The key in the PC's Insert position is sometimes engraved Help (at least +// in Switzerland and Great Britain), with Insert sometimes above. But in the +// US and Canada, it remains Insert. So this should probably be an XkbOption, +// but I have to do more research. +// Perhaps Help should be the primary symbol with Insert in the 1st shift-level +// key { [ Help, Insert ] }; +// The keys next to F12, labeled F13, F14, & F15 generate codes that XFree86 +// claims not to generate. I think they should be equivalent to the PC keys +// Print Screen / SysRq, Scroll Lock, and Pause. Linux kernel bug? +// key { [ F13 ] }; // should be keycode 93 or +// key { [ F13 ] }; // should be keycode 118 +// key { [ F14 ] }; // should be keycode 123 or +// key { [ F14 ] }; // should be keycode 119 +// key { [ F15 ] }; // should be keycode 127 or +// key { [ F15 ] }; // should be keycode 120 +}; + +partial modifier_keys +xkb_symbols "laptop" { + + include "apple(extended)" + + // The real numlock key on the iBook (shared with F5) works internally to + // the keyboard. It illuminates the Num_Lock led and locks the fn-key to + // type only the keypad keys on the letter keys (U=4, I=5, O=6, P=*, etc.). + // The key in the Num_lock position is engraved with Clear. + override key { [ Clear ] }; + // The key engraved Delete sends BKSP. To get Delete, use Shift-Delete + override key { [ BackSpace, Delete ] }; + // These keyboards only generate a when pressing fn+Alt. This makes + // it impossible to get to the third shift level on keys that are on + // the fn-keypad, so use the Enter key (right of ) for Mode_switch, + // and use fn+Enter (Apple's code for Menu) for KP_Enter. + replace key { [ ISO_Level3_Shift ] }; + modifier_map Mod2 { ISO_Level3_Shift }; + // Linux kernel bug with Menu on macs means this doesn't work yet +// replace key { [ KP_Enter ] }; // should be keycode 117 +}; + +partial modifier_keys +xkb_symbols "laptop_bad_switch" { + include "apple(laptop)" + + // Before XFree86 4.3, most keymaps were configured to generate the + // third-level shift from the second group as opposed to the third-level + // of the first group. These keymaps require this mapping to work as + // expected. + replace key { [ Mode_switch ] }; + modifier_map Mod2 { Mode_switch }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/ar /opt/SUNWut/lib/xkb/symbols/ar --- /opt/SUNWut.orig/lib/xkb/symbols/ar 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/ar 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,146 @@ +// $XConsortium: th /main/3 1996/08/31 12:20:18 kaleb $ +// $XFree86: xc/programs/xkbcomp/symbols/ar,v 1.1 2001/11/21 22:28:52 dawes Exp $ +partial default alphanumeric_keys +xkb_symbols "basic" { + name[Group2]= "Arabic"; + +// NOTES: +// +// there is also combined shadda diacritis in AltGr position of simple +// diacritics fatha, fathatan, damma, dammatan, kasra and kasratan +// should a third state be added to Group2 ? +// + + key { [ ], [ Arabic_thal, Arabic_shadda ] }; + key { [ ], [ 1, exclam ] }; + key { [ ], [ 2, at ] }; + key { [ ], [ 3, numbersign ] }; + key { [ ], [ 4, dollar ] }; + key { [ ], [ 5, percent ] }; + key { [ ], [ 6, asciicircum ] }; + key { [ ], [ 7, ampersand ] }; + key { [ ], [ 8, asterisk ] }; + key { [ ], [ 9, parenleft ] }; + key { [ ], [ 0, parenright ] }; + key { [ ], [ minus, underscore ] }; + key { [ ], [ equal, plus ] }; + + key { [ ], [ Arabic_dad, Arabic_fatha ] }; + key { [ ], [ Arabic_sad, Arabic_fathatan ] }; + key { [ ], [ Arabic_theh, Arabic_damma ] }; + key { [ ], [ Arabic_qaf, Arabic_dammatan ] }; + key { [ ], [ Arabic_feh, 0x100fef9 ] }; + key { [ ], [ Arabic_ghain, Arabic_hamzaunderalef ] }; + key { [ ], [ Arabic_ain, grave ] }; + key { [ ], [ Arabic_ha, division ] }; + key { [ ], [ Arabic_khah, multiply ] }; + key { [ ], [ Arabic_hah, Arabic_semicolon ] }; + key { [ ], [ Arabic_jeem, braceleft ] }; + key { [ ], [ Arabic_dal, braceright ] }; + + key { [ ], [ Arabic_sheen, backslash ] }; + key { [ ], [ Arabic_seen, S ] }; + key { [ ], [ Arabic_yeh, bracketleft ] }; + key { [ ], [ Arabic_beh, bracketright ] }; + key { [ ], [ Arabic_lam, 0x100fef7 ] }; + key { [ ], [ Arabic_alef, Arabic_hamzaonalef ] }; + key { [ ], [ Arabic_teh, Arabic_tatweel ] }; + key { [ ], [ Arabic_noon, Arabic_comma ] }; + key { [ ], [ Arabic_meem, slash ] }; + key { [ ], [ Arabic_kaf, colon ] }; + key { [ ], [ Arabic_tah, quotedbl ] }; + key { [ ], [ less, greater ] }; + + key { [ ], [ bar, brokenbar ] }; + key { [ ], [Arabic_hamzaonyeh, asciitilde ] }; + key { [ ], [ Arabic_hamza, Arabic_sukun ] }; + key { [ ], [Arabic_hamzaonwaw, Arabic_kasra ] }; + key { [ ], [ Arabic_ra, Arabic_kasratan ] }; + key { [ ], [ 0x100fefb, 0x100fef5 ] }; + key { [ ], [Arabic_alefmaksura, Arabic_maddaonalef ] }; + key { [ ], [Arabic_tehmarbuta, apostrophe ] }; + key { [ ], [ Arabic_waw, comma ] }; + key { [ ], [ Arabic_zain, period ] }; + key { [ ], [ Arabic_zah, Arabic_question_mark ] }; + + // End alphanumeric section + + // Begin modifier mappings + + modifier_map Shift { Shift_L }; + modifier_map Lock { Caps_Lock, ISO_Lock }; + modifier_map Control{ Control_L }; + modifier_map Mod3 { Mode_switch }; +}; + +partial alphanumeric_keys +xkb_symbols "qwerty" { + include "ar(basic)" +}; + +partial alphanumeric_keys +xkb_symbols "azerty" { + include "ar(basic)" + + // the north african arabic keyboard differs from the middle east one + // by the numeric row; it follows French keyboard style + // + // PROBLEM: some chars are inaccessible: ! @ # $ % ^ * + // should they go elsewhere? replace " ' that are now in double ? + // also, dead_circumflex and dead_diaeresis from French keyboard + // as well as ugrave are missing, which questions the utility of the + // other accentuated latin letters. Maybe this is useful only with + // a French keyboard in Group1 ? Then, shouldn't Group1 be filled ? + + key { [ ], [ ampersand, 1 ] }; + key { [ ], [ eacute, 2 ] }; + key { [ ], [ quotedbl, 3 ] }; + key { [ ], [ apostrophe, 4 ] }; + key { [ ], [ parenleft, 5 ] }; + key { [ ], [ minus, 6 ] }; + key { [ ], [ egrave, 7 ] }; + key { [ ], [ underscore, 8 ] }; + key { [ ], [ ccedilla, 9 ] }; + key { [ ], [ agrave, 0 ] }; + key { [ ], [ parenright, degree ] }; +}; + +partial alphanumeric_keys +xkb_symbols "digits" { + include "ar(basic)" + + // use arabic script digits + + key { [ ], [ 0x1000661, exclam ] }; + key { [ ], [ 0x1000662, at ] }; + key { [ ], [ 0x1000663, numbersign ] }; + key { [ ], [ 0x1000664, dollar ] }; + key { [ ], [ 0x1000665, percent ] }; + key { [ ], [ 0x1000666, asciicircum ] }; + key { [ ], [ 0x1000667, ampersand ] }; + key { [ ], [ 0x1000668, asterisk ] }; + key { [ ], [ 0x1000669, parenleft ] }; + key { [ ], [ 0x1000660, parenright ] }; +}; + +partial alphanumeric_keys +xkb_symbols "qwerty_digits" { + include "ar(digits)" +}; + +partial alphanumeric_keys +xkb_symbols "azerty_digits" { + include "ar(azerty)" + + key { [ ], [ ampersand, 0x1000661 ] }; + key { [ ], [ eacute, 0x1000662 ] }; + key { [ ], [ quotedbl, 0x1000663 ] }; + key { [ ], [ apostrophe, 0x1000664 ] }; + key { [ ], [ parenleft, 0x1000665 ] }; + key { [ ], [ minus, 0x1000666 ] }; + key { [ ], [ egrave, 0x1000667 ] }; + key { [ ], [ underscore, 0x1000668 ] }; + key { [ ], [ ccedilla, 0x1000669 ] }; + key { [ ], [ agrave, 0x1000660 ] }; +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/az /opt/SUNWut/lib/xkb/symbols/az --- /opt/SUNWut.orig/lib/xkb/symbols/az 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/az 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,213 @@ +// $TOG: us /main/12 1997/06/14 06:37:07 kaleb $ + +// +// symbols definition for a very simple Azerbaidjani keyboard layout. + +// $XFree86: xc/programs/xkbcomp/symbols/az,v 1.1 2000/10/27 18:31:08 dawes Exp $ +// both latin and cyrillic layouts are available. +// the cyrillic layout uses the corresponding latin letters in group2; +// so it is useful to type in latin for people accostumed to cyrillic layout +// +// 2001 - Pablo Saratxaga + +partial hidden alphanumeric_keys modifier_keys +xkb_symbols "basic" { + + name[Group1]= "Azeri"; + + key {[ grave, asciitilde ], + [ dead_grave, dead_tilde ]}; + key {[ 1, exclam ]}; + key {[ 2, quotedbl ], + [ at ]}; + key {[ 3, apostrophe ], + [ numbersign ]}; + key {[ 4, semicolon ], + [ dollar ]}; + key {[ 5, percent ], + [ sterling ]}; + key {[ 6, colon ], + [ EuroSign, periodcentered ]}; + key {[ 7, question ], + [ ampersand ]}; + key {[ 8, asterisk ], + [ asciicircum, dead_circumflex ]}; + key {[ 9, parenleft ]}; + key {[ 0, parenright ], + [ section ]}; + key {[ minus, underscore ], + [ hyphen, emdash ]}; + key {[ equal, plus ]}; + + key {[ q, Q ]}; + key {[ udiaeresis, Udiaeresis ], + [ w, W ]}; + key {[ e, E ]}; + key {[ r, R ], + [ registered ]}; + key {[ t, T ], + [ brokenbar ]}; + key {[ y, Y ]}; + key {[ u, U ]}; + key {[ i, Iabovedot ]}; + key {[ o, O ]}; + key {[ p, P ]}; + key {[ odiaeresis, Odiaeresis ], + [ bracketleft, braceleft ]}; + key {[ gbreve, Gbreve ], + [ bracketright, braceright ]}; + + key {[ a, A ]}; + key {[ s, S ]}; + key {[ d, D ]}; + key {[ f, F ]}; + key {[ g, G ]}; + key {[ h, H ]}; + key {[ j, J ]}; + key {[ k, K ]}; + key {[ l, L ]}; + key {[ idotless, I ]}; + key {[ 0x1000259, 0x100018f ]}; + key {[ backslash, slash ]}; + + key {[ less, greater ], + [ bar ]}; + key {[ z, z ]}; + key {[ x, X ]}; + key {[ c, C ], + [ copyright, division ]}; + key {[ v, V ]}; + key {[ b, B ]}; + key {[ n, N ]}; + key {[ m, M ], + [ periodcentered, currency ]}; + key {[ ccedilla, Ccedilla ]}; + key {[ scedilla, Scedilla ]}; + key {[ period, comma ]}; + + // End alphanumeric section + + // Begin modifier mappings + + modifier_map Shift { Shift_L }; + modifier_map Lock { Caps_Lock, ISO_Lock }; + modifier_map Control{ Control_L }; + modifier_map Mod3 { Mode_switch }; +}; + +partial alphanumeric_keys +xkb_symbols "latin" { + include "az(basic)" +}; + +partial alphanumeric_keys +xkb_symbols "cyrillic" { + + name[Group1]= "Cyrillic"; + name[Group2]= "Latin"; + + key {[ grave, asciitilde ], + [ w, W ]}; + key {[ 1, exclam ]}; + key {[ 2, quotedbl ], + [ at ]}; + key {[ 3, numbersign ], + [ apostrophe ]}; + key {[ 4, semicolon ], + [ dollar ]}; + key {[ 5, percent ]}; + key {[ 6, colon ], + [ asciicircum ]}; + key {[ 7, question ], + [ ampersand ]}; + key {[ 8, asterisk ], + [ braceleft ]}; + key {[ 9, parenleft ], + [ bracketleft ]}; + key {[ 0, parenright ], + [ bracketright ]}; + key {[ minus, underscore ], + [ braceright ]}; + key {[ equal, plus ]}; + + key {[ Cyrillic_je, Cyrillic_JE ], + [ y, Y ]}; + key {[ 0x10004af, 0x10004ae ], + [ udiaeresis, Udiaeresis ]}; + key {[ Cyrillic_u, Cyrillic_U ], + [ u, U ]}; + key {[ Cyrillic_ka, Cyrillic_KA ], + [ k, K ]}; + key {[ Cyrillic_ie, Cyrillic_IE ], + [ e, E ]}; + key {[ Cyrillic_en, Cyrillic_EN ], + [ n, N ]}; + key {[ Cyrillic_ghe, Cyrillic_GHE ], + [ q, Q ]}; + key {[ Cyrillic_sha, Cyrillic_SHA ], + [ scedilla, Scedilla ]}; + key {[ 0x10004bb, 0x10004ba ], + [ h, H ]}; + key {[ Cyrillic_ze, Cyrillic_ZE ], + [ z, Z ]}; + key {[ Cyrillic_ha, Cyrillic_HA ], + [ x, X ]}; + key {[ 0x10004b9, 0x10004b8 ], + [ c, C ]}; + + key {[ Cyrillic_ef, Cyrillic_EF ], + [ f, F ]}; + key {[ Cyrillic_yeru, Cyrillic_YERU ], + [ idotless, I ]}; + key {[ Cyrillic_ve, Cyrillic_VE ], + [ v, V ]}; + key {[ Cyrillic_a, Cyrillic_A ], + [ a, A ]}; + key {[ Cyrillic_pe, Cyrillic_PE ], + [ p, P ]}; + key {[ Cyrillic_er, Cyrillic_ER ], + [ r, R ]}; + key {[ Cyrillic_o, Cyrillic_O ], + [ o, O ]}; + key {[ Cyrillic_el, Cyrillic_EL ], + [ l, L ]}; + key {[ Cyrillic_de, Cyrillic_DE ], + [ d, D ]}; + key {[ Cyrillic_zhe, Cyrillic_ZHE ], + [ j, J ]}; + key {[ 0x100049d, 0x100049c ], + [ g, G ]}; + key {[ backslash, slash ]}; + + key {[ less, greater ], + [ bar ]}; + key {[ 0x10004d9, 0x10004d8 ], + [ 0x1000259, 0x100018f ]}; + key {[ Cyrillic_che, Cyrillic_CHE ], + [ ccedilla, Ccedilla ]}; + key {[ Cyrillic_es, Cyrillic_ES ], + [ s, S ]}; + key {[ Cyrillic_em, Cyrillic_EM ], + [ m, M ]}; + key {[ Cyrillic_i, Cyrillic_I ], + [ i, Iabovedot ]}; + key {[ Cyrillic_te, Cyrillic_TE ], + [ t, T ]}; + key {[ 0x1000493, 0x1000492 ], + [ gbreve, Gbreve ]}; + key {[ Cyrillic_be, Cyrillic_BE ], + [ b, B ]}; + key {[ 0x10004e9, 0x10004e8 ], + [ odiaeresis, Odiaeresis ]}; + key {[ period, comma ], + [ slash, question ]}; + + // End alphanumeric section + + // Begin modifier mappings + + modifier_map Shift { Shift_L }; + modifier_map Lock { Caps_Lock, ISO_Lock }; + modifier_map Control{ Control_L }; + modifier_map Mod3 { Mode_switch }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/be /opt/SUNWut/lib/xkb/symbols/be --- /opt/SUNWut.orig/lib/xkb/symbols/be 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/be 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,121 @@ +// $Xorg: be,v 1.3 2000/08/17 19:54:42 cpqbld Exp $ + + + + +// $XFree86: xc/programs/xkbcomp/symbols/be,v 3.4 2000/10/27 18:31:08 dawes Exp $ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + // Describes the differences between a very simple US/ASCII + // keyboard and a very simple Belgian keyboard + + name[Group1]= "Belgian"; + + key { [ twosuperior, threesuperior ] }; + key { [ ampersand, 1 ], + [ bar ] }; + key { [ eacute, 2 ], + [ at ] }; + key { [ quotedbl, 3 ], + [ numbersign ] }; + key { [ apostrophe, 4 ] }; + key { [ parenleft, 5 ] }; + key { [ section, 6 ], + [ asciicircum ] }; + key { [ egrave, 7 ] }; + key { [ exclam, 8 ] }; + key { [ ccedilla, 9 ], + [ braceleft, plusminus ] }; + key { [ agrave, 0 ], + [ braceright, degree ] }; + key { [ parenright, degree ] }; + key { [ minus, underscore ] }; + key { [ a, A ] }; + key { [ z, Z ] }; + key { [ e, E ], + [ EuroSign, cent ] }; + key { [ dead_circumflex, dead_diaeresis ], + [ bracketleft ] }; + key { [ dollar, asterisk ], + [ bracketright ] }; + key { [ q, Q ] }; + key { [ m, M ] }; + key { [ ugrave, percent ], + [ dead_acute ] }; + key { [ mu, sterling ], + [ dead_grave ] }; + key { [ less, greater ], + [ backslash ] }; + key { [ w, W ] }; + key { [ comma, question ], + [ dead_cedilla ] }; + key { [ semicolon, period ] }; + key { [ colon, slash ] }; + key { [ equal, plus ], + [ dead_tilde ] }; + // End alphanumeric section + + // begin modifier mappings + modifier_map Shift { Shift_L }; + modifier_map Lock { Caps_Lock }; + modifier_map Control{ Control_L }; + modifier_map Mod3 { Mode_switch }; +}; + +partial alphanumeric_keys +xkb_symbols "iso-alternate" { + include "be(basic)" + replace key {[ a, A ], + [ ae, AE ] }; + replace key {[ z, Z ], + [ guillemotleft, less ] }; + replace key {[ q, Q ], + [ at, Greek_OMEGA ] }; + replace key {[ m, M ], + [ mu, masculine ] }; + replace key {[ w, W ], + [ lstroke, Lstroke ] }; + replace key {[ comma, question ], + [ dead_cedilla, dead_doubleacute ] }; +}; + +partial alphanumeric_keys +xkb_symbols "Sundeadkeys" { + + // Use the Sun dead keys + include "be(basic)" + key { [ SunFA_Circum, SunFA_Diaeresis ], + [ bracketleft ] }; + key { [ ugrave, percent ], + [ SunFA_Acute ] }; + key { [ mu, sterling ], + [ SunFA_Grave ] }; + key { [ comma, question ], + [ SunFA_Cedilla ] }; + key { [ equal, plus ], + [ SunFA_Tilde ] }; +}; + +partial alphanumeric_keys +xkb_symbols "sundeadkeys" { + + // Use the Sun dead keys + include "be(Sundeadkeys)" +}; + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + + // Eliminates dead keys from the basic Belgian layout + include "be(basic)" + key { [ asciicircum, diaeresis ], + [ bracketleft ] }; + key { [ ugrave, percent ], + [ quoteright ] }; + key { [ mu, sterling ], + [ quoteleft ] }; + key { [ equal, plus ], + [ asciitilde ] }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/ben /opt/SUNWut/lib/xkb/symbols/ben --- /opt/SUNWut.orig/lib/xkb/symbols/ben 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/ben 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,141 @@ +// $XConsortium: th /main/3 1996/08/31 12:20:18 kaleb $ +// $XFree86: xc/programs/xkbcomp/symbols/ben,v 1.1 2001/11/21 22:28:52 dawes Exp $ +partial default alphanumeric_keys +xkb_symbols "basic" { + name[Group2]= "Bengali"; + key { [], [ ] }; + + // Mainly numbers. + key { [], [ 0x10009E7 ] }; + key { [], [ 0x10009E8 ] }; + key { [], [ 0x10009E9 ] }; + key { [], [ 0x10009EA ] }; + key { [], [ 0x10009EB ] }; + key { [], [ 0x10009EC ] }; + key { [], [ 0x10009ED ] }; + key { [], [ 0x10009EE ] }; + key { [], [ 0x10009EF, parenleft ] }; + key { [], [ 0x10009E6, parenright ] }; + key { [], [ minus, 0x1000983 ] }; + key { [], [ 0x100098B, 0x10009C3 ] }; + +// Mainly long vowels + + key { [], [ 0x10009CC, 0x1000994 ] }; + key { [], [ 0x10009C8, 0x1000990 ] }; + key { [], [ 0x10009BE, 0x1000986 ] }; + key { [], [ 0x10009C0, 0x1000988 ] }; + key { [], [ 0x10009C2, 0x100098A ] }; + +// Mainly voiced consonants + + key { [], [ 0x10009AC, 0x10009AD ] }; + key { [], [ 0x10009B9, 0x1000999 ] }; + key { [], [ 0x1000997, 0x1000998 ] }; + key { [], [ 0x10009A6, 0x10009A7 ] }; + key { [], [ 0x100099C, 0x100099D ] }; + key { [], [ 0x10009A1, 0x10009A2 ] }; + key { [], [ 0x10009BC, 0x100099E ] }; + +// Mainly short vowels + key { [], [ 0x10009CB, 0x1000993 ] }; + key { [], [ 0x10009C7, 0x100098F ] }; + key { [], [ 0x10009CD, 0x1000985 ] }; + key { [], [ 0x10009BF, 0x1000987 ] }; + key { [], [ 0x10009C1, 0x1000989 ] }; + +// Mainly unvoiced consonants + + key { [], [ 0x10009AA, 0x10009AB ] }; + key { [], [ 0x10009B0, 0x10009DD ] }; + key { [], [ 0x1000995, 0x1000996 ] }; + key { [], [ 0x10009A4, 0x10009A5 ] }; + key { [], [ 0x100099A, 0x100099B ] }; + key { [], [ 0x100099F, 0x10009A0 ] }; + key { [], [ backslash, bar ] }; + + key { [], [ z, Z ] }; + key { [], [ 0x1000982, 0x1000981 ] }; + key { [], [ 0x10009AE, 0x10009A3 ] }; + key { [], [ 0x10009A8, 0x10009A8 ] }; + key { [], [ 0x10009AC, 0x10009AC ] }; + key { [], [ 0x10009B2, 0x10009B2 ] }; + key { [], [ 0x10009B8, 0x10009B6 ] }; + key { [], [ comma, 0x10009B7 ] }; + key { [], [ period, 0x1000964 ] }; + key { [], [ 0x10009DF, 0x10009AF ] }; +}; + +xkb_symbols "probhat" { + name[Group2]= "Bengali"; + key { [], [ Escape ] }; + +// numbers + key { [], [ quoteleft, asciitilde ] }; + key { [], [ 0x10009E7, exclam ] }; + key { [], [ 0x10009E8, at ] }; + key { [], [ 0x10009E9, numbersign ] }; + key { [], [ 0x10009EA, 0x10009F3 ] }; + key { [], [ 0x10009EB, percent ] }; + key { [], [ 0x10009EC, asciicircum ] }; + key { [], [ 0x10009ED, 0x100099E ] }; + key { [], [ 0x10009EE, asterisk ] }; + key { [], [ 0x10009EF, parenleft ] }; + key { [], [ 0x10009E6, parenright ] }; + key { [], [ minus, 0x1000983 ] }; + key { [], [ 0x100098B, 0x10009C3 ] }; + key { [], [ BackSpace ] }; + +// tab, q to ] + key { [], [ Tab, ISO_Left_Tab ] }; + key { [], [ 0x10009A6, 0x10009A7 ] }; + key { [], [ 0x10009C2, 0x100098A ] }; + key { [], [ 0x10009C0, 0x1000988 ] }; + key { [], [ 0x10009B0, 0x10009DC ] }; + key { [], [ 0x100099F, 0x10009A0 ] }; + key { [], [ 0x100098F, 0x1000990 ] }; + key { [], [ 0x10009C1, 0x1000989 ] }; + key { [], [ 0x10009BF, 0x1000987 ] }; + key { [], [ 0x1000993, 0x1000994 ] }; + key { [], [ 0x10009AA, 0x10009AB ] }; + key { [], [ 0x10009C7, 0x10009C8 ] }; + key { [], [ 0x10009CB, 0x10009CC ] }; + key { [], [ Return ] }; + +// caps, a to ' +// key { [], [ Caps_Lock ] }; + key { [], [ 0x10009BE, 0x1000985 ] }; + key { [], [ 0x10009B8, 0x10009B7 ] }; + key { [], [ 0x10009A1, 0x10009A2 ] }; + key { [], [ 0x10009A4, 0x10009A5 ] }; + key { [], [ 0x1000997, 0x1000998 ] }; + key { [], [ 0x10009B9, 0x1000983 ] }; + key { [], [ 0x100099C, 0x100099D ] }; + key { [], [ 0x1000995, 0x1000996 ] }; + key { [], [ 0x10009B2, 0x1000982 ] }; + key { [], [ semicolon, colon ] }; + key { [], [ quoteright, quotedbl ] }; + +// shift, z to / +// key { [], [ Shift_L ] }; + key { [], [ 0x10009DF, 0x10009AF ] }; + key { [], [ 0x10009B6, 0x10009DD ] }; + key { [], [ 0x100099A, 0x100099B ] }; + key { [], [ 0x1000986, 0x100098B ] }; + key { [], [ 0x10009AC, 0x10009AD ] }; + key { [], [ 0x10009A8, 0x10009A3 ] }; + key { [], [ 0x10009AE, 0x1000999 ] }; + key { [], [ comma, 0x10009C3 ] }; + key { [], [ period, 0x1000981 ] }; + key { [], [ 0x10009CD, question ] }; + key { [], [ backslash, bar ] }; + +// key { [], [ Control_L ] }; +// key { [], [ space ] }; + +// modifier_map Shift { Shift_L }; +// modifier_map Lock { Caps_Lock }; +// modifier_map Control{ Control_L }; + +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/bg /opt/SUNWut/lib/xkb/symbols/bg --- /opt/SUNWut.orig/lib/xkb/symbols/bg 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/bg 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,515 @@ +// $Xorg: ca,v 1.3 2000/08/17 19:54:42 cpqbld Exp $ + +////////////////////////////////////////////////////////////////////////// +// Copyright (C) 1999, 2000 by Anton Zinoviev +// +// This software may be used, modified, copied, distributed, and sold, +// in both source and binary form provided that the above copyright +// and these terms are retained. Under no circumstances is the author +// responsible for the proper functioning of this software, nor does +// the author assume any responsibility for damages incurred with its +// use. +// +////////////////////////////////////////////////////////////////////////// + +// $XFree86: xc/programs/xkbcomp/symbols/bg,v 3.2 2000/11/06 19:24:10 dawes Exp $ + +// Version 1.6r1 + +// Thanks to Ivan Pascal for improvements in this file. + +partial alphanumeric_keys +xkb_symbols "bds_enhanced" { + + // Describes the differences between a very simple en_US keyboard + // and a very simple Bulgarian keyboard with publishing symbols in + // the third level. + + name[Group1]= "Latin"; + name[Group2]= "Cyrillic"; + + key.type = "THREE_LEVEL"; + + key {[ quoteleft, asciitilde, degree ], + [ parenleft, parenright, degree ]}; + key {[ 1, exclam, multiply ], + [ 1, exclam, multiply ]}; + key {[ 2, at, division ], + [ 2, question, division ]}; + key {[ 3, numbersign, plusminus ], + [ 3, plus, plusminus ]}; + key {[ 4, dollar, notsign ], + [ 4, quotedbl, notsign ]}; + // I want here per mille sign, but it is not defined X keysym. + key {[ 5, percent, NoSymbol ], + [ 5, percent, NoSymbol ]}; + key {[ 6, asciicircum, notequal ], + [ 6, equal, notequal ]}; + key {[ 7, ampersand, ampersand ], + [ 7, colon, ampersand ]}; + key {[ 8, asterisk, asterisk ], + [ 8, slash, asterisk ]}; + key {[ 9, parenleft, bracketleft ], + [ 9, emdash, bracketleft ]}; + key {[ 0, parenright, bracketright ], + [ 0, numerosign, bracketright ]}; + key {[ minus, underscore, X ], + [ minus, I, X ]}; + key {[ equal, plus, L ], + [ period, V, L ]}; + + key {[ q, Q, apostrophe ], + [ comma, Cyrillic_yeru, apostrophe ]}; + key {[ w, W, grave ], + [ Cyrillic_u, Cyrillic_U, grave ]}; + key {[ e, E, EuroSign ], + [ Cyrillic_ie, Cyrillic_IE, EuroSign ]}; + key {[ r, R, registered ], + [ Cyrillic_i, Cyrillic_I, registered ]}; + key {[ t, T, trademark ], + [ Cyrillic_sha, Cyrillic_SHA, trademark ]}; + key {[ y, Y, yen ], + [ Cyrillic_shcha, Cyrillic_SHCHA, yen ]}; + key {[ u, U, doublelowquotemark ], + [ Cyrillic_ka, Cyrillic_KA, doublelowquotemark ]}; + key {[ i, I, leftdoublequotemark ], + [ Cyrillic_es, Cyrillic_ES, leftdoublequotemark ]}; + key {[ o, O, rightdoublequotemark ], + [ Cyrillic_de, Cyrillic_DE, rightdoublequotemark ]}; + // I want here `P' in a circle, but it is not defined X keysym. + key {[ p, P, NoSymbol ], + [ Cyrillic_ze, Cyrillic_ZE, NoSymbol ]}; + key {[ bracketleft, braceleft, braceleft ], + [ Cyrillic_tse, Cyrillic_TSE, braceleft ]}; + key {[ bracketright, braceright, braceright ], + [ semicolon, section, braceright ]}; + + key {[ a, A, mu ], + [ Cyrillic_softsign, Cyrillic_SOFTSIGN, mu ]}; + key {[ s, S, sterling ], + [ Cyrillic_ya, Cyrillic_YA, sterling ]}; + key {[ d, D, dollar ], + [ Cyrillic_a, Cyrillic_A, dollar ]}; + key {[ f, F, cent ], + [ Cyrillic_o, Cyrillic_O, cent ]}; + key {[ g, G, Cyrillic_yeru ], + [ Cyrillic_zhe, Cyrillic_ZHE, Cyrillic_yeru ]}; + key {[ h, H, Cyrillic_YERU ], + [ Cyrillic_ghe, Cyrillic_GHE, Cyrillic_YERU ]}; + key {[ j, J, Cyrillic_e ], + [ Cyrillic_te, Cyrillic_TE, Cyrillic_e ]}; + key {[ k, K, Cyrillic_E ], + [ Cyrillic_en, Cyrillic_EN, Cyrillic_E ]}; + key {[ l, L, numerosign ], + [ Cyrillic_ve, Cyrillic_VE, numerosign ]}; + key {[ semicolon, colon, section ], + [ Cyrillic_em, Cyrillic_EM, section ]}; + key {[ quoteright, quotedbl, ellipsis ], + [ Cyrillic_che, Cyrillic_CHE, ellipsis ]}; + key {[ backslash, bar, bar ], + [ apostrophe, Cyrillic_YERU, bar ]}; + + key {[ less, greater, NoSymbol ], + [ less, greater, NoSymbol ]}; + key {[ z, Z, emdash ], + [ Cyrillic_yu, Cyrillic_YU, emdash ]}; + key {[ x, X, endash ], + [ Cyrillic_shorti, Cyrillic_SHORTI, endash ]}; + key {[ c, C, copyright ], + [ Cyrillic_hardsign, Cyrillic_HARDSIGN, copyright ]}; + key {[ v, V, NoSymbol ], + [ Cyrillic_e, Cyrillic_E, NoSymbol ]}; + key {[ b, B, NoSymbol ], + [ Cyrillic_ef, Cyrillic_EF, NoSymbol ]}; + key {[ n, N, less ], + [ Cyrillic_ha, Cyrillic_HA, less ]}; + key {[ m, M, greater ], + [ Cyrillic_pe, Cyrillic_PE, greater ]}; + key {[ comma, less, guillemotleft ], + [ Cyrillic_er, Cyrillic_ER, guillemotleft ]}; + key {[ period, greater, guillemotright ], + [ Cyrillic_el, Cyrillic_EL, guillemotright ]}; + key {[ slash, question, backslash ], + [ Cyrillic_be, Cyrillic_BE, backslash ]}; + + // End alphanumeric section + + key {[ space, space, nobreakspace ]}; + key { type="TWO_LEVEL",[ Alt_R, Meta_R ]}; + + // Begin modifier mappings + + modifier_map Shift { Shift_L }; + modifier_map Lock { Caps_Lock, ISO_Lock }; + modifier_map Control{ Control_L }; + modifier_map Mod3 { Mode_switch }; +}; + +partial alphanumeric_keys +xkb_symbols "phonetic_enhanced" { + + // Describes the differences between a very simple en_US keyboard + // and a very simple Bulgarian phonetic keyboard with publishing + // symbols in the third level. + + name[Group1]= "Latin"; + name[Group2]= "Cyrillic"; + + key.type = "THREE_LEVEL"; + + key {[ quoteleft, asciitilde, degree ], + [ Cyrillic_che, Cyrillic_CHE, degree ]}; + key {[ 1, exclam, multiply ], + [ 1, exclam, multiply ]}; + key {[ 2, at, division ], + [ 2, at, division ]}; + key {[ 3, numbersign, plusminus ], + [ 3, numbersign, plusminus ]}; + key {[ 4, dollar, notsign ], + [ 4, dollar, notsign ]}; + // I want here per mille sign, but it is not defined X keysym. + key {[ 5, percent, NoSymbol ], + [ 5, percent, NoSymbol ]}; + key {[ 6, asciicircum, notequal ], + [ 6, asciicircum, notequal ]}; + key {[ 7, ampersand, ampersand ], + [ 7, ampersand, ampersand ]}; + key {[ 8, asterisk, asterisk ], + [ 8, asterisk, asterisk ]}; + key {[ 9, parenleft, bracketleft ], + [ 9, parenleft, bracketleft ]}; + key {[ 0, parenright, bracketright ], + [ 0, parenright, bracketright ]}; + key {[ minus, underscore, X ], + [ minus, underscore, X ]}; + key {[ equal, plus, L ], + [ equal, plus, L ]}; + + key {[ q, Q, apostrophe ], + [ Cyrillic_ya, Cyrillic_YA, apostrophe ]}; + key {[ w, W, grave ], + [ Cyrillic_ve, Cyrillic_VE, grave ]}; + key {[ e, E, EuroSign ], + [ Cyrillic_ie, Cyrillic_IE, EuroSign ]}; + key {[ r, R, registered ], + [ Cyrillic_er, Cyrillic_ER, registered ]}; + key {[ t, T, trademark ], + [ Cyrillic_te, Cyrillic_TE, trademark ]}; + key {[ y, Y, yen ], + [ Cyrillic_hardsign, Cyrillic_HARDSIGN, yen ]}; + key {[ u, U, doublelowquotemark ], + [ Cyrillic_u, Cyrillic_U, doublelowquotemark ]}; + key {[ i, I, leftdoublequotemark ], + [ Cyrillic_i, Cyrillic_I, leftdoublequotemark ]}; + key {[ o, O, rightdoublequotemark ], + [ Cyrillic_o, Cyrillic_O, rightdoublequotemark ]}; + // I want here `P' in a circle, but it is not defined X keysym. + key {[ p, P, NoSymbol ], + [ Cyrillic_pe, Cyrillic_PE, NoSymbol ]}; + key {[ bracketleft, braceleft, braceleft ], + [ Cyrillic_sha, Cyrillic_SHA, braceleft ]}; + key {[ bracketright, braceright, braceright ], + [ Cyrillic_shcha, Cyrillic_SHCHA, braceright ]}; + + key {[ a, A, mu ], + [ Cyrillic_a, Cyrillic_A, mu ]}; + key {[ s, S, sterling ], + [ Cyrillic_es, Cyrillic_ES, sterling ]}; + key {[ d, D, dollar ], + [ Cyrillic_de, Cyrillic_DE, dollar ]}; + key {[ f, F, cent ], + [ Cyrillic_ef, Cyrillic_EF, cent ]}; + key {[ g, G, Cyrillic_yeru ], + [ Cyrillic_ghe, Cyrillic_GHE, Cyrillic_yeru ]}; + key {[ h, H, Cyrillic_YERU ], + [ Cyrillic_ha, Cyrillic_HA, Cyrillic_YERU ]}; + key {[ j, J, Cyrillic_e ], + [ Cyrillic_shorti, Cyrillic_SHORTI, Cyrillic_e ]}; + key {[ k, K, Cyrillic_E ], + [ Cyrillic_ka, Cyrillic_KA, Cyrillic_E ]}; + key {[ l, L, numerosign ], + [ Cyrillic_el, Cyrillic_EL, numerosign ]}; + key {[ semicolon, colon, section ], + [ semicolon, colon, section ]}; + key {[ quoteright, quotedbl, ellipsis ], + [ quoteright, quotedbl, ellipsis ]}; + key {[ backslash, bar, bar ], + [ Cyrillic_yu, Cyrillic_YU, bar ]}; + + key {[ less, greater, NoSymbol ], + [ less, greater, NoSymbol ]}; + key {[ z, Z, emdash ], + [ Cyrillic_ze, Cyrillic_ZE, emdash ]}; + key {[ x, X, endash ], + [ Cyrillic_softsign, Cyrillic_SOFTSIGN, endash ]}; + key {[ c, C, copyright ], + [ Cyrillic_tse, Cyrillic_TSE, copyright ]}; + key {[ v, V, NoSymbol ], + [ Cyrillic_zhe, Cyrillic_ZHE, NoSymbol ]}; + key {[ b, B, NoSymbol ], + [ Cyrillic_be, Cyrillic_BE, NoSymbol ]}; + key {[ n, N, less ], + [ Cyrillic_en, Cyrillic_EN, less ]}; + key {[ m, M, greater ], + [ Cyrillic_em, Cyrillic_EM, greater ]}; + key {[ comma, less, guillemotleft ], + [ comma, less, guillemotleft ]}; + key {[ period, greater, guillemotright ], + [ period, greater, guillemotright ]}; + key {[ slash, question, backslash ], + [ slash, question, backslash ]}; + + // End alphanumeric section + + key {[ space, space, nobreakspace ]}; + key { type="TWO_LEVEL",[ Alt_R, Meta_R ]}; + + // Begin modifier mappings + + modifier_map Shift { Shift_L }; + modifier_map Lock { Caps_Lock, ISO_Lock }; + modifier_map Control{ Control_L }; + modifier_map Mod3 { Mode_switch }; +}; + +partial default alphanumeric_keys +xkb_symbols "bds" { + + // Describes the differences between a very simple en_US keyboard + // and a very simple Bulgarian keyboard. + + name[Group1]= "Latin"; + name[Group2]= "Cyrillic"; + + key { [ quoteleft, asciitilde ], + [ parenleft, parenright ] }; + key { [ 1, exclam ], + [ 1, exclam ] }; + key { [ 2, at ], + [ 2, question ] }; + key { [ 3, numbersign ], + [ 3, plus ] }; + key { [ 4, dollar ], + [ 4, quotedbl ] }; + key { [ 5, percent ], + [ 5, percent ] }; + key { [ 6, asciicircum ], + [ 6, equal ] }; + key { [ 7, ampersand ], + [ 7, colon ] }; + key { [ 8, asterisk ], + [ 8, slash ] }; + key { [ 9, parenleft ], + [ 9, emdash ] }; + key { [ 0, parenright ], + [ 0, numerosign ] }; + key { [ minus, underscore ], + [ minus, I ] }; + key { [ equal, plus ], + [ period, V ] }; + + key { [ q, Q ], + [ comma, Cyrillic_yeru ] }; + key { [ w, W ], + [ Cyrillic_u, Cyrillic_U ] }; + key { [ e, E ], + [ Cyrillic_ie, Cyrillic_IE ] }; + key { [ r, R ], + [ Cyrillic_i, Cyrillic_I ] }; + key { [ t, T ], + [ Cyrillic_sha, Cyrillic_SHA ] }; + key { [ y, Y ], + [ Cyrillic_shcha, Cyrillic_SHCHA ] }; + key { [ u, U ], + [ Cyrillic_ka, Cyrillic_KA ] }; + key { [ i, I ], + [ Cyrillic_es, Cyrillic_ES ] }; + key { [ o, O ], + [ Cyrillic_de, Cyrillic_DE ] }; + key { [ p, P ], + [ Cyrillic_ze, Cyrillic_ZE ] }; + key { [ bracketleft, braceleft ], + [ Cyrillic_tse, Cyrillic_TSE ] }; + key { [ bracketright, braceright ], + [ semicolon, section ] }; + + key { [ a, A ], + [ Cyrillic_softsign, Cyrillic_SOFTSIGN ] }; + key { [ s, S ], + [ Cyrillic_ya, Cyrillic_YA ] }; + key { [ d, D ], + [ Cyrillic_a, Cyrillic_A ] }; + key { [ f, F ], + [ Cyrillic_o, Cyrillic_O ] }; + key { [ g, G ], + [ Cyrillic_zhe, Cyrillic_ZHE ] }; + key { [ h, H ], + [ Cyrillic_ghe, Cyrillic_GHE ] }; + key { [ j, J ], + [ Cyrillic_te, Cyrillic_TE ] }; + key { [ k, K ], + [ Cyrillic_en, Cyrillic_EN ] }; + key { [ l, L ], + [ Cyrillic_ve, Cyrillic_VE ] }; + key { [ semicolon, colon ], + [ Cyrillic_em, Cyrillic_EM ] }; + key { [ quoteright, quotedbl ], + [ Cyrillic_che, Cyrillic_CHE ] }; + key { [ backslash, bar ], + [ apostrophe, Cyrillic_YERU ] }; + + key { [ less, greater ], + [ less, greater ] }; + key { [ z, Z ], + [ Cyrillic_yu, Cyrillic_YU ] }; + key { [ x, X ], + [ Cyrillic_shorti, Cyrillic_SHORTI ] }; + key { [ c, C ], + [ Cyrillic_hardsign, Cyrillic_HARDSIGN ] }; + key { [ v, V ], + [ Cyrillic_e, Cyrillic_E ] }; + key { [ b, B ], + [ Cyrillic_ef, Cyrillic_EF ] }; + key { [ n, N ], + [ Cyrillic_ha, Cyrillic_HA ] }; + key { [ m, M ], + [ Cyrillic_pe, Cyrillic_PE ] }; + key { [ comma, less ], + [ Cyrillic_er, Cyrillic_ER ] }; + key { [ period, greater ], + [ Cyrillic_el, Cyrillic_EL ] }; + key { [ slash, question ], + [ Cyrillic_be, Cyrillic_BE ] }; + + // End alphanumeric section + + key { [ Alt_R, Meta_R ] }; + + // Begin modifier mappings + + modifier_map Shift { Shift_L }; + modifier_map Lock { Caps_Lock, ISO_Lock }; + modifier_map Control{ Control_L }; + modifier_map Mod3 { Mode_switch }; +}; + +partial alphanumeric_keys +xkb_symbols "phonetic" { + + // Describes the differences between a very simple en_US keyboard + // and a very simple Bulgarian phonetic keyboard. + + name[Group1]= "Latin"; + name[Group2]= "Cyrillic"; + + key { [ quoteleft, asciitilde ], + [ Cyrillic_che, Cyrillic_CHE ] }; + key { [ 1, exclam ], + [ 1, exclam ] }; + key { [ 2, at ], + [ 2, at ] }; + key { [ 3, numbersign ], + [ 3, numbersign ] }; + key { [ 4, dollar ], + [ 4, dollar ] }; + key { [ 5, percent ], + [ 5, percent ] }; + key { [ 6, asciicircum ], + [ 6, asciicircum ] }; + key { [ 7, ampersand ], + [ 7, ampersand ] }; + key { [ 8, asterisk ], + [ 8, asterisk ] }; + key { [ 9, parenleft ], + [ 9, parenleft ] }; + key { [ 0, parenright ], + [ 0, parenright ] }; + key { [ minus, underscore ], + [ minus, underscore ] }; + key { [ equal, plus ], + [ equal, plus ] }; + + key { [ q, Q ], + [ Cyrillic_ya, Cyrillic_YA ] }; + key { [ w, W ], + [ Cyrillic_ve, Cyrillic_VE ] }; + key { [ e, E ], + [ Cyrillic_ie, Cyrillic_IE ] }; + key { [ r, R ], + [ Cyrillic_er, Cyrillic_ER ] }; + key { [ t, T ], + [ Cyrillic_te, Cyrillic_TE ] }; + key { [ y, Y ], + [ Cyrillic_hardsign, Cyrillic_HARDSIGN ] }; + key { [ u, U ], + [ Cyrillic_u, Cyrillic_U ] }; + key { [ i, I ], + [ Cyrillic_i, Cyrillic_I ] }; + key { [ o, O ], + [ Cyrillic_o, Cyrillic_O ] }; + key { [ p, P ], + [ Cyrillic_pe, Cyrillic_PE ] }; + key { [ bracketleft, braceleft ], + [ Cyrillic_sha, Cyrillic_SHA ] }; + key { [ bracketright, braceright ], + [ Cyrillic_shcha, Cyrillic_SHCHA ] }; + + key { [ a, A ], + [ Cyrillic_a, Cyrillic_A ] }; + key { [ s, S ], + [ Cyrillic_es, Cyrillic_ES ] }; + key { [ d, D ], + [ Cyrillic_de, Cyrillic_DE ] }; + key { [ f, F ], + [ Cyrillic_ef, Cyrillic_EF ] }; + key { [ g, G ], + [ Cyrillic_ghe, Cyrillic_GHE ] }; + key { [ h, H ], + [ Cyrillic_ha, Cyrillic_HA ] }; + key { [ j, J ], + [ Cyrillic_shorti, Cyrillic_SHORTI ] }; + key { [ k, K ], + [ Cyrillic_ka, Cyrillic_KA ] }; + key { [ l, L ], + [ Cyrillic_el, Cyrillic_EL ] }; + key { [ semicolon, colon ], + [ semicolon, colon ] }; + key { [ quoteright, quotedbl ], + [ quoteright, quotedbl ] }; + key { [ backslash, bar ], + [ Cyrillic_yu, Cyrillic_YU ] }; + + key { [ less, greater ], + [ less, greater ] }; + key { [ z, Z ], + [ Cyrillic_ze, Cyrillic_ZE ] }; + key { [ x, X ], + [ Cyrillic_softsign, Cyrillic_SOFTSIGN ] }; + key { [ c, C ], + [ Cyrillic_tse, Cyrillic_TSE ] }; + key { [ v, V ], + [ Cyrillic_zhe, Cyrillic_ZHE ] }; + key { [ b, B ], + [ Cyrillic_be, Cyrillic_BE ] }; + key { [ n, N ], + [ Cyrillic_en, Cyrillic_EN ] }; + key { [ m, M ], + [ Cyrillic_em, Cyrillic_EM ] }; + key { [ comma, less ], + [ comma, less ] }; + key { [ period, greater ], + [ period, greater ] }; + key { [ slash, question ], + [ slash, question ] }; + + // End alphanumeric section + + key { [ Alt_R, Meta_R ] }; + + // Begin modifier mappings + + modifier_map Shift { Shift_L }; + modifier_map Lock { Caps_Lock, ISO_Lock }; + modifier_map Control{ Control_L }; + modifier_map Mod3 { Mode_switch }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/br /opt/SUNWut/lib/xkb/symbols/br --- /opt/SUNWut.orig/lib/xkb/symbols/br 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/br 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,95 @@ +// +// $XFree86: xc/programs/xkbcomp/symbols/br,v 1.3 2000/10/27 18:31:08 dawes Exp $ +// +partial default alphanumeric_keys +xkb_symbols "abnt2" { + + // Describes the differences between a very simple us + // keyboard and a very simple Brasilian ABNT2 keybaord + // by Ricardo Y. Igarashi (iga@that.com.br) + // Adds suport for dead-keys in I18N applications + // by Conectiva (http://www.conectiva.com.br) + + name[Group1]= "Brazilian"; + + key { [ apostrophe, quotedbl ] }; + key { [ 1, exclam ], + [ onesuperior, exclamdown ] }; + key { [ 2, at ], + [ twosuperior, onehalf ] }; + key { [ 3, numbersign ], + [ threesuperior, threequarters ] }; + key { [ 4, dollar ], + [ sterling, onequarter ] }; + key { [ 5, percent ], + [ cent ] }; + key { [ 6, dead_diaeresis ], + [ notsign, diaeresis ] }; + key { [ 7, ampersand ], + [ braceleft ] }; + key { [ 8, asterisk ], + [ bracketleft ] }; + key { [ 9, parenleft ], + [ bracketright ] }; + key { [ 0, parenright ], + [ braceright ] }; + key { [ minus, underscore ], + [ backslash ] }; + key { [ equal, plus ], + [ section ] }; + key { [ e, E ], + [ EuroSign ] }; + key { [ r, R ], + [ registered ] }; + key { [ dead_acute, dead_grave ], + [ acute, grave ] }; + key { [ bracketleft, braceleft ], + [ ordfeminine ] }; + key { [ ccedilla, Ccedilla ] }; + key { [ dead_tilde, dead_circumflex ], + [ asciitilde, asciicircum ] }; + key { [ bracketright, braceright ], + [ masculine ] }; + key { [ c, C ], + [ copyright ] }; + key { [ m, M ], + [ mu ] }; + key { [ backslash, bar ] }; + key { [ semicolon, colon ] }; +// ABNT-2 keyboard has this special key + key { [ slash, question ], + [ degree, questiondown ] }; + + key { [ KP_Decimal ] }; + key { [ KP_Delete, KP_Separator ] }; + + // begin modifier mappings + + modifier_map Shift { Shift_L }; + modifier_map Lock { Caps_Lock }; + modifier_map Control{ Control_L }; + key { + symbols[Group1]= [ Mode_switch, Multi_key ], + virtualMods= AltGr + }; +}; + +partial alphanumeric_keys +xkb_symbols "Sundeadkeys" { + include "br(basic)" // for consistent naming +}; + +partial alphanumeric_keys +xkb_symbols "sundeadkeys" { + include "br(Sundeadkeys)" // for consistent naming +}; + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + include "br(abnt2)" // for consistent naming + key { [ 6, diaeresis ], + [ notsign ] }; + key { [ apostrophe, grave ] }; + key { [ asciitilde, asciicircum ] }; +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/bs /opt/SUNWut/lib/xkb/symbols/bs --- /opt/SUNWut.orig/lib/xkb/symbols/bs 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/bs 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,91 @@ +// Bosnian keyboards +// Amila Akagic, +// Zadnja promjena: 07.05.2002. +// $XFree86$ + +default partial alphanumeric_keys +xkb_symbols "basic" { + + // Alphanumeric section + name[Group1]= "Bosnian"; + key { [ dead_cedilla, dead_diaeresis ] }; + key { [ 1, exclam ], + [ asciitilde, dead_tilde ] }; + key { [ 2, quotedbl ], + [ dead_caron, caron ] }; + key { [ 3, numbersign ], + [ asciicircum, dead_circumflex ] }; + key { [ 4, dollar ], + [ dead_breve, breve ] }; + key { [ 5, percent ], + [ degree, dead_abovering ] }; + key { [ 6, ampersand ], + [ dead_ogonek, ogonek ] }; + key { [ 7, slash ], + [ quoteleft, dead_grave ] }; + key { [ 8, parenleft ], + [ dead_abovedot, abovedot ] }; + key { [ 9, parenright ], + [ dead_acute, quoteright ] }; + key { [ 0, equal ], + [ dead_doubleacute, doubleacute ] }; + key { [ apostrophe, question ], + [ dead_diaeresis, diaeresis ] }; + key { [ plus, asterisk ], + [ dead_cedilla, cedilla ] }; + + key { [ q, Q ], + [ backslash ] }; + key { [ w, W ], + [ bar ] }; + key { [ e, E ], + [ EuroSign ] }; + key { [ t, T ] }; + key { [ z, Z ] }; + key { [ u, U ] }; + key { [ i, I ] }; + key { [ scaron, Scaron ], + [ division ] }; + key { [ dstroke, Dstroke ], + [ multiply, dead_macron ] }; + key { [ f, F ], + [ bracketleft ] }; + key { [ g, G ], + [ bracketright ] }; + key { [ k, K ], + [ lstroke ] }; + key { [ l, L ], + [ Lstroke ] }; + key { [ ccaron, Ccaron ] }; + key { [ cacute, Cacute ], + [ ssharp ] }; + + key { [ less, greater ], + [ bar ] }; + key { [ y, Y ] }; + key { [ v, V ], + [ at ] }; + key { [ b, B ], + [ braceleft ] }; + key { [ n, N ], + [ braceright ] }; + key { [ m, M ], + [ section ] }; + key { [ comma, semicolon ] }; + key { [ period, colon ], + [ periodcentered ] }; + key { [ minus, underscore ] }; + key { [ zcaron, Zcaron ], + [ currency ] }; + key { [ Mode_switch, Multi_key ] }; + + // End alphanumeric section + + // begin modifier mappings + modifier_map Shift { Shift_L }; + modifier_map Lock { Caps_Lock }; + modifier_map Control{ Control_L }; + modifier_map Mod3 { Mode_switch }; +}; + + diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/by /opt/SUNWut/lib/xkb/symbols/by --- /opt/SUNWut.orig/lib/xkb/symbols/by 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/by 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,142 @@ +// +// belarusian standard keyboard +// Alexander Mikhailian +// + +partial default alphanumeric_keys +xkb_symbols "basic" { + + // Describes the differences between a very simple en_US + // keyboard and a very simple Belarusian keybaord + + name[Group1]= "US/ASCII"; + name[Group2]= "Belarusian"; + + key { [ grave, asciitilde ], + [ Cyrillic_io, Cyrillic_IO ] }; + key { [ less, greater ], + [ bar, brokenbar ] }; + key { [ q, Q ], + [ Cyrillic_shorti, Cyrillic_SHORTI ] }; + key { [ 1, exclam ], + [ 1, exclam ] }; + key { [ z, Z ], + [ Cyrillic_ya, Cyrillic_YA ] }; + key { [ s, S ], + [ Cyrillic_yeru, Cyrillic_YERU ] }; + key { [ a, A ], + [ Cyrillic_ef, Cyrillic_EF ] }; + key { [ w, W ], + [ Cyrillic_tse, Cyrillic_TSE ] }; + key { [ 2, at ], + [ 2, quotedbl ] }; + key { [ c, C ], + [ Cyrillic_es, Cyrillic_ES ] }; + key { [ x, X ], + [ Cyrillic_che, Cyrillic_CHE ] }; + key { [ d, D ], + [ Cyrillic_ve, Cyrillic_VE ] }; + key { [ e, E ], + [ Cyrillic_u, Cyrillic_U ] }; + key { [ 4, dollar ], + [ 4, semicolon ] }; + key { [ 3, numbersign ], + [ 3, numbersign ] }; + key { [ v, V ], + [ Cyrillic_em, Cyrillic_EM ] }; + key { [ f, F ], + [ Cyrillic_a, Cyrillic_A ] }; + key { [ t, T ], + [ Cyrillic_ie, Cyrillic_IE ] }; + key { [ r, R ], + [ Cyrillic_ka, Cyrillic_KA ] }; + key { [ 5, percent ], + [ 5, percent ] }; + key { [ n, N ], + [ Cyrillic_te, Cyrillic_TE ] }; + key { [ b, B ], + [ Ukrainian_i, Ukrainian_I ] }; + key { [ h, H ], + [ Cyrillic_er, Cyrillic_ER ] }; + key { [ g, G ], + [ Cyrillic_pe, Cyrillic_PE ] }; + key { [ y, Y ], + [ Cyrillic_en, Cyrillic_EN ] }; + key { [ 6, asciicircum ], + [ 6, colon ] }; + key { [ m, M ], + [Cyrillic_softsign,Cyrillic_SOFTSIGN ] }; + key { [ j, J ], + [ Cyrillic_o, Cyrillic_O ] }; + key { [ u, U ], + [ Cyrillic_ghe, Cyrillic_GHE ] }; + key { [ 7, ampersand ], + [ 7, question ] }; + key { [ 8, asterisk ], + [ 8, asterisk ] }; + key { [ comma, less ], + [ Cyrillic_be, Cyrillic_BE ] }; + key { [ k, K ], + [ Cyrillic_el, Cyrillic_EL ] }; + key { [ i, I ], + [ Cyrillic_sha, Cyrillic_SHA ] }; + key { [ o, O ], + [ Byelorussian_shortu, Byelorussian_SHORTU ] }; + key { [ 0, parenright ], + [ 0, parenright ] }; + key { [ 9, parenleft ], + [ 9, parenleft ] }; + key { [ period, greater ], + [ Cyrillic_yu, Cyrillic_YU ] }; + key { [ slash, question ], + [ period, comma ] }; + key { [ l, L ], + [ Cyrillic_de, Cyrillic_DE ] }; + key { [ semicolon, colon ], + [ Cyrillic_zhe, Cyrillic_ZHE ] }; + key { [ p, P ], + [ Cyrillic_ze, Cyrillic_ZE ] }; + key { [ minus, underscore ], + [ minus, underscore ] }; + key { [ apostrophe, quotedbl ], + [ Cyrillic_e, Cyrillic_E ] }; + key { [ bracketleft, braceleft ], + [ Cyrillic_ha, Cyrillic_HA ] }; + key { [ equal, plus ], + [ equal, plus ] }; + key { [ bracketright, braceright ], + [ apostrophe, apostrophe ] }; + key { [ backslash, bar ], + [ slash, bar ] }; + + // End alphanumeric section + + // Begin modifier mappings + + modifier_map Shift { Shift_L }; + modifier_map Lock { Caps_Lock, ISO_Lock }; + modifier_map Control{ Control_L }; + modifier_map Mod3 { Mode_switch }; +}; + +partial alphanumeric_keys +xkb_symbols "winkeys" { + include "by(basic)" + key { [ 4, dollar ], + [ 4, semicolon ] }; + key { [ 3, numbersign ], + [ 3, numbersign ] }; + key { [ 5, percent ], + [ 5, percent ] }; + key { [ 6, asciicircum ], + [ 6, colon ] }; + key { [ 7, ampersand ], + [ 7, question ] }; + key { [ 8, asterisk ], + [ 8, asterisk ] }; + key { [ slash, question ], + [ period, comma ] }; + key { [ backslash, bar ], + [ slash, bar ] }; +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/ca /opt/SUNWut/lib/xkb/symbols/ca --- /opt/SUNWut.orig/lib/xkb/symbols/ca 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/ca 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,275 @@ +// $Xorg: ca,v 1.3 2000/08/17 19:54:42 cpqbld Exp $ + + + + +// $XFree86: xc/programs/xkbcomp/symbols/ca,v 3.7 2001/01/17 23:45:57 dawes Exp $ + +default partial alphanumeric_keys +xkb_symbols "basic" { + + // Describes the differences between a very simple en_US + // keyboard and a very simple Canadian keyboard + // This layout conforms to the CAN/CSA-Z243.200-92 standard + + name[Group1]= "Canadian"; + + // Alphanumeric section + // CAN/CSA-Z243.200-92 calls this key "AE00" + key { + type[Group1]= "THREE_LEVEL", + symbols[Group1]= [ slash, backslash, bar ], +// The standard calls for a soft hyphen, but X doesn't declare +// a keysym for soft_hyphen. +// symbols[Group2]= [ NoSymbol, soft_hyphen ] + symbols[Group2]= [ NoSymbol, hyphen ] + }; + key { [ 4, dollar ], + [onequarter, currency ] }; + key { [ 6, question ], + [threequarters, fiveeighths ] }; + key { + type[Group1]= "THREE_LEVEL", + symbols[Group1]= [ 7, ampersand, braceleft ], + symbols[Group2]= [ 7, seveneighths ] + }; + key { + type[Group1]= "THREE_LEVEL", + symbols[Group1]= [ 8, asterisk, braceright ], + symbols[Group2]= [ 8, trademark ] + }; + key { + type[Group1]= "THREE_LEVEL", + symbols[Group1]= [ 9, parenleft, bracketleft ], + symbols[Group2]= [ 9, plusminus ] + }; + key { + type[Group1]="THREE_LEVEL", + type[Group2]="THREE_LEVEL", + symbols[Group1]= [ 0, parenright, bracketright ], + symbols[Group2]= [ 0, parenright, bracketright ] + }; + key { + symbols[Group1]= [ minus, underscore ], + symbols[Group2]= [ minus, questiondown ] + }; + key { + type[Group1]="THREE_LEVEL", + symbols[Group1]= [ equal, plus, notsign ], + symbols[Group2]= [ dead_cedilla, dead_ogonek ] + }; +// once again, CAN/CSA-Z243-200.0 defines a key for which there is no +// symbol. +// key { [ e, E ], +// [ oe, OE ] }; + key { + type[Group1]="THREE_LEVEL", + symbols[Group1]=[ dead_circumflex, dead_diaeresis, dead_grave ], + symbols[Group2]=[ NoSymbol, dead_abovering ] + }; + key { + type[Group1]="THREE_LEVEL", + symbols[Group1]=[ ccedilla, Ccedilla, asciitilde ], + symbols[Group2]=[ dead_tilde, dead_macron ] + }; + key { [ d, D ], + [ eth, Dstroke ] }; +// CAN/CSA-Z243.200-92 calls for ij and IJ ligatures on group two of +// this key, but X doesn't define keysyms for them. Put them here but +// comment them out. +// key { [ j, J ], +// [ ij, IJ ] }; + key { [ k, K ], + [ kra ] }; + key { + type[Group1]="THREE_LEVEL", + symbols[Group1]= [ semicolon, colon, degree ], + symbols[Group2]= [ dead_acute, dead_doubleacute ] + }; + key { [ egrave, Egrave ], + [ NoSymbol, dead_caron ] }; +// CAN/CSA-Z243.200-92 calls this key C12 on "47-key" keyboards +// or D13 on "48-key" keyboards. + key { [ agrave, Agrave ], + [ NoSymbol, dead_breve ] }; + key { [ ugrave, Ugrave ], + [ ugrave, brokenbar ] }; + key { + type="THREE_LEVEL", + symbols[Group1]= [ z, Z, guillemotleft ], + symbols[Group2]= [ z, Z, guillemotleft ] + }; + key { + type="THREE_LEVEL", + symbols[Group1]= [ x, X, guillemotright ], + symbols[Group2]= [ x, X, guillemotright ] + }; + key { [ v, V ], + [leftdoublequotemark,leftsinglequotemark] }; + key { [ b, B ], + [rightdoublequotemark,rightsinglequotemark] }; +// Neither apostrophen (apostrophe followed by n) or musical note +// are legal keysyms. Leave the definition here until they get +// defined, but comment it out for now. +// key { [ n, N ], +// [ apostrophen, musicnote ] }; + key { + type[Group1]="THREE_LEVEL", + symbols[Group1]= [ comma, apostrophe, less ], + symbols[Group2]= [ horizconnector, multiply ] + }; + key { + type[Group1]= "THREE_LEVEL", + symbols[Group1]= [ period, quotedbl, greater ], + symbols[Group2]= [ periodcentered, division ] + }; + key { [ eacute, Eacute ], + [ NoSymbol, dead_abovedot ] }; + key { [ ISO_Level3_Shift ] }; + + modifier_map Mod5 { }; + +}; +partial alphanumeric_keys +xkb_symbols "alternate" { + include "ca(basic)" + key { + type[Group1]="THREE_LEVEL", + symbols[Group1]=[slash, backslash,bar], + symbols[Group2]=[dead_diaeresis ] + }; + key { + type[Group1]="THREE_LEVEL", + symbols[Group1]=[7, ampersand,braceleft], + symbols[Group2]=[seveneighths ] + }; + key { + type[Group1]="THREE_LEVEL", + symbols[Group1]=[8, asterisk,braceright], + symbols[Group2]=[trademark ] + }; + key { + type[Group1]="THREE_LEVEL", + symbols[Group1]=[9, parenleft,bracketleft], + symbols[Group2]=[plusminus ] + }; + key { + type[Group1]="THREE_LEVEL", + symbols[Group1]=[0, parenright,bracketright], + symbols[Group2]=[ ] + }; + key { + type[Group1]="THREE_LEVEL", + symbols[Group1]=[equal, plus,notsign], + symbols[Group2]=[dead_cedilla,dead_ogonek] + }; + key { + type[Group1]="THREE_LEVEL", + symbols[Group1]=[dead_circumflex,dead_diaeresis,dead_grave], + symbols[Group2]=[dead_abovering] + }; + key { + type[Group1]="THREE_LEVEL", + symbols[Group1]=[ccedilla,Ccedilla,asciitilde], + symbols[Group2]=[dead_tilde,dead_macron] + }; + key { + type[Group1]="THREE_LEVEL", + symbols[Group1]=[semicolon,colon,degree], + symbols[Group2]=[dead_acute,dead_doubleacute] + }; + key { + type[Group1]="THREE_LEVEL", + symbols[Group1]=[z,Z,guillemotleft], + symbols[Group2]=[ ] + }; + key { + type[Group1]="THREE_LEVEL", + symbols[Group1]=[x,X,guillemotright], + symbols[Group2]=[ ] + }; + key { + type[Group1]="THREE_LEVEL", + symbols[Group1]=[comma,apostrophe,less], + symbols[Group2]=[horizconnector,multiply] + }; + key { + type[Group1]="THREE_LEVEL", + symbols[Group1]=[period,quotedbl,greater], + symbols[Group2]=[periodcentered,division] + }; + key { + type[Group1]="THREE_LEVEL", + symbols[Group1]=[space,space,nobreakspace] + }; + // End alphanumeric section + + // begin modifier mappings + + modifier_map Shift { Shift_L }; + modifier_map Lock { Caps_Lock }; + modifier_map Control{ Control_L }; + modifier_map Mod3 { Mode_switch }; +}; + +partial alphanumeric_keys +xkb_symbols "Sundeadkeys" { + include "ca(basic)" + key { + type[Group1]="THREE_LEVEL", + symbols[Group1]= [ equal, plus, notsign ], + symbols[Group2]= [ SunFA_Cedilla, dead_ogonek ] + }; + key { + type[Group1]="THREE_LEVEL", + symbols[Group1]=[ SunFA_Circum, SunFA_Diaeresis, SunFA_Grave ], + symbols[Group2]=[ NoSymbol, dead_abovering ] + }; + key { + type[Group1]="THREE_LEVEL", + symbols[Group1]=[ ccedilla, Ccedilla, asciitilde ], + symbols[Group2]=[ SunFA_Tilde, dead_macron ] + }; + key { + type[Group1]="THREE_LEVEL", + symbols[Group1]= [ semicolon, colon, degree ], + symbols[Group2]= [ SunFA_Acute, dead_doubleacute ] + }; + +}; + +partial alphanumeric_keys +xkb_symbols "sundeadkeys" { + include "ca(Sundeadkeys)" +}; + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + include "ca(basic)" + key { + type[Group1]="THREE_LEVEL", + symbols[Group1]= [ equal, plus, notsign ], + symbols[Group2]= [ cedilla, ogonek ] + }; + key { + type[Group1]="THREE_LEVEL", + symbols[Group1]=[ asciicircum, diaeresis, grave ], + symbols[Group2]=[ NoSymbol, degree ] + }; + key { + type[Group1]="THREE_LEVEL", + symbols[Group1]=[ ccedilla, Ccedilla, asciitilde ], + symbols[Group2]=[ asciitilde, macron ] + }; + key { + type[Group1]="THREE_LEVEL", + symbols[Group1]= [ semicolon, colon, degree ], + symbols[Group2]= [ acute, doubleacute ] + }; + key { [ egrave, Egrave ], + [ NoSymbol, caron ] }; + key { [ agrave, Agrave ], + [ NoSymbol, breve ] }; + +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/ca_enhanced /opt/SUNWut/lib/xkb/symbols/ca_enhanced --- /opt/SUNWut.orig/lib/xkb/symbols/ca_enhanced 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/ca_enhanced 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,185 @@ +// This file was inspired by XFree86 version 3.3.2 +// as distributed with RedHat Linux 5.1 +// This file was created by Eric Moreau, 1998-09-27 +// I am reachable at eric_moreau@compuserve.com +// +// $XFree86$ +// +// Those are intened to be modifications to the symbols +// defined by /usr/X11R6/lib/X11/xkb/symbols/ca +// +// Most of the french canadian keyboards availables on PCs +// are mapped like this. +// Note that I remaped the ISO9995-3 keyboard but took +// care of not loosing symbols. + +partial alphanumeric_keys +xkb_symbols "basic" { + include "ca(basic)" + key { + type[Group1]="THREE_LEVEL", + symbols[Group1]= [ numbersign, bar, backslash ], + symbols[Group2]= [ backslash, exclamdown ] + }; + key { + type[Group1]="THREE_LEVEL", + symbols[Group1]= [ 1, exclam, plusminus ], + symbols[Group2]= [ plusminus, onesuperior ] + }; + key { + type[Group1]="THREE_LEVEL", + symbols[Group1]= [ 2, quotedbl, at ], + symbols[Group2]= [ at, oneeighth ] + }; + key { + type[Group1]="THREE_LEVEL", + symbols[Group1]= [ 3, slash, sterling ], + symbols[Group2]= [ sterling ] + }; + key { + type[Group1]="THREE_LEVEL", + symbols[Group1]= [ 4, dollar, cent ], + symbols[Group2]= [ cent ] + }; + key { + type[Group1]="THREE_LEVEL", + symbols[Group1]= [ 5, percent, currency ], + symbols[Group2]= [ currency, threeeighths ] + }; + key { + type[Group1]="THREE_LEVEL", + symbols[Group1]= [ 6, question, notsign ], + symbols[Group2]= [ notsign, fiveeighths ] + }; + key { + type[Group1]="THREE_LEVEL", + symbols[Group1]= [ 7, ampersand, brokenbar ], + symbols[Group2]= [ brokenbar, seveneighths ] + }; + key { + type[Group1]="THREE_LEVEL", + symbols[Group1]= [ 8, asterisk, twosuperior ], + symbols[Group2]= [ twosuperior, trademark ] + }; + key { + type[Group1]="THREE_LEVEL", + symbols[Group1]= [ 9, parenleft, threesuperior ], + symbols[Group2]= [ threesuperior ] + }; + key { + type[Group1]="THREE_LEVEL", + symbols[Group1]= [ 0, parenright, onequarter ], + symbols[Group2]= [ onequarter ] + }; + key { + type[Group1]="THREE_LEVEL", + symbols[Group1]= [ minus, underscore, onehalf ], + symbols[Group2]= [ onehalf, questiondown ] + }; + key { + type[Group1]="THREE_LEVEL", + symbols[Group1]= [ equal, plus, threequarters ], + symbols[Group2]= [ threequarters, dead_ogonek ] + }; + + key { + symbols[Group1]= [ q, Q ], + symbols[Group2]= [ oslash, Ooblique ] + }; + key { + symbols[Group1]= [ r, R ], + symbols[Group2]= [ thorn, Thorn ] + }; + key { + type[Group1]="THREE_LEVEL", + symbols[Group1]= [ o, O, section ], + symbols[Group2]= [ section, Greek_OMEGA ] + }; + key { + type[Group1]="THREE_LEVEL", + symbols[Group1]= [ p, P, paragraph ], + symbols[Group2]= [ paragraph, registered ] + }; + key { + type[Group1]="THREE_LEVEL", + symbols[Group1]= [ dead_circumflex, dead_circumflex, bracketleft ], + symbols[Group2]= [ bracketleft, dead_abovering ] + }; + key { + type[Group1]="THREE_LEVEL", + symbols[Group1]= [ dead_cedilla, dead_diaeresis, bracketright ], + symbols[Group2]= [ bracketright, horizconnector ] + }; + + key { + type[Group1]="THREE_LEVEL", + symbols[Group1]= [ semicolon, colon, asciitilde ], + symbols[Group2]= [ asciitilde, dead_doubleacute ] + }; + key { + type[Group1]="THREE_LEVEL", + symbols[Group1]= [ dead_grave, dead_grave, braceleft ], + symbols[Group2]= [ braceleft, dead_caron ] + }; + + key { + symbols[Group1]= [ z, Z ], + symbols[Group2]= [ dead_belowdot, dead_abovedot ] + }; + key { + type[Group1]="THREE_LEVEL", + symbols[Group1]= [ m, M, mu ], + symbols[Group2]= [ mu, masculine ] + }; + key { + type[Group1]="THREE_LEVEL", + symbols[Group1]= [ comma, quoteright, horizconnector ], + symbols[Group2]= [ dead_macron, multiply ] + }; + key { + type[Group1]="THREE_LEVEL", + symbols[Group1]= [ period, period, periodcentered ], + symbols[Group2]= [ periodcentered, division ] + }; + key { + type[Group1]="THREE_LEVEL", + symbols[Group1]= [ eacute, Eacute, dead_acute ], + symbols[Group2]= [ dead_acute ] + }; + key { + type[Group1]="THREE_LEVEL", + symbols[Group1]= [ less, greater, braceright ], + symbols[Group2]= [ braceright, dead_breve ] + }; + + key { + type[Group1]="THREE_LEVEL", + symbols[Group1]= [ guillemotleft, guillemotright, degree ], + symbols[Group2]= [ degree ] + }; +}; + +partial alphanumeric_keys +xkb_symbols "Sundeadkeys" { + include "ca_enhanced(basic)" + key { + type[Group1]="THREE_LEVEL", + symbols[Group1]= [ SunFA_Circum, SunFA_Circum, bracketleft ], + symbols[Group2]= [ bracketleft, dead_abovering ] + }; + key { + type[Group1]="THREE_LEVEL", + symbols[Group1]= [ SunFA_Cedilla, SunFA_Diaeresis, bracketright ], + symbols[Group2]= [ bracketright, horizconnector ] + }; + key { + type[Group1]="THREE_LEVEL", + symbols[Group1]= [ SunFA_Grave, SunFA_Grave, braceleft ], + symbols[Group2]= [ braceleft, dead_caron ] + }; +}; + +partial alphanumeric_keys +xkb_symbols "sundeadkeys" { + include "ca_enhanced(Sundeadkeys)" +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/capslock /opt/SUNWut/lib/xkb/symbols/capslock --- /opt/SUNWut.orig/lib/xkb/symbols/capslock 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/capslock 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,20 @@ +// $XdotOrg$ +// $XKeyboardConfig: xkbdesc/symbols/capslock,v 1.3 2004/10/09 17:31:42 svu Exp $ + +default partial hidden modifier_keys +xkb_symbols "capslock" { + key { [ Caps_Lock ] }; + modifier_map Lock { Caps_Lock }; +}; + +partial hidden modifier_keys +xkb_symbols "shiftlock" { + key { [ Shift_Lock ] }; + modifier_map Shift { Shift_Lock }; +}; + +partial hidden modifier_keys +xkb_symbols "grouplock" { + key { [ ISO_Next_Group, Caps_Lock ] }; +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/compose /opt/SUNWut/lib/xkb/symbols/compose --- /opt/SUNWut.orig/lib/xkb/symbols/compose 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/compose 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,29 @@ +// $XdotOrg$ +// $XKeyboardConfig: xkbdesc/symbols/compose,v 1.4 2005/07/30 23:29:11 svu Exp $ + +// $XFree86: xc/programs/xkbcomp/symbols/compose,v 1.1 2001/08/17 16:31:25 dawes Exp $ + +partial modifier_keys +xkb_symbols "ralt" { + key { type[Group1]="TWO_LEVEL", [ Multi_key, Multi_key ] }; +}; + +partial modifier_keys +xkb_symbols "rwin" { + key { type[Group1]="TWO_LEVEL", [ Multi_key, Multi_key ] }; +}; + +partial modifier_keys +xkb_symbols "menu" { + key { type[Group1]="TWO_LEVEL", [ Multi_key, Multi_key ] }; +}; + +partial modifier_keys +xkb_symbols "rctrl" { + key { type[Group1]="TWO_LEVEL", [ Multi_key, Multi_key ] }; +}; + +partial modifier_keys +xkb_symbols "caps" { + key { type[Group1]="TWO_LEVEL", [ Multi_key, Multi_key ] }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/ctrl /opt/SUNWut/lib/xkb/symbols/ctrl --- /opt/SUNWut.orig/lib/xkb/symbols/ctrl 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/ctrl 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,39 @@ +// $XFree86$ +// +// eliminate the caps lock key completely (replace with control) +partial modifier_keys +xkb_symbols "nocaps" { + key { symbols[Group1]= [ Control_L ] }; + modifier_map Control { , }; +}; + +// swap the caps lock key with the left control key +partial modifier_keys +xkb_symbols "swapcaps" { + key { symbols[Group1]= [ Control_L ] }; + key { symbols[Group1]= [ Caps_Lock ] }; +}; + +// moves the control key to the middle row and the caps lock +// to the bottom row. Only works if the geometry or keycodes +// file has defined appropriate aliases for the keys in question. +partial modifier_keys +xkb_symbols "ctrl_ac" { + key { symbols[Group1]= [ Control_L ] }; + key { symbols[Group1]= [ Caps_Lock ] }; +}; + +// Moves the control key to the bottom row and the caps lock +// to the middle row. Only works if the geometry or keycodes +// file has defined appropriate aliases for the keys in question. +partial modifier_keys +xkb_symbols "ctrl_aa" { + key { symbols[Group1]= [ Control_L ] }; + key { symbols[Group1]= [ Caps_Lock ] }; +}; + +// Right Ctrl works as Right Alt +partial modifier_keys +xkb_symbols "ctrl_ra" { + key { symbols[Group1]= [ Alt_R ] }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/cz /opt/SUNWut/lib/xkb/symbols/cz --- /opt/SUNWut.orig/lib/xkb/symbols/cz 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/cz 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,147 @@ +// $XFree86: xc/programs/xkbcomp/symbols/cz,v 1.1 2001/05/18 23:35:35 dawes Exp $ + +partial alphanumeric_keys +xkb_symbols "basic" { + + // Describes the differences between a very simple en_US + // keyboard and a Czech keyboard + // This layout conforms to a new cz compromise standard designed + // to satisfy most unix, windows and mac users. + // 2001 by Kamil Toman + + // Switching to US added by Jan Holesovsky , 2001 + + include "us_group2(basic)" + include "group(shift_toggle)" + + name[Group1]= "Czech"; + + key.type = "FOUR_LEVEL"; + + key { [ semicolon, dead_abovering, + grave, asciitilde ] }; + key { [ plus, 1, + exclam, dead_tilde ] }; + key { [ ecaron, 2, + at, dead_caron ] }; + key { [ scaron, 3, + numbersign, dead_circumflex ] }; + key { [ ccaron, 4, + dollar, dead_breve ] }; + key { [ rcaron, 5, + percent, dead_abovering ] }; + key { [ zcaron, 6, + asciicircum, dead_ogonek ] }; + key { [ yacute, 7, + ampersand, dead_grave ] }; + key { [ aacute, 8, + asterisk, dead_abovedot ] }; + key { [ iacute, 9, + braceleft, dead_acute ] }; + key { [ eacute, 0, + braceright, dead_doubleacute ] }; + key { [ equal, percent, + NoSymbol, dead_diaeresis ] }; + key { [ dead_acute, dead_caron, + dead_macron, dead_cedilla ] }; + + key { [ q, Q, + backslash, NoSymbol ] }; + key { [ w, W, + bar, Nosymbol ] }; + key { [ e, E, + EuroSign, NoSymbol ] }; + key { [ r, R, + NoSymbol, NoSymbol ] }; + key { [ t, T, + NoSymbol, NoSymbol ] }; + key { [ z, Z, + NoSymbol, NoSymbol ] }; + key { [ u, U, + NoSymbol, NoSymbol ] }; + key { [ i, I, + NoSymbol, NoSymbol ] }; + key { [ o, O, + NoSymbol, NoSymbol ] }; + key { [ p, P, + NoSymbol, NoSymbol ] }; + + key { [ uacute, slash, + bracketleft, division ] }; + key { [ parenright, parenleft, + bracketright, multiply ] }; + + key { [ a, A, + asciitilde, NoSymbol ] }; + key { [ s, S, + dstroke, NoSymbol ] }; + key { [ d, D, + Dstroke, NoSymbol ] }; + key { [ f, F, + bracketleft, NoSymbol ] }; + key { [ g, G, + bracketright, NoSymbol ] }; + key { [ h, H, + grave, NoSymbol ] }; + key { [ j, J, + apostrophe, NoSymbol ] }; + key { [ k, K, + lstroke, NoSymbol ] }; + key { [ l, L, + Lstroke, NoSymbol ] }; + + key { [ uring, quotedbl, + dollar, NoSymbol ] }; + key { [ section, exclam, + apostrophe, ssharp ] }; + key { [ EuroSign, dead_diaeresis, + NoSymbol, NoSymbol ] }; + key { [ dead_diaeresis, apostrophe, + backslash, bar ] }; + + key { [ backslash, bar, + slash, NoSymbol ] }; + key { [ y, Y, + degree, NoSymbol ] }; + key { [ x, X, + numbersign, Nosymbol ] }; + key { [ c, C, + ampersand, NoSymbol ] }; + key { [ v, V, + at, NoSymbol ] }; + key { [ b, B, + braceleft, NoSymbol ] }; + key { [ n, N, + braceright, NoSymbol ] }; + key { [ m, M, + asciicircum, NoSymbol ] }; + key { [ comma, question, + less, NoSymbol ] }; + key { [ period, colon, + greater, NoSymbol ] }; + key { [ minus, underscore, + asterisk, NoSymbol ] }; + + key { [ space, space, + nobreakspace, nobreakspace ] }; + +// KP_Separator should produce a comma as KP_Decimal produces a "." +// independent of the locale selected. + key { type="FOUR_LEVEL_KEYPAD", [ KP_Delete, KP_Separator, + KP_Delete, KP_Decimal], + // hack a decimal dot into the second (US) group + // Martin Vidner + [ KP_Delete, KP_Decimal, + KP_Delete, KP_Separator] }; + + key { type="TWO_LEVEL", [ ISO_Level3_Shift, ISO_Level3_Shift ] }; + modifier_map Mod5 { }; + +}; + + // Use instead of (useful for keyboard without key) +xkb_symbols "bksl" { + include "cz(basic)" + key { [ backslash, bar, + slash, NoSymbol ] }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/cz_qwerty /opt/SUNWut/lib/xkb/symbols/cz_qwerty --- /opt/SUNWut.orig/lib/xkb/symbols/cz_qwerty 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/cz_qwerty 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,16 @@ +// $XFree86: xc/programs/xkbcomp/symbols/cz_qwerty,v 1.1 2001/05/18 23:35:35 dawes Exp $ + +partial alphanumeric_keys +xkb_symbols "basic" { + + // This layout should work exactly as a cz with the exception + // of 'Z' and 'Y' keys, which are in the qwerty style (ie. swapped). + // 2001 by Kamil Toman + + include "cz(basic)" + + key { [ z, Z, + degree, NoSymbol ] }; + key { [ y, Y, + NoSymbol, NoSymbol ] }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/czsk /opt/SUNWut/lib/xkb/symbols/czsk --- /opt/SUNWut.orig/lib/xkb/symbols/czsk 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/czsk 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,730 @@ +// Czech and Slovak keyboard symbols for XKB and PC keyboard +// +// (C) 1997,1999 Stanislav Meduna, stano@eunet.sk +// (C) 2000 Kamil Toman, ktoman@email.cz +// +// Permission is granted to anyone to use, distribute and modify +// this file in any way, provided that the above copyright notice +// is left intact and the author of the modification summarizes +// the changes in this header. +// +// This file is distributed without any expressed or implied warranty. +// +// $XFree86: xc/programs/xkbcomp/symbols/czsk,v 1.8 2002/11/20 04:49:03 dawes Exp $ + +partial default alphanumeric_keys +xkb_symbols "us_sk_qwerty" { + Name[Group1] = "US/ASCII"; + Name[Group2] = "Slovak"; + + include "czsk(def_qwerty)" + include "czsk(def_us_sk)" +}; + +partial alphanumeric_keys +xkb_symbols "us_sk_qwertz" { + Name[Group1] = "US/ASCII"; + Name[Group2] = "Slovak"; + + include "czsk(def_us_qwertz)" + include "czsk(def_us_sk)" +}; + +partial alphanumeric_keys +xkb_symbols "sk_us_qwerty" { + Name[Group1] = "Slovak"; + Name[Group2] = "US/ASCII"; + + include "czsk(def_qwerty)" + include "czsk(def_sk_us)" +}; + +partial alphanumeric_keys +xkb_symbols "sk_us_qwertz" { + Name[Group1] = "Slovak"; + Name[Group2] = "US/ASCII"; + + include "czsk(def_qwertz_us)" + include "czsk(def_sk_us)" +}; + +partial alphanumeric_keys +xkb_symbols "us_sk_prog" { + Name[Group1] = "US/ASCII"; + Name[Group2] = "Slovak"; + + include "czsk(def_basic)" + include "czsk(def_qwerty)" + include "czsk(def_us_sk_prog)" +}; + +partial alphanumeric_keys +xkb_symbols "sk_us_prog" { + Name[Group1] = "Slovak"; + Name[Group2] = "US/ASCII"; + + include "czsk(def_basic)" + include "czsk(def_qwerty)" + include "czsk(def_sk_us_prog)" +}; + +partial alphanumeric_keys +xkb_symbols "us_cz_qwerty" { + Name[Group1] = "US/ASCII"; + Name[Group2] = "Czech"; + + include "czsk(def_qwerty)" + include "czsk(def_us_cz)" +}; + +partial alphanumeric_keys +xkb_symbols "us_cz_qwertz" { + Name[Group1] = "US/ASCII"; + Name[Group2] = "Czech"; + + include "czsk(def_us_qwertz)" + include "czsk(def_us_cz)" +}; + +partial alphanumeric_keys +xkb_symbols "cz_us_qwerty" { + Name[Group1] = "Czech"; + Name[Group2] = "US/ASCII"; + + include "czsk(def_qwerty)" + include "czsk(def_cz_us)" +}; + +partial alphanumeric_keys +xkb_symbols "cz_us_qwertz" { + Name[Group1] = "Czech"; + Name[Group2] = "US/ASCII"; + + include "czsk(def_qwertz_us)" + include "czsk(def_cz_us)" +}; + +partial alphanumeric_keys +xkb_symbols "us_cz_prog" { + Name[Group1] = "US/ASCII"; + Name[Group2] = "Czech"; + + include "czsk(def_basic)" + include "czsk(def_qwerty)" + include "czsk(def_us_cz_prog)" +}; + +partial alphanumeric_keys +xkb_symbols "cz_us_prog" { + Name[Group1] = "Czech"; + Name[Group2] = "US/ASCII"; + + include "czsk(def_basic)" + include "czsk(def_qwerty)" + include "czsk(def_cz_us_prog)" +}; + +partial alphanumeric_keys +xkb_symbols "def_us_sk" { + include "czsk(def_basic)" + include "czsk(def_us_czsk)" + include "czsk(def_us_sk_prog)" + include "czsk(def_us_sk_rp)" +}; + +partial alphanumeric_keys +xkb_symbols "def_sk_us" { + include "czsk(def_basic)" + include "czsk(def_czsk_us)" + include "czsk(def_sk_us_prog)" + include "czsk(def_sk_us_rp)" +}; + +partial alphanumeric_keys +xkb_symbols "def_us_cz" { + include "czsk(def_basic)" + include "czsk(def_us_czsk)" + include "czsk(def_us_cz_prog)" + include "czsk(def_us_cz_rp)" +}; + +partial alphanumeric_keys +xkb_symbols "def_cz_us" { + include "czsk(def_basic)" + include "czsk(def_czsk_us)" + include "czsk(def_cz_us_prog)" + include "czsk(def_cz_us_rp)" +}; + +partial alphanumeric_keys +xkb_symbols "def_basic" { + + include "group(shift_toggle)" + include "srvr_ctrl(xfree86)" + + // Alphanumeric keys identical to US + key { [ Escape ], + [ Escape ] }; + + key { + type="CTRL+ALT", + symbols[Group1]= [ BackSpace, Terminate_Server ] + }; + + key { [ grave, asciitilde ], + [ grave, asciitilde ] }; + + + key { [ Tab, ISO_Left_Tab ], + [ Tab, ISO_Left_Tab ] }; + key { [ q, Q ], + [ q, Q ] }; + key { [ w, W ], + [ w, W ] }; + key { [ e, E ], + [ e, E ] }; + key { [ r, R ], + [ r, R ] }; + key { [ t, T ], + [ t, T ] }; + key { [ u, U ], + [ u, U ] }; + key { [ i, I ], + [ i, I ] }; + key { [ o, O ], + [ o, O ] }; + key { [ p, P ], + [ p, P ] }; + key { [ Return ], + [ Return ] }; + + key { [ Caps_Lock ], + [ Caps_Lock ] }; + key { [ a, A ], + [ a, A ] }; + key { [ s, S ], + [ s, S ] }; + key { [ d, D ], + [ d, D ] }; + key { [ f, F ], + [ f, F ] }; + key { [ g, G ], + [ g, G ] }; + key { [ h, H ], + [ h, H ] }; + key { [ j, J ], + [ j, J ] }; + key { [ k, K ], + [ k, K ] }; + key { [ l, L ], + [ l, L ] }; + + key { [ Shift_L ], + [ Shift_L ] }; + key { [ x, X ], + [ x, X ] }; + key { [ c, C ], + [ c, C ] }; + key { [ v, V ], + [ v, V ] }; + key { [ b, B ], + [ b, B ] }; + key { [ n, N ], + [ n, N ] }; + key { [ m, M ], + [ m, M ] }; + key { [ backslash, bar ], + [ backslash, bar ] }; + + key { [ Control_L ], + [ Control_L ] }; + key { [ space ], + [ space ] }; + + key { [ less, greater ], + [ less, greater ] }; + + key { [ Alt_L ], + [ Meta_L ] }; + key { [ Meta_L ], + [ Meta_L ] }; + key { [ Meta_R ], + [ Meta_R ] }; + key { [ Menu ], + [ Menu ] }; + // End alphanumeric section + + // begin modifier mappings + + modifier_map Shift { Shift_L, Shift_R }; + modifier_map Lock { Caps_Lock }; + modifier_map Control{ Control_L, Control_R }; + modifier_map Mod3 { Mode_switch }; + + // Begin "Function" section + key { [ F1 ], + [ F1 ] }; + key { [ F2 ], + [ F2 ] }; + key { [ F3 ], + [ F3 ] }; + key { [ F4 ], + [ F4 ] }; + key { [ F5 ], + [ F5 ] }; + key { [ F6 ], + [ F6 ] }; + key { [ F7 ], + [ F7 ] }; + key { [ F8 ], + [ F8 ] }; + key { [ F9 ], + [ F9 ] }; + key { [ F10 ], + [ F10 ] }; + key { [ F11 ], + [ F11 ] }; + key { [ F12 ], + [ F12 ] }; + // End "Function" section + + // Begin "Editing" section + key { + type= "PC_SYSRQ", + symbols[Group1]= [ Print, Sys_Req ] + }; + + key { [ Multi_key ] }; + key { [ Mode_switch, Multi_key ] }; + key { [ ISO_Next_Group, ISO_Next_Group ] }; + + // Gray keys + + key { [ Insert ], + [ Insert ] }; + key { [ Home ], + [ Home ] }; + key { [ Prior ], + [ Prior ] }; + key { [ Delete ], + [ Delete ] }; + key { [ End ], + [ End ] }; + key { [ Next ], + [ Next ] }; + + // Cursor keys + key { [ Up ], + [ Up ] }; + key { [ Left ], + [ Left ] }; + key { [ Down ], + [ Down ] }; + key { [ Right ], + [ Right ] }; + + + // Keypad keys + key { [ Num_Lock, Pointer_EnableKeys ], + [ Num_Lock, Pointer_EnableKeys ]}; + key { [ KP_Divide ], + [ KP_Divide ] }; + key { [ KP_Multiply ], + [ KP_Multiply ] }; + key { [ KP_Subtract ], + [ KP_Subtract ] }; + + key { [ KP_Home, KP_7 ], + [ KP_Home, KP_7 ] }; + key { [ KP_Up, KP_8 ], + [ KP_Up, KP_8 ] }; + key { [ KP_Prior, KP_9 ], + [ KP_Prior, KP_9 ] }; + key { [ KP_Add ], + [ KP_Add ] }; + + key { [ KP_Left, KP_4 ], + [ KP_Left, KP_4 ] }; + key { [ KP_Begin, KP_5 ], + [ KP_Begin, KP_5 ] }; + key { [ KP_Right, KP_6 ], + [ KP_Right, KP_6 ] }; + + key { [ KP_End, KP_1 ], + [ KP_End, KP_1 ] }; + key { [ KP_Down, KP_2 ], + [ KP_Down, KP_2 ] }; + key { [ KP_Next, KP_3 ], + [ KP_Next, KP_3 ] }; + key { [ KP_Enter ], + [ KP_Enter ] }; + + key { [ KP_Insert, KP_0 ], + [ KP_Insert, KP_0 ] }; + key { [ KP_Delete, KP_Decimal ], + [ KP_Delete, KP_Decimal ] }; +}; + +partial alphanumeric_keys +xkb_symbols "def_czsk_us" { + key { + [ equal, percent ], + [ minus, underscore ] + }; + key { + [ uacute, slash ], + [ bracketleft, braceleft ] + }; + key { + [ section, exclam ], + [ apostrophe, quotedbl ] + }; + key { + [ comma, question ], + [ comma, less ] + }; + key { + [ period, colon ], + [ period, greater ] + }; + key { + [ minus, underscore ], + [ slash, question ] + }; +}; + +partial alphanumeric_keys +xkb_symbols "def_us_czsk" { + key { + [ minus, underscore ], + [ equal, percent ] + }; + key { + [ bracketleft, braceleft ], + [ uacute, slash ] + }; + key { + [ apostrophe, quotedbl ], + [ section, exclam ] + }; + key { + [ comma, less ], + [ comma, question ] + }; + key { + [ period, greater ], + [ period, colon ] + }; + key { + [ slash, question ], + [ minus, underscore ] + }; +}; + +partial alphanumeric_keys +xkb_symbols "def_sk_us_rp" { + key { + [ ocircumflex, quotedbl ], + [ semicolon, colon ] + }; + key { + [ adiaeresis, parenleft ], + [ bracketright, braceright ] + }; + key { + [ ncaron, parenright ], + [ backslash, bar ] + }; +}; + +partial alphanumeric_keys +xkb_symbols "def_cz_us_rp" { + key { + [ uring, quotedbl ], + [ semicolon, colon ] + }; + key { + [ parenright, parenleft ], + [ bracketright, braceright ] + }; + key { + [ backslash, bar ], + [ backslash, bar ] + }; +}; + +partial alphanumeric_keys +xkb_symbols "def_us_sk_rp" { + key { + [ semicolon, colon ], + [ ocircumflex, quotedbl ] + }; + key { + [ bracketright, braceright ], + [ adiaeresis, parenleft ] + }; + key { + [ backslash, bar ], + [ ncaron, parenright ] + }; +}; + +partial alphanumeric_keys +xkb_symbols "def_us_cz_rp" { + key { + [ semicolon, colon ], + [ uring, quotedbl ] + }; + key { + [ bracketright, braceright ], + [ parenright, parenleft ] + }; + key { + [ backslash, bar ], + [ backslash, bar ] + }; +}; + +partial alphanumeric_keys +xkb_symbols "def_qwertz_us" { + key { + [ z, Z ], + [ y, Y ] + }; + key { + [ y, Y ], + [ z, Z ] + }; +}; + +partial alphanumeric_keys +xkb_symbols "def_us_qwertz" { + key { + [ y, Y ], + [ z, Z ] + }; + key { + [ z, Z ], + [ y, Y ] + }; +}; + +partial alphanumeric_keys +xkb_symbols "def_qwerty" { + key { + [ y, Y ], + [ y, Y ] + }; + key { + [ z, Z ], + [ z, Z ] + }; +}; + +partial alphanumeric_keys +xkb_symbols "def_us_sk_prog" { + key { + [ grave, asciitilde ], + [ dead_diaeresis, semicolon ] + }; + key { + [ 1, exclam ], + [ plus, 1 ] + }; + key { + [ 2, at ], + [ lcaron, 2 ] + }; + key { + [ 3, numbersign ], + [ scaron, 3 ] + }; + key { + [ 4, dollar ], + [ ccaron, 4 ] + }; + key { + [ 5, percent ], + [ tcaron, 5 ] + }; + key { + [ 6, asciicircum ], + [ zcaron, 6 ] + }; + key { + [ 7, ampersand ], + [ yacute, 7 ] + }; + key { + [ 8, asterisk ], + [ aacute, 8 ] + }; + key { + [ 9, parenleft ], + [ iacute, 9 ] + }; + key { + [ 0, parenright ], + [ eacute, 0 ] + }; + key { + [ equal, plus ], + [ dead_acute, dead_caron ] + }; +}; + +partial alphanumeric_keys +xkb_symbols "def_us_cz_prog" { + key { + [ grave, asciitilde ], + [ dead_diaeresis, semicolon ] + }; + key { + [ 1, exclam ], + [ plus, 1 ] + }; + key { + [ 2, at ], + [ ecaron, 2 ] + }; + key { + [ 3, numbersign ], + [ scaron, 3 ] + }; + key { + [ 4, dollar ], + [ ccaron, 4 ] + }; + key { + [ 5, percent ], + [ rcaron, 5 ] + }; + key { + [ 6, asciicircum ], + [ zcaron, 6 ] + }; + key { + [ 7, ampersand ], + [ yacute, 7 ] + }; + key { + [ 8, asterisk ], + [ aacute, 8 ] + }; + key { + [ 9, parenleft ], + [ iacute, 9 ] + }; + key { + [ 0, parenright ], + [ eacute, 0 ] + }; + key { + [ equal, plus ], + [ dead_acute, dead_caron ] + }; +}; + +partial alphanumeric_keys +xkb_symbols "def_sk_us_prog" { + key { + [ dead_diaeresis, semicolon ], + [ grave, asciitilde ] + }; + key { + [ plus, 1 ], + [ 1, exclam ] + }; + key { + [ lcaron, 2 ], + [ 2, at ] + }; + key { + [ scaron, 3 ], + [ 3, numbersign ] + }; + key { + [ ccaron, 4 ], + [ 4, dollar ] + }; + key { + [ tcaron, 5 ], + [ 5, percent ] + }; + key { + [ zcaron, 6 ], + [ 6, asciicircum ] + }; + key { + [ yacute, 7 ], + [ 7, ampersand ] + }; + key { + [ aacute, 8 ], + [ 8, asterisk ] + }; + key { + [ iacute, 9 ], + [ 9, parenleft ] + }; + key { + [ eacute, 0 ], + [ 0, parenright ] + }; + key { + [ dead_acute, dead_caron ], + [ equal, plus ] + }; +}; + +partial alphanumeric_keys +xkb_symbols "def_cz_us_prog" { + key { + [ dead_diaeresis, semicolon ], + [ grave, asciitilde ] + }; + key { + [ plus, 1 ], + [ 1, exclam ] + }; + key { + [ ecaron, 2 ], + [ 2, at ] + }; + key { + [ scaron, 3 ], + [ 3, numbersign ] + }; + key { + [ ccaron, 4 ], + [ 4, dollar ] + }; + key { + [ rcaron, 5 ], + [ 5, percent ] + }; + key { + [ zcaron, 6 ], + [ 6, asciicircum ] + }; + key { + [ yacute, 7 ], + [ 7, ampersand ] + }; + key { + [ aacute, 8 ], + [ 8, asterisk ] + }; + key { + [ iacute, 9 ], + [ 9, parenleft ] + }; + key { + [ eacute, 0 ], + [ 0, parenright ] + }; + key { + [ dead_acute, dead_caron ], + [ equal, plus ] + }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/de /opt/SUNWut/lib/xkb/symbols/de --- /opt/SUNWut.orig/lib/xkb/symbols/de 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/de 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,173 @@ +// $Xorg: de,v 1.3 2000/08/17 19:54:42 cpqbld Exp $ + + + + +// $XFree86: xc/programs/xkbcomp/symbols/de,v 3.14 2003/09/08 13:12:37 pascal Exp $ + +default partial alphanumeric_keys +xkb_symbols "basic" { + + // Describes the differences between a very simple US/ASCII + // keyboard and a very simple German keyboard + + // Alphanumeric section + name[Group1]= "German"; + key { [ dead_circumflex, degree ], + [ notsign ] }; + key { [ 2, quotedbl ], + [ twosuperior ] }; + key { [ 3, section ], + [ threesuperior,sterling ] }; + key { [ 4, dollar ], + [ onequarter, currency ] }; + key { [ 5, percent ], + [ onehalf ] }; + key { [ 6, ampersand ], + [ threequarters ] }; + key { [ 7, slash ], + [ braceleft ] }; + key { [ 8, parenleft ], + [ bracketleft ] }; + key { [ 9, parenright ], + [ bracketright, plusminus ] }; + key { [ 0, equal ], + [ braceright, degree ] }; + key { [ ssharp, question ], + [ backslash, questiondown ] }; + key { [ dead_acute, dead_grave ], + [ dead_cedilla, dead_ogonek ] }; + + key { [ q, Q ], + [ at ] }; + key { [ e, E ], + [ EuroSign ] }; + key { [ t, T ] }; + key { [ z, Z ] }; + key { [ u, U ] }; + key { [ i, I ] }; + key { [ udiaeresis, Udiaeresis ], + [ dead_diaeresis ] }; + key { [ plus, asterisk ], + [ dead_tilde, dead_macron ] }; + key { [ f, F ] }; + key { [ g, G ] }; + key { [ odiaeresis, Odiaeresis ], + [ dead_doubleacute ] }; + key { [ adiaeresis, Adiaeresis ], + [ dead_circumflex ] }; + + key { [ less, greater ], + [ bar ] }; + key { [ y, Y ], + [ guillemotleft,less ] }; + key { [ m, M ], + [ mu ] }; + key { [ comma, semicolon ] }; + key { [ period, colon ], + [ periodcentered, division ] }; + key { [ minus, underscore ] }; + key { [ numbersign, apostrophe ], + [ dead_grave ] }; + key { [ Mode_switch, Multi_key ] }; + + // End alphanumeric section, begin "Keypad" + key { [ KP_Delete, KP_Separator ] }; + // End "Keypad" section + + // begin modifier mappings + modifier_map Shift { Shift_L }; + modifier_map Lock { Caps_Lock }; + modifier_map Control{ Control_L }; + modifier_map Mod3 { Mode_switch }; +}; + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + // modify the default German layout to not have any dead keys + include "de(basic)" + key { [ asciicircum, degree ], + [ notsign ] }; + key { [ apostrophe, grave ], + [ cedilla ] }; + key { [ udiaeresis, Udiaeresis ], + [ diaeresis ] }; + key { [ plus, asterisk ], + [ asciitilde, macron ] }; + key { [ odiaeresis, Odiaeresis ], + [ doubleacute ] }; + key { [ adiaeresis, Adiaeresis ], + [ asciicircum ] }; + + key { [ numbersign, apostrophe ], + [ grave ] }; +}; + +partial alphanumeric_keys +xkb_symbols "deadgraveacute" { + // modify the default German layout to have only acute and grave + // as dead keys (tilde and circumflex are needed as spacing characters + // in many programming languages) + include "de(basic)" + key { [ asciicircum, degree ], + [ notsign ] }; + key { [ plus, asterisk ], + [ asciitilde, dead_macron ] }; + key { [ numbersign, apostrophe ], + [ grave ] }; +}; + +partial alphanumeric_keys +xkb_symbols "deadacute" { + // modify the default German layout to have only acute as + // dead keys (ASCII grave, tilde and circumflex are needed as + // spacing characters in many programming languages and text formatters) + include "de(deadgraveacute)" + key { [ dead_acute, grave ], + [ dead_cedilla, dead_ogonek ] }; + key { [ numbersign, apostrophe ], + [ dead_grave ] }; +}; + +partial alphanumeric_keys +xkb_symbols "de_ro" { + // add romanian-specific characters to the basic German layout. + // Romanian symbols are accessible with combination of and + // 'a', 's', 't', 'i', 'ä (ä)' (+ for capital letters). + // To view romanian specific symbols, add "export LC_CTYPE=ro_RO" + // or "export LC_CTYPE=de_DE.utf8" to your .profile. + + include "de(basic)" + + name[Group1]="Romanian for German keyboard"; + + key { [ t, T ], + [ tcedilla, Tcedilla ] }; + key { [ i, I ], + [ icircumflex, Icircumflex ] }; + key { [ a, A ], + [ acircumflex, Acircumflex ] }; + key { [ s, S ], + [ scedilla, Scedilla ] }; + key { [ adiaeresis, Adiaeresis ], + [ abreve, Abreve ] }; +}; + +partial alphanumeric_keys +xkb_symbols "de_ro_nodeadkeys" { + // add romanian-specific characters to the "nodeadkeys" German layout. + // Read the comment for de_ro ! + + include "de(nodeadkeys)" + + key { [ t, T ], + [ tcedilla, Tcedilla ] }; + key { [ i, I ], + [ icircumflex, Icircumflex ] }; + key { [ a, A ], + [ acircumflex, Acircumflex ] }; + key { [ s, S ], + [ scedilla, Scedilla ] }; + key { [ adiaeresis, Adiaeresis ], + [ abreve, Abreve ] }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/de_CH /opt/SUNWut/lib/xkb/symbols/de_CH --- /opt/SUNWut.orig/lib/xkb/symbols/de_CH 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/de_CH 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,94 @@ +// $Xorg: de_CH,v 1.3 2000/08/17 19:54:42 cpqbld Exp $ + + + + +// $XFree86: xc/programs/xkbcomp/symbols/de_CH,v 3.4 2000/01/21 01:12:27 dawes Exp $ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + // Describes the differences between a very simple US/ASCII + // keyboard and a very simple Swiss keyboard + + // Alphanumeric section + name[Group1]= "Swiss German"; + key { [ section, degree ] }; + key { [ 1, plus ], + [ bar, exclamdown ] }; + key { [ 2, quotedbl ], + [ at, oneeighth ] }; + key { [ 3, asterisk ], + [ numbersign ] }; + key { [ 4, ccedilla ] }; + key { [ 5, percent ] }; + key { [ 6, ampersand ], + [ notsign ] }; + key { [ 7, slash ], + [ brokenbar ] }; + key { [ 8, parenleft ], + [ cent ] }; + key { [ 9, parenright ] }; + key { [ 0, equal ] }; + key { [ apostrophe, question ], + [ dead_acute ] }; + key { [ dead_circumflex, dead_grave ], + [ dead_tilde ] }; + + key { [ e, E ], + [ EuroSign ] }; + key { [ z, Z ] }; + key { [ udiaeresis, egrave ], + [ bracketleft ] }; + key { [ dead_diaeresis, exclam ], + [ bracketright ] }; + + key { [ odiaeresis, eacute ] }; + key { [ adiaeresis, agrave ], + [ braceleft ] }; + key { [ dollar, sterling ], + [ braceright ] }; + + key { [ less, greater ], + [ backslash, brokenbar ] }; + key { [ y, Y ] }; + key { [ comma, semicolon ] }; + key { [ period, colon ] }; + key { [ minus, underscore ] }; + + // End alphanumeric section, begin "Keypad" + key { [ KP_Delete, KP_Decimal ] }; + // End "Keypad" section + + + // begin modifier mappings + modifier_map Shift { Shift_L }; + modifier_map Lock { Caps_Lock }; + modifier_map Control{ Control_L }; +}; +partial alphanumeric_keys +xkb_symbols "Sundeadkeys" { + // modify the default Swiss German layout to use Sun dead keys + include "de_CH(basic)" + key { [ apostrophe, question ], + [ SunFA_Acute ] }; + key { [ SunFA_Circum, SunFA_Grave ], + [ SunFA_Tilde ] }; + key { [ SunFA_Diaeresis, exclam ], + [ bracketright ] }; +}; +partial alphanumeric_keys +xkb_symbols "sundeadkeys" { + include "de_CH(Sundeadkeys)" +}; +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + // modify the default Swiss German layout not to have any dead keys + include "de_CH(basic)" + key { [ apostrophe, question ], + [ acute ] }; + key { [ asciicircum, grave ], + [ asciitilde ] }; + key { [ diaeresis, exclam ], + [ bracketright ] }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/dev /opt/SUNWut/lib/xkb/symbols/dev --- /opt/SUNWut.orig/lib/xkb/symbols/dev 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/dev 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,67 @@ +// $XConsortium: th /main/3 1996/08/31 12:20:18 kaleb $ +// $XFree86: xc/programs/xkbcomp/symbols/th,v 3.1.2.1 1997/07/19 13:28:20 dawes Exp $ +partial default alphanumeric_keys +xkb_symbols "basic" { + name[Group2]= "Hindi"; + key { [], [ 0x100094A, 0x1000912 ] }; + + // Mainly numbers. + key { [], [ 0x1000967, 0x100090D ] }; + key { [], [ 0x1000968, 0x1000945 ] }; + key { [], [ 0x1000969 ] }; + key { [], [ 0x100096A ] }; + key { [], [ 0x100096B ] }; + key { [], [ 0x100096C ] }; + key { [], [ 0x100096D ] }; + key { [], [ 0x100096e ] }; + key { [], [ 0x100096F, parenleft ] }; + key { [], [ 0x1000966, parenright ] }; + key { [], [ 0x1000903 ] }; + key { [], [ 0x1000943, 0x100090B ] }; + +// Mainly long vowels + + key { [], [ 0x100094C, 0x1000914 ] }; + key { [], [ 0x1000948, 0x1000910 ] }; + key { [], [ 0x100093E, 0x1000906 ] }; + key { [], [ 0x1000940, 0x1000908 ] }; + key { [], [ 0x1000942, 0x100090A ] }; + +// Mainly voiced consonants + + key { [], [ 0x100092C, 0x100092D ] }; + key { [], [ 0x1000939, 0x1000919 ] }; + key { [], [ 0x1000917, 0x1000918 ] }; + key { [], [ 0x1000926, 0x1000927 ] }; + key { [], [ 0x100091C, 0x100091D ] }; + key { [], [ 0x1000921, 0x1000922 ] }; + key { [], [ 0x100093C, 0x100091E ] }; + +// Mainly short vowels + key { [], [ 0x100094B, 0x1000913 ] }; + key { [], [ 0x1000947, 0x100090F ] }; + key { [], [ 0x100094D, 0x1000905 ] }; + key { [], [ 0x100093F, 0x1000907 ] }; + key { [], [ 0x1000941, 0x1000909 ] }; + +// Mainly unvoiced consonants + + key { [], [ 0x100092A, 0x100092B ] }; + key { [], [ 0x1000930, 0x1000931 ] }; + key { [], [ 0x1000915, 0x1000916 ] }; + key { [], [ 0x1000924, 0x1000925 ] }; + key { [], [ 0x100091A, 0x100091B ] }; + key { [], [ 0x100091F, 0x1000920 ] }; + key { [], [ 0x1000949, 0x1000911 ] }; + + key { [], [ 0x1000946, 0x100090E ] }; + key { [], [ 0x1000902, 0x1000901 ] }; + key { [], [ 0x100092E, 0x1000923 ] }; + key { [], [ 0x1000928, 0x1000929 ] }; + key { [], [ 0x1000935, 0x1000934 ] }; + key { [], [ 0x1000932, 0x1000933 ] }; + key { [], [ 0x1000938, 0x1000936 ] }; + key { [], [ comma, 0x1000937 ] }; + key { [], [ period, 0x1000964 ] }; + key { [], [ 0x100092F, question ] }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/digital/lk /opt/SUNWut/lib/xkb/symbols/digital/lk --- /opt/SUNWut.orig/lib/xkb/symbols/digital/lk 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/digital/lk 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,131 @@ +// $Xorg: lk,v 1.3 2000/08/17 19:54:44 cpqbld Exp $ +// +//Copyright (c) 1996 Digital Equipment Corporation +// +//Permission is hereby granted, free of charge, to any person obtaining +//a copy of this software and associated documentation files (the +//"Software"), to deal in the Software without restriction, including +//without limitation the rights to use, copy, modify, merge, publish, +//distribute, sublicense, and sell copies of the Software, and to +//permit persons to whom the Software is furnished to do so, subject to +//the following conditions: +// +//The above copyright notice and this permission notice shall be included +//in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +//OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL DIGITAL EQUIPMENT CORPORATION BE LIABLE FOR ANY CLAIM, +//DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR +//OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR +//THE USE OR OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of the Digital Equipment +//Corporation shall not be used in advertising or otherwise to promote +//the sale, use or other dealings in this Software without prior written +//authorization from Digital Equipment Corporation. +// +// HISTORY +// Log: lk,v +// Revision 1.2 1996/06/18 09:10:09 erik +// use flags correctly, assorted cleanups and consortium fixes +// +// Revision 1.1.2.2 1995/03/10 17:16:52 William_Walker +// Rename to avoid name conflicts with XKB stuff +// [1995/03/10 17:10:33 William_Walker] +// +// Revision 1.1.2.2 1994/10/31 15:22:00 William_Walker +// New experimental version. +// [1994/10/31 14:48:37 William_Walker] +// +// EndLog +// +// @(#)RCSfile: lk,v Revision: 1.2 (DEC) Date: 1996/01/24 12:14:58 +// +// Symbols common to all the LK-style keyboards. +// +default xkb_symbols "common" { + + // Modifier mappings + modifier_map Shift { Shift_L, Shift_R }; + modifier_map Lock { Caps_Lock }; + modifier_map Control { Control_L, Control_R }; + modifier_map Mod1 { Alt_L, Alt_R, Meta_L, Meta_R }; + modifier_map Mod2 { Num_Lock }; + modifier_map Mod3 { Scroll_Lock }; + + // Additional alphanumeric keys + key { [ less, greater ] }; + key { [ Alt_L, Meta_L ] }; + + // "Function" keys + key { [ F1 ] }; + key { [ F2 ] }; + key { [ F3 ] }; + key { [ F4 ] }; + key { [ F5 ] }; + key { [ F6 ] }; + key { [ F7 ] }; + key { [ F8 ] }; + key { [ F9 ] }; + key { [ F10 ] }; + key { [ Escape, F11 ] }; + key { [ F12 ] }; + key { [ F13 ] }; + key { [ F14 ] }; + key { [ F17 ] }; + key { [ F18 ] }; + key { [ F19 ] }; + key { [ F20 ] }; + + // "Editing" keys + key { [ Help ] }; + key { [ Menu ] }; + key { [ Find ] }; + key { [ Insert ] }; + key { [ Delete ] }; + key { [ Select ] }; + key { [ Prior ] }; + key { [ Next ] }; + + key { [ Up ] }; + key { [ Left ] }; + key { [ Down ] }; + key { [ Right ] }; + + // "Keypad" keys + key { + type= "SHIFT+ALT", + symbols[Group1]=[ KP_F1,Pointer_EnableKeys ] + }; + key { [ KP_F2 ] }; + key { [ KP_F3 ] }; + key { [ KP_F4 ] }; + + key { [ KP_Separator ] }; + key { [ KP_Subtract ] }; + + key { [ KP_7 ] }; + key { [ KP_8 ] }; + key { [ KP_9 ] }; + + key { [ KP_4 ] }; + key { [ KP_5 ] }; + key { [ KP_6 ] }; + + key { [ KP_1 ] }; + key { [ KP_2 ] }; + key { [ KP_3 ] }; + key { [ KP_Enter ] }; + + key { [ KP_0 ] }; + key { [ KP_Decimal ] }; +}; + +xkb_symbols "lk401" { + include "symbols/digital/lk(common)" + key { [ Alt_R, Meta_R ] }; + key { [ Multi_key ] }; + key { [ Multi_key ] }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/digital/pc /opt/SUNWut/lib/xkb/symbols/digital/pc --- /opt/SUNWut.orig/lib/xkb/symbols/digital/pc 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/digital/pc 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,176 @@ +// $Xorg: pc,v 1.3 2000/08/17 19:54:44 cpqbld Exp $ +// +//Copyright (c) 1996 Digital Equipment Corporation +// +//Permission is hereby granted, free of charge, to any person obtaining +//a copy of this software and associated documentation files (the +//"Software"), to deal in the Software without restriction, including +//without limitation the rights to use, copy, modify, merge, publish, +//distribute, sublicense, and sell copies of the Software, and to +//permit persons to whom the Software is furnished to do so, subject to +//the following conditions: +// +//The above copyright notice and this permission notice shall be included +//in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +//OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL DIGITAL EQUIPMENT CORPORATION BE LIABLE FOR ANY CLAIM, +//DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR +//OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR +//THE USE OR OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of the Digital Equipment +//Corporation shall not be used in advertising or otherwise to promote +//the sale, use or other dealings in this Software without prior written +//authorization from Digital Equipment Corporation. +// +// HISTORY +// Log +// Revision 1.2 1996/06/18 09:10:12 erik +// use flags correctly, assorted cleanups and consortium fixes +// +// Revision 1.1.6.4 1995/12/19 19:55:58 William_Walker +// Update to XKB 0.65 +// [1995/12/17 02:37:07 William_Walker] +// +// Revision 1.1.6.3 1995/10/25 21:01:09 William_Walker +// Make sure we use DIN 2137 and VT510 Spec for Group Semantics +// [1995/10/23 15:49:03 William_Walker] +// +// Revision 1.1.6.2 1995/08/07 17:40:40 William_Walker +// Upgrade XKB to protocol 0.62 (dual submit from decx11) +// [1995/08/06 14:06:32 William_Walker] +// +// Revision 1.1.2.7 1995/08/05 15:25:57 William_Walker +// Sync up with Erik's pool. +// [1995/08/03 20:17:15 William_Walker] +// +// Revision 1.1.2.6 1995/06/27 12:18:25 William_Walker +// Add LK201 and LK450 support as well as TW and DP variants. +// [1995/06/26 20:29:52 William_Walker] +// +// Revision 1.1.2.5 1995/06/08 17:10:28 William_Walker +// Make RALT default to Mode_switch +// [1995/06/08 17:08:50 William_Walker] +// +// Revision 1.1.2.4 1995/06/05 19:24:14 William_Walker +// New file. I love keymaps. +// [1995/06/05 18:17:03 William_Walker] +// +// EndLog +// +// @(#)RCSfile: pc Revision: /main/4 (DEC) Date: 1996/01/24 12:15:02 +// + +// ************************************************************** +// * * +// * The symbols common to all Extended PC layouts. * +// * * +// ************************************************************** +xkb_symbols "pc" { + + // Modifier mappings + // + modifier_map Shift { Shift_L, Shift_R }; + modifier_map Lock { Caps_Lock }; + modifier_map Control { Control_L, Control_R }; + modifier_map Mod1 { Alt_L, Alt_R, Meta_L, Meta_R }; + modifier_map Mod3 { Mode_switch }; + modifier_map Mod4 { Num_Lock }; + modifier_map Mod5 { Scroll_Lock }; + + // Common keys + // + key { [ BackSpace, Delete ] }; + key { [ Tab, ISO_Left_Tab ] }; + key { [ Caps_Lock ] }; + key { [ Return ] }; + key { [ Shift_L ] }; + key { [ Shift_R ] }; + key { [ Control_L ] }; + key { [ Alt_L, Meta_L ] }; + key { [ space ] }; + key { [ Mode_switch ] }; + key { [ Control_R ] }; + + // "Function" keys + // + key { [ Escape ] }; + key { [ F1 ] }; + key { [ F2 ] }; + key { [ F3 ] }; + key { [ F4 ] }; + key { [ F5 ] }; + key { [ F6 ] }; + key { [ F7 ] }; + key { [ F8 ] }; + key { [ F9 ] }; + key { [ F10 ] }; + key { [ F11 ] }; + key { [ F12 ] }; + key { + type= "PC_SYSRQ", + symbols[Group1]= [ Print, Sys_Req ] + }; + key { [ Scroll_Lock ] }; + key { + type= "PC_BREAK", + symbols[Group1]= [ Pause, Break ] + }; + + // "Editing" keys + // + key { [ Insert ] }; + key { [ Home ] }; + key { [ Prior ] }; + key { [ Delete ] }; + key { [ End ] }; + key { [ Next ] }; + + key { [ Up ] }; + key { [ Left ] }; + key { [ Down ] }; + key { [ Right ] }; + + // "Keypad" keys + // + key { + type= "SHIFT+ALT", + symbols[Group1]= [ Num_Lock,Pointer_EnableKeys] + }; + key { [ KP_Divide ] }; + key { [ KP_Multiply ] }; + key { [ KP_Subtract ] }; + + key { [ KP_Home, KP_7 ] }; + key { [ KP_Up, KP_8 ] }; + key { [ KP_Prior, KP_9 ] }; + key { [ KP_Add ] }; + + key { [ KP_Left, KP_4 ] }; + key { [ KP_5 ] }; + key { [ KP_Right, KP_6 ] }; + + key { [ KP_End, KP_1 ] }; + key { [ KP_Down, KP_2 ] }; + key { [ KP_Next, KP_3 ] }; + key { [ KP_Enter ] }; + + key { [ KP_Insert, KP_0 ] }; + key { [ KP_Delete, KP_Decimal ] }; + + // Key to support Lock-Down Modifier descriptions for R5 + // + key { [ NoSymbol ] }; +}; + +xkb_symbols "pc104" { + include "digital/pc(pc)" + + replace key { [ Alt_L ] }; + key { [ Meta_L ] }; + key { [ Meta_R ] }; + key { [ Menu ] }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/digital/us /opt/SUNWut/lib/xkb/symbols/digital/us --- /opt/SUNWut.orig/lib/xkb/symbols/digital/us 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/digital/us 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,212 @@ +// $Xorg: us,v 1.3 2000/08/17 19:54:44 cpqbld Exp $ +// +//Copyright (c) 1996 Digital Equipment Corporation +// +//Permission is hereby granted, free of charge, to any person obtaining +//a copy of this software and associated documentation files (the +//"Software"), to deal in the Software without restriction, including +//without limitation the rights to use, copy, modify, merge, publish, +//distribute, sublicense, and sell copies of the Software, and to +//permit persons to whom the Software is furnished to do so, subject to +//the following conditions: +// +//The above copyright notice and this permission notice shall be included +//in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +//OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL DIGITAL EQUIPMENT CORPORATION BE LIABLE FOR ANY CLAIM, +//DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR +//OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR +//THE USE OR OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of the Digital Equipment +//Corporation shall not be used in advertising or otherwise to promote +//the sale, use or other dealings in this Software without prior written +//authorization from Digital Equipment Corporation. +// +// HISTORY +// Log +// Revision 1.2 1996/06/18 09:10:16 erik +// use flags correctly, assorted cleanups and consortium fixes +// +// Revision 1.1.6.3 1995/12/19 19:56:37 William_Walker +// Update to XKB 0.65 +// [1995/12/17 02:37:44 William_Walker] +// +// Revision 1.1.6.2 1995/10/25 21:01:25 William_Walker +// Add pc104-key support +// [1995/10/23 15:46:27 William_Walker] +// +// Revision 1.1.2.7 1995/06/27 12:18:40 William_Walker +// Add LK201 and LK450 support as well as TW and DP variants. +// [1995/06/26 20:30:33 William_Walker] +// +// Revision 1.1.2.6 1995/06/09 20:55:20 William_Walker +// Add VT105 layout support and ISO group support +// [1995/06/09 20:43:05 William_Walker] +// +// Revision 1.1.2.5 1995/06/08 21:05:49 William_Walker +// Use ISO_Next_Group instead of grouplock +// [1995/06/08 21:03:56 William_Walker] +// +// Revision 1.1.2.4 1995/06/05 19:25:00 William_Walker +// New file. I love keymaps. +// [1995/06/05 18:17:54 William_Walker] +// +// EndLog +// +// @(#)RCSfile: us Revision: /main/4 (DEC) Date: 1996/01/24 12:15:05 +// + +// ************************************************************** +// * * +// * Symbols for en_US.ISO8859-1 - English for U.S. * +// * * +// ************************************************************** + +xkb_symbols "us" { + + key { [ grave, asciitilde ] }; + key { [ 1, exclam ] }; + key { [ 2, at ] }; + key { [ 3, numbersign ] }; + key { [ 4, dollar ] }; + key { [ 5, percent ] }; + key { [ 6, asciicircum ] }; + key { [ 7, ampersand ] }; + key { [ 8, asterisk ] }; + key { [ 9, parenleft ] }; + key { [ 0, parenright ] }; + key { [ minus, underscore ] }; + key { [ equal, plus ] }; + + key { [ q, Q ] }; + key { [ w, W ] }; + key { [ e, E ] }; + key { [ r, R ] }; + key { [ t, T ] }; + key { [ y, Y ] }; + key { [ u, U ] }; + key { [ i, I ] }; + key { [ o, O ] }; + key { [ p, P ] }; + key { [ bracketleft, braceleft ] }; + key { [ bracketright, braceright ] }; + + key { [ a, A ] }; + key { [ s, S ] }; + key { [ d, D ] }; + key { [ f, F ] }; + key { [ g, G ] }; + key { [ h, H ] }; + key { [ j, J ] }; + key { [ k, K ] }; + key { [ l, L ] }; + key { [ semicolon, colon ] }; + key { [ apostrophe, quotedbl ] }; + key { [ backslash, bar ] }; + + key { [ z, Z ] }; + key { [ x, X ] }; + key { [ c, C ] }; + key { [ v, V ] }; + key { [ b, B ] }; + key { [ n, N ] }; + key { [ m, M ] }; + key { [ comma, less ] }; + key { [ period, greater ] }; + key { [ slash, question ] }; +}; + +// ************************************************************** +// * * +// * The VT105 layouts * +// * * +// * NOTES: The typewriter (TW) and dataprocessing (DP) keys * +// * for the VT108 layout are identical for the US. * +// * * +// ************************************************************** +xkb_symbols "vt105-tw" { + include "digital/us(us)" + include "digital/vt(vt105)" + override key { + symbols[Group1]= [ 3, numbersign ], + symbols[Group2]= [ sterling ] + }; + key { [ less, greater ] }; +}; + +xkb_symbols "vt105-dp" { include "digital/us(vt105-tw)" }; +xkb_symbols "vt105" { include "digital/us(vt105-tw)" }; + +// ************************************************************** +// * * +// * The VT108 layouts - based upon the LK401-AA * +// * * +// * NOTES: The typewriter (TW) and dataprocessing (DP) keys * +// * for the VT108 layout are identical for the US. * +// * * +// ************************************************************** +xkb_symbols "vt108-tw" { + include "digital/us(us)" + include "digital/vt(vt108)" + replace key { [ Multi_key ] }; + override key { + symbols[Group1]= [ 3, numbersign ], + symbols[Group2]= [ sterling ] + }; + key { [ less, greater ] }; +}; + +xkb_symbols "vt108-dp" { include "digital/us(vt108-tw)" }; +xkb_symbols "vt108" { include "digital/us(vt108-tw)" }; + +// ************************************************************** +// * * +// * The "unix" layouts - based upon the LK421-AA * +// * * +// * NOTES: The "unix" keyboard emits the same keycodes as the * +// * LK401, but is a shorter keyboard that uses an * +// * "extend" key. To make life easier, we map * +// * to Escape so users do not have to press Extend+F11 * +// * to get Escape. * +// * * +// ************************************************************** +xkb_symbols "unix" { + include "digital/us(vt108)" + override key { [ Escape ] }; + override key { [ grave, asciitilde ] }; +}; + +// ************************************************************** +// * * +// * The "pcxal" layouts * +// * * +// * NOTES: The pcxal layouts are pretty much standardized for * +// * the US and use a 101-key keyboard. * +// * * +// ************************************************************** +xkb_symbols "pcxalga" { + include "digital/pc(pc)" + include "digital/us(us)" + replace key { [ Alt_R, Meta_R ] }; +}; + +xkb_symbols "pcxal" { include "digital/us(pcxalga)" }; +xkb_symbols "pcxalaa" { include "digital/us(pcxalga)" }; +xkb_symbols "pcxalfa" { include "digital/us(pcxalga)" }; +xkb_symbols "pcxalka" { include "digital/us(pcxalga)" }; +xkb_symbols "lk44x" { include "digital/us(pcxalga)" }; + +// ************************************************************** +// * * +// * The "pc104" layouts. * +// * * +// ************************************************************** +xkb_symbols "pc104" { + include "digital/pc(pc104)" + include "digital/us(us)" + replace key { [ Alt_R ] }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/digital/vt /opt/SUNWut/lib/xkb/symbols/digital/vt --- /opt/SUNWut.orig/lib/xkb/symbols/digital/vt 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/digital/vt 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,159 @@ +// $Xorg: vt,v 1.3 2000/08/17 19:54:44 cpqbld Exp $ +// +//Copyright (c) 1996 Digital Equipment Corporation +// +//Permission is hereby granted, free of charge, to any person obtaining +//a copy of this software and associated documentation files (the +//"Software"), to deal in the Software without restriction, including +//without limitation the rights to use, copy, modify, merge, publish, +//distribute, sublicense, and sell copies of the Software, and to +//permit persons to whom the Software is furnished to do so, subject to +//the following conditions: +// +//The above copyright notice and this permission notice shall be included +//in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +//OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL DIGITAL EQUIPMENT CORPORATION BE LIABLE FOR ANY CLAIM, +//DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR +//OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR +//THE USE OR OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of the Digital Equipment +//Corporation shall not be used in advertising or otherwise to promote +//the sale, use or other dealings in this Software without prior written +//authorization from Digital Equipment Corporation. +// +// HISTORY +// Log +// Revision 1.2 1996/06/18 09:10:19 erik +// use flags correctly, assorted cleanups and consortium fixes +// +// Revision 1.1.6.2 1995/12/19 19:56:39 William_Walker +// Update to XKB 0.65 +// [1995/12/17 02:37:47 William_Walker] +// +// Revision 1.1.2.5 1995/07/11 21:20:50 William_Walker +// Make RALT act as RALT +// [1995/07/11 21:18:28 William_Walker] +// +// Revision 1.1.2.4 1995/06/27 12:18:41 William_Walker +// Add LK201 and LK450 support as well as TW and DP variants. +// [1995/06/26 20:30:37 William_Walker] +// +// Revision 1.1.2.3 1995/06/09 20:55:21 William_Walker +// Add VT105 layout support and ISO group support +// [1995/06/09 20:43:09 William_Walker] +// +// Revision 1.1.2.2 1995/06/05 19:25:04 William_Walker +// New file. I love keymaps. +// [1995/06/05 18:17:58 William_Walker] +// +// EndLog +// +// @(#)RCSfile: vt Revision: /main/3 (DEC) Date: 1996/01/24 12:15:08 +// +xkb_symbols "vt105" { + + // Modifier mappings + // + modifier_map Shift { Shift_L, Shift_R }; + modifier_map Lock { Caps_Lock }; + modifier_map Control { Control_L, Control_R }; + modifier_map Mod1 { Alt_L, Alt_R, Meta_L, Meta_R }; + modifier_map Mod3 { Mode_switch }; + + // Common keys + // + key { [ Delete ] }; + key { [ Tab ] }; + key { [ Return ] }; + key { [ Control_L ] }; + key { [ Caps_Lock ] }; + key { [ Shift_L ] }; + key { [ Shift_R ] }; + key { [ Alt_L, Meta_L ] }; + key { [ space ] }; + + // "Function" keys + // + key { [ F1 ] }; + key { [ F2 ] }; + key { [ F3 ] }; + key { [ F4 ] }; + key { [ F5 ] }; + key { [ F6 ] }; + key { [ F7 ] }; + key { [ F8 ] }; + key { [ F9 ] }; + key { [ F10 ] }; + key { [ Escape, F11 ] }; + key { [ F12 ] }; + key { [ F13 ] }; + key { [ F14 ] }; + key { [ F17 ] }; + key { [ F18 ] }; + key { [ F19 ] }; + key { [ F20 ] }; + + // "Editing" keys + // + key { [ Help ] }; + key { [ Menu ] }; + key { [ Find ] }; + key { [ Insert ] }; + key { [ apLineDel ] }; + key { [ Select ] }; + key { [ Prior ] }; + key { [ Next ] }; + + key { [ Up ] }; + key { [ Left ] }; + key { [ Down ] }; + key { [ Right ] }; + + // "Keypad" keys + // + key { + type= "SHIFT+ALT", + symbols[Group1]= [ KP_F1,Pointer_EnableKeys ] + }; + key { [ KP_F2 ] }; + key { [ KP_F3 ] }; + key { [ KP_F4 ] }; + + key { [ KP_7 ] }; + key { [ KP_8 ] }; + key { [ KP_9 ] }; + key { [ KP_Subtract ] }; + + key { [ KP_4 ] }; + key { [ KP_5 ] }; + key { [ KP_6 ] }; + key { [ KP_Separator ] }; + + key { [ KP_1 ] }; + key { [ KP_2 ] }; + key { [ KP_3 ] }; + key { [ KP_Enter ] }; + + key { [ KP_0 ] }; + key { [ KP_Decimal ] }; + + // Key to support Lock-Down Modifier descriptions for R5 + // + key { [ NoSymbol ] }; +}; + +xkb_symbols "vt108" { + + include "digital/vt(vt105)" + + replace key { [ Mode_switch ] }; + + key { [ Alt_L, Meta_L ] }; + key { [ Alt_R, Meta_R ] }; + key { [ Multi_key ] }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/dk /opt/SUNWut/lib/xkb/symbols/dk --- /opt/SUNWut.orig/lib/xkb/symbols/dk 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/dk 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,116 @@ +// $Xorg: dk,v 1.3 2000/08/17 19:54:42 cpqbld Exp $ + + + + +// $XFree86: xc/programs/xkbcomp/symbols/dk,v 3.6 2001/01/17 23:45:58 dawes Exp $ + +partial alphanumeric_keys +xkb_symbols "basic" { + + // Describes the differences between a very simple en_US + // keyboard and a Danish keyboard with dead key support + // and all of ISO-8859-1 characters available. + + name[Group1]= "Danish"; + + key { [ onehalf, section ], + [ threequarters, paragraph ]}; + key { [ less, greater ], + [ backslash, notsign ]}; + key { [ space, space ], + [ nobreakspace, nobreakspace ]}; + key { [ 1, exclam ], + [ exclamdown, onesuperior ]}; + key { [ 2, quotedbl ], + [ at, twosuperior ]}; + key { [ 3, numbersign ], + [ sterling, threesuperior ]}; + key { [ 4, currency ], + [ dollar, onequarter ]}; + key { [ 5, percent ], + [ NoSymbol, cent ]}; + key { [ 6, ampersand ], + [ yen, NoSymbol ]}; + key { [ 7, slash ], + [ braceleft, division ]}; + key { [ 8, parenleft ], + [ bracketleft, guillemotleft ]}; + key { [ 9, parenright ], + [ bracketright, guillemotright ]}; + key { [ 0, equal ], + [ braceright, degree ]}; + key { [ comma, semicolon ], + [ dead_cedilla, dead_ogonek ]}; + key { [ period, colon ], + [ periodcentered, dead_abovedot ]}; + key { [ c, C ], + [ copyright, NoSymbol ]}; + key { [ minus, underscore ], + [ hyphen, macron ]}; + key { [ a, A ], + [ ordfeminine, masculine ]}; + key { [ d, D ], + [ eth, ETH ]}; + key { [ e, E ], + [ EuroSign, cent ]}; + key { [ r, R ], + [ registered, NoSymbol ]}; + key { [ t, T ], + [ thorn, THORN ]}; + key { [ i, I ], + [ NoSymbol, NoSymbol ]}; + key { [ o, O ], + [ oe, OE ]}; + key { [ ae, AE ]}; + key { [ plus, question ], + [ plusminus, questiondown ]}; + key { [ oslash, Ooblique ]}; + key { [ apostrophe, asterisk ], + [dead_doubleacute, multiply ]}; + key { [ aring, Aring ]}; + key { [ dead_acute, dead_grave ], + [ bar, brokenbar ]}; + key { [ dead_diaeresis, dead_circumflex ], + [ dead_tilde, dead_caron ]}; + + + // End alphanumeric section, begin "Keypad" + key { [ KP_Delete, KP_Separator ] }; + // End "Keypad" section + + // begin modifier mappings + + modifier_map Shift { Shift_L }; + modifier_map Lock { Caps_Lock }; + modifier_map Control{ Control_L }; + modifier_map Mod3 { Mode_switch }; +}; + +partial alphanumeric_keys +xkb_symbols "Sundeadkeys" { + // For naming consistency + include "dk(basic)" +}; + +partial alphanumeric_keys +xkb_symbols "sundeadkeys" { + // For naming consistency + include "dk(Sundeadkeys)" +}; + +partial default alphanumeric_keys +xkb_symbols "full" { + include "iso9995-3(full)" + include "dk(basic)" +}; + + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + include "dk(basic)" + key { [ acute, grave ], + [ bar, ogonek ] }; + key { [ diaeresis, asciicircum ], + [ asciitilde, dead_macron ] }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/dvorak /opt/SUNWut/lib/xkb/symbols/dvorak --- /opt/SUNWut.orig/lib/xkb/symbols/dvorak 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/dvorak 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,351 @@ +// $XdotOrg: xc/programs/xkbcomp/symbols/dvorak,v 1.2 2004/04/23 19:54:52 eich Exp $ +// $Xorg: dvorak,v 1.3 2000/08/17 19:54:42 cpqbld Exp $ + +// symbols definition for a very simple dvorak layout. +// It has basically the alphanumeric keys, punctuation, +// one shift key, one control key and caps lock. It +// uses the punctuation keys configurations common on PC +// keyboards (e.g. key is { [ period greater ] }) + +// $XFree86: xc/programs/xkbcomp/symbols/dvorak,v 3.10 2003/08/08 06:27:09 dawes Exp $ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + include "srvr_ctrl(xfree86)" + + name[Group1]= "Dvorak"; + key { [ Escape ] }; + + // Alphanumeric section + key { [ grave, asciitilde ], + [ dead_grave, dead_tilde ] }; + + key { [ 1, exclam ] }; + key { [ 2, at ] }; + key { [ 3, numbersign ] }; + key { [ 4, dollar ] }; + key { [ 5, percent ] }; + key { [ 6, asciicircum ], + [ dead_circumflex, dead_circumflex ] }; + key { [ 7, ampersand ] }; + key { [ 8, asterisk ] }; + key { [ 9, parenleft ], + [ dead_grave ] }; + key { [ 0, parenright ] }; + key { [ bracketleft, braceleft ] }; + key { [ bracketright, braceright ], + [ dead_tilde ] }; + key { + type="CTRL+ALT", + symbols[Group1]= [ BackSpace, Terminate_Server ] + }; + + key { [ Tab, ISO_Left_Tab ] }; + key { [ apostrophe, quotedbl ], + [ dead_acute, dead_diaeresis ] }; + key { [ comma, less ], + [ dead_cedilla, dead_caron ] }; + key { [ period, greater ], + [ dead_abovedot, periodcentered ] }; + key { [ p, P ] }; + key { [ y, Y ] }; + key { [ f, F ] }; + key { [ g, G ] }; + key { [ c, C ] }; + key { [ r, R ] }; + key { [ l, L ] }; + key { [ slash, question ] }; + key { [ equal, plus ] }; + key { [ Return ] }; + + key { [ Caps_Lock ] }; + key { [ a, A ] }; + key { [ o, O ] }; + key { [ e, E ] }; + key { [ u, U ] }; + key { [ i, I ] }; + key { [ d, D ] }; + key { [ h, H ] }; + key { [ t, T ] }; + key { [ n, N ] }; + key { [ s, S ] }; + key { [ minus, underscore ] }; + + key { [ Shift_L ] }; + key { [ semicolon, colon ], + [ dead_ogonek, dead_doubleacute ] }; + key { [ q, Q ] }; + key { [ j, J ] }; + key { [ k, K ] }; + key { [ x, X ] }; + key { [ b, B ] }; + key { [ m, M ] }; + key { [ w, W ] }; + key { [ v, V ] }; + key { [ z, Z ] }; + key { [ backslash, bar ] }; + + key { [ Control_L ] }; + key { [ space ] }; + // End alphanumeric section + + // begin modifier mappings + modifier_map Shift { Shift_L }; + modifier_map Lock { Caps_Lock }; + modifier_map Control{ Control_L }; +}; + +// Norwegian Dvorak +partial alphanumeric_keys +xkb_symbols "no" { + include "dvorak(basic)" + + key { [ bar, section ], + [ brokenbar, paragraph ] }; + + key { [ 1, exclam ], + [ exclamdown, onesuperior ] }; + key { [ 2, quotedbl ], + [ at, twosuperior ] }; + key { [ 3, numbersign ], + [ sterling, threesuperior ] }; + key { [ 4, dollar ], + [ currency, onequarter ] }; + key { [ 5, percent ], + [ onehalf, onehalf ] }; + key { [ 6, ampersand ], + [ threequarters, threequarters ] }; + key { [ 7, slash ], + [ braceleft, division ] }; + key { [ 8, parenleft ], + [ bracketleft ] }; + key { [ 9, parenright ], + [ bracketright ] }; + key { [ 0, equal ], + [ braceright ] }; + key { [ plus, question ], + [ plusminus, questiondown ] }; + key { [ backslash, grave ], + [ dead_acute, dead_grave ] }; + + key { [ aring, Aring ], + [ braceright, bracketright ] }; + key { [ comma, semicolon ], + [ dead_cedilla, cedilla ] }; + key { [ period, colon ], + [ periodcentered ] }; + key { [ p, P ], + [ thorn, THORN ] }; + key { [ y, Y ], + [ yen ] }; + key { [ f, F ], + [ ordfeminine ] }; + key { [ c, C ], + [ ccedilla, copyright ] }; + key { [ r, R ], + [ registered ] }; + key { [ apostrophe, asterisk ], + [ dead_circumflex, acute ] }; + key { [ asciitilde, asciicircum ], + [ dead_diaeresis, dead_tilde ] }; + + key { [ e, E ], + [ EuroSign, cent ] }; + key { [ i, I ], + [ idotless, Iabovedot ] }; + key { [ d, D ], + [ eth, ETH ] }; + key { [ s, S ], + [ ssharp ] }; + key { [ minus, underscore ], + [ hyphen, diaeresis ] }; + + key { [ ae, AE ], + [ braceleft, bracketleft ] }; + key { [ x, X ], + [ multiply ] }; + key { [ m, M ], + [ mu ] }; + key { [ less, greater ], + [ guillemotleft, guillemotright ] }; + + key { [ space, space ], + [ nobreakspace, nobreakspace ] }; + + key { [ oslash, Ooblique ], + [ bar, backslash ] }; + +}; + +// Swedish Dvorak +partial alphanumeric_keys +xkb_symbols "se" { + include "dvorak(no)" + + key { [ section, onehalf ] }; + + key { [ 4, currency ], + [ dollar, onequarter ] }; + key { [ plus, question ], + [ backslash, questiondown ] }; + key { [ dead_acute, dead_grave ], + [ backslash, grave ] }; + + key { [ odiaeresis, Odiaeresis ], + [ braceright, bracketright ] }; + key { [ aring, Aring ] }; + key { [ adiaeresis, Adiaeresis ] }; + key { [ q, Q ] }; + key { [ dead_diaeresis, dead_circumflex], + [ dead_tilde, asciicircum ] }; + + key { [ comma, semicolon ], + [ dead_cedilla, cedilla ] }; + key { [ period, colon ], + [ periodcentered ] }; + + key { [ less, greater ], + [ bar, brokenbar ] }; + + key { [ apostrophe, asterisk ], + [ bar, backslash ] }; + +}; +// Swedish Dvorak alias +partial alphanumeric_keys +xkb_symbols "sv" { + include "dvorak(se)" +}; + + +// Dvorak (UK) keymap (by odaen) allowing the usage of +// the £ and ? key and swapping the @ and " keys. + +partial alphanumeric_keys +xkb_symbols "gb" { + include "dvorak(basic)" + + key { [ numbersign, asciitilde ] }; + key { [ 2, quotedbl ], + [ twosuperior, NoSymbol ] }; + key { [ 3, sterling ], + [ threesuperior, NoSymbol ] }; + key { [ 4, dollar ], + [ EuroSign, NoSymbol ] }; + key { [ backslash, bar ] }; + key { [ apostrophe, at ] }; +}; + +// Keymap Dvorak pour le Français +// par Josselin Mouette . + +partial alphanumeric_keys modifier_keys +xkb_symbols "fr" { + + include "dvorak(basic)" + + name[Group1]= "French dvorak"; + + key { [ oe, OE ], + [ ae, AE ] }; + key { [ slash, 1 ], + [ ampersand, onesuperior ] }; + key { [ plus, 2 ], + [ asciitilde, twosuperior ] }; + key { [ minus, 3 ], + [ numbersign, threesuperior ] }; + key { [ asterisk, 4 ], + [ less, guillemotleft ] }; + key { [ equal, 5 ], + [ greater, guillemotright ] }; + key { [ backslash, 6 ], + [ at, notsign ] }; + key { [ parenleft, 7 ], + [ dead_circumflex, multiply ] }; + key { [ grave, 8 ], + [ dead_grave, division ] }; + key { [ parenright, 9 ], + [ asciicircum, plusminus ] }; + key { [ quotedbl, 0 ], + [ dead_diaeresis, dead_diaeresis ] }; + key { [ bracketleft, braceleft ], + [ bar, degree ] }; + key { [ bracketright, braceright ], + [ percent ] }; + + key { [ colon, question ], + [ question, questiondown ] }; + key { [ agrave, Agrave ], + [ aring, Aring ] }; + key { [ eacute, Eacute ], + [ EuroSign, cent ] }; + key { [ g, G ], + [ oslash, Ooblique ] }; + key { [ period, exclam ], + [ periodcentered, exclamdown ] }; + key { [ h, H ], + [ eth, ETH ] }; + key { [ v, V ] }; + key { [ c, C ], + [ copyright, registered ] }; + key { [ m, M ], + [ mu, mu ] }; + key { [ k, K ], + [ dollar, dollar ] }; + key { [ egrave, Egrave ], + [ sterling, sterling ] }; + key { [ z, Z ], + [ yen ] }; + + key { [ o, O ], + [ ocircumflex, Ocircumflex ] }; + key { [ a, A ], + [ acircumflex, Acircumflex ] }; + key { [ u, U ], + [ ucircumflex, Ucircumflex ] }; + key { [ e, E ], + [ ecircumflex, Ecircumflex ] }; + key { [ b, B ], + [ ssharp ] }; + key { [ f, F ] }; + key { [ s, S ] }; + key { [ t, T ], + [ thorn, THORN ] }; + key { [ n, N ], + [ ntilde, Ntilde ] }; + key { [ d, D ], + [ section ] }; + key { [ w, W ], + [ paragraph ] }; + key { [ ugrave, Ugrave ], + [ masculine, ordfeminine ] }; + + key { [ ccedilla, Ccedilla ], + [ ccedilla, Ccedilla ] }; + key { [ apostrophe, underscore ], + [ dead_acute, macron ] }; + key { [ q, Q ], + [ guillemotleft, guillemotleft ] }; + key { [ comma, semicolon ], + [ guillemotright, guillemotright ] }; + key { [ i, I ], + [ icircumflex, Icircumflex ] }; + key { [ y, Y ], + [ ydiaeresis, Ydiaeresis ] }; + key { [ x, X ], + [ ediaeresis, Ediaeresis ] }; + key { [ r, R ], + [ udiaeresis, Udiaeresis ] }; + key { [ l, L ], + [ adiaeresis, Adiaeresis ] }; + key { [ p, P ], + [ odiaeresis, Odiaeresis ] }; + key { [ j, J ], + [ idiaeresis, Idiaeresis ] }; + + key { [ space, space ], + [ nobreakspace, nobreakspace ] }; + key { [ Mode_switch, Multi_key ] }; +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/ee /opt/SUNWut/lib/xkb/symbols/ee --- /opt/SUNWut.orig/lib/xkb/symbols/ee 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/ee 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,83 @@ +// $XFree86: xc/programs/xkbcomp/symbols/ee,v 1.2 2000/10/27 18:31:08 dawes Exp $ +// Estonian XKB-keymap by Ville Hallik + +partial default alphanumeric_keys +xkb_symbols "basic" { + + // Describes the differences between a very simple en_US + // keyboard and a very simple Estonian keyboard + // This layout conforms to both EVS8:1993 and EVS8:2000 standards + + name[Group1]= "Estonian"; + + key { [ dead_caron, dead_tilde ] }; + key { [ 2, quotedbl ], + [ at ] }; + key { [ 3, numbersign ], + [ sterling ] }; + key { [ 4, currency ], + [ dollar ] }; + key { [ 6, ampersand ] }; + key { [ 7, slash ], + [ braceleft ] }; + key { [ 8, parenleft ], + [ bracketleft ] }; + key { [ 9, parenright ], + [ bracketright ] }; + key { [ 0, equal ], + [ braceright ] }; + key { [ plus, question ], + [ backslash ] }; + key { [ dead_acute, dead_grave ], + [ quoteleft, quoteright ] }; + key { [ e, E ], + [ EuroSign ] }; + key { [ udiaeresis, Udiaeresis ] }; + key { [ otilde, Otilde ], + [ section ] }; + key { [ s, S ], + [ scaron, Scaron ] }; + key { [ odiaeresis, Odiaeresis ] }; + key { [ adiaeresis, Adiaeresis ], + [ asciicircum ] }; + key { [ z, Z ], + [ zcaron, Zcaron ] }; + key { [ comma, semicolon ], + [ less ] }; + key { [ period, colon ], + [ greater ] }; + key { [ minus, underscore ] }; + key { [ apostrophe, asterisk ], + [ onehalf ] }; + key { [ less, greater ], + [ bar ] }; + + // End alphanumeric section + + // begin modifier mappings + + modifier_map Shift { Shift_L }; + modifier_map Lock { Caps_Lock }; + modifier_map Control{ Control_L }; + modifier_map Mod3 { Mode_switch }; +}; + +partial alphanumeric_keys +xkb_symbols "Sundeadkeys" { + include "ee(basic)" // for consistent naming +}; + +partial alphanumeric_keys +xkb_symbols "sundeadkeys" { + include "ee(Sundeadkeys)" // for consistent naming +}; + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + + // Modifies the basic Estonian layout to eliminate all dead keys + + include "ee(basic)" + key { [ asciicircum, asciitilde ] }; + key { [ apostrophe, grave ] }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/el /opt/SUNWut/lib/xkb/symbols/el --- /opt/SUNWut.orig/lib/xkb/symbols/el 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/el 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,145 @@ +// $XFree86$ +// +// Hellenic keyboard map for XFree86 +// Original version: +// Kostas Gewrgiou +// Heavily modified by: +// Vasilis Vasaitis + +default partial alphanumeric_keys alternate_group +xkb_symbols "basic" { + + include "el(bare)" + + key { [], [ grave, asciitilde ] }; + key { [], [ 1, exclam ] }; + key { [], [ 2, at ] }; + key { [], [ 3, numbersign ] }; + key { [], [ 4, dollar ] }; + key { [], [ 5, percent ] }; + key { [], [ 6, asciicircum ] }; + key { [], [ 7, ampersand ] }; + key { [], [ 8, asterisk ] }; + key { [], [ 9, parenleft ] }; + key { [], [ 0, parenright ] }; + key { [], [ minus, underscore ] }; + key { [], [ equal, plus ] }; + + key { [], [ bracketleft, braceleft ] }; + key { [], [ bracketright, braceright ] }; + + key { [], [ apostrophe, quotedbl ] }; + + key { [], [ comma, less ] }; + key { [], [ period, greater ] }; + key { [], [ slash, question ] }; + key { [], [ backslash, bar ] }; + +}; + +hidden partial alphanumeric_keys alternate_group +xkb_symbols "bare" { + + name[Group2] = "ISO8859-7"; + + key { [], [ semicolon, colon ] }; + key { [], [ Greek_finalsmallsigma, Greek_SIGMA ] }; + key { [], [ Greek_epsilon, Greek_EPSILON ] }; + key { [], [ Greek_rho, Greek_RHO ] }; + key { [], [ Greek_tau, Greek_TAU ] }; + key { [], [ Greek_upsilon, Greek_UPSILON ] }; + key { [], [ Greek_theta, Greek_THETA ] }; + key { [], [ Greek_iota, Greek_IOTA ] }; + key { [], [ Greek_omicron, Greek_OMICRON ] }; + key { [], [ Greek_pi, Greek_PI ] }; + + key { [], [ Greek_alpha, Greek_ALPHA ] }; + key { [], [ Greek_sigma, Greek_SIGMA ] }; + key { [], [ Greek_delta, Greek_DELTA ] }; + key { [], [ Greek_phi, Greek_PHI ] }; + key { [], [ Greek_gamma, Greek_GAMMA ] }; + key { [], [ Greek_eta, Greek_ETA ] }; + key { [], [ Greek_xi, Greek_XI ] }; + key { [], [ Greek_kappa, Greek_KAPPA ] }; + key { [], [ Greek_lamda, Greek_LAMDA ] }; + key { [], [ dead_acute, dead_diaeresis ] }; + + key { [], [ Greek_zeta, Greek_ZETA ] }; + key { [], [ Greek_chi, Greek_CHI ] }; + key { [], [ Greek_psi, Greek_PSI ] }; + key { [], [ Greek_omega, Greek_OMEGA ] }; + key { [], [ Greek_beta, Greek_BETA ] }; + key { [], [ Greek_nu, Greek_NU ] }; + key { [], [ Greek_mu, Greek_MU ] }; + + key { [], [ guillemotleft, guillemotright ] }; + +}; + +partial alphanumeric_keys alternate_group +xkb_symbols "extended" { + + include "el(basic)" + + key.type = "THREE_LEVEL"; + + key { [ 5, percent, EuroSign ], + [ 5, percent, EuroSign ] }; + + key { [], [ semicolon, colon, periodcentered ] }; + + key { [ e, E, EuroSign ], + [ Greek_epsilon, Greek_EPSILON, EuroSign ] }; + + key { [ semicolon, colon, periodcentered ] }; + + key { [ comma, less, guillemotleft ], + [ comma, less, guillemotleft ] }; + + key { [ period, greater, guillemotright ], + [ period, greater, guillemotright ] }; + + key { [ ISO_Level3_Shift ] }; + + modifier_map Mod5 { ISO_Level3_Shift }; + +}; + +partial alphanumeric_keys alternate_group +xkb_symbols "polytonic" { + + include "el(extended)" + + key.type = "THREE_LEVEL"; + + key { [], [ dead_tilde, dead_diaeresis, dead_macron ] }; + key { [], [ dead_iota, VoidSymbol, dead_breve ] }; + + key { [], [ dead_acute, dead_horn ] }; + key { [], [ dead_grave, dead_ogonek ] }; + +}; + +partial alphanumeric_keys alternate_group +xkb_symbols "Sundeadkeys" { + + include "el(basic)" + +}; + +partial alphanumeric_keys alternate_group +xkb_symbols "sundeadkeys" { + + include "el(Sundeadkeys)" + +}; + +partial alphanumeric_keys alternate_group +xkb_symbols "nodeadkeys" { + + include "el(basic)" + + key { [], [ semicolon, colon ] }; + +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/en_US /opt/SUNWut/lib/xkb/symbols/en_US --- /opt/SUNWut.orig/lib/xkb/symbols/en_US 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/en_US 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,126 @@ +// $Xorg: en_US,v 1.3 2000/08/17 19:54:42 cpqbld Exp $ +// $XFree86$ + +partial hidden alphanumeric_keys +xkb_symbols "basic" { + include "us(basic)" + include "iso9995-3(basic)" +}; +default +xkb_symbols "pc101" { + include "us(pc101)" + + replace key { [ Mode_switch, Multi_key ] }; + + include "iso9995-3(basic101)" + + modifier_map Mod3 { Mode_switch }; +}; +xkb_symbols "pc102" { + include "us(pc102)" + + replace key { [ Mode_switch, Multi_key ] }; + + include "iso9995-3(basic)" + + modifier_map Mod3 { Mode_switch }; +}; +xkb_symbols "pc104" { + include "us(pc104)" + + replace key { [ Mode_switch ] }; + replace key { [ Multi_key ] }; + + include "iso9995-3(basic101)" + + modifier_map Mod3 { Mode_switch }; +}; +xkb_symbols "pc105" { + include "us(pc105)" + + replace key { [ Mode_switch ] }; + replace key { [ Multi_key ] }; + + include "iso9995-3(basic)" + + modifier_map Mod3 { Mode_switch }; +}; +xkb_symbols "pc_universal" { + include "us(pc_universal)" + + replace key { [ Mode_switch ] }; + replace key { [ Multi_key ] }; + + include "iso9995-3(basic)" + + modifier_map Mod3 { Mode_switch }; +}; + +xkb_symbols "sun4" { + include "us(sun4)" + include "iso9995-3(basic)" +}; +xkb_symbols "sun5" { + include "us(sun5)" + include "iso9995-3(basic)" +}; +xkb_symbols "pc101_nodeadkeys" { + include "us(pc101)" + + replace key { [ Mode_switch, Multi_key ] }; + + include "iso9995-3(nodeadkeys101)" + + modifier_map Mod3 { Mode_switch }; +}; +xkb_symbols "pc102_nodeadkeys" { + include "us(pc102)" + + replace key { [ Mode_switch, Multi_key ] }; + + include "iso9995-3(nodeadkeys)" + + modifier_map Mod3 { Mode_switch }; +}; + +xkb_symbols "pc104_nodeadkeys" { + include "us(pc104)" + + replace key { [ Mode_switch ] }; + replace key { [ Multi_key ] }; + + include "iso9995-3(nodeadkeys101)" + + modifier_map Mod3 { Mode_switch }; +}; + +xkb_symbols "pc105_nodeadkeys" { + include "us(pc105)" + + replace key { [ Mode_switch ] }; + replace key { [ Multi_key ] }; + + include "iso9995-3(nodeadkeys101)" + + modifier_map Mod3 { Mode_switch }; +}; + +xkb_symbols "pc_universal_nodeadkeys" { + include "us(pc_universal)" + + replace key { [ Mode_switch ] }; + replace key { [ Multi_key ] }; + + include "iso9995-3(nodeadkeys101)" + + modifier_map Mod3 { Mode_switch }; +}; + +xkb_symbols "sun4_nodeadkeys" { + include "us(sun4)" + include "iso9995-3(nodeadkeys)" +}; +xkb_symbols "sun5_nodeadkeys" { + include "us(sun5)" + include "iso9995-3(nodeadkeys)" +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/es /opt/SUNWut/lib/xkb/symbols/es --- /opt/SUNWut.orig/lib/xkb/symbols/es 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/es 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,91 @@ +// $Xorg: es,v 1.3 2000/08/17 19:54:42 cpqbld Exp $ + + + +// Modified for a real Spanish Keyboard by Jon Tombs +// $XFree86: xc/programs/xkbcomp/symbols/es,v 3.4 2000/10/27 18:31:08 dawes Exp $ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + // Describes the differences between a very simple en_US + // keyboard and a very simple Spanish keybaord + + name[Group1]= "Spanish"; + + key { [ masculine, ordfeminine ], + [ backslash, backslash ] }; + key { [ less, greater ], + [ bar, brokenbar ] }; + key { [ 1, exclam ], + [ bar, exclamdown ] }; + key { [ 2, quotedbl ], + [ at, oneeighth ] }; + key { [ 3, periodcentered ], + [ numbersign, sterling ] }; + key { [ 4, dollar ], + [ asciitilde, dollar ] }; + key { [ 6, ampersand ], + [ notsign, fiveeighths ] }; + key { [ 7, slash ] }; + key { [ 8, parenleft ] }; + key { [ comma, semicolon ] }; + key { [ 0, equal ] }; + key { [ 9, parenright ] }; + key { [ period, colon ] }; + key { [ minus, underscore ] }; + key { [ ntilde, Ntilde ], + [ asciitilde,dead_doubleacute ] }; + key { [ apostrophe, question ] }; + key { [ dead_acute, dead_diaeresis ], + [ braceleft, braceleft ] }; + key { [ ccedilla, Ccedilla ], + [ braceright, dead_breve ] }; + key { [ dead_grave, dead_circumflex ], + [ bracketleft, dead_abovering ] }; + key { [ exclamdown, questiondown ], + [ asciitilde, asciitilde ] }; + key { [ plus, asterisk ], + [ bracketright, dead_macron ] }; + key { [ e, E ], + [ EuroSign, cent ] }; + + // End alphanumeric section + + // Begin modifier mappings + modifier_map Shift { Shift_L }; + modifier_map Lock { Caps_Lock }; + modifier_map Control{ Control_L }; + modifier_map Mod3 { Mode_switch }; +}; + +partial alphanumeric_keys +xkb_symbols "Sundeadkeys" { + include "es(basic)" + + key { [ SunFA_Acute, SunFA_Diaeresis ], + [ braceleft, braceleft ] }; + key { [ SunFA_Grave, SunFA_Circum ], + [ bracketleft, dead_abovering ] }; +}; + +partial alphanumeric_keys +xkb_symbols "sundeadkeys" { + include "es(Sundeadkeys)" +}; + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + include "es(basic)" + + key { [ ntilde, Ntilde ], + [ asciitilde, doubleacute ] }; + key { [ acute, diaeresis ], + [ braceleft, braceleft ] }; + key { [ ccedilla, Ccedilla ], + [ braceright, breve ] }; + key { [ grave, asciicircum ], + [ bracketleft, degree ] }; + key { [ plus, asterisk ], + [ bracketright, macron ] }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/eurosign /opt/SUNWut/lib/xkb/symbols/eurosign --- /opt/SUNWut.orig/lib/xkb/symbols/eurosign 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/eurosign 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,20 @@ +// $XdotOrg$ +// $XKeyboardConfig: xkbdesc/symbols/eurosign,v 1.2 2004/10/09 17:35:01 svu Exp $ + +// Most keyboards have the EuroSign engraved on the E key +partial +xkb_symbols "e" { + key { [ NoSymbol, NoSymbol, EuroSign ] }; +}; + +// Many keyboards have the EuroSign engraved on the 5 key +partial +xkb_symbols "5" { + key { [ NoSymbol, NoSymbol, EuroSign ] }; +}; + +// Many Apple keyboards have the EuroSign engraved on the 2 key +partial +xkb_symbols "2" { + key { [ NoSymbol, NoSymbol, EuroSign ] }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/fi /opt/SUNWut/lib/xkb/symbols/fi --- /opt/SUNWut.orig/lib/xkb/symbols/fi 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/fi 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,122 @@ +// $Xorg: fi,v 1.3 2000/08/17 19:54:42 cpqbld Exp $ + +// $XFree86: xc/programs/xkbcomp/symbols/fi,v 3.9 2002/12/19 01:07:54 dawes Exp $ + + +partial alphanumeric_keys + xkb_symbols "basic" { + + // Describes the differences between a very simple en_US + // keyboard and a Finnish keyboard with dead key support + // and all of ISO-8859-1 and ISO-8859-15 characters available. + + name[Group1]= "Finnish"; + + key { [ section, onehalf ], + [ onequarter, threequarters ]}; + key { [ less, greater ], + [ bar, brokenbar ]}; + // AltGr+ is pressed accidentally too often after AltGr+, + // hence AltGr+ produces now space, not nobreakspace. + key { [ space, space ], + [ space, nobreakspace ]}; + key { [ 1, exclam ], + [ exclamdown, onesuperior ]}; + key { [ 2, quotedbl ], + [ at, twosuperior ]}; + key { [ 3, numbersign ], + [ sterling, threesuperior ]}; + key { [ 4, currency ], + [ dollar, cent ]}; + key { [ 5, percent ], + [ EuroSign, masculine ]}; + key { [ 6, ampersand ], + [ yen, ordfeminine ]}; + key { [ 7, slash ], + [ braceleft, plusminus ]}; + key { [ 8, parenleft ], + [ bracketleft, guillemotleft ]}; + key { [ 9, parenright ], + [ bracketright, guillemotright ]}; + key { [ 0, equal ], + [ braceright, degree ]}; + key { [ comma, semicolon ], + [ dead_cedilla, dead_ogonek ]}; + key { [ period, colon ], + [ periodcentered, notsign ]}; + key { [ z, Z ], + [ zcaron, Zcaron ]}; + key { [ x, X ], + [ multiply, division ]}; + key { [ c, C ], + [ copyright, cent ]}; + key { [ b, B ], + [ ssharp, NoSymbol ]}; + key { [ n, N ], + [ ntilde, Ntilde ]}; + key { [ m, M ], + [ mu, NoSymbol ]}; + key { [ minus, underscore ], + [ hyphen, macron ]}; + key { [ s, S ], + [ scaron, Scaron ]}; + key { [ d, D ], + [ eth, ETH ]}; + key { [ e, E ], + [ EuroSign, cent ]}; + key { [ r, R ], + [ registered, NoSymbol ]}; + key { [ t, T ], + [ thorn, THORN ]}; + key { [ p, P ], + [ paragraph, NoSymbol ]}; + key { [ odiaeresis, Odiaeresis ], + [ oslash, Ooblique ]}; + key { [ plus, question ], + [ backslash, questiondown ]}; + key { [ adiaeresis, Adiaeresis ], + [ ae, AE ]}; + key { [ apostrophe, asterisk ], + [ NoSymbol, NoSymbol ]}; + key { [ aring, Aring ], + [ oe, OE ]}; + key { [ dead_acute, dead_grave ], + [ NoSymbol, NoSymbol ]}; + key { [ dead_diaeresis, dead_circumflex ], + [ dead_tilde, dead_caron ]}; + + // End alphanumeric section, begin "Keypad" + key { [ KP_Delete, KP_Separator ] }; + // End "Keypad" section + + // Begin modifier mappings + + modifier_map Shift { Shift_L }; + modifier_map Lock { Caps_Lock }; + modifier_map Control { Control_L }; + modifier_map Mod3 { Mode_switch }; +}; + +partial alphanumeric_keys +xkb_symbols "Sundeadkeys" { + include "fi(basic)" // for consistent naming +}; + +partial alphanumeric_keys +xkb_symbols "sundeadkeys" { + include "fi(Sundeadkeys)" // for consistent naming +}; + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + // Modifies the basic Finnish layout to eliminate all dead keys + + include "fi(basic)" // for consistent naming + + key { [ comma, semicolon ], + [ cedilla, ogonek ]}; + key { [ acute, grave ], + [ NoSymbol, NoSymbol ]}; + key { [ diaeresis, asciicircum ], + [ asciitilde, caron ]}; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/fo /opt/SUNWut/lib/xkb/symbols/fo --- /opt/SUNWut.orig/lib/xkb/symbols/fo 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/fo 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,91 @@ +// $XFree86$ + +partial alphanumeric_keys +xkb_symbols "basic" { + + // Describes the differences between a very simple en_US + // keyboard and a Faroese keyboard with dead key support + // and all of ISO-8859-1 characters available. + + name[Group1]= "Faroese"; + + key { [ onehalf, section ], + [ threequarters, paragraph ]}; + key { [ less, greater ], + [ backslash, notsign ]}; + key { [ space, space ], + [ nobreakspace, nobreakspace ]}; + key { [ 1, exclam ], + [ exclamdown, onesuperior ]}; + key { [ 2, quotedbl ], + [ at, twosuperior ]}; + key { [ 3, numbersign ], + [ sterling, threesuperior ]}; + key { [ 4, currency ], + [ dollar, onequarter ]}; + key { [ 5, percent ], + [ NoSymbol, cent ]}; + key { [ 6, ampersand ], + [ yen, NoSymbol ]}; + key { [ 7, slash ], + [ braceleft, division ]}; + key { [ 8, parenleft ], + [ bracketleft, guillemotleft ]}; + key { [ 9, parenright ], + [ bracketright, guillemotright ]}; + key { [ 0, equal ], + [ braceright, degree ]}; + key { [ comma, semicolon ], + [ dead_cedilla, dead_ogonek ]}; + key { [ period, colon ], + [ periodcentered, dead_abovedot ]}; + key { [ c, C ], + [ copyright, NoSymbol ]}; + key { [ minus, underscore ], + [ hyphen, macron ]}; + key { [ a, A ], + [ ordfeminine, masculine ]}; + key { [ d, D ], + [ eth, ETH ]}; + key { [ e, E ], + [ EuroSign, cent ]}; + key { [ r, R ], + [ registered, NoSymbol ]}; + key { [ t, T ], + [ thorn, THORN ]}; + key { [ i, I ], + [ NoSymbol, NoSymbol ]}; + key { [ o, O ], + [ oe, OE ]}; + key { [ ae, AE ]}; + key { [ plus, question ], + [ plusminus, questiondown ]}; + key { [ oslash, Ooblique ]}; + key { [ apostrophe, asterisk ], + [dead_doubleacute, multiply ]}; + key { [ aring, Aring ], + [ dead_diaeresis, dead_circumflex ]}; + key { [ dead_acute, dead_grave ], + [ bar, brokenbar ]}; + key { [ eth, ETH ], + [ dead_tilde, dead_caron ]}; + + + // End alphanumeric section + + // begin modifier mappings + + modifier_map Shift { Shift_L }; + modifier_map Lock { Caps_Lock }; + modifier_map Control{ Control_L }; + modifier_map Mod3 { Mode_switch }; +}; + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + include "fo(basic)" + key { [ acute, grave ], + [ bar, ogonek ] }; + key { [ diaeresis, asciicircum ], + [ asciitilde, macron ] }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/fr /opt/SUNWut/lib/xkb/symbols/fr --- /opt/SUNWut.orig/lib/xkb/symbols/fr 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/fr 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,101 @@ +// $Xorg: fr,v 1.3 2000/08/17 19:54:42 cpqbld Exp $ + + + + +// $XFree86: xc/programs/xkbcomp/symbols/fr,v 3.5 2000/10/27 18:31:09 dawes Exp $ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + // Describes the differences between a very simple US/ASCII + // keyboard and a very simple French keybaord + + name[Group1]= "French"; + key { [ twosuperior ] }; + key { [ ampersand, 1 ], + [ onesuperior, exclamdown ] }; + key { [ eacute, 2 ], + [ asciitilde, oneeighth ] }; + key { [ quotedbl, 3 ], + [ numbersign, sterling ] }; + key { [ apostrophe, 4 ], + [ braceleft, dollar ] }; + key { [ parenleft, 5 ], + [ bracketleft, threeeighths ] }; + key { [ minus, 6 ], + [ bar, fiveeighths ] }; + key { [ egrave, 7 ], + [ grave, seveneighths ] }; + key { [ underscore, 8 ], + [ backslash, trademark ] }; + key { [ ccedilla, 9 ], + [ asciicircum, plusminus ] }; + key { [ agrave, 0 ], + [ at, degree ] }; + key { [ parenright, degree ], + [ bracketright, questiondown ] }; + key { [ equal, plus ], + [ braceright, dead_ogonek ] }; + key { [ a, A ], + [ ae, AE ] }; + key { [ z, Z ], + [ guillemotleft, less ] }; + key { [ e, E ], + [ EuroSign, cent ] }; + key { [ dead_circumflex, dead_diaeresis ] }; + key { [ dollar, sterling ], + [ currency, dead_macron ] }; + key { [ q, Q ], + [ at, Greek_OMEGA ] }; + key { [ m, M ], + [ mu, masculine ] }; + key { [ ugrave, percent ] }; + key { [ less, greater ] }; + key { [ w, W ], + [ lstroke, Lstroke ] }; + key { [ comma, question ], + [ dead_acute, dead_doubleacute ] }; + key { [ semicolon, period ] }; + key { [ colon, slash ] }; + key { [ exclam, section ] }; + key { [ asterisk, mu ] }; + // End alphanumeric section + + // begin modifier mappings + modifier_map Shift { Shift_L }; + modifier_map Lock { Caps_Lock }; + modifier_map Control{ Control_L }; + modifier_map Mod3 { Mode_switch }; +}; + +partial alphanumeric_keys +xkb_symbols "Sundeadkeys" { + + // Modifies the basic French layout to use the Sun dead keys + + include "fr(basic)" + key { [ SunFA_Circum, SunFA_Diaeresis ] }; + key { [ comma, question ], + [ SunFA_Acute,dead_doubleacute ] }; +}; + +partial alphanumeric_keys +xkb_symbols "sundeadkeys" { + include "fr(Sundeadkeys)" +}; + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + + // Modifies the basic French layout to eliminate all dead keys + + include "fr(basic)" + key { [ equal, plus ], + [ braceright, ogonek ] }; + key { [ asciicircum, diaeresis ] }; + key { [ dollar, sterling ], + [ currency, macron ] }; + key { [ comma, question ], + [ acute, doubleacute ] }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/fr_CH /opt/SUNWut/lib/xkb/symbols/fr_CH --- /opt/SUNWut.orig/lib/xkb/symbols/fr_CH 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/fr_CH 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,57 @@ +// $Xorg: fr_CH,v 1.3 2000/08/17 19:54:42 cpqbld Exp $ + + + + +// $XFree86: xc/programs/xkbcomp/symbols/fr_CH,v 3.4 2000/01/21 01:12:27 dawes Exp $ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + // Describes the differences between a very simple US/ASCII + // keyboard and a very simple Swiss/French keybaord + + include "de_CH(basic)" + name[Group1]= "Swiss French"; + + override key { + [ egrave, udiaeresis ], + [ bracketleft ] + }; + override key { + [ eacute, odiaeresis ] + }; + override key { + [ agrave, adiaeresis ], + [ braceleft ] + }; +}; + +partial alphanumeric_keys +xkb_symbols "Sundeadkeys" { + // modify the default Swiss French layout to use Sun dead keys + include "fr_CH(basic)" + key { [ apostrophe, question ], + [ SunFA_Acute ] }; + key { [ SunFA_Circum, SunFA_Grave ], + [ SunFA_Tilde ] }; + key { [ SunFA_Diaeresis, exclam ], + [ bracketright ] }; +}; + +partial alphanumeric_keys +xkb_symbols "sundeadkeys" { + include "fr_CH(Sundeadkeys)" +}; + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + // modify the default Swiss French layout not to have any dead keys + include "fr_CH(basic)" + key { [ apostrophe, question ], + [ acute ] }; + key { [ asciicircum, grave ], + [ asciitilde ] }; + key { [ diaeresis, exclam ], + [ bracketright ] }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/fujitsu/jp /opt/SUNWut/lib/xkb/symbols/fujitsu/jp --- /opt/SUNWut.orig/lib/xkb/symbols/fujitsu/jp 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/fujitsu/jp 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,88 @@ +// $Xorg: jp,v 1.4 2001/02/09 02:05:52 xorgcvs Exp $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +// Japanese layout for a Fujitsu 140 key keyboard + +xkb_symbols { + override "fujitsu/us" + augment key { [], [ kana_NU ] }; + key { [ 2, quotedbl ], [ kana_FU ] }; + key { [ 3, numbersign ], [ kana_A, kana_a ] }; + key { [ 4, dollar ], [ kana_U, kana_u ] }; + augment key { [], [ kana_E, kana_e ] }; + key { [ 6, ampersand ], [ kana_O, kana_o ] }; + key { [ 7, apostrophe ], [ kana_YA, kana_ya ] }; + key { [ 8, parenleft ], [ kana_YU, kana_yu ] }; + key { [ 9, parenright ], [ kana_YO, kana_yo ] }; + replace key { [ 0 ], [ kana_WA, kana_WO ] }; + key { [ minus, equal ], [ kana_HO ] }; + key { [ asciicircum, asciitilde ], [ kana_HE ] }; + key { [ backslash, bar ], [ prolongedsound] }; + augment key { [], [ kana_TA ] }; + augment key { [], [ kana_TE ] }; + augment key { [], [ kana_I, kana_i ] }; + augment key { [], [ kana_SU ] }; + augment key { [], [ kana_KA ] }; + augment key { [], [ kana_N ] }; + augment key { [], [ kana_NA ] }; + augment key { [], [ kana_NI ] }; + augment key { [], [ kana_RA ] }; + augment key { [], [ kana_SE ] }; + key { [ at, grave ], [ voicedsound ] }; + key { [ bracketleft, braceleft ], [ semivoicedsound, kana_openingbracket ] }; + augment key { [], [ kana_CHI ] }; + augment key { [], [ kana_TO ] }; + augment key { [], [ kana_SHI ] }; + augment key { [], [ kana_HA ] }; + augment key { [], [ kana_KI ] }; + augment key { [], [ kana_KU ] }; + augment key { [], [ kana_MA ] }; + augment key { [], [ kana_NO ] }; + augment key { [], [ kana_RI ] }; + key { [ semicolon, plus ], [ kana_RE ] }; + key { [ colon, asterisk ], [ kana_KE ] }; + key { [ bracketright, braceright ], [ kana_MU, kana_closingbracket ] }; + augment key { [], [ kana_TSU, kana_tsu ] }; + augment key { [], [ kana_SA ] }; + augment key { [], [ kana_SO ] }; + augment key { [], [ kana_HI ] }; + augment key { [], [ kana_KO ] }; + augment key { [], [ kana_MI ] }; + augment key { [], [ kana_MO ] }; + augment key { [], [ kana_NE, kana_comma ] }; + augment key { [], [ kana_RU, kana_fullstop ] }; + augment key { [], [ kana_ME, kana_conjunctive ] }; + key { [ underscore ], [ kana_RO ] }; + key { [ Select ] }; + key { [ Massyo ] }; + key { [ Touroku ] }; + key { [ Zenkaku_Hankaku ] }; + key { [ Eisu_Shift ] }; + key { [ Mode_switch ] }; + key { [ Cancel ] }; + key { [ Muhenkan ] }; + key { [ Henkan ] }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/fujitsu/us /opt/SUNWut/lib/xkb/symbols/fujitsu/us --- /opt/SUNWut.orig/lib/xkb/symbols/fujitsu/us 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/fujitsu/us 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,145 @@ +// $Xorg: us,v 1.4 2001/02/09 02:05:53 xorgcvs Exp $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +// US/ASCII layout for a Fujitsu 138 key keyboard +xkb_symbols { + include "us(basic)" + + // A few alphanumeric keys are different + key { [ grave, asciitilde ] }; + key { [ BackSpace ] }; + key { [ backslash, bar ] }; + key { [ ] }; + + key { [ Shift_R ] }; + + key { [ Alt_L ] }; + key { [ Alt_R ] }; + key { [ Meta_L ] }; + key { [ Meta_R ] }; + key { [ Linefeed ] }; + key { [ Multi_key ] }; + // End alphanumeric section + + // Begin "Function" section + key { [ Break ] }; + key { [ Print ] }; + key { [ Kanji ] }; + key { [ Pause ] }; + + key { [ F1 ] }; + key { [ F2 ] }; + key { [ F3 ] }; + key { [ F4 ] }; + key { [ F5 ] }; + key { [ F6 ] }; + key { [ F7 ] }; + key { [ F8 ] }; + key { [ F9 ] }; + key { [ F10 ] }; + key { [ F11 ] }; + key { [ F12 ] }; + key { [ F13 ] }; + key { [ F14 ] }; + key { [ F15 ] }; + key { [ F16 ] }; + key { [ F17 ] }; + key { [ F18 ] }; + key { [ F19 ] }; + key { [ F20 ] }; + key { [ F21 ] }; + key { [ F22 ] }; + key { [ F23 ] }; + key { [ F24 ] }; + key { [ F25 ] }; + key { [ F26 ] }; + key { [ F27 ] }; + key { [ F28 ] }; + key { [ F29 ] }; + key { [ F30 ] }; + key { [ F31 ] }; + key { [ F32 ] }; + // End "Function" section + + // Begin "Editing" section + key { [ Undo ] }; + key { [ F33 ] }; + key { [ F34 ] }; + key { [ F35 ] }; + key { [ Help ] }; + // End "Editing" section + + // Begin "Cursor" section + key { [ ] }; + key { [ ] }; + key { [ ] }; + key { [ Prior ] }; + key { [ Home ] }; + key { [ Next ] }; + key { [ ] }; + key { [ Delete ] }; + key { [ Insert ] }; + key { [ Left ] }; + key { [ Right ] }; + key { [ Up ] }; + key { [ Down ] }; + key { [ Execute ] }; + // End "Cursor" section + + // Begin "Keypad" section + key { [ KP_Multiply ] }; + key { [ KP_Divide ] }; + key { [ KP_Add ] }; + key { [ KP_Subtract ] }; + + key { [ KP_7 ] }; + key { [ KP_8 ] }; + key { [ KP_9 ] }; + key { [ KP_Equal ] }; + + key { [ KP_4 ] }; + key { [ KP_5 ] }; + key { [ KP_6 ] }; + key { [ KP_Decimal ] }; + + key { [ KP_1 ] }; + key { [ KP_2 ] }; + key { [ KP_3 ] }; + key { [ KP_Enter ] }; + + key { [ KP_0 ] }; + key { [ KP_0 ] }; + // End "Keypad" section + + // begin modifier mappings + modifier_map Shift { Shift_R }; + modifier_map Mod1 { Meta_L, Meta_R }; + modifier_map Mod2 { Mode_switch }; + modifier_map Mod3 { Alt_L }; + modifier_map Mod4 { Num_Lock }; + modifier_map Mod5 { F13, F18, F20 }; +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/gb /opt/SUNWut/lib/xkb/symbols/gb --- /opt/SUNWut.orig/lib/xkb/symbols/gb 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/gb 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,134 @@ +// $Xorg: gb,v 1.3 2000/08/17 19:54:43 cpqbld Exp $ + + + + +// $XFree86: xc/programs/xkbcomp/symbols/gb,v 3.6 2003/10/04 10:25:13 pascal Exp $ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + // Describes the differences between a very simple en_US + // keyboard and a very simple U.K. keyboard layout defined by + // the SVR4 European Language Supplement and sometimes also + // known as the IBM 166 layout. + + + name[Group1]= "Great Britain"; + + key { [ grave, notsign ], + [ bar, bar ] }; + key { [ backslash, bar ], + [ bar, brokenbar ] }; + key { [ 2, quotedbl ] }; + key { [ 3, sterling ] }; + key { [ 4, dollar ], + [ EuroSign ] }; + key { [ apostrophe, at ] }; + key { [ numbersign, asciitilde ] }; + + // End alphanumeric section + + // begin modifier mappings + + modifier_map Shift { Shift_L }; + modifier_map Lock { Caps_Lock }; + modifier_map Control{ Control_L }; + modifier_map Mod3 { Mode_switch }; +}; + +partial alphanumeric_keys +xkb_symbols "ibm168" { + + // Describes the differences between a very simple en_US + // keyboard and a very simple U.K. keyboard + // Based on the IBM 168 + + name[Group1]= "Great Britain"; + + key { [ backslash, bar ] }; + key { [ brokenbar, horizconnector ] }; + key { [ 2, quotedbl ], + [ twosuperior, twosuperior ] }; + key { [ 3, sterling ], + [ threesuperior, threesuperior ] }; + key { [ 5, percent ], + [ onehalf, onehalf ] }; + key { [ 7 ] }; + key { [ 8, parenleft ] }; + key { [ 9, parenright ], + [ plusminus, plusminus ] }; + key { [ 0, numbersign ], + [ degree, degree ] }; + key { [ minus, equal ] }; + key { [ notsign, underscore ] }; + key { [ at, grave ] }; + key { [ bracketleft, braceleft ], + [ asciitilde, asciitilde ] }; + key { [ semicolon, plus ] }; + key { [ colon, periodcentered ], + [ caret, caret ] }; + key { [ m, M ], + [ mu, mu ] }; + key { [ bracketright, braceright ] }; + + // End alphanumeric section + + // begin modifier mappings + + modifier_map Shift { Shift_L }; + modifier_map Lock { Caps_Lock }; + modifier_map Control{ Control_L }; + modifier_map Mod3 { Mode_switch }; +}; + +partial alphanumeric_keys +xkb_symbols "Sundeadkeys" { + include "gb(basic)" // for naming consistency +}; + +partial alphanumeric_keys +xkb_symbols "sundeadkeys" { + include "gb(Sundeadkeys)" // for naming consistency +}; + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + include "gb(basic)" // for naming consistency +}; + +partial default alphanumeric_keys +xkb_symbols "intl" { + + // Describes the differences between a very simple en_US + // keyboard and a very simple U.K. keyboard layout with + // dead keys. By Phil Jones (philjones1@blueyonder.co.uk) + + // Includes the following keys: + // dead_grave + // dead_acute + // dead_circumflex + // dead_tilde + // dead_diaeresis + + include "gb(basic)" + + key { [ 2, dead_diaeresis ], + [ twosuperior, onehalf ] }; + key { [ 3, sterling ], + [ threesuperior, onethird ] }; + key { [ 4, dollar ], + [ EuroSign, onequarter ] }; + key { [ 6, dead_circumflex ], + [ NoSymbol, onesixth ] }; + + key { [ dead_acute, at ], + [ apostrophe, bar ] }; + key { [ dead_grave, notsign ], + [ bar, bar ] }; + + key { [ numbersign, dead_tilde ], + [ bar, bar ] }; + key { [ backslash, bar ], + [ bar, bar ] }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/ge_la /opt/SUNWut/lib/xkb/symbols/ge_la --- /opt/SUNWut.orig/lib/xkb/symbols/ge_la 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/ge_la 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,71 @@ +// ge_la (Georgian "latin layout") + +// From the comments of the xmodmap file: +// +// Georgian keyboard map, in the so called "latin" layout. +// 1999, Pablo Saratxaga +// +// Georgian mode is toggled by Right_Ctrl key and shifted by AltGr key. +// uppercase in georgian mode gives the lower case ascii, this can be useful +// to type whithout switching mode. +// +// the layout has been copied from +// http://members.tripod.com/~beso/html/L-K-COD.HTM +// with some few changes it is: +// +// `~ 1!1! 2@2@ 3 3 4$4$ 5% 6^6^ 7&7& 8*8* 9(9( 0)0) -_-_ =+=+ \|\| BackSp +// Tab qQქq wWწჭ eEეe rRრr tTტღ yYყთ uUუu iIიi oOოo Ppპp [{[{ ]}]} +// CapsLock aAაa sSსშ dDდd fFფf gGგg hHჰh jJჯჟ kKკk lLლl ;:;: '"'" Return +// Shift «» zZზძ xXხx cCცჩ vVვv bBბb nNნn mMმm ,<,< .>.> /?/? Shift +// Ctrl Alt Space Space Space NonBreakingSpace  ModeShift ModeLock +// +// the chars ჱჲჳჴჵჶ are not mapped... +// + +partial default alphanumeric_keys +xkb_symbols "basic" { + + // Describes the differences between a very simple en_US + // keyboard and a very simple Georgian "latin layout" keyboard + + name[Group2]= "Georgian"; + + key {[], [ 0x010010e5, q ] }; + key {[], [ 0x010010ec, 0x010010ed ] }; + key {[], [ 0x010010d4, e ] }; + key {[], [ 0x010010e0, 0x010010e6 ] }; + key {[], [ 0x010010e2, 0x010010d7 ] }; + key {[], [ 0x010010e7, y ] }; + key {[], [ 0x010010e3, u ] }; + key {[], [ 0x010010d8, i ] }; + key {[], [ 0x010010dd, o ] }; + key {[], [ 0x010010de, p ] }; + key {[], [ bracketleft, braceleft ] }; + key {[], [ bracketright, braceright ] }; + + key {[], [ 0x010010d0, a ] }; + key {[], [ 0x010010e1, 0x010010e8 ] }; + key {[], [ 0x010010d3, d ] }; + key {[], [ 0x010010e4, f ] }; + key {[], [ 0x010010d2, g ] }; + key {[], [ 0x010010f0, h ] }; + key {[], [ 0x010010ef, 0x010010df ] }; + key {[], [ 0x010010d9, k ] }; + key {[], [ 0x010010da, l ] }; + key {[], [ semicolon, colon ] }; + key {[], [ apostrophe, quotedbl ] }; + key {[], [ backslash, bar ] }; + + key {[], [ guillemotleft,guillemotright ] }; + key {[], [ 0x010010d6, 0x010010eb ] }; + key {[], [ 0x010010ee, x ] }; + key {[], [ 0x010010ea, 0x010010e9 ] }; + key {[], [ 0x010010d5, v ] }; + key {[], [ 0x010010d1, b ] }; + key {[], [ 0x010010dc, n ] }; + key {[], [ 0x010010db, m ] }; + key {[], [ comma, less ] }; + key {[], [ period, greater ] }; + key {[], [ slash, question ] }; + +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/ge_ru /opt/SUNWut/lib/xkb/symbols/ge_ru --- /opt/SUNWut.orig/lib/xkb/symbols/ge_ru 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/ge_ru 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,83 @@ +// ge_ru (Georgian "russian layout") + +// From the comments of the xmodmap file: +// +// Georgian keyboard map, in the so called "russian" layout. +// 1999, Pablo Saratxaga +// +// Georgian mode is toggled by Right_Ctrl key and shifted by AltGr key. +// uppercase in georgian mode gives the lower case ascii, this can be useful +// to type whithout switching mode. +// +// the layout has been copied from +// http://members.tripod.com/~beso/html/RU-K-COD.HTM +// with some few changes it is: +// +// `~^~ 1!1! 2@2 3 3 4$4; 5%5: 6^6, 7&7. 8*8* 9(9( 0)0) -_-_ =+ | \| BackSp +// Tab qQღq wWცw eEუe rRკr tTეt yYნy uUგu iIშi oOწp [{ხ[ ]}ჯ] +// CapsLock aAფa sSთs dDვd fFაf gGპg hHრh jJოj kKლk lLდ; ;:ჟ: '"ძ% Return +// Shift «» zZჭz xXჩx cCსc vVმv bBიb nNტn mMქm ,<ბ< .>ყ> /?ჰ? Shift +// Ctrl Alt Space Space Space NonBreakingSpace  ModeShift ModeLock +// + +partial default alphanumeric_keys +xkb_symbols "basic" { + + // Describes the differences between a very simple en_US + // keyboard and a very simple Georgian "russian layout" keyboard + + name[Group2]= "Georgian"; + + key {[], [ asciicircum, asciitilde ] }; + key {[], [ 1, exclam ] }; + key {[], [ 2, at ] }; // 2 0xeb + key {[], [ 3, numbersign ] }; // 3 0xec + key {[], [ 4, semicolon ] }; + key {[], [ 5, colon ] }; + key {[], [ 6, comma ] }; + key {[], [ 7, period ] }; + key {[], [ 8, asterisk ] }; + key {[], [ 9, parenleft ] }; + key {[], [ 0, parenright ] }; + key {[], [ minus, underscore ] }; + key {[], [ numbersign, bar ] }; + + key {[], [ 0x010010e6, q ] }; + key {[], [ 0x010010ea, w ] }; + key {[], [ 0x010010e3, e ] }; + key {[], [ 0x010010d9, r ] }; + key {[], [ 0x010010d4, t ] }; + key {[], [ 0x010010dc, y ] }; + key {[], [ 0x010010d2, u ] }; + key {[], [ 0x010010e8, i ] }; + key {[], [ 0x010010ec, o ] }; + key {[], [ 0x010010d6, p ] }; + key {[], [ 0x010010ee, bracketleft ] }; + key {[], [ 0x010010ef, bracketright ] }; + + key {[], [ 0x010010e4, a ] }; + key {[], [ 0x010010d7, s ] }; + key {[], [ 0x010010d5, d ] }; + key {[], [ 0x010010d0, f ] }; + key {[], [ 0x010010de, g ] }; + key {[], [ 0x010010e0, h ] }; + key {[], [ 0x010010dd, j ] }; + key {[], [ 0x010010da, k ] }; + key {[], [ 0x010010d3, l ] }; + key {[], [ 0x010010df, semicolon ] }; + key {[], [ 0x010010eb, percent ] }; + key {[], [ backslash, bar ] }; // 0xe9 0xea + + key {[], [ guillemotleft,guillemotright ] }; // 0xab 0xbb 0xe7 0xe8 + key {[], [ 0x010010ed, z ] }; + key {[], [ 0x010010e9, x ] }; + key {[], [ 0x010010e1, c ] }; + key {[], [ 0x010010db, v ] }; + key {[], [ 0x010010d8, b ] }; + key {[], [ 0x010010e2, n ] }; + key {[], [ 0x010010e5, m ] }; + key {[], [ 0x010010d1, less ] }; + key {[], [ 0x010010e7, greater ] }; + key {[], [ 0x010010f0, question ] }; + +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/group /opt/SUNWut/lib/xkb/symbols/group --- /opt/SUNWut.orig/lib/xkb/symbols/group 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/group 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,308 @@ +// $XdotOrg$ +// $XKeyboardConfig: xkbdesc/symbols/group,v 1.6 2004/09/16 00:11:27 svu Exp $ +// $Xorg: group,v 1.3 2000/08/17 19:54:43 cpqbld Exp $ +// using the group(switch) map, the right alt key temporarily chooses +// the second keyboard group (until it is released). +// +// $XFree86: xc/programs/xkbcomp/symbols/group,v 3.9 2003/12/30 13:26:25 pascal Exp $ +partial modifier_keys +xkb_symbols "switch" { + key { + symbols[Group1]= [ Mode_switch, Multi_key ], + virtualMods= AltGr + }; +}; + +// using the group(lswitch) map, the left alt key temporarily chooses +// the second keyboard group (until it is released). +// +partial modifier_keys +xkb_symbols "lswitch" { + key { + symbols[Group1]= [ Mode_switch, Multi_key ], + virtualMods= AltGr + }; +}; + + +// using the group(win_switch) map, both Windows'logo keys temporarily +// choose the second keyboard group (until release). If you use this +// map, you would declare you keyboard as pc101 or pc102 instead of +// pc104 or pc105. +partial modifier_keys +xkb_symbols "win_switch" { + key { + symbols[Group1] = [ Mode_switch, Multi_key ], + virtualMods= AltGr + }; + key { + symbols[Group1] = [ Mode_switch, Multi_key ], + virtualMods= AltGr + }; +}; + +// using the group(lwin_switch) map, the left Windows' logo key +// temporarily chooses the second keyboard group (until it is +// released). If you use this map, you would declare you keyboard as +// pc101 or pc102 instead of pc104 or pc105. +partial modifier_keys +xkb_symbols "lwin_switch" { + key { + symbols[Group1] = [ Mode_switch, Multi_key ], + virtualMods= AltGr + }; +}; + +// using the group(rwin_switch) map, the right Windows' logo key +// temporarily chooses the second keyboard group (until it is +// released). If you use this map, you would declare you keyboard as +// pc101 or pc102 instead of pc104 or pc105. +partial modifier_keys +xkb_symbols "rwin_switch" { + key { + symbols[Group1] = [ Mode_switch, Multi_key ], + virtualMods= AltGr + }; +}; + +// Right Ctrl key temporary chooses the second keyboard group. +// Needed mainly for Canadian keyboard +partial modifier_keys +xkb_symbols "rctrl_switch" { + key { + symbols[Group1]= [ Mode_switch ] + }; +}; + +// using the group(toggle) map, pressing the right alt key switches to +// the next sequential group (until the next explicit group change). +partial modifier_keys +xkb_symbols "toggle" { + virtual_modifiers AltGr; + key { + symbols[Group1]= [ ISO_Next_Group ], + virtualMods= AltGr + }; +}; + +// using the group(shifts_toggle) map, pressing both shift keys together +// locks the next or previous sequential keyboard group +// (depending on which shift is pressed first - right or left, +// correspongingly) +partial modifier_keys +xkb_symbols "shifts_toggle" { + key { [ Shift_L, ISO_Prev_Group ] }; + key { [ Shift_R, ISO_Next_Group ] }; +}; + +// using the group(ctrl_shift_toggle) map, pressing: +// Control_L+Shift_L locks the previous group +// Control_R+Shift_R locks the next group +// If you have two groups and group wrap is enabled, the effect is +// indistinguishable. +partial modifier_keys +xkb_symbols "ctrl_shift_toggle" { + key { + type="PC_BREAK", + symbols[Group1]= [ Shift_L, ISO_Prev_Group ] + }; + key { + type="PC_BREAK", + symbols[Group1]= [ Shift_R, ISO_Next_Group ] + }; + key { [ Control_L, ISO_Prev_Group ] }; + key { [ Control_R, ISO_Next_Group ] }; +}; + +// using the group(caps_toggle) map, pressing: +// Caps Lock toggles groups +// Shift+Caps Lock toggles caps lock +partial modifier_keys +xkb_symbols "caps_toggle" { + include "capslock(grouplock)" +}; + +// using the group(shift_caps_toggle) map, pressing: +// Shift+Caps Lock toggles group +partial modifier_keys +xkb_symbols "shift_caps_toggle" { + key { [ Caps_Lock, ISO_Next_Group ] }; +}; + +// using the group(ctrl_alt_toggle) map, pressing: +// Control_L+Alt_L locks the previous group +// Control_R+Alt_R locks the next group +// If you have two groups and group wrap is enabled, the effect is +// indistinguishable. +partial modifier_keys +xkb_symbols "ctrl_alt_toggle" { + virtual_modifiers Alt; + key { + type="PC_BREAK", + symbols[Group1]= [ NoSymbol, ISO_Prev_Group ], + virtualMods= Alt + }; + key { + type="PC_BREAK", + symbols[Group1]= [ NoSymbol, ISO_Next_Group ], + virtualMods= Alt + }; + key { + type="PC_SYSRQ", + symbols[Group1]= [ Control_L, ISO_Prev_Group ] + }; + key { + type="PC_SYSRQ", + symbols[Group1]= [ Control_R, ISO_Next_Group ] + }; +}; + +// using the group(alt_shift_toggle) map, pressing: +// Shift_L+Alt_L locks the previous group +// Shift_R+Alt_R locks the next group +// If you have two groups and group wrap is enabled, the effect is +// indistinguishable. +partial modifier_keys +xkb_symbols "alt_shift_toggle" { + virtual_modifiers Alt; + key { + symbols[Group1]= [ NoSymbol, ISO_Prev_Group ], + virtualMods= Alt + }; + key { + symbols[Group1]= [ NoSymbol, ISO_Next_Group ], + virtualMods= Alt + }; + key { + type="PC_SYSRQ", + symbols[Group1]= [ Shift_L, ISO_Prev_Group ] + }; + key { + type="PC_SYSRQ", + symbols[Group1]= [ Shift_R, ISO_Next_Group ] + }; +}; + +// using the group(menu_toggle) map, pressing: +// Menu key toggles groups +// Shift+Menu acts as Menu +partial modifier_keys +xkb_symbols "menu_toggle" { + key { [ ISO_Next_Group, Menu ] }; +}; + +// using the group(lwin_toggle) map, pressing the left Windows' logo key +// toggles groups. If you use this map, you would declare you keyboard +// as pc101 or pc102 instead of pc104 or pc105. +partial modifier_keys +xkb_symbols "lwin_toggle" { + virtual_modifiers AltGr; + key { + virtualMods= AltGr, + symbols[Group1] = [ ISO_Next_Group ] + }; +}; + +// using the group(rwin_toggle) map, pressing the right Windows' logo key +// toggles groups. If you use this map, you would declare you keyboard +// as pc101 or pc102 instead of pc104 or pc105. +partial modifier_keys +xkb_symbols "rwin_toggle" { + virtual_modifiers AltGr; + key { + virtualMods= AltGr, + symbols[Group1] = [ ISO_Next_Group ] + }; +}; + +// using the group(sclk_toggle) map, pressing the Scroll Lock key +// toggles groups. +partial modifier_keys +xkb_symbols "sclk_toggle" { + virtual_modifiers AltGr; + key { + virtualMods= AltGr, + symbols[Group1] = [ ISO_Next_Group ] + }; +}; + + +// Both Ctrls pressed together toggle group +partial modifier_keys +xkb_symbols "ctrls_toggle" { + virtual_modifiers AltGr; + key { + type="PC_BREAK", + symbols[Group1]= [ NoSymbol, ISO_Prev_Group ] + }; + key { + type="PC_BREAK", + symbols[Group1]= [ NoSymbol, ISO_Next_Group ] + }; +}; + +// Both Alts pressed together toggle group +partial modifier_keys +xkb_symbols "alts_toggle" { + virtual_modifiers AltGr; + key { + type="PC_SYSRQ", + symbols[Group1]= [ NoSymbol, ISO_Prev_Group ], + virtualMods= Alt + }; + key { + type="PC_SYSRQ", + symbols[Group1]= [ NoSymbol, ISO_Next_Group ], + virtualMods= Alt + }; +}; + +// Left Shift key toggles group +partial modifier_keys +xkb_symbols "lshift_toggle" { + virtual_modifiers AltGr; + key { + symbols[Group1]= [ ISO_Next_Group ], + virtualMods= AltGr + }; +}; + +// Right Shift key toggles group +partial modifier_keys +xkb_symbols "rshift_toggle" { + virtual_modifiers AltGr; + key { + symbols[Group1]= [ ISO_Next_Group ], + virtualMods= AltGr + }; +}; + +// Left Alt key toggles group +partial modifier_keys +xkb_symbols "lalt_toggle" { + virtual_modifiers AltGr; + key { + symbols[Group1]= [ ISO_Next_Group ], + virtualMods= AltGr + }; +}; + +// Left Ctrl key toggles group +partial modifier_keys +xkb_symbols "lctrl_toggle" { + virtual_modifiers AltGr; + key { + symbols[Group1]= [ ISO_Next_Group ], + virtualMods= AltGr + }; +}; + +// Right Ctrl key toggles group +partial modifier_keys +xkb_symbols "rctrl_toggle" { + virtual_modifiers AltGr; + key { + symbols[Group1]= [ ISO_Next_Group ], + virtualMods= AltGr + }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/guj /opt/SUNWut/lib/xkb/symbols/guj --- /opt/SUNWut.orig/lib/xkb/symbols/guj 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/guj 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,67 @@ +// $XConsortium: th /main/3 1996/08/31 12:20:18 kaleb $ +// $XFree86: xc/programs/xkbcomp/symbols/th,v 3.1.2.1 1997/07/19 13:28:20 dawes Exp $ +partial default alphanumeric_keys +xkb_symbols "basic" { + name[Group2]= "Gujarati"; + key { [], [ ] }; + + // Mainly numbers. + key { [], [ 0x1000AE7, 0x1000A8D ] }; + key { [], [ 0x1000AE8, 0x1000AC5 ] }; + key { [], [ 0x1000AE9 ] }; + key { [], [ 0x1000AEA ] }; + key { [], [ 0x1000AEB ] }; + key { [], [ 0x1000AEC ] }; + key { [], [ 0x1000AED ] }; + key { [], [ 0x1000AEE ] }; + key { [], [ 0x1000AEF, parenleft ] }; + key { [], [ 0x1000AE6, parenright ] }; + key { [], [ minus, 0x1000A83 ] }; + key { [], [ 0x1000A8B, 0x1000AC3 ] }; + +// Mainly long vowels + + key { [], [ 0x1000ACC, 0x1000A94 ] }; + key { [], [ 0x1000AC8, 0x1000A90 ] }; + key { [], [ 0x1000ABE, 0x1000A86 ] }; + key { [], [ 0x1000AC0, 0x1000A88 ] }; + key { [], [ 0x1000AC2, 0x1000A8A ] }; + +// Mainly voiced consonants + + key { [], [ 0x1000AAC, 0x1000AAD ] }; + key { [], [ 0x1000AB9, 0x1000A99 ] }; + key { [], [ 0x1000A97, 0x1000A98 ] }; + key { [], [ 0x1000AA6, 0x1000AA7 ] }; + key { [], [ 0x1000A9C, 0x1000A9D ] }; + key { [], [ 0x1000AA1, 0x1000AA2 ] }; + key { [], [ 0x1000ABC, 0x1000A9E ] }; + +// Mainly short vowels + key { [], [ 0x1000ACB, 0x1000A93 ] }; + key { [], [ 0x1000AC7, 0x1000A8F ] }; + key { [], [ 0x1000ACD, 0x1000A85 ] }; + key { [], [ 0x1000ABF, 0x1000A87 ] }; + key { [], [ 0x1000AC1, 0x1000A89 ] }; + +// Mainly unvoiced consonants + + key { [], [ 0x1000AAA, 0x1000AAB ] }; + key { [], [ 0x1000AB0, guj_rra ] }; + key { [], [ 0x1000A95, 0x1000A96 ] }; + key { [], [ 0x1000AA4, 0x1000AA5 ] }; + key { [], [ 0x1000A9A, 0x1000A9B ] }; + key { [], [ 0x1000A9F, 0x1000AA0 ] }; + key { [], [ 0x1000AC9, 0x1000A91 ] }; + + key { [], [ z , Z ] }; + key { [], [ 0x1000A82, 0x1000A81 ] }; + key { [], [ 0x1000AAE, 0x1000AA3 ] }; + key { [], [ 0x1000AA8, guj_nnna ] }; + key { [], [ 0x1000AB5, guj_llla ] }; + key { [], [ 0x1000AB2, 0x1000AB3 ] }; + key { [], [ 0x1000AB8, 0x1000AB6 ] }; + key { [], [ comma, 0x1000AB7 ] }; + key { [], [ period, 0x1000964 ] }; + key { [], [ 0x1000AAF, question ] }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/gur /opt/SUNWut/lib/xkb/symbols/gur --- /opt/SUNWut.orig/lib/xkb/symbols/gur 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/gur 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,67 @@ +// $XConsortium: th /main/3 1996/08/31 12:20:18 kaleb $ +// $XFree86: xc/programs/xkbcomp/symbols/th,v 3.1.2.1 1997/07/19 13:28:20 dawes Exp $ +partial default alphanumeric_keys +xkb_symbols "basic" { + name[Group2]= "Gurmukhi"; + key { [], [ ] }; + + // Mainly numbers. + key { [], [ 0x1000A67 ] }; + key { [], [ 0x1000A68 ] }; + key { [], [ 0x1000A69 ] }; + key { [], [ 0x1000A6A ] }; + key { [], [ 0x1000A6B ] }; + key { [], [ 0x1000A6C ] }; + key { [], [ 0x1000A6D ] }; + key { [], [ 0x1000A6e ] }; + key { [], [ 0x1000A6F, parenleft ] }; + key { [], [ 0x1000A66, parenright ] }; + key { [], [ gur_visarga ] }; + key { [], [ gur_v_r, gur_v_r_s ] }; + +// Mainly long vowels + + key { [], [ 0x1000A4C, 0x1000A14 ] }; + key { [], [ 0x1000A48, 0x1000A10 ] }; + key { [], [ 0x1000A3E, 0x1000A06 ] }; + key { [], [ 0x1000A40, 0x1000A08 ] }; + key { [], [ 0x1000A42, 0x1000A0A ] }; + +// Mainly voiced consonants + + key { [], [ 0x1000A2C, 0x1000A2D ] }; + key { [], [ 0x1000A39, 0x1000A19 ] }; + key { [], [ 0x1000A17, 0x1000A18 ] }; + key { [], [ 0x1000A26, 0x1000A27 ] }; + key { [], [ 0x1000A1C, 0x1000A1D ] }; + key { [], [ 0x1000A21, 0x1000A22 ] }; + key { [], [ 0x1000A3C, 0x1000A1E ] }; + +// Mainly short vowels + key { [], [ 0x1000A4B, 0x1000A13 ] }; + key { [], [ 0x1000A47, 0x1000A0F ] }; + key { [], [ 0x1000A4D, 0x1000A05 ] }; + key { [], [ 0x1000A3F, 0x1000A07 ] }; + key { [], [ 0x1000A41, 0x1000A09 ] }; + +// Mainly unvoiced consonants + + key { [], [ 0x1000A2A, 0x1000A2B ] }; + key { [], [ 0x1000A30, 0x1000A30 ] }; + key { [], [ 0x1000A15, 0x1000A16 ] }; + key { [], [ 0x1000A24, 0x1000A25 ] }; + key { [], [ 0x1000A1A, 0x1000A1B ] }; + key { [], [ 0x1000A1F, 0x1000A20 ] }; + key { [], [ backslash, bar ] }; + + key { [], [ z, Z ] }; + key { [], [ 0x1000A02, 0x1000A70 ] }; + key { [], [ 0x1000A2E, 0x1000A23 ] }; + key { [], [ 0x1000A28, 0x1000A28 ] }; + key { [], [ 0x1000A35, 0x1000A35 ] }; + key { [], [ 0x1000A32, 0x1000A33 ] }; + key { [], [ 0x1000A38, 0x1000A36 ] }; + key { [], [ comma, less ] }; + key { [], [ period, 0x1000964 ] }; + key { [], [ 0x1000A2F, question ] }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/hp/us /opt/SUNWut/lib/xkb/symbols/hp/us --- /opt/SUNWut.orig/lib/xkb/symbols/hp/us 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/hp/us 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,106 @@ +// $Xorg: us,v 1.4 2001/02/09 02:05:53 xorgcvs Exp $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +// US/ASCII layout for a HP non-PC keyboard +xkb_symbols "hil" { + include "us(basic)" + + // A few alphanumeric keys are different + key { [ grave, asciitilde ]}; + key { [ Shift_R ]}; + key { [ Meta_L ]}; + key { [ Meta_R ]}; + // End alphanumeric section + + // Begin "Function" section + key { [ Break ]}; + key { [ Cancel ]}; + key { [ F1 ] }; + key { [ F2 ] }; + key { [ F3 ] }; + key { [ F4 ] }; + key { [ Menu ] }; + key { [ hpSystem ]}; + key { [ F5 ] }; + key { [ F6 ] }; + key { [ F7 ] }; + key { [ F8 ] }; + key { [ hpClearLine ]}; + key { [ Clear ]}; + key { [ F9 ] }; + key { [ F10 ] }; + key { [ F11 ] }; + key { [ F12 ] }; + // End "Function" section + + // Begin "Editing" section + key { [ Execute, Print ]}; + key { [ hpInsertLine ]}; + key { [ hpDeleteLine ]}; + key { [ hpInsertChar ]}; + key { [ hpDeleteChar ]}; + key { [ Home ] }; + key { [ Prior ] }; + key { [ Next ] }; + key { [ Select ] }; + key { [ Left ] }; + key { [ Down ] }; + key { [ Up ] }; + key { [ Right ]}; + + // End "Editing" section, begin "Keypad" + key { [ KP_Multiply ]}; + key { [ KP_Divide ]}; + key { [ KP_Add ]}; + key { [ KP_Subtract ]}; + + key { [ KP_7 ] }; + key { [ KP_8 ] }; + key { [ KP_9 ] }; + key { [ KP_Enter ]}; + + key { [ KP_4 ] }; + key { [ KP_5 ] }; + key { [ KP_6 ] }; + key { [ KP_Separator ]}; + + key { [ KP_1 ] }; + key { [ KP_2 ] }; + key { [ KP_3 ] }; + key { [ KP_Tab ]}; + + key { [ KP_0 ] }; + key { [ KP_Decimal ] }; + // End "Keypad" section + + + // begin modifier mappings + modifier_map Shift { Shift_R }; + modifier_map Mod1 { Meta_L, Meta_R }; + modifier_map Mod2 { Alt_L }; + modifier_map Mod3 { Mode_switch }; +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/hr /opt/SUNWut/lib/xkb/symbols/hr --- /opt/SUNWut.orig/lib/xkb/symbols/hr 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/hr 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,105 @@ +// Croatian keyboards +// by Vlatko Kosturjak (kost at linux.hr) +// Taken from Slovenian keyboards +// by Marko Samastur (markos@elite.org) and +// Primoz Peterlin (primoz.peterlin@biofiz.mf.uni-lj.si) +// +// Changelog +// ========= +// 2003-04-11 Fixes from joy (AltGr+, i AltGr+.) +// 2003-04-03 Added (Delete/Separator) +// 2000-02-06 Initial version +// +// xc/programs/xkbcomp/symbols/hr +// $XFree86: xc/programs/xkbcomp/symbols/hr,v 1.2 2003/04/13 18:22:19 dawes Exp $ + +default partial alphanumeric_keys +xkb_symbols "basic" { + + // Describes the differences between a very simple US/ASCII + // keyboard and a Slovenian keybaord + // by Marko Samastur (markos@elite.org) + + // Alphanumeric section + name[Group1]= "Croatian"; + key { [ dead_cedilla, dead_diaeresis ] }; + key { [ 1, exclam ], + [ asciitilde, dead_tilde ] }; + key { [ 2, quotedbl ], + [ dead_caron, caron ] }; + key { [ 3, numbersign ], + [ asciicircum, dead_circumflex ] }; + key { [ 4, dollar ], + [ dead_breve, breve ] }; + key { [ 5, percent ], + [ degree, dead_abovering ] }; + key { [ 6, ampersand ], + [ dead_ogonek, ogonek ] }; + key { [ 7, slash ], + [ quoteleft, dead_grave ] }; + key { [ 8, parenleft ], + [ dead_abovedot, abovedot ] }; + key { [ 9, parenright ], + [ dead_acute, quoteright ] }; + key { [ 0, equal ], + [ dead_doubleacute, doubleacute ] }; + key { [ apostrophe, question ], + [ dead_diaeresis, diaeresis ] }; + key { [ plus, asterisk ], + [ dead_cedilla, cedilla ] }; + + key { [ q, Q ], + [ backslash ] }; + key { [ w, W ], + [ bar ] }; + key { [ e, E ], + [ EuroSign ] }; + key { [ t, T ] }; + key { [ z, Z ] }; + key { [ u, U ] }; + key { [ i, I ] }; + key { [ scaron, Scaron ], + [ division ] }; + key { [ dstroke, Dstroke ], + [ multiply, dead_macron ] }; + key { [ f, F ], + [ bracketleft ] }; + key { [ g, G ], + [ bracketright ] }; + key { [ k, K ], + [ lstroke ] }; + key { [ l, L ], + [ Lstroke ] }; + key { [ ccaron, Ccaron ] }; + key { [ cacute, Cacute ], + [ ssharp ] }; + + key { [ less, greater ], + [ bar ] }; + key { [ y, Y ] }; + key { [ v, V ], + [ at ] }; + key { [ b, B ], + [ braceleft ] }; + key { [ n, N ], + [ braceright ] }; + key { [ m, M ], + [ section ] }; + key { [ comma, semicolon ], + [ less ] }; + key { [ period, colon ], + [ greater ] }; + key { [ minus, underscore ] }; + key { [ zcaron, Zcaron ], + [ currency ] }; + key { [ KP_Delete, KP_Separator ] }; + key { [ Mode_switch, Multi_key ] }; + + // End alphanumeric section + + // begin modifier mappings + modifier_map Shift { Shift_L }; + modifier_map Lock { Caps_Lock }; + modifier_map Control{ Control_L }; + modifier_map Mod3 { Mode_switch }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/hr_US /opt/SUNWut/lib/xkb/symbols/hr_US --- /opt/SUNWut.orig/lib/xkb/symbols/hr_US 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/hr_US 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,80 @@ +// Croatian-US keyboards +// by Vlatko Kosturjak (kost at linux.hr) +// +// Changelog +// ========= +// 2003-04-03 Added (Delete/Separator) +// 2002-11-20 Initial version +// +// xc/programs/xkbcomp/symbols/hr_US +// $XFree86$ + +default partial alphanumeric_keys +xkb_symbols "basic" { + + // Describes the differences between US/ASCII + // keyboard and a Croatian-US keyboard + // by Vlatko Kosturjak (kost at linux.hr) + + // Alphanumeric section + name[Group1]= "Croatian(US)"; + key { [ q, Q ], + [ backslash ] }; + key { [ w, W ], + [ bar ] }; + key { [ e, E ], + [ EuroSign ] }; + key { [ t, T ] }; + key { [ y, Y ], + [ z, Z ] }; + key { [ u, U ] }; + key { [ i, I ] }; + key { [ bracketleft, braceleft ], + [ scaron, Scaron ] }; + key { [ bracketright, braceright ], + [ dstroke, Dstroke ] }; + key { [ f, F ], + [ bracketleft ] }; + key { [ g, G ], + [ bracketright ] }; + key { [ k, K ], + [ lstroke ] }; + key { [ l, L ], + [ Lstroke ] }; + key { [ semicolon, colon ], + [ ccaron, Ccaron ] }; + key { [ apostrophe, quotedbl ], + [ cacute, Cacute ] }; + + + key { [ less, greater ], + [ bar ] }; + key { [ z, Z ], + [ y, Y ] }; + key { [ v, V ], + [ at ] }; + key { [ b, B ], + [ braceleft ] }; + key { [ n, N ], + [ braceright ] }; + key { [ m, M ], + [ section ] }; + key { [ comma, less ], + [ semicolon ] }; + key { [ period, greater ], + [ colon ] }; + key { [ slash, question ], + [ minus, underscore ] }; + key { [ backslash, bar ], + [ zcaron, Zcaron ] }; + key { [ KP_Delete, KP_Separator ] }; + key { [ Mode_switch, Multi_key ] }; + + // End alphanumeric section + + // begin modifier mappings + modifier_map Shift { Shift_L }; + modifier_map Lock { Caps_Lock }; + modifier_map Control{ Control_L }; + modifier_map Mod3 { Mode_switch }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/hu /opt/SUNWut/lib/xkb/symbols/hu --- /opt/SUNWut.orig/lib/xkb/symbols/hu 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/hu 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,338 @@ +// Hungarian keyboard symbols for XKB and PC keyboard +// +// (C) 2002 Peter Soos +// +// Permission is granted to anyone to use, distribute and modify +// this file in any way, provided that the above copyright notice +// is left intact and the author of the modification summarizes +// the changes in this header. +// +// This file is distributed without any expressed or implied warranty. +// +// It describes the differences between a very simple US/ASCII keyboard +// layout and some widely used Hungarian keyboard layouts. +// Tested on Linux with XFree86 3.3.6 +// +// $XFree86: xc/programs/xkbcomp/symbols/hu,v 1.7 2002/12/13 04:18:03 dawes Exp $ + + +// Default layout +default partial +xkb_symbols "default" { + include "hu(102_qwertz_comma)" +}; + +// Standard layout +partial +xkb_symbols "standard" { + include "hu(102_qwertz_comma)" +}; + +// Main layouts + +// 101_qwertz_comma: +// Unicode based 101 key qwertz layout with decimal comma on keypad +// You have to set your locale settings (at least LC_CTYPE) to hu_HU. +partial +xkb_symbols "101_qwertz_comma" { + name[Group1] = "Hungarian"; + include "hu(def_uni)" + include "hu(def_101)" + include "hu(def_qwertz)" + include "hu(def_comma)" + include "hu(def_common)" +}; + +// 101_qwertz_dot: +// Unicode based 101 key qwertz layout with decimal dot on keypad +// You have to set your locale settings (at least LC_CTYPE) to hu_HU. +partial +xkb_symbols "101_qwertz_dot" { + name[Group1] = "Hungarian"; + include "hu(def_uni)" + include "hu(def_101)" + include "hu(def_qwertz)" + include "hu(def_dot)" + include "hu(def_common)" +}; + +// 101_qwerty_comma: +// Unicode based 101 key qwerty layout with decimal comma on keypad +// You have to set your locale settings (at least LC_CTYPE) to hu_HU. +partial +xkb_symbols "101_qwerty_comma" { + name[Group1] = "Hungarian"; + include "hu(def_uni)" + include "hu(def_101)" + include "hu(def_qwerty)" + include "hu(def_comma)" + include "hu(def_common)" +}; + +// 101_qwerty_dot: +// Unicode based 101 key qwerty layout with decimal dot on keypad +// You have to set your locale settings (at least LC_CTYPE) to hu_HU. +partial +xkb_symbols "101_qwerty_dot" { + name[Group1] = "Hungarian"; + include "hu(def_uni)" + include "hu(def_101)" + include "hu(def_qwerty)" + include "hu(def_dot)" + include "hu(def_common)" +}; + +// 102_qwertz_comma: +// Unicode based 102 key qwertz layout with decimal comma on keypad +// You have to set your locale settings (at least LC_CTYPE) to hu_HU. +partial +xkb_symbols "102_qwertz_comma" { + name[Group1] = "Hungarian"; + include "hu(def_uni)" + include "hu(def_102)" + include "hu(def_qwertz)" + include "hu(def_comma)" + include "hu(def_common)" +}; + +// 102_qwertz_dot: +// Unicode based 102 key qwertz layout with decimal dot on keypad +// You have to set your locale settings (at least LC_CTYPE) to hu_HU. +partial +xkb_symbols "102_qwertz_dot" { + name[Group1] = "Hungarian"; + include "hu(def_uni)" + include "hu(def_102)" + include "hu(def_qwertz)" + include "hu(def_dot)" + include "hu(def_common)" +}; + +// 102_qwerty_comma: +// Unicode based 102 key qwerty layout with decimal comma on keypad +// You have to set your locale settings (at least LC_CTYPE) to hu_HU. +partial +xkb_symbols "102_qwerty_comma" { + name[Group1] = "Hungarian"; + include "hu(def_uni)" + include "hu(def_102)" + include "hu(def_qwerty)" + include "hu(def_comma)" + include "hu(def_common)" +}; + +// 102_qwerty_dot: +// Unicode based 102 key qwerty layout with decimal dot on keypad +// You have to set your locale settings (at least LC_CTYPE) to hu_HU. +partial +xkb_symbols "102_qwerty_dot" { + name[Group1] = "Hungarian"; + include "hu(def_uni)" + include "hu(def_102)" + include "hu(def_qwerty)" + include "hu(def_dot)" + include "hu(def_common)" +}; + +// Partial layouts + +// def_uni: +// Unicode based Hungarian keybaord. + +hidden partial alphanumeric_keys +xkb_symbols "def_uni" { + + key { [ u, U ], + [ EuroSign ] }; + key { [ s, S ], + [ dstroke ] }; + key { [ d, D ], + [ Dstroke ] }; + key { [ k, K ], + [ lstroke ] }; + key { [ l, L ], + [ Lstroke ] }; + key { [ odoubleacute, Odoubleacute ], + [ division ] }; + key { [ udoubleacute, Udoubleacute ], + [ currency ] }; +}; + +// def_102: +// The standard Hungarian 102 key layout + +hidden partial alphanumeric_keys +xkb_symbols "def_102" { + key { [ 0, section ], + [ notsign ] }; +}; + +// def_101: +// An alternative layout for 101 key keyboards + +hidden partial alphanumeric_keys +xkb_symbols "def_101" { + key { [ iacute, Iacute ], + [ 0, section ] }; +}; + +// def_qwertz: +// The standard Hungaryan qwertz layout + +hidden partial alphanumeric_keys +xkb_symbols "def_qwertz" { + key { [ y, Y ], + [ greater ] }; + key { [ z, Z ] }; +}; + +// def_qwerty: +// The qwerty layout for people who familiar with the standard US layout + +hidden partial alphanumeric_keys +xkb_symbols "def_qwerty" { + key { [ z, Z ], + [ greater ] }; + key { [ y, Y ] }; +}; + +// def_comma: +// The Hungarian standard is the comma on the keypad not decimal dot +hidden partial keypad_keys +xkb_symbols "def_comma" { + key { [ KP_Delete, KP_Separator ] }; +}; + +// def_dot: +// The Hungarian standard is the comma on the keypad not decimal dot, +// but programmers hate it +hidden partial keypad_keys +xkb_symbols "def_dot" { + key { [ KP_Delete, KP_Decimal ] }; +}; + +// def_common: +// The common part of all Hungarian layout above +hidden partial alphanumeric_keys modifier_keys +xkb_symbols "def_common" { + + // Alphanumeric section + key { [ 1, apostrophe ], + [ asciitilde, dead_tilde ] }; + key { [ 2, quotedbl ], + [ dead_caron, caron ] }; + key { [ 3, plus ], + [ asciicircum, dead_circumflex ] }; + key { [ 4, exclam ], + [ dead_breve, breve ] }; + key { [ 5, percent ], + [ dead_abovering, degree ] }; + key { [ 6, slash ], + [ dead_ogonek, ogonek ] }; + key { [ 7, equal ], + [ grave, dead_grave ] }; + key { [ 8, parenleft ], + [ dead_abovedot, degree ] }; + key { [ 9, parenright ], + [ dead_acute, acute ] }; + key { [ odiaeresis, Odiaeresis ], + [ dead_doubleacute, doubleacute ] }; + key { [ udiaeresis, Udiaeresis ], + [ dead_diaeresis, diaeresis ] }; + key { [ oacute, Oacute ], + [ dead_cedilla, cedilla ] }; + + key { [ q, Q ], + [ backslash ] }; + key { [ w, W ], + [ bar ] }; + key { [ u, U ], + [ EuroSign ] }; + key { [ i, I ], + [ Iacute ] }; + key { [ uacute, Uacute ], + [ multiply ] }; + + key { [ f, F ], + [ bracketleft ] }; + key { [ g, G ], + [ bracketright ] }; + key { [ j, J ], + [ iacute ] }; + key { [ eacute, Eacute ], + [ dollar ] }; + key { [ aacute, Aacute ], + [ ssharp ] }; + + key { [ iacute, Iacute ], + [ less ] }; + key { [ x, X ], + [ numbersign ] }; + key { [ c, C ], + [ ampersand ] }; + key { [ v, V ], + [ at ] }; + key { [ b, B ], + [ braceleft ] }; + key { [ n, N ], + [ braceright ] }; + key { [ m, M ], + [ less ] }; + key { [ comma, question ], + [ semicolon ] }; + key { [ period, colon ], + [ greater ] }; + key { [ minus, underscore ], + [ asterisk ] }; + key { [ Mode_switch, Multi_key ] }; + key { [ Alt_L, Meta_L ] }; + + // End alphanumeric section + + // begin modifier mappings + modifier_map Shift { Shift_L }; + modifier_map Lock { Caps_Lock }; + modifier_map Control{ Control_L }; + modifier_map Mod3 { Mode_switch }; +}; + +partial +xkb_symbols "Sundeadkeys" { + include "hu(default)" // for consistent naming +}; + +partial +xkb_symbols "sundeadkeys" { + include "hu(Sundeadkeys)" // for consistent naming +}; + +partial +xkb_symbols "nodeadkeys" { + // modify the default Hungarian layout to not have any dead keys + include "hu(default)" + key { [ 1, apostrophe ], + [ asciitilde ] }; + key { [ 2, quotedbl ], + [ caron ] }; + key { [ 3, plus ], + [ asciicircum ] }; + key { [ 4, exclam ], + [ breve ] }; + key { [ 5, percent ], + [ degree ] }; + key { [ 6, slash ], + [ ogonek ] }; + key { [ 7, equal ], + [ grave ] }; + key { [ 8, parenleft ], + [ abovedot ] }; + key { [ 9, parenright ], + [ acute ] }; + key { [ odiaeresis, Odiaeresis ], + [ doubleacute ] }; + key { [ udiaeresis, Udiaeresis ], + [ diaeresis ] }; + key { [ oacute, Oacute ], + [ cedilla ] }; + +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/hu_US /opt/SUNWut/lib/xkb/symbols/hu_US --- /opt/SUNWut.orig/lib/xkb/symbols/hu_US 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/hu_US 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,152 @@ +// $XFree86: xc/programs/xkbcomp/symbols/hu,v 1.1.2.2 1997/06/22 10:32:56 dawes Exp $ + +default partial alphanumeric_keys +xkb_symbols "basic" { + + // Describes the differences between a very simple US/ASCII + // keyboard and a very simple Hungarian keybaord used with + // us or another ISO-8859-1 based locale settings. + // If you use the standard Hungarian locale (hu_HU) use the hu + // xkb file instead. + // Peter Soos + + // Alphanumeric section + name[Group1]= "Hungarian"; + key { [ 0, section ], + [ notsign ] }; + key { [ 1, apostrophe ], + [ asciitilde, dead_tilde ] }; + key { [ 2, quotedbl ], + [ caron, dead_caron ] }; + key { [ 3, plus ], + [ asciicircum, dead_circumflex ] }; + key { [ 4, exclam ], + [ breve, dead_breve ] }; + key { [ 5, percent ], + [ degree, dead_abovering ] }; + key { [ 6, slash ], + [ ogonek, dead_ogonek ] }; + key { [ 7, equal ], + [ grave, dead_grave ] }; + key { [ 8, parenleft ], + [ abovedot, dead_abovedot ] }; + key { [ 9, parenright ], + [ acute, dead_acute ] }; + key { [ odiaeresis, Odiaeresis ], + [ doubleacute, dead_doubleacute ] }; + key { [ udiaeresis, Udiaeresis ], + [ diaeresis, dead_diaeresis ] }; + key { [ oacute, Oacute ], + [ cedilla, dead_cedilla ] }; + + key { [ q, Q ], + [ backslash ] }; + key { [ w, W ], + [ bar ] }; + key { [ z, Z ] }; + key { [ u, U ], + [ EuroSign ] }; + key { [ i, I ], + [ Iacute ] }; +// key { [ odoubleacute, Odoubleacute ], +// [ division ] }; + key { [ otilde, Otilde ], + [ division ] }; + key { [ uacute, Uacute ], + [ multiply ] }; + + key { [ s, S ], + [ dstroke ] }; + key { [ d, D ], + [ Dstroke ] }; + key { [ f, F ], + [ bracketleft ] }; + key { [ g, G ], + [ bracketright ] }; + key { [ j, J ], + [ iacute ] }; + key { [ k, K ], + [ lstroke ] }; + key { [ l, L ], + [ Lstroke ] }; + key { [ eacute, Eacute ], + [ dollar ] }; + key { [ aacute, Aacute ], + [ ssharp ] }; + + key { [ iacute, Iacute ], + [ less ] }; + key { [ y, Y ], + [ greater ] }; + key { [ x, X ], + [ numbersign ] }; + key { [ c, C ], + [ ampersand ] }; + key { [ v, V ], + [ at ] }; + key { [ b, B ], + [ braceleft ] }; + key { [ n, N ], + [ braceright ] }; + key { [ comma, question ], + [ semicolon ] }; + key { [ period, colon ] }; + key { [ minus, underscore ], + [ asterisk ] }; + key { [ ucircumflex, Ucircumflex ], + [ currency ] }; +// key { [ udoubleacute, Udoubleacute ], +// [ currency ] }; + key { [ Mode_switch, Multi_key ] }; + key { [ Alt_L, Meta_L ] }; + + // End alphanumeric section + + // begin modifier mappings + modifier_map Shift { Shift_L }; + modifier_map Lock { Caps_Lock }; + modifier_map Control{ Control_L }; + modifier_map Mod3 { Mode_switch }; +}; + +partial alphanumeric_keys +xkb_symbols "Sundeadkeys" { + include "hu(basic)" // for consistent naming +}; + +partial alphanumeric_keys +xkb_symbols "sundeadkeys" { + include "hu(Sundeadkeys)" // for consistent naming +}; + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + // modify the default Hungarian layout to not have any dead keys + include "hu(basic)" + key { [ 1, apostrophe ], + [ asciitilde ] }; + key { [ 2, quotedbl ], + [ caron ] }; + key { [ 3, plus ], + [ asciicircum ] }; + key { [ 4, exclam ], + [ breve ] }; + key { [ 5, percent ], + [ degree ] }; + key { [ 6, slash ], + [ ogonek ] }; + key { [ 7, equal ], + [ grave ] }; + key { [ 8, parenleft ], + [ abovedot ] }; + key { [ 9, parenright ], + [ acute ] }; + key { [ odiaeresis, Odiaeresis ], + [ doubleacute ] }; + key { [ udiaeresis, Udiaeresis ], + [ diaeresis ] }; + key { [ oacute, Oacute ], + [ cedilla ] }; + +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/hu_qwerty /opt/SUNWut/lib/xkb/symbols/hu_qwerty --- /opt/SUNWut.orig/lib/xkb/symbols/hu_qwerty 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/hu_qwerty 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,10 @@ +// Hungarian keyboard symbols for XKB and 101-key qwerty PC keyboard +// +// $XFree86$ +// +// Check also ../rules/xfree86.lst + +default partial +xkb_symbols "default" { + include "hu(101_qwerty_comma)" +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/ie /opt/SUNWut/lib/xkb/symbols/ie --- /opt/SUNWut.orig/lib/xkb/symbols/ie 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/ie 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,262 @@ +// $XFree86: xc/programs/xkbcomp/symbols/ie,v 1.2 2002/12/19 00:49:41 dawes Exp $ + +// Irish keyboard map + +// Support for Irish (old and new orthography) and English +// Seamus O Ciardhuain (19 December 2002) + +// The general idea is to provide the characters in ISO 8859-1, +// ISO 8859-15, ISO 8859-14, CP1252 and "Extended Latin-8". +// However, not all are accessible directly because there aren't +// enough keys; some need deadkeys to access them, others the +// "Multi_key" compose sequences. + +// Designed to be similar to the layouts used on Windows +// and the Macintosh. + +// Everything is in Group 1 to be compatible with the +// multi-layout keyboard support in XFree86 4.3. + +// The basic layout is a modern keyboard, but dotted consonants are +// accessible using a deadkey (AltGr+H or AltGr+W). +// If a proper Clo Gaelach keyboard is needed, then use the layout +// defined below as ie(CloGaelach), which gives dotted consonants +// without use of a deadkey. + + +partial default alphanumeric_keys +xkb_symbols "basic" { + + // Modern keyboard for Irish and English + // - acute-accented vowels as AltGr+vowel and AltGr+Shift+vowel + // - euro currency sign as AltGr+4 + // - Comhartha Agus (Tironian Sign Et) as AltGr+Shift+7 + // - non-breaking space as AltGr+Space and AltGr+Shift+Space + // - matches hardware (keys and engraved symbols) for Irish keyboards + + name[Group1] = "Irish"; + + key.type[Group1] = "FOUR_LEVEL_ALPHABETIC"; + + // + // Numeric row `1234567890-= + // + key { [ grave, notsign, brokenbar, NoSymbol ] }; + key { [ 1, exclam, exclamdown, onesuperior ] }; + key { [ 2, quotedbl, trademark, twosuperior ] }; + key { [ 3, sterling, copyright, threesuperior ] }; + key { [ 4, dollar, EuroSign, cent ] }; + key { [ 5, percent, section, dagger ] }; + key { [ 6, asciicircum, dead_circumflex, 0x1002030 ] }; + // per thousand + key { [ 7, ampersand, paragraph, 0x100204A ] }; + // Tironian Et + key { [ 8, asterisk, dead_diaeresis, enfilledcircbullet ] }; + key { [ 9, parenleft, ordfeminine, periodcentered ] }; + key { [ 0, parenright, masculine, degree ] }; + key { [ minus, underscore, endash, emdash ] }; + key { [ equal, plus, notequal, plusminus ] }; + + // + // QWERTYUIOP[] + // + key { [ q, Q, oe, OE ] }; + key { [ w, W, dead_abovedot, dead_abovedot ] }; + key { [ e, E, eacute, Eacute ] }; + key { [ r, R, registered, 0x1002030 ] }; + // per thousand + key { [ t, T, thorn, THORN ] }; + key { [ y, Y, yen, mu ] }; + key { [ u, U, uacute, Uacute ] }; + key { [ i, I, iacute, Iacute ] }; + key { [ o, O, oacute, Oacute ] }; + key { [ p, P, singlelowquotemark, NoSymbol ] }; + key { [ bracketleft, braceleft, leftdoublequotemark, rightdoublequotemark ] }; + key { [ bracketright, braceright, leftsinglequotemark, rightsinglequotemark ] }; + + // + // ASDFGHJKL;'# + // + key { [ a, A, aacute, Aacute ] }; + key { [ s, S, ssharp, NoSymbol ] }; + key { [ d, D, eth, ETH ] }; + key { [ f, F, 0x1000192, NoSymbol ] }; + // f with hook + key { [ g, G, copyright, NoSymbol ] }; + key { [ h, H, dead_abovedot, dead_abovedot ] }; + key { [ j, J, idotless, onequarter ] }; + key { [ k, K, dead_abovering, onehalf ] }; + key { [ l, L, acute, threequarters ] }; + key { [ semicolon, colon, ellipsis, doubledagger ] }; + key { [ apostrophe, at, ae, AE ] }; + key { [ numbersign, asciitilde, guillemotleft, guillemotright ] }; + + + // + // \ZXCVBNM,./ + // + key { [ backslash, bar, dead_grave, dead_acute ] }; + key { [ z, Z, leftanglebracket, rightanglebracket ] }; + key { [ x, X, multiply, approximate ] }; + key { [ c, C, dead_cedilla, cedilla ] }; + key { [ v, V, dead_caron, NoSymbol ] }; + key { [ b, B, diaeresis, NoSymbol ] }; + key { [ n, N, dead_tilde, NoSymbol ] }; + key { [ m, M, macron, NoSymbol ] }; + key { [ comma, less, lessthanequal, doublelowquotemark ] }; + key { [ period, greater, greaterthanequal, singlelowquotemark ] }; + key { [ slash, question, division, questiondown ] }; + + + key { type[Group1]="FOUR_LEVEL", + [ space, space, nobreakspace, nobreakspace ] }; + + key { type[Group1]="ONE_LEVEL", [ ISO_Level3_Shift ] }; + modifier_map Mod5 { ISO_Level3_Shift }; + + // NB: putting Shift+ as Multi_key gives odd behaviour since the + // order of pressing keys affects the result. + + key { type[Group1]="TWO_LEVEL", [ Multi_key, ISO_Next_Group ] }; +}; + +partial alphanumeric_keys +xkb_symbols "laptop" { + // For laptops which don't have the RWIN key but are otherwise + // the same as 105-key layouts. + include "ie(basic)" + key { type[Group1]="TWO_LEVEL", [ Multi_key, ISO_Next_Group ] }; +}; + +partial alphanumeric_keys +xkb_symbols "CloGaelach" { + + // Adds support for Clo Gaelach (old orthography for Irish). + // Changes from "basic": + // - dotted consonants as AltGr+consonant or AltGr+Shift+consonant (TPSDFGCBM) + // - long lowercase r as AltGr+R + // - long lowercase s as AltGr+Z + // - long lowercase s dotted as AltGr+Shift+Z + // - some symbols moved around to retain them + // - several characters unlikely to be used are lost + // The long letters are needed only where the font provides + // both the long and short forms as different glyphs. + + include "ie(basic)" + + name[Group1] = "Irish (Clo Gaelach)"; + + key { [ grave, notsign, brokenbar, ssharp ] }; + key { [ r, R, 0x100027C, registered ] }; + // long r + key { [ t, T, tabovedot, Tabovedot ] }; + key { [ p, P, pabovedot, Pabovedot ] }; + + key { [ s, S, sabovedot, Sabovedot ] }; + key { [ d, D, dabovedot, Dabovedot ] }; + key { [ f, F, fabovedot, Fabovedot ] }; + key { [ g, G, gabovedot, Gabovedot ] }; + + key { [ z, Z, 0x100017F, 0x1001E9B ] }; + // long s, long s dot + key { [ c, C, cabovedot, Cabovedot ] }; + key { [ b, B, babovedot, Babovedot ] }; + key { [ m, M, mabovedot, Mabovedot ] }; + + key { [ backslash, bar, dead_grave, dead_cedilla ] }; +}; + +partial alphanumeric_keys +xkb_symbols "CloGaelachLaptop" { + // For laptops which don't have the RWIN key but are otherwise + // the same as 105-key layouts. + include "ie(CloGaelach)" + key { type[Group1]="TWO_LEVEL", [ Multi_key, ISO_Next_Group ] }; +}; + +partial alphanumeric_keys +xkb_symbols "UnicodeExpert" { + +// This should eventually be a "Unicode Expert" layout like the Mac one. + + name[Group1] = "Irish (Unicode Expert)"; + + key.type[Group1] = "FOUR_LEVEL_ALPHABETIC"; + + // + // Numeric row `1234567890-= + // + key { [ grave, notsign, 0x10000A6, 0x10000A6 ] }; + // broken bar + key { [ 1, exclam, NoSymbol, NoSymbol ] }; + key { [ 2, quotedbl, dead_doubleacute, dead_doubleacute ] }; + key { [ 3, sterling, NoSymbol, NoSymbol ] }; + key { [ 4, dollar, EuroSign, EuroSign ] }; + key { [ 5, percent, NoSymbol, NoSymbol ] }; + key { [ 6, asciicircum, dead_circumflex, dead_circumflex ] }; + key { [ 7, ampersand, 0x100204A, 0x100204A ] }; + // Tironian Et + key { [ 8, asterisk, dead_abovering, dead_abovering ] }; + key { [ 9, parenleft, dead_breve, dead_breve ] }; + key { [ 0, parenright, dead_ogonek, dead_ogonek ] }; + key { [ minus, underscore, dead_macron, dead_macron ] }; + key { [ equal, plus, NoSymbol, NoSymbol ] }; + + // + // QWERTYUIOP[] + // + key { [ q, Q, NoSymbol, NoSymbol ] }; + key { [ w, W, NoSymbol, NoSymbol ] }; + key { [ e, E, eacute, Eacute ] }; + key { [ r, R, 0x100027C, 0x100027C ] }; + // long r + key { [ t, T, NoSymbol, NoSymbol ] }; + key { [ y, Y, NoSymbol, NoSymbol ] }; + key { [ u, U, uacute, Uacute ] }; + key { [ i, I, iacute, Iacute ] }; + key { [ o, O, oacute, Oacute ] }; + key { [ p, P, NoSymbol, NoSymbol ] }; + key { [ bracketleft, braceleft, dead_hook, dead_hook ] }; + key { [ bracketright, braceright, dead_horn, dead_horn ] }; + + // + // ASDFGHJKL;'# + // + key { [ a, A, aacute, Aacute ] }; + key { [ s, S, NoSymbol, NoSymbol ] }; + key { [ d, D, NoSymbol, NoSymbol ] }; + key { [ f, F, NoSymbol, NoSymbol ] }; + key { [ g, G, NoSymbol, NoSymbol ] }; + key { [ h, H, dead_abovedot, dead_abovedot ] }; + key { [ j, J, NoSymbol, NoSymbol ] }; + key { [ k, K, NoSymbol, NoSymbol ] }; + key { [ l, L, NoSymbol, NoSymbol ] }; + key { [ semicolon, colon, dead_diaeresis, dead_diaeresis ] }; + key { [ apostrophe, at, dead_acute, dead_acute ] }; + key { [ numbersign, asciitilde, dead_tilde, dead_tilde ] }; + + // + // \ZXCVBNM,./ + // + key { [ backslash, bar, dead_grave, dead_grave ] }; + key { [ z, Z, 0x100017F, 0x1001E9B ] }; + // long s, long s dot + key { [ x, X, NoSymbol, NoSymbol ] }; + key { [ c, C, NoSymbol, NoSymbol ] }; + key { [ v, V, dead_caron, dead_caron ] }; + key { [ b, B, NoSymbol, NoSymbol ] }; + key { [ n, N, NoSymbol, NoSymbol ] }; + key { [ m, M, NoSymbol, NoSymbol ] }; + key { [ comma, less, dead_cedilla, dead_cedilla ] }; + key { [ period, greater, dead_abovedot, dead_abovedot ] }; + key { [ slash, question, dead_belowdot, dead_belowdot ] }; + + key { type[Group1]="FOUR_LEVEL", + [ space, space, space, nobreakspace ] }; + + key { type[Group1]="ONE_LEVEL", [ ISO_Level3_Shift ] }; + modifier_map Mod5 { }; + + key { type[Group1]="TWO_LEVEL", [ Multi_key, ISO_Next_Group ] }; +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/il /opt/SUNWut/lib/xkb/symbols/il --- /opt/SUNWut.orig/lib/xkb/symbols/il 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/il 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,75 @@ +// $XConsortium: il /main/3 1997/12/18 12:40:12 rch $ +// +// $XFree86$ + + +partial default alphanumeric_keys +xkb_symbols "basic" { + + // Describes the differences between a very simple us + // keyboard and a very simple Israelian keyboard + + // uses the kbd layout in use in Israel. + + name[Group2]= "Israelian"; + + + key {[], [ semicolon, asciitilde ] }; + + key {[], [ slash, Q ] }; + key {[], [ apostrophe, W ] }; + key {[], [ hebrew_qoph, E ] }; + key {[], [ hebrew_resh, R ] }; + key {[], [ hebrew_aleph, T ] }; + key {[], [ hebrew_tet, Y ] }; + key {[], [ hebrew_waw, U ] }; + key {[], [ hebrew_finalnun, I ] }; + key {[], [ hebrew_finalmem, O ] }; + key {[], [ hebrew_pe, P ] }; + + key {[], [ hebrew_shin, A ] }; + key {[], [ hebrew_dalet, S ] }; + key {[], [ hebrew_gimel, D ] }; + key {[], [ hebrew_kaph, F ] }; + key {[], [ hebrew_ayin, G ] }; + key {[], [ hebrew_yod, H ] }; + key {[], [ hebrew_chet, J ] }; + key {[], [ hebrew_lamed, K ] }; + key {[], [ hebrew_finalkaph, L ] }; + key {[], [ hebrew_finalpe, colon ] }; + key {[], [ comma, quotedbl ] }; + + key {[], [ hebrew_zain, Z ] }; + key {[], [ hebrew_samech, X ] }; + key {[], [ hebrew_bet, C ] }; + key {[], [ hebrew_he, V ] }; + key {[], [ hebrew_nun, B ] }; + key {[], [ hebrew_mem, N ] }; + key {[], [ hebrew_zade, M ] }; + key {[], [ hebrew_taw, less ] }; + key {[], [ hebrew_finalzade, greater ] }; + key {[], [ period, question ] }; + + // The following may get overriden by the iso9995-3(basic101) symbols. + // therefore they are included here. + // Including them isn't a great idea (for instance: what if group 1 uses + // UK keyboard mapping, and maps shift-3 to sterling? This mapping won't + // preserve that, and I'm not sure that this is a good feature. + key {[], [ 1, exclam ] }; + key {[], [ 2, at ] }; + key {[], [ 3, numbersign ] }; + key {[], [ 4, dollar ] }; + key {[], [ 5, percent ] }; + key {[], [ 6, asciicircum ] }; + key {[], [ 7, ampersand ] }; + key {[], [ 8, asterisk ] }; + key {[], [ 9, parenleft ] }; + key {[], [ 0, parenright ] }; + key {[], [ minus, underscore ] }; + key {[], [ equal, plus ] }; + + key {[], [ bracketleft, braceleft ] }; + key {[], [ bracketright, braceright ] }; + + key {[], [ backslash, bar ] }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/il_phonetic /opt/SUNWut/lib/xkb/symbols/il_phonetic --- /opt/SUNWut.orig/lib/xkb/symbols/il_phonetic 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/il_phonetic 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,83 @@ +// $XConsortium: il_phonetic /main/3 1997/12/18 12:40:12 rch $ +// +// $XFree86$ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + // Describes the differences between a very simple en_US + // keyboard and a very simple Israelian keyboard + + // uses the phonetic layout from old Slackware 'il.map' file + + name[Group1]= "US/ASCII"; + name[Group2]= "Israelian"; + + + key { [ equal, plus ], + [ hebrew_doublelowline, hebrew_doublelowline ]}; + + key { [ q, Q ], + [ hebrew_qoph, hebrew_qoph ] }; + key { [ w, W ], + [ hebrew_waw, hebrew_waw ] }; + key { [ e, E ], + [ hebrew_aleph, hebrew_aleph ] }; + key { [ r, R ], + [ hebrew_resh, hebrew_resh ] }; + key { [ t, T ], + [ hebrew_taw, hebrew_tet ] }; + key { [ y, Y ], + [ hebrew_ayin, hebrew_ayin ] }; + key { [ u, U ], + [ hebrew_waw, hebrew_waw ] }; + key { [ i, I ], + [ hebrew_yod, hebrew_yod ] }; + key { [ o, O ], + [ hebrew_samech, hebrew_samech ] }; + key { [ p, P ], + [ hebrew_pe, hebrew_finalpe ] }; + + key { [ a, A ], + [ hebrew_aleph, hebrew_aleph ] }; + key { [ s, S ], + [ hebrew_shin, hebrew_shin ] }; + key { [ d, D ], + [ hebrew_dalet, hebrew_dalet ] }; + key { [ f, F ], + [ hebrew_pe, hebrew_finalpe ] }; + key { [ g, G ], + [ hebrew_gimel, hebrew_gimel ] }; + key { [ h, H ], + [ hebrew_he, hebrew_he ] }; + key { [ j, J ], + [ hebrew_yod, hebrew_yod ] }; + key { [ k, K ], + [ hebrew_kaph, hebrew_finalkaph ] }; + key { [ l, L ], + [ hebrew_lamed, hebrew_lamed ] }; + + key { [ z, Z ], + [ hebrew_zain, hebrew_zain ] }; + key { [ x, X ], + [ hebrew_chet, hebrew_chet ] }; + key { [ c, C ], + [ hebrew_zade, hebrew_finalzade ] }; + key { [ v, V ], + [ hebrew_waw, hebrew_waw ] }; + key { [ b, B ], + [ hebrew_bet, hebrew_bet ] }; + key { [ n, N ], + [ hebrew_nun, hebrew_finalnun ] }; + key { [ m, M ], + [ hebrew_mem, hebrew_finalmem ] }; + + // Begin modifier mappings + + modifier_map Shift { Shift_L }; + modifier_map Lock { Caps_Lock, ISO_Lock }; + modifier_map Control{ Control_L }; + modifier_map Mod3 { Mode_switch }; +}; + + diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/inet /opt/SUNWut/lib/xkb/symbols/inet --- /opt/SUNWut.orig/lib/xkb/symbols/inet 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/inet 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,2154 @@ +// $XdotOrg$ +// $XKeyboardConfig: xkbdesc/symbols/inet,v 1.11 2005/07/15 21:15:22 svu Exp $ + +// $XFree86: xc/programs/xkbcomp/symbols/inet,v 1.38 2004/01/17 14:59:37 pascal Exp $ + +// EAK (Easy Access, Internet, Multimedia, PDA) keyboards +// Copyright (C) 2002 Stanislav Brabec +// +// Based on LinEAK project +// LinEAK - Linux support for Easy Access and Internet Keyboards +// Copyright (C) 2001, 2002 Mark Smulders + +// Usage in XF86Config: +// Option "XkbLayout" "my_kb_layout" +// Option "XkbVariant" "my_kb_variant" +// Option "XkbModel" "my_eak_type" +// Option "XkbRules" "xorg" +// Simple command line usage: +// setxkbmap 'my_kb_layout' -variant 'my_kb_variant' -model 'my_eak_type' + +// All keyboards listed here should be also mentioned in +// xc/programs/xkbcomp/rules: xorg, xorg.lst and xorg.xml. + +// A4Tech KB-21 +partial alphanumeric_keys +xkb_symbols "a4techKB21" { + // Left side + key { [ XF86Back ] }; + key { [ XF86Forward ] }; + key { [ XF86Stop ] }; + key { [ XF86Refresh ] }; + key { [ XF86HomePage ] }; + key { [ XF86Search ] }; + + // Middle + key { [ XF86AudioPrev ] }; + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioStop, XF86Eject ] }; + key { [ XF86AudioNext ] }; + + // Right side + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioMute ] }; + key { [ XF86Favorites ] }; + key { [ XF86Mail ] }; + key { [ XF86MyComputer ] }; +}; + +// A4 KBS-8. Contributed by ojo at force dot sk +partial alphanumeric_keys +xkb_symbols "a4techKBS8" { + include "inet(a4techKB21)" + key { [ XF86AudioMedia ] }; + key { [ XF86Calculator ] }; + key { [ XF86Standby ] }; + +}; + +// Acer AirKey V +partial alphanumeric_keys +xkb_symbols "airkey" { + key { [ XF86AudioPrev ] }; + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioStop, XF86Eject ] }; + key { [ XF86AudioNext ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioMute ] }; + key { [ XF86WWW ] }; + key { [ XF86Mail ] }; + key { [ XF86Terminal ] }; + key { [ XF86Standby ] }; + key { [ XF86PowerOff ] }; +}; + +// Azona + +// Azona RF2300 wireless Internet Keyboard +partial alphanumeric_keys +xkb_symbols "azonaRF2300" { + // From Radics Laszlo + key { [ XF86WWW ] }; + key { [ XF86AudioStop ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86Calculator ] }; + key { [ XF86AudioNext ] }; + key { [ XF86AudioPrev ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioMute ] }; + key { [ XF86Copy ] }; + key { [ XF86Standby ] }; + key { [ XF86Search ] }; + key { [ XF86Favorites ] }; + key { [ XF86Forward ] }; + key { [ XF86Back ] }; + key { [ XF86Mail ] }; + key { [ XF86Cut ] }; +// key { [ XF86Paste ] }; +}; + +// ACPI Standard +partial alphanumeric_keys +xkb_symbols "acpi" { + key { [ XF86PowerOff ] }; + key { [ XF86Standby ] }; + key { [ XF86WakeUp ] }; +}; + + +// Advance + +// Advance Scorpius KI +partial alphanumeric_keys +xkb_symbols "scorpius" { + key { [ XF86AudioPrev ] }; + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioStop ] }; + key { [ XF86AudioNext ] }; + key { [ XF86AudioMedia ] }; + + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioMute ] }; + key { [ XF86AudioRaiseVolume ] }; + + key { [ XF86WakeUp ] }; + key { [ XF86Standby ] }; + key { [ XF86PowerOff ] }; + + key { [ XF86Calculator ] }; + key { [ XF86MyComputer ] }; + key { [ XF86Mail ] }; + key { [ XF86Favorites ] }; + key { [ XF86HomePage ] }; + + key { [ XF86Back ] }; + key { [ XF86Forward ] }; + key { [ XF86Stop ] }; + key { [ XF86Reload ] }; + key { [ XF86Search ] }; +}; + + +// Brother + +// Brother Internet Keyboard +partial alphanumeric_keys +xkb_symbols "brother" { + key { [ XF86WWW ] }; + key { [ XF86AudioMute ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86ScrollDown ] }; + key { [ XF86ScrollUp ] }; + key { [ XF86AudioPrev ] }; + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioNext ] }; + key { [ XF86AudioStop ] }; + key { [ XF86ZoomOut ] }; + key { [ XF86ZoomIn ] }; + key { [ XF86Calculator ] }; + key { [ XF86Xfer ] }; + key { [ Menu ] }; + key { [ XF86Mail ] }; + key { [ XF86PowerOff ] }; + key { [ XF86Standby ] }; + key { [ XF86WakeUp ] }; +}; + + +// BTC + +// BTC 5113RF Multimedia +partial alphanumeric_keys +xkb_symbols "btc5113rf" { + key { [ XF86WWW ] }; + key { [ XF86Back ] }; + key { [ XF86Favorites ] }; + key { [ XF86Search ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioMute ] }; + key { [ XF86AudioPrev ] }; + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioStop ] }; + key { [ XF86AudioNext ] }; + key { [ XF86Eject ] }; + key { [ XF86PowerOff ] }; + key { [ XF86Standby ] }; + key { [ XF86WakeUp ] }; +}; + +// BTC 5126T +partial alphanumeric_keys +xkb_symbols "btc5126t" { + key { [ XF86WWW ] }; + key { [ XF86Standby ] }; + key { [ XF86Mail ] }; +}; + +// BTC 9000 +partial alphanumeric_keys +xkb_symbols "btc9000" { + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioPrev ] }; + key { [ XF86AudioNext ] }; + key { [ XF86AudioStop ] }; + key { [ XF86AudioMedia ] }; + + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioMute ] }; + + key { [ XF86HomePage ] }; + key { [ XF86Reload ] }; + key { [ XF86Search ] }; + key { [ XF86Favorites ] }; + + key { [ XF86Mail ] }; + key { [ XF86WakeUp ] }; + key { [ XF86Standby ] }; + key { [ XF86PowerOff ] }; +}; + +// BTC 9000A +partial alphanumeric_keys +xkb_symbols "btc9000a" { + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioPrev ] }; + key { [ XF86AudioNext ] }; + key { [ XF86AudioStop ] }; + key { [ XF86Eject ] }; + + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioMute ] }; + + key { [ XF86WWW ] }; + key { [ XF86HomePage ] }; + key { [ XF86Search ] }; + key { [ XF86Favorites ] }; + + key { [ Help ] }; + key { [ XF86WakeUp ] }; + key { [ XF86Standby ] }; + key { [ XF86PowerOff ] }; +}; + +// BTC 9001AH +xkb_symbols "btc9001ah" { + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioPrev ] }; + key { [ XF86AudioNext ] }; + key { [ XF86AudioStop ] }; + key { [ XF86Eject ] }; + + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioMute ] }; + + key { [ XF86WWW ] }; + key { [ XF86PowerOff ] }; + key { [ XF86Mail ] }; +}; + +// BTC 5090 +partial alphanumeric_keys +xkb_symbols "btc5090" { + key { [ XF86WWW ] }; + key { [ XF86Start ] }; + key { [ XF86Favorites ] }; + key { [ XF86Search ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioMute ] }; + key { [ XF86AudioPrev ] }; + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioStop ] }; + key { [ XF86AudioNext ] }; + key { [ XF86Eject ] }; + key { [ XF86PowerOff ] }; + key { [ XF86Standby ] }; + key { [ XF86WakeUp ] }; +}; + +// Cherry Blue Line + +// Cherry Blue Line CyBo@rd +partial alphanumeric_keys +xkb_symbols "cherryblue" { + key { [ XF86Back ] }; + key { [ XF86Forward ] }; + key { [ XF86Stop ] }; + key { [ XF86Reload ] }; + key { [ XF86Search ] }; + key { [ XF86MyComputer ] }; + key { [ XF86HomePage ] }; + key { [ XF86Mail ] }; + key { [ XF86Terminal ] }; + key { [ XF86Calculator ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioMute ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86Go ] }; + key { [ XF86AudioPrev ] }; + key { [ XF86AudioNext ] }; + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioStop ] }; + key { [ XF86Standby ] }; +}; + +// Cherry CyMotion Master XPress +partial alphanumeric_keys +xkb_symbols "cherryblueb" { + key { [ XF86ScrollUp ] }; + key { [ XF86ScrollDown ] }; + key { [ XF86Cut ] }; + key { [ XF86Copy ] }; + key { [ XF86Paste ] }; + key { [ XF86Book ] }; + key { [ XF86Book ] }; + key { [ XF86Book ] }; + key { [ XF86Forward ] }; + key { [ XF86Back ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioMute ] }; + key { [ XF86AudioMedia ] }; + key { [ XF86AudioRewind ] }; + key { [ XF86Back ] }; + key { [ XF86Forward ] }; + key { [ XF86Eject ] }; + key { [ XF86Finance ] }; + key { [ XF86Back ] }; + key { [ XF86Forward ] }; + key { [ XF86Stop ] }; + key { [ XF86Reload ] }; + key { [ XF86Search ] }; + key { [ XF86MyComputer ] }; + key { [ XF86HomePage ] }; + key { [ XF86Mail ] }; + key { [ XF86Terminal ] }; + key { [ XF86Calculator ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioMute ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86Go ] }; + key { [ XF86AudioStop ] }; + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86Standby ] }; +}; + +// Cherry Blue Line CyBo@rd (alternate option) +partial alphanumeric_keys +xkb_symbols "cherryblueb" { + name[Group1]= "Cherry CyMotion Master XPress"; + + key { [ XF86ScrollUp ] }; + key { [ XF86ScrollDown ] }; + key { [ XF86Cut ] }; + key { [ XF86Copy ] }; + key { [ XF86Paste ] }; + key { [ XF86Book ] }; + key { [ XF86Book ] }; + key { [ XF86Book ] }; + key { [ XF86Forward ] }; + key { [ XF86Back ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioMute ] }; + key { [ XF86AudioMedia ] }; + key { [ XF86AudioRewind ] }; + key { [ XF86Back ] }; + key { [ XF86Forward ] }; + key { [ XF86Eject ] }; + key { [ XF86Finance ] }; + key { [ XF86Back ] }; + key { [ XF86Forward ] }; + key { [ XF86Stop ] }; + key { [ XF86Reload ] }; + key { [ XF86Search ] }; + key { [ XF86MyComputer ] }; + key { [ XF86HomePage ] }; + key { [ XF86Mail ] }; + key { [ XF86Terminal ] }; + key { [ XF86Calculator ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioMute ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86Go ] }; + key { [ XF86AudioStop ] }; + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86Standby ] }; +}; + +partial alphanumeric_keys +xkb_symbols "cherrybluea" { + key { [ XF86Back ] }; + key { [ XF86Forward ] }; + key { [ XF86Stop ] }; + key { [ XF86Reload ] }; + key { [ XF86Search ] }; + key { [ XF86MyComputer ] }; + key { [ XF86HomePage ] }; + key { [ XF86Mail ] }; + key { [ XF86Terminal ] }; + key { [ XF86Calculator ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioMute ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86Go ] }; + key { [ XF86AudioPrev ] }; + key { [ XF86AudioNext ] }; + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioStop ] }; + key { [ XF86Standby ] }; +}; + + +// Chicony + +// Chicony Internet Keyboard +partial alphanumeric_keys +xkb_symbols "chicony" { + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioMute ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioPrev ] }; + key { [ XF86AudioStop ] }; + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioNext ] }; + key { [ XF86PowerOff ] }; + key { [ XF86HomePage ] }; + key { [ XF86Mail ] }; + key { [ XF86Back ] }; + key { [ XF86Forward ] }; + key { [ XF86ContrastAdjust ] }; + key { [ XF86BrightnessAdjust ] }; + key { [ XF86LaunchA ] }; + key { [ XF86LaunchB ] }; + key { [ XF86LaunchC ] }; +}; + +// Chicony KB-9885 +partial alphanumeric_keys +xkb_symbols "chicony9885" { + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioMute ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioPrev ] }; + key { [ XF86AudioStop ] }; + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioNext ] }; + key { [ XF86PowerOff ] }; + key { [ XF86Standby ] }; + key { [ XF86WakeUp ] }; + key { [ XF86WWW ] }; + key { [ XF86Mail ] }; + key { [ XF86LaunchA ] }; + key { [ XF86LaunchB ] }; + key { [ XF86LaunchC ] }; + key { [ XF86Back ] }; + key { [ XF86Forward ] }; +}; + + +// Compaq + +// Compaq Easy Access Keyboard +partial alphanumeric_keys +xkb_symbols "compaqeak8" { + key { [ XF86WWW ] }; + key { [ XF86HomePage ] }; + key { [ XF86Search ] }; + key { [ XF86Mail ] }; + key { [ XF86Community ] }; + key { [ XF86Market ] }; + key { [ XF86Meeting ] }; + key { [ XF86News ] }; +}; + +// Compaq Internet Keyboard (7 keys) +partial alphanumeric_keys +xkb_symbols "compaqik7" { + key { [ XF86Mail ] }; + key { [ Help ] }; + key { [ XF86Search ] }; + key { [ XF86VendorHome ] }; + key { [ XF86HomePage ] }; + key { [ XF86LightBulb ] }; + key { [ XF86Shop ] }; +}; + +// Compaq Internet Keyboard (13 keys) +partial alphanumeric_keys +xkb_symbols "compaqik13" { + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioStop ] }; + key { [ XF86AudioPrev ] }; + key { [ XF86AudioNext ] }; + key { [ XF86Standby ] }; + key { [ XF86AudioMute ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86Go ] }; + key { [ XF86WWW ] }; + key { [ XF86Search ] }; + key { [ XF86Mail ] }; + key { [ XF86Shop ] }; +}; + +// Compaq Internet Keyboard (18 keys) +partial alphanumeric_keys +xkb_symbols "compaqik18" { + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioPrev ] }; + key { [ XF86AudioNext ] }; + key { [ XF86AudioStop ] }; + key { [ XF86Eject ] }; + + key { [ XF86Mail ] }; + key { [ XF86Community ] }; + key { [ XF86VendorHome ] }; + key { [ XF86WWW ] }; + key { [ XF86Search ] }; + key { [ XF86LightBulb ] }; + key { [ XF86Shop ] }; + + key { [ Print ] }; + key { [ XF86Go ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioMute ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86Standby ] }; +}; + + +// Laptop/notebook Compaq (eg. Armada, Evo) Laptop Keyboard +partial alphanumeric_keys +xkb_symbols "armada" { + key { [ XF86AudioMedia ] }; + key { [ XF86AudioMute ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86WWW ] }; + key { [ XF86HomePage ] }; + key { [ XF86Search ] }; + key { [ XF86Mail ] }; +}; + +// Laptop/notebook Compaq (eg. Presario) Internet Keyboard +partial alphanumeric_keys +xkb_symbols "presario" { + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioPrev ] }; + key { [ XF86AudioNext ] }; + key { [ XF86AudioStop ] }; + key { [ XF86Launch1 ] }; + key { [ XF86Launch2 ] }; + + key { [ XF86AudioMedia ] }; + key { [ XF86WWW ] }; + key { [ XF86Q ] }; + key { [ XF86Shop ] }; + key { [ XF86Mail ] }; + key { [ XF86AudioMute ] }; + key { [ XF86Standby ] }; +}; + +// Compaq iPaq Keyboard +partial alphanumeric_keys +xkb_symbols "ipaq" { + key { [ XF86Mail ] }; + key { [ XF86BackForward ] }; + key { [ XF86Q ] }; + key { [ XF86Standby ] }; + key { [ XF86Search ] }; + key { [ XF86Travel ] }; + key { [ XF86Shop ] }; +}; + + +// Dell + +partial alphanumeric_keys +xkb_symbols "dell" { + key { [ XF86Mail ] }; + key { [ XF86HomePage ] }; + key { [ XF86Search ] }; + key { [ XF86Standby ] }; +}; + + +// Laptop/notebook Dell Inspiron 8xxx +partial alphanumeric_keys +xkb_symbols "inspiron" { + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioPrev ] }; + key { [ XF86AudioNext ] }; + key { [ XF86AudioStop ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioMute ] }; +}; + + +// Dexxa + +// Dexxa Wireless Desktop Keyboard +partial alphanumeric_keys +xkb_symbols "dexxa" { + key { [ XF86Reload ] }; + key { [ XF86Favorites ] }; + key { [ XF86Search ] }; + key { [ XF86Mail ] }; + key { [ XF86WWW ] }; + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioMute ] }; +}; + + +// Diamond + +// Diamond 9801 / 9802 series +partial alphanumeric_keys +xkb_symbols "diamond" { + key { [ XF86Back ] }; + key { [ XF86Forward ] }; + key { [ XF86Stop ] }; + key { [ XF86Favorites ] }; + key { [ XF86Search ] }; + key { [ XF86Reload ] }; + key { [ XF86HomePage ] }; + key { [ XF86Mail ] }; + key { [ XF86AudioMute ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86Go ] }; + key { [ XF86AudioStop ] }; + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioNext ] }; + key { [ XF86AudioPrev ] }; + key { [ XF86Calculator ] }; + key { [ XF86MyComputer ] }; + key { [ XF86PowerOff ] }; + key { [ XF86Standby ] }; + key { [ XF86WakeUp ] }; +}; + +// DTK + +// DTK2000 +partial alphanumeric_keys +xkb_symbols "dtk2000" { + // From Radics Laszlo + // Describes the extra keys on a DTK2000 Internet keyboard. + key { [ XF86AudioPrev ] }; + key { [ XF86AudioNext ] }; + key { [ XF86AudioMute ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86Calculator ] }; + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioStop ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86HomePage ] }; + key { [ XF86PowerOff ] }; + key { [ XF86Sleep ] }; + key { [ XF86WakeUp ] }; + key { [ XF86Search ] }; + key { [ XF86Favorites ] }; + key { [ XF86Refresh ] }; + key { [ XF86Stop ] }; + key { [ XF86Forward ] }; + key { [ XF86Back ] }; + key { [ XF86MyComputer ] }; + key { [ XF86Mail ] }; + key { [ XF86AudioMedia ] }; +}; + + +// Ennyah + +// Ennyah DKB-1008 +partial alphanumeric_keys +xkb_symbols "ennyah_dkb1008" { + key { [ XF86HomePage ] }; + key { [ XF86Mail ] }; + key { [ XF86Back ] }; + key { [ XF86Forward ] }; + key { [ XF86Search ] }; + key { [ XF86Refresh ] }; + key { [ XF86Favorites ] }; + key { [ XF86Stop ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioMute ] }; + key { [ XF86AudioStop ] }; + key { [ XF86AudioPrev ] }; + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioNext ] }; + key { [ XF86AudioMedia ] }; + key { [ XF86PowerOff ] }; + key { [ XF86Standby ] }; + key { [ XF86WakeUp ] }; +}; + + +// Genius + +// Genius Comfy KB-16M / Genius MM Keyboard KWD-910 +partial alphanumeric_keys +xkb_symbols "genius" { + key { [ XF86AudioPrev ] }; + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioStop ] }; + key { [ XF86AudioNext ] }; + key { [ XF86Eject ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioMute ] }; + key { [ XF86ScreenSaver ] }; + key { [ XF86Calculator ] }; + key { [ XF86Mail ] }; + key { [ XF86Back ] }; + key { [ XF86WWW ] }; + key { [ XF86Forward ] }; + key { [ XF86Standby ] }; + key { [ XF86WakeUp ] }; +}; + +// GeniusComfy21e +partial alphanumeric_keys +xkb_symbols "geniuscomfy2" { + // From Radics Laszlo + // Describes the extra keys on a Genius Comfy KB-21e-Scroll + key { [ XF86AudioPrev ] }; + key { [ XF86Word ] }; + key { [ XF86Excel ] }; + key { [ XF86AudioNext ] }; + key { [ XF86AudioMute ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86Calculator ] }; + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ Return ] }; + key { [ XF86AudioStop ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86HomePage ] }; + key { [ XF86Sleep ] }; + key { [ XF86Search ] }; + key { [ XF86Favorites ] }; + key { [ XF86Refresh ] }; + key { [ XF86Stop ] }; + key { [ XF86Forward ] }; + key { [ XF86Back ] }; + key { [ XF86MyComputer ] }; + key { [ XF86Mail ] }; + key { [ XF86AudioMedia ] }; +}; + + +// Gyration + +partial alphanumeric_keys +xkb_symbols "gyration" { + key { [ XF86AudioPrev ] }; + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioStop ] }; + key { [ XF86AudioNext ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioMute ] }; + key { [ XF86Back ] }; + key { [ XF86Forward ] }; + key { [ XF86Stop ] }; + key { [ XF86Reload ] }; + key { [ XF86Search ] }; + key { [ XF86WWW ] }; + key { [ XF86Favorites ] }; + key { [ XF86Mail ] }; +}; + + +// Hewlett-Packard + +// Hewlett-Packard Internet Keyboard +partial alphanumeric_keys +xkb_symbols "hpi6" { + key { [ XF86Search ] }; + key { [ Help ] }; + key { [ XF86Standby ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioMute ] }; +}; + +// Hewlett-Packard SK-2501 Multimedia Keyboard +partial alphanumeric_keys +xkb_symbols "hp2501" { + key { [ XF86WWW ] }; + key { [ XF86Search ] }; + key { [ XF86Tools ] }; + key { [ XF86Mail ] }; + key { [ XF86Launch2 ] }; + key { [ XF86Launch3 ] }; + key { [ XF86Launch4 ] }; + key { [ XF86Launch5 ] }; + key { [ XF86Standby ] }; + key { [ Help ] }; + key { [ XF86AudioMute ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioLowerVolume ] }; +}; + +// Hewlett-Packard SK-2505 Internet Keyboard +partial alphanumeric_keys +xkb_symbols "hp2505" { + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioPrev ] }; + key { [ XF86AudioNext ] }; + key { [ XF86AudioStop ] }; + key { [ XF86Eject ] }; + key { [ XF86Mail ] }; + key { [ XF86WWW ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioMute ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86Standby ] }; +}; + +// Hewlett-Packard 5181 Internet Keyboard +partial alphanumeric_keys +xkb_symbols "hp5181" { + key { [ XF86AudioPrev ] }; + key { [ XF86Search ] }; + key { [ XF86VendorHome ] }; + key { [ XF86Community ] }; + key { [ XF86AudioMedia ] }; + key { [ XF86Eject ] }; + key { [ XF86AudioNext ] }; + key { [ XF86Shop ] }; + key { [ XF86Launch1 ] }; + key { [ XF86AudioMute ] }; + key { [ XF86AudioStop ] }; + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ Help ] }; + key { [ XF86Finance ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86HomePage ] }; + key { [ Print ] }; + key { [ XF86Standby ] }; + key { [ XF86Mail ] }; +}; + +// Hewlett-Packard 5185 Internet Keyboard +partial alphanumeric_keys +xkb_symbols "hp5185" { + key { [ XF86AudioPrev ] }; + key { [ XF86Search ] }; + key { [ XF86Go ] }; + key { [ XF86VendorHome ] }; + key { [ XF86Community ] }; + key { [ XF86AudioMedia ] }; + key { [ XF86Eject ] }; + key { [ XF86AudioNext ] }; + key { [ XF86Shop ] }; + key { [ XF86Pictures ] }; + key { [ XF86AudioMute ] }; + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioStop ] }; + key { [ Help ] }; + key { [ XF86Finance ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86WWW ] }; + key { [ Print ] }; + key { [ XF86Standby ] }; + key { [ XF86Mail ] }; +}; + +// Hewlett-Packard Omnibook XE3 GC, GD, GE and Pavilion N5xxx +partial alphanumeric_keys +xkb_symbols "hpxe3gc" { + // Describes the OneTouch buttons on HP Omnibook XE3 GC and + // HP Pavilion N52XX models. + // See http://sourceforge.net/projects/omke for details on enabling + // these keys + + key { [ XF86WWW ] }; + key { [ XF86Mail ] }; + key { [ XF86Launch1 ] }; + key { [ Help ] }; + key { [ XF86AudioPrev ] }; + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioStop, XF86Eject ] }; + key { [ XF86AudioNext ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioMute ] }; +}; + +// Hewlett-Packard Omnibook XE3 GF +partial alphanumeric_keys +xkb_symbols "hpxe3gf" { + + // Describes the OneTouch buttons on HP Omnibook XE3 GF models. + // See http://sourceforge.net/projects/omke for details on enabling + // these keys + + key { [ XF86WWW ] }; + key { [ XF86Mail ] }; + key { [ XF86Launch1 ] }; + key { [ Help ] }; + key { [ XF86AudioPrev ] }; + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioStop, XF86Eject ] }; + key { [ XF86AudioNext ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioMute ] }; +}; + +// Hewlett-Packard Omnibook XT1000 +partial alphanumeric_keys +xkb_symbols "hpxt1000" { + + // Describes the OneTouch buttons on HP Omnibook XT1000 models. + // See http://sourceforge.net/projects/omke for details on enabling + // these keys + + key { [ XF86Mail ] }; + key { [ XF86Launch1 ] }; + key { [ XF86WWW ] }; + key { [ XF86Launch2 ] }; + key { [ Help ] }; + key { [ XF86Launch3 ] }; + key { [ XF86AudioPrev ] }; + key { [ XF86AudioNext ] }; + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioStop, XF86Eject ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioMute ] }; +}; + +// Hewlett-Packard Pavilion ZT11xx +partial alphanumeric_keys +xkb_symbols "hpzt11xx" { + + // Describes the OneTouch buttons on HP Pavilion ZT11xx models. + // See http://sourceforge.net/projects/omke for details on enabling + // these keys + + key { [ XF86Mail ] }; + key { [ XF86Launch1 ] }; + key { [ XF86WWW ] }; + key { [ XF86Launch2 ] }; + key { [ Help ] }; + key { [ XF86Launch3 ] }; + key { [ XF86AudioPrev ] }; + key { [ XF86AudioNext ] }; + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioStop, XF86Eject ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioMute ] }; +}; + +// Hewlett-Packard Omnibook XE4xxx and ZE4xxx +partial alphanumeric_keys +xkb_symbols "hpxe4xxx" { + + // Describes the OneTouch buttons on HP Omnibook XE4xxx and ZE4xxx + // models. + // See http://sourceforge.net/projects/omke for details on enabling + // these keys + + key { [ XF86Mail ] }; + key { [ XF86Launch1 ] }; + key { [ XF86WWW ] }; + key { [ XF86Launch2 ] }; + key { [ Help ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioMute ] }; +}; + +// Hewlett-Packard Omnibook 500 FA +partial alphanumeric_keys +xkb_symbols "hp500fa" { + + // Describes the OneTouch buttons on HP Omnibook 500 FA models. + // See http://sourceforge.net/projects/omke for details on enabling + // these keys + + key { [ XF86Launch1 ] }; + key { [ Help ] }; +}; + +// Hewlett-Packard Omnibook 5xx +partial alphanumeric_keys +xkb_symbols "hp5xx" { + + // Describes the OneTouch buttons on HP Omnibook 5xx models. + // See http://sourceforge.net/projects/omke for details on enabling + // these keys + + key { [ XF86Launch1 ] }; + key { [ Help ] }; + key { [ XF86AudioPrev ] }; + key { [ XF86AudioNext ] }; + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioStop, XF86Eject ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioRaiseVolume ] }; +}; + + +// Honeywell + + +// Honeywell Euroboard +partial alphanumeric_keys +xkb_symbols "honeywell_euroboard" { + + // Scott Penrose + // January 2002 + // http://linux.dd.com.au/quest/linux/keyboard/honeywell/ + + key { [ XF86Game ] }; + key { [ XF86AudioPrev ] }; + key { [ XF86Eject ] }; + key { [ XF86Launch2 ] }; + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86Launch1 ] }; + key { [ XF86AudioMute ] }; + key { [ XF86AudioNext ] }; + key { [ XF86AudioStop ] }; + key { [ XF86Mail ] }; + key { [ XF86ScreenSaver ] }; + key { [ XF86Calculator ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86WWW ] }; +}; + + +// IBM + + +// IBM Rapid Access +partial alphanumeric_keys +xkb_symbols "rapidaccess" { + key { [ XF86AudioPause ] }; + key { [ XF86AudioMute ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioStop ] }; + key { [ XF86AudioPrev ] }; + key { [ XF86AudioNext ] }; + key { [ XF86Standby ] }; + key { [ XF86Launch1 ] }; + key { [ XF86Launch2 ] }; + key { [ XF86Launch3 ] }; + key { [ XF86Launch4 ] }; + key { [ Help ] }; +}; + +// IBM Rapid Access II +partial alphanumeric_keys +xkb_symbols "rapidaccess2" { + key { [ XF86HomePage ] }; + key { [ XF86Shop ] }; + key { [ XF86VendorHome ] }; + key { [ XF86Favorites ] }; + key { [ XF86MyComputer ] }; + key { [ XF86Search ] }; + key { [ XF86Standby ] }; + key { [ XF86AudioMute ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioStop ] }; + key { [ XF86AudioPrev ] }; + key { [ XF86AudioNext ] }; +}; + +// IBM Rapid Access II (alternate option) +partial alphanumeric_keys +xkb_symbols "rapidaccess2a" { + key { [ XF86WWW ] }; + key { [ XF86Shop ] }; + key { [ XF86VendorHome ] }; + key { [ XF86Favorites ] }; + key { [ XF86Option ] }; + key { [ Help ] }; + key { [ XF86Standby ] }; + key { [ XF86AudioMute ] }; + key { [ XF86AudioStop ] }; + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioPrev ] }; + key { [ XF86AudioNext ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ Menu ] }; +}; + + +// Logitech + +// Logitech Cordless Desktop +partial alphanumeric_keys +xkb_symbols "ltcd" { + key { [ XF86Standby ] }; + + key { [ XF86AudioMute ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioStop ] }; + key { [ XF86AudioPrev ] }; + key { [ XF86AudioNext ] }; + + key { [ XF86WWW ] }; + key { [ XF86Mail ] }; + key { [ XF86Search ] }; + key { [ XF86Go ] }; +}; + +// Logitech Access Keyboard +partial alphanumeric_keys +xkb_symbols "logiaccess" { + key { [ XF86AudioMute ] }; + key { [ XF86AudioMedia ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioStop ] }; + key { [ XF86AudioPrev ] }; + key { [ XF86AudioNext ] }; + + key { [ XF86Standby ] }; + key { [ XF86Mail ] }; + key { [ XF86Messenger ] }; + key { [ XF86WebCam ] }; + + key { [ XF86HomePage ] }; + + key { [ XF86New ] }; + key { [ XF86Reply ] }; + key { [ XF86MailForward ] }; + key { [ XF86Send ] }; + + key { [ XF86MyComputer ] }; + key { [ XF86Documents ] }; + key { [ XF86Pictures ] }; + key { [ XF86Music ] }; +}; + +// Logitech Cordless Desktop iTouch +partial alphanumeric_keys +xkb_symbols "logicdit" { + key { [ XF86Standby ] }; + + key { [ XF86AudioMute ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioStop ] }; + key { [ XF86AudioPrev ] }; + key { [ XF86AudioNext ] }; + + key { [ XF86HomePage ] }; + key { [ XF86Mail ] }; + key { [ XF86Search ] }; + key { [ XF86Go ] }; +}; + +// Logitech Cordless Desktop Pro +partial alphanumeric_keys +xkb_symbols "logicdp" { + key { [ XF86Standby ] }; + + key { [ XF86AudioMute ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioStop ] }; + key { [ XF86AudioPrev ] }; + key { [ XF86AudioNext ] }; + key { [ XF86AudioMedia ] }; + + key { [ XF86HomePage ] }; + key { [ XF86Mail ] }; + key { [ XF86Search ] }; + key { [ XF86Go ] }; + + key { [ XF86VendorHome ] }; +}; + +// Logitech Cordless Desktop Pro (alternate option) +partial alphanumeric_keys +xkb_symbols "logicdpa" { + key { [ XF86Standby ] }; + + key { [ XF86AudioMute ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioStop ] }; + key { [ XF86AudioPrev ] }; + key { [ XF86AudioNext ] }; + + key { [ XF86WWW ] }; + key { [ XF86Mail ] }; + key { [ XF86Search ] }; + key { [ XF86Go ] }; + + key { [ XF86VendorHome ] }; +}; + +// Logitech Internet Navigator Keyboard +partial alphanumeric_keys +xkb_symbols "logicink" { + // Media keys + key { [ XF86AudioMute ] }; + key { [ XF86AudioMedia ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioStop ] }; + key { [ XF86AudioPrev ] }; + key { [ XF86AudioNext ] }; + + // Left side + key { [ XF86Standby ] }; + key { [ XF86Finance ] }; + key { [ XF86MySites ] }; + key { [ XF86Community ] }; + key { [ XF86Favorites ] }; + + // Right side + key { [ XF86VendorHome ] }; + key { [ XF86Mail ] }; + key { [ XF86HomePage ] }; + key { [ XF86Shop ] }; + key { [ XF86Search ] }; + + // Wheel buttons + key { [ XF86Go ] }; + key { [ XF86Back ] }; + key { [ XF86ScrollClick ] }; +}; + +// Logitech iTouch Internet Navigator Keyboard +partial alphanumeric_keys +xkb_symbols "logiciink" { + // Media keys + key { [ XF86AudioMute ] }; + key { [ XF86AudioMedia ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioStop ] }; + key { [ XF86AudioPrev ] }; + key { [ XF86AudioNext ] }; + + // Left side + key { [ XF86Standby ] }; + key { [ XF86Finance ] }; + key { [ XF86Favorites ] }; + key { [ XF86Community ] }; + key { [ XF86Start ] }; + + // Right side + key { [ XF86VendorHome ] }; + key { [ XF86Mail ] }; + key { [ XF86HomePage ] }; + key { [ XF86Shop ] }; + key { [ XF86Search ] }; + + // Wheel buttons + key { [ XF86Back ] }; + key { [ XF86Forward ] }; + key { [ XF86ScrollClick ] }; +}; + +// Logitech iTouch Internet Navigator Keyboard SE +partial alphanumeric_keys +xkb_symbols "logiinkse" { + // Media keys + key { [ XF86AudioMute ] }; + key { [ XF86AudioMedia ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioStop ] }; + key { [ XF86AudioPrev ] }; + key { [ XF86AudioNext ] }; + + // Left side + key { [ XF86Standby ] }; + key { [ XF86Mail ] }; + key { [ XF86Messenger ] }; + key { [ XF86WebCam ] }; + + // Right side + key { [ XF86VendorHome ] }; + key { [ XF86Search ] }; + key { [ XF86Shop ] }; + key { [ XF86Favorites ] }; + key { [ XF86HomePage ] }; + + // Wheel buttons + key { [ XF86Forward ] }; + key { [ XF86Back ] }; + key { [ XF86ScrollClick ] }; + + // Extended function keys + key { [ XF86New ] }; // F1 + key { [ XF86Reply ] }; // F2 + key { [ XF86MailForward ] }; // F3 + key { [ XF86Send ] }; // F4 + key { [ Undo ] }; // F5 + key { [ Redo ] }; // F6 + key { [ Print ] }; // F7 + key { [ XF86Save ] }; // F8 + key { [ XF86MyComputer ] }; // F9 + key { [ XF86Documents ] }; // F10 + key { [ XF86Pictures ] }; // F11 + key { [ XF86Music ] }; // F12 +}; + +// Logitech iTouch Internet Navigator Keyboard SE (USB) +partial alphanumeric_keys +xkb_symbols "logiinkseusb" { + // Media keys + key { [ XF86AudioMute ] }; + key { [ XF86AudioMedia ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioStop ] }; + key { [ XF86AudioPrev ] }; + key { [ XF86AudioNext ] }; + + // Left side + key { [ XF86Standby ] }; + key { [ XF86Mail ] }; + key { [ XF86Go ] }; + key { [ XF86Back ] }; + + // Right side + key { [ XF86Search ] }; + key { [ XF86Favorites ] }; + key { [ XF86HomePage ] }; + + // Extended function keys + key { [ XF86New ] }; // F1 + key { [ XF86Reply ] }; // F2 + key { [ XF86Send ] }; // F4 + key { [ Print ] }; // F7 + key { [ XF86Save ] }; // F8 + key { [ XF86MyComputer ] }; // F9 + key { [ XF86Documents ] }; // F10 + key { [ XF86Pictures ] }; // F11 + key { [ XF86Music ] }; // F12 + +}; + +// Logitech iTouch Cordless Keyboard (model Y-RB6) +partial alphanumeric_keys +xkb_symbols "logiitc" { + key { [ XF86PowerOff ] }; + key { [ XF86AudioMute ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioStop ] }; + key { [ XF86AudioPrev ] }; + key { [ XF86AudioNext ] }; + key { [ XF86HomePage ] }; + key { [ XF86Mail ] }; + key { [ XF86Search ] }; + key { [ XF86Favorites ] }; +}; + +// Logitech Internet Keyboard +partial alphanumeric_keys +xkb_symbols "logiik" { + key { [ XF86VendorHome ] }; + key { [ XF86Back ] }; + key { [ XF86Forward ] }; + key { [ XF86Stop ] }; + key { [ XF86Reload ] }; + key { [ XF86Search ] }; + key { [ XF86Favorites ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86HomePage ] }; + + key { [ XF86WWW ] }; + key { [ XF86History ] }; + key { [ XF86OpenURL ] }; + key { [ Print ] }; + key { [ Find ] }; + key { [ XF86AddFavorite ] }; + key { [ XF86HotLinks ] }; +}; + +// Logitech iTouch +partial alphanumeric_keys +xkb_symbols "itouch" { + key { [ XF86Standby ] }; + + key { [ XF86AudioMute ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioStop ] }; + key { [ XF86AudioPrev ] }; + key { [ XF86AudioNext ] }; + + key { [ XF86HomePage ] }; + key { [ XF86Mail ] }; + key { [ XF86Search ] }; + key { [ XF86Start ] }; +}; + +partial alphanumeric_keys +xkb_symbols "logiultrax" { + key { [ XF86AudioMedia ] }; + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioMute ] }; + key { [ XF86Favorites ] }; + key { [ XF86Mail ] }; + key { [ XF86WWW ] }; +}; + +// Memorex + +// Memorex MX1998 +partial alphanumeric_keys +xkb_symbols "mx1998" { + key { [ XF86AudioStop ] }; + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioPrev ] }; + key { [ XF86AudioNext ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioMute ] }; + key { [ XF86PowerOff ] }; + key { [ XF86Standby ] }; + key { [ XF86ScreenSaver ] }; + key { [ XF86WakeUp ] }; + key { [ XF86WWW ] }; + key { [ XF86Calculator ] }; + key { [ XF86Xfer ] }; + key { [ XF86DOS ] }; + key { [ XF86Documents ] }; + key { [ XF86AudioRewind ] }; + key { [ XF86AudioRecord ] }; + key { [ XF86Game ] }; + key { [ XF86Close ] }; + key { [ Menu ] }; + key { [ XF86ScrollUp ] }; + key { [ XF86ScrollDown ] }; +}; + +// Memorex MX2500 EZ-Access Keyboard +partial alphanumeric_keys +xkb_symbols "mx2500" { + key { [ XF86Standby ] }; + key { [ XF86WakeUp ] }; + key { [ XF86PowerOff ] }; + key { [ XF86DOS ] }; + key { [ XF86Documents ] }; + key { [ XF86News ] }; + key { [ XF86WWW ] }; + key { [ XF86Xfer ] }; + key { [ XF86Mail ] }; + key { [ XF86Clear ] }; + key { [ XF86Phone ] }; + key { [ XF86Calculator ] }; + key { [ XF86AudioPrev ] }; + key { [ XF86AudioNext ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioMute ] }; + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86RotateWindows ] }; + key { [ XF86AudioStop ] }; + key { [ XF86Close ] }; + key { [ XF86Eject ] }; + key { [ Meta_L ] }; + key { [ Meta_R ] }; + key { [ Menu ] }; +}; + +// Memorex MX2750 +partial alphanumeric_keys +xkb_symbols "mx2750" { + key { [ XF86PowerOff ] }; + key { [ XF86Standby ] }; + key { [ XF86WakeUp ] }; + key { [ XF86Launch0 ] }; + key { [ XF86Search ] }; + key { [ XF86Favorites ] }; + key { [ XF86Back ] }; + key { [ XF86Forward ] }; + key { [ XF86Mail ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioStop ] }; + key { [ XF86AudioMute ] }; + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioPrev ] }; + key { [ XF86AudioNext ] }; +}; + + +// Microsoft + +// Microsoft Internet Keyboard +partial alphanumeric_keys +xkb_symbols "microsoftinet" { + key { [ XF86Back ] }; + key { [ XF86Forward ] }; + key { [ XF86AudioStop ] }; + key { [ XF86Mail ] }; + key { [ XF86WWW ] }; + key { [ XF86MyComputer ] }; + key { [ XF86Calculator ] }; + key { [ XF86Search ] }; + key { [ XF86Favorites ] }; + key { [ XF86Standby ] }; +}; + +// Microsoft Natural Keyboard Pro / Microsoft Internet Keyboard Pro +partial alphanumeric_keys +xkb_symbols "microsoftpro" { +// Multimedia Section -- Right Side + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioPrev ] }; + key { [ XF86AudioStop ] }; + key { [ XF86AudioNext ] }; + key { [ XF86AudioMedia ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioMute ] }; +// Internet Section -- Left Side + key { [ XF86HomePage ] }; + key { [ XF86Mail ] }; + key { [ XF86Favorites ] }; + key { [ XF86Search ] }; + key { [ XF86Stop ] }; + key { [ XF86Back ] }; + key { [ XF86Forward ] }; + key { [ XF86Reload ] }; +// My Computer Section -- Far Right + key { [ XF86MyComputer ] }; + key { [ XF86Calculator ] }; + key { [ XF86Standby ] }; +}; + +// Microsoft Natural Keyboard Pro USB +partial alphanumeric_keys + xkb_symbols "microsoftprousb" { + // Multimedia Section -- Right Side + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioPrev ] }; + key { [ XF86AudioStop ] }; + key { [ XF86AudioNext ] }; + key { [ XF86AudioMedia ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioMute ] }; + // Internet Section -- Left Side + key { [ XF86HomePage ] }; + key { [ XF86Mail ] }; + key { [ XF86Favorites ] }; + key { [ XF86Search ] }; + key { [ XF86Stop ] }; + key { [ XF86Back ] }; + key { [ XF86Forward ] }; + key { [ XF86Reload ] }; + // My Computer Section -- Far Right + // My computer maps to printscreen, so leaving commented out for now + // key { [ XF86MyComputer ] }; + key { [ XF86Calculator ] }; + key { [ XF86Standby ] }; +}; + +// Microsoft Natural Keyboard Pro OEM +partial alphanumeric_keys +xkb_symbols "microsoftprooem" { +// Multimedia Section -- Right Side + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioPrev ] }; + key { [ XF86AudioStop ] }; + key { [ XF86AudioNext ] }; + key { [ XF86AudioMedia ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioMute ] }; + +// Internet Section -- Left Side + key { [ XF86HomePage ] }; + key { [ XF86Mail ] }; + key { [ XF86Favorites ] }; + key { [ XF86Search ] }; + key { [ XF86Stop ] }; + key { [ XF86Back ] }; + key { [ XF86Forward ] }; + key { [ XF86Reload ] }; + +// My Computer Section -- Far Right + key { [ XF86MyComputer ] }; + key { [ XF86Calculator ] }; + key { [ XF86Standby ] }; +}; + +// Microsoft Internet Keyboard Pro, Swedish +partial alphanumeric_keys +xkb_symbols "microsoftprose" { + key { [ XF86Back ] }; + key { [ XF86Forward ] }; + key { [ XF86AudioStop ] }; + key { [ XF86Reload ] }; + key { [ XF86Search ] }; + key { [ XF86Favorites ] }; + key { [ XF86HomePage ] }; + key { [ XF86Mail ] }; + key { [ XF86AudioMute ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioStop ] }; + key { [ XF86AudioPrev ] }; + key { [ XF86AudioNext ] }; + key { [ XF86AudioMedia ] }; + key { [ XF86MyComputer ] }; + key { [ XF86Calculator ] }; + key { [ XF86Standby ] }; +}; + +// Microsoft Office Keyboard +partial alphanumeric_keys +xkb_symbols "microsoftoffice" { + key { [ XF86Back ] }; + key { [ XF86Forward ] }; + key { [ XF86Cut ] }; + key { [ XF86Copy ] }; + key { [ XF86Paste ] }; + key { [ XF86ApplicationLeft ] }; + key { [ XF86ApplicationRight ] }; + key { [ XF86Word ] }; + key { [ XF86Excel ] }; + key { [ XF86WWW ] }; + key { [ XF86Mail ] }; + key { [ XF86Calendar ] }; + key { [ XF86HomePage ] }; + key { [ XF86Calculator ] }; + key { [ XF86AudioMute ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86LogOff ] }; + key { [ XF86Standby ] }; + key { [ Help ] }; + key { [ XF86OfficeHome ] }; + key { [ XF86TaskPane ] }; + key { [ XF86New ] }; + key { [ XF86Open ] }; + key { [ XF86Close ] }; + key { [ XF86Reply ] }; + key { [ XF86MailForward ] }; + key { [ XF86Send ] }; + key { [ XF86Spell ] }; + key { [ XF86Save ] }; + key { [ Print ] }; + key { [ Undo ] }; + key { [ Redo ] }; +}; + +// Microsoft Wireless Multimedia Keyboard 1.0A +partial alphanumeric_keys +xkb_symbols "microsoftmult" { +// My Computer Section -- Left Side + key { [ XF86Documents ] }; + key { [ XF86Pictures ] }; + key { [ XF86Music ] }; + +// Multimedia Section -- Centre + key { [ XF86AudioMute ] }; + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioStop ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioPrev ] }; + key { [ XF86AudioNext ] }; + key { [ XF86AudioMedia ] }; + +// Internet Section -- Right Side + key { [ XF86Mail ] }; + key { [ XF86HomePage ] }; + key { [ XF86Messenger ] }; + +// Control Section -- Far Right + key { [ XF86Calculator ] }; + key { [ XF86LogOff ] }; + key { [ XF86Sleep ] }; + +// F-Locked Function keys + key { [ Help ] }; + key { [ Undo ] }; + key { [ Redo ] }; + key { [ XF86New ] }; + key { [ XF86Open ] }; + key { [ XF86Close ] }; + key { [ XF86Reply ] }; + key { [ XF86Forward ] }; + key { [ XF86Send ] }; + key { [ XF86Spell ] }; + key { [ XF86Save ] }; + key { [ Print ] }; +}; + +// Oretec + +// Oretec MCK-800 MM/Internet keyboard +partial alphanumeric_keys +xkb_symbols "oretec" { + key { [ XF86WWW ] }; + key { [ XF86AudioMute ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86ScrollDown ] }; + key { [ XF86ScrollUp ] }; + key { [ XF86AudioPrev ] }; + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioNext ] }; + key { [ XF86AudioStop ] }; + key { [ XF86ZoomOut ] }; + key { [ XF86ZoomIn ] }; + key { [ XF86Calculator ] }; + key { [ XF86Xfer ] }; + key { [ Menu ] }; + key { [ XF86Mail ] }; + key { [ XF86PowerOff ] }; + key { [ XF86Standby ] }; + key { [ XF86WakeUp ] }; +}; + + +// Propeller + +// Propeller Voyager (KTEZ-1000) +partial alphanumeric_keys +xkb_symbols "propeller" { + key { [ XF86Calculator ] }; + key { [ XF86Xfer ] }; + + key { [ XF86DOS ] }; + key { [ XF86Documents ] }; + key { [ XF86WWW ] }; + key { [ Menu ] }; + key { [ XF86Game ] }; + + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioRewind ] }; + key { [ XF86AudioPrev ] }; + key { [ XF86AudioNext ] }; + key { [ XF86AudioStop ] }; + key { [ XF86Close ] }; + key { [ XF86AudioRecord ] }; + + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioMute ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86Standby ] }; +}; + + +// QTronix + +// QTronix Scorpius 98N+ +partial alphanumeric_keys +xkb_symbols "qtronix" { + key { [ XF86AudioPrev ] }; + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioStop ] }; + key { [ XF86AudioNext ] }; + key { [ XF86AudioRecord ] }; + + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioMute ] }; + key { [ XF86AudioRaiseVolume ] }; + + key { [ XF86WakeUp ] }; + key { [ XF86Standby ] }; + key { [ XF86PowerOff ] }; + key { [ XF86Calculator ] }; + key { [ XF86Reload ] }; + + key { [ XF86HomePage ] }; + key { [ XF86Back ] }; + key { [ XF86Search ] }; + key { [ XF86Stop ] }; + key { [ XF86Forward ] }; + + key { [ XF86ScrollUp ] }; + key { [ XF86ScrollDown ] }; +}; + + +// Samsung + +// Samsung SDM 4500P +partial alphanumeric_keys +xkb_symbols "samsung4500" { + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioMute ] }; + key { [ XF86Eject ] }; + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioStop ] }; + key { [ XF86AudioPrev ] }; + key { [ XF86AudioNext ] }; + key { [ XF86WWW ] }; + key { [ XF86Mail ] }; + key { [ XF86Standby ] }; + key { [ Help ] }; + key { [ XF86Explorer ] }; + key { [ XF86Close ] }; + key { [ XF86Book ] }; + key { [ XF86Launch1 ] }; + key { [ XF86Launch2 ] }; + key { [ XF86Launch3 ] }; + key { [ XF86Launch4 ] }; + key { [ XF86Launch5 ] }; +}; + +// Samsung SDM 4510P +partial alphanumeric_keys +xkb_symbols "samsung4510" { + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioMute ] }; + key { [ XF86Eject ] }; + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioStop ] }; + key { [ XF86AudioPrev ] }; + key { [ XF86AudioNext ] }; + key { [ XF86Launch1 ] }; + key { [ XF86Launch2 ] }; + key { [ XF86Launch3 ] }; + key { [ XF86Standby ] }; +}; + + +// SK + +// SK-1300 +partial alphanumeric_keys +xkb_symbols "sk1300" { + key { [ XF86WWW ] }; + key { [ XF86Back ] }; + key { [ XF86Forward ] }; + key { [ XF86Stop ] }; + key { [ XF86Standby ] }; + key { [ XF86AudioPrev ] }; + key { [ XF86AudioNext ] }; + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioStop ] }; + key { [ XF86Eject ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioLowerVolume ] }; +}; + +// SK-2500 +partial alphanumeric_keys +xkb_symbols "sk2500" { + key { [ XF86PowerOff ] }; + key { [ XF86ScreenSaver ] }; + key { [ XF86WWW ] }; + key { [ XF86Calculator ] }; + key { [ XF86Xfer ] }; + key { [ XF86Close ] }; + key { [ XF86AudioPrev ] }; + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioStop ] }; + key { [ XF86AudioNext ] }; + key { [ XF86AudioRecord ] }; + key { [ XF86AudioRewind ] }; + key { [ Menu ] }; + key { [ XF86Eject ] }; + key { [ XF86AudioMute ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86Forward ] }; + key { [ XF86Eject ] }; +}; + +// SK-6200 +partial alphanumeric_keys +xkb_symbols "sk6200" { + key { [ XF86AudioStop ] }; + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioPrev ] }; + key { [ XF86AudioNext ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioMute ] }; + key { [ XF86PowerOff ] }; + key { [ XF86Standby ] }; + key { [ XF86WWW ] }; + key { [ XF86Favorites ] }; + key { [ XF86Mail ] }; + key { [ XF86Back ] }; + key { [ XF86Forward ] }; +}; + +// SK-7100 +partial alphanumeric_keys +xkb_symbols "sk7100" { + key { [ XF86Close ] }; + key { [ XF86CD ] }; + key { [ XF86Video ] }; + key { [ XF86WWW ] }; + key { [ XF86Eject ] }; + key { [ XF86AudioPrev ] }; + key { [ XF86AudioPause ] }; + key { [ XF86AudioPlay ] }; + key { [ XF86AudioStop ] }; + key { [ XF86AudioNext ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioMute ] }; + key { [ XF86Display ] }; +}; + + +// Sven + +// SVEN Ergonomic 2500 +partial alphanumeric_keys +xkb_symbols "sven" { + key { [ XF86Back ] }; + key { [ XF86Forward ] }; + key { [ XF86Stop ] }; + key { [ XF86Reload ] }; + key { [ XF86Search ] }; + key { [ XF86Favorites ] }; + key { [ XF86HomePage ] }; + key { [ XF86AudioPrev ] }; + key { [ XF86AudioStop ] }; + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioNext ] }; + key { [ XF86AudioMute ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86ZoomOut ] }; + key { [ XF86ZoomIn ] }; + key { [ XF86ScrollDown ] }; + key { [ XF86ScrollUp ] }; + key { [ XF86Mail ] }; + key { [ XF86MyComputer ] }; + key { [ XF86Calculator ] }; + key { [ XF86ScreenSaver ] }; + key { [ XF86PowerOff ] }; + key { [ XF86Standby ] }; + key { [ XF86WakeUp ] }; +}; + + +// Symplon + +// Symplon PaceBook (tablet PC) +partial alphanumeric_keys +xkb_symbols "symplon" { + key { [ XF86RotationPB ] }; + key { [ XF86MenuPB ] }; + key { [ XF86UserPB ] }; + key { [ XF86RotationKB ] }; + key { [ XF86MenuKB ] }; + key { [ XF86SplitScreen ] }; + key { [ XF86User1KB ] }; + key { [ XF86User2KB ] }; + key { [ XF86Standby ] }; + key { [ XF86New ] }; + key { [ XF86Mail ] }; + key { [ XF86WWW ] }; + key { [ XF86Support ] }; +}; + +// Toshiba + +// Toshiba Satellite S3000 +partial alphanumeric_keys +xkb_symbols "toshiba_s3000" { + + // Describes the Special buttons on Toshiba Satellite 3000 models. + // See http://sourceforge.net/projects/omke for details on enabling + // these keys + + key { [ XF86WWW ] }; + key { [ XF86Mail ] }; + key { [ XF86Launch1 ] }; + key { [ XF86Launch2 ] }; + key { [ XF86AudioStop, XF86Eject ] }; + key { [ XF86AudioPrev ] }; + key { [ XF86AudioNext ] }; + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioLowerVolume ] }; +}; + +// Trust + +// Trust Wireless Keyboard Classic +partial alphanumeric_keys +xkb_symbols "trust" { + key { [ XF86WWW ] }; + key { [ XF86Back ] }; + key { [ XF86Forward ] }; + key { [ XF86Mail ] }; + key { [ XF86Calculator ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioMute ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioPrev ] }; + key { [ XF86AudioNext ] }; + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioStop ] }; + key { [ XF86Eject ] }; + key { [ XF86Standby ] }; + key { [ XF86WakeUp ] }; + key { [ XF86ScreenSaver ] }; +}; + + +// Trust Direct Access Keyboard +partial alphanumeric_keys +xkb_symbols "trustda" { + key { [ XF86Away ] }; + key { [ XF86WWW ] }; + key { [ XF86Calculator ] }; + key { [ XF86Xfer ] }; + key { [ XF86Close ] }; + key { [ XF86AudioPrev ] }; + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioStop ] }; + key { [ XF86AudioNext ] }; + key { [ XF86AudioRecord ] }; + key { [ XF86AudioRewind ] }; + key { [ Help ] }; + key { [ XF86Eject ] }; + key { [ XF86AudioMute ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86Standby ] }; +}; + + +// YaHoo! + +// Yahoo! Internet Keyboard +partial alphanumeric_keys +xkb_symbols "yahoo" { + key { [ XF86AudioPrev ] }; + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioStop ] }; + key { [ XF86AudioNext ] }; + key { [ XF86AudioRecord ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioMute ] }; + key { [ XF86Close ] }; + key { [ XF86Calculator ] }; + key { [ Help ] }; + key { [ XF86Mail ] }; + key { [ XF86WWW ] }; + key { [ XF86PowerOff ] }; + key { [ XF86Standby ] }; + key { [ XF86WakeUp ] }; +}; + +// Super Power Internet Keyboard + +// Super Power Multimedia Keyboard +xkb_symbols "sp_inet" { + key { [ XF86Refresh ] }; + key { [ XF86Favorites ] }; + key { [ XF86Back ] }; + key { [ XF86Forward ] }; + key { [ XF86Stop ] }; + key { [ XF86HomePage ] }; + key { [ XF86Mail ] }; + key { [ XF86AudioPlay, XF86AudioPause ] }; + key { [ XF86AudioStop ] }; + key { [ XF86AudioPrev ] }; + key { [ XF86AudioNext ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioMute ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86PowerOff ] }; + key { [ XF86Standby ] }; + key { [ XF86WakeUp ] }; +}; + +// Acer Travelmate 800 +xkb_symbols "acer_tm_800" { + key { [ XF86Mail ] }; + key { [ XF86WWW ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioMute ] }; +// There are other buttons (P1, P2, Fn-F2, Fn-F3 - but they +// don't generate scancodes. It is possible to map them to whatever user wants. +}; + +partial alphanumeric_keys +xkb_symbols "cymotionlinux" { + key { [ XF86Back ] }; + key { [ XF86Forward ] }; + key { [ XF86Stop ] }; + key { [ XF86Reload ] }; + key { [ XF86Search ] }; + key { [ XF86AudioRaiseVolume ] }; + key { [ XF86AudioLowerVolume ] }; + key { [ XF86AudioMute ] }; + key { [ XF86AudioMedia ] }; + key { [ XF86AudioPlay ] }; + key { [ XF86AudioStop ] }; + key { [ XF86AudioPrev ] }; + key { [ XF86AudioNext ] }; + key { [ XF86Calculator ] }; + key { [ XF86Mail ] }; + key { [ XF86WWW ] }; + key { [ XF86Standby ] }; + key { [ XF86ScrollUp ] }; + key { [ XF86ScrollDown ] }; + key { [ XF86Cut ] }; + key { [ XF86Copy ] }; + key { [ XF86Launch1 ] }; + key { [ XF86Launch2 ] }; + key { [ XF86Launch3 ] }; + key { [ Redo ] }; + key { [ Undo ] }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/ir /opt/SUNWut/lib/xkb/symbols/ir --- /opt/SUNWut.orig/lib/xkb/symbols/ir 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/ir 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,66 @@ +// $XConsortium: +// $XFree86: +// +// Iranian keymap, by Robert Brady +// Data supplied by Roozbeh Pournader +// Minor changes made by Arash Zeini , +// and Roozbeh Pournader. +// +// Last update: 2002-06-19 + +partial default alphanumeric_keys +xkb_symbols "basic" { + name[Group2]= "Iranian"; + key { [], [ 0x100200d ] }; + key { [], [ 0x10006f1, exclam ] }; + key { [], [ 0x10006f2, 0x100066c ] }; + key { [], [ 0x10006f3, 0x100066b ] }; + key { [], [ 0x10006f4, 0x100fdfc ] }; + key { [], [ 0x10006f5, 0x100066a ] }; + key { [], [ 0x10006f6, multiply ] }; + key { [], [ 0x10006f7, Arabic_comma ] }; + key { [], [ 0x10006f8, asterisk ] }; + key { [], [ 0x10006f9, parenright ] }; + key { [], [ 0x10006f0, parenleft ] }; + key { [], [ minus, Arabic_tatweel ] }; + key { [], [ equal, plus ] }; + + key { [], [ Arabic_dad, Arabic_sukun ] }; + key { [], [ Arabic_sad, Arabic_dammatan ] }; + key { [], [ Arabic_theh, Arabic_kasratan ] }; + key { [], [ Arabic_qaf, Arabic_fathatan ] }; + key { [], [ Arabic_feh, Arabic_damma ] }; + key { [], [ Arabic_ghain, Arabic_kasra ] }; + key { [], [ Arabic_ain, Arabic_fatha ] }; + key { [], [ Arabic_heh, Arabic_shadda ] }; + key { [], [ Arabic_khah, bracketright ] }; + key { [], [ Arabic_hah, bracketleft ] }; + key { [], [ Arabic_jeem, braceright ] }; + key { [], [ 0x1000686, braceleft ] }; + + key { [], [ Arabic_sheen, Arabic_hamzaonwaw ] }; + key { [], [ Arabic_seen, Arabic_hamzaonyeh ] }; + key { [], [ 0x10006cc, Arabic_yeh ] }; + key { [], [ Arabic_beh, Arabic_hamzaunderalef] }; + key { [], [ Arabic_lam, Arabic_hamzaonalef ] }; + key { [], [ Arabic_alef, Arabic_maddaonalef ] }; + key { [], [ Arabic_teh, Arabic_tehmarbuta ] }; + key { [], [ Arabic_noon, guillemotright ] }; + key { [], [ Arabic_meem, guillemotleft ] }; + key { [], [ 0x10006a9, colon ] }; + key { [], [ 0x10006af, Arabic_semicolon ] }; + + key { [], [ backslash, bar ] }; + key { [], [ space, 0x100200c ] }; + + key { [], [ Arabic_zah, Arabic_kaf ] }; + key { [], [ Arabic_tah ] }; + key { [], [ Arabic_zain, 0x1000698 ] }; + key { [], [ Arabic_ra ] }; + key { [], [ Arabic_thal, 0x100200c ] }; + key { [], [ Arabic_dal ] }; + key { [], [ 0x100067e, Arabic_hamza ] }; + key { [], [ Arabic_waw, greater ] }; + key { [], [ period, less ] }; + key { [], [ slash, Arabic_question_mark ] }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/is /opt/SUNWut/lib/xkb/symbols/is --- /opt/SUNWut.orig/lib/xkb/symbols/is 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/is 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,126 @@ +// $Xorg: is,v 1.3 2000/08/17 19:54:43 cpqbld Exp $ +// XKB keyboard by Hrafnkell Eiriksson - hkelle@rhi.hi.is +// fixes by Olafur Osvaldsson - oli@isnic.is +// $XFree86: xc/programs/xkbcomp/symbols/is,v 3.7 2002/11/26 01:57:24 dawes Exp $ + +default partial alphanumeric_keys +xkb_symbols "basic" { + + // Describes the differences between a very simple US/ASCII + // keyboard and an Icelandic one - hopefully + + // Alphanumeric section + name[Group1]= "Icelandic"; + key { [ degree, diaeresis ], + [ notsign ] }; + key { [ 2, quotedbl ], + [ twosuperior ] }; + key { [ 3, numbersign ], + [ threesuperior,sterling ] }; + key { [ 4, dollar ], + [ onequarter, currency ] }; + key { [ 5, percent ], + [ onehalf ] }; + key { [ 6, ampersand ], + [ threequarters ] }; + key { [ 7, slash ], + [ braceleft ] }; + key { [ 8, parenleft ], + [ bracketleft ] }; + key { [ 9, parenright ], + [ bracketright, plusminus ] }; + key { [ 0, equal ], + [ braceright, degree ] }; + key { [ odiaeresis, Odiaeresis ], + [ backslash, questiondown ] }; + key { [ minus, underscore ], + [ ccedilla ] }; + key { [ q, Q ], + [ at ] }; + key { [ e, E ], + [ EuroSign, cent ] }; +// key { [ t, T ] }; +// key { [ z, Z ] }; +// key { [ u, U ] }; +// key { [ i, I ] }; + key { [ eth, Eth ], + [ dead_diaeresis ] }; + key { [ apostrophe , question ], + [ asciitilde, dead_macron ] }; +// key { [ f, F ] }; +// key { [ g, G ] }; + key { [ ae, AE ], + [ asciicircum ] }; + key { [ dead_acute, dead_diaeresis ], + [ dead_circumflex ] }; + + key { [ less, greater ], + [ bar ] }; +// key { [ y, Y ], +// [ guillemotleft, less ] }; +// key { [ m, M ], +// [ mu ] }; + key { [ comma, semicolon ] }; + key { [ period, colon ], + [ periodcentered, division ] }; + key { [ thorn, Thorn ] }; + key { [ plus, asterisk ], + [ grave ] }; + + // End alphanumeric section + + // begin modifier mappings + include "ralt(mode_switch)" + + modifier_map Shift { Shift_L }; + modifier_map Lock { Caps_Lock }; + modifier_map Control{ Control_L }; + modifier_map Mod3 { Mode_switch }; +}; + +partial alphanumeric_keys +xkb_symbols "Sundeadkeys" { + // modify the default Icelandic layout to use Sun dead keys + include "is(basic)" + key { [ SunFA_Circum, degree ], + [ notsign ] }; + key { [ SunFA_Acute, SunFA_Grave ], + [ SunFA_Cedilla ] }; + key { [ udiaeresis, Udiaeresis ], + [ SunFA_Diaeresis ] }; + key { [ plus, asterisk ], + [ SunFA_Tilde, dead_macron ] }; + key { [ odiaeresis, Odiaeresis ], + [ SunFA_Acute ] }; + key { [ adiaeresis, Adiaeresis ], + [ SunFA_Circum ] }; + key { [ numbersign, acute ], + [ SunFA_Grave ] }; +}; + +partial alphanumeric_keys +xkb_symbols "sundeadkeys" { + include "is(Sundeadkeys)" +}; + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + // modify the default Icelandic layout to not have any dead keys + include "is(basic)" + key { [ asciicircum, degree ], + [ notsign ] }; + key { [ apostrophe, grave ], + [ cedilla ] }; + key { [ udiaeresis, Udiaeresis ], + [ diaeresis ] }; + key { [ plus, asterisk ], + [ asciitilde, macron ] }; + key { [ odiaeresis, Odiaeresis ], + [ acute ] }; + key { [ adiaeresis, Adiaeresis ], + [ asciicircum ] }; + key { [ numbersign, acute ], + [ grave ] }; +}; + + diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/iso9995-3 /opt/SUNWut/lib/xkb/symbols/iso9995-3 --- /opt/SUNWut.orig/lib/xkb/symbols/iso9995-3 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/iso9995-3 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,137 @@ +// $Xorg: iso9995-3,v 1.3 2000/08/17 19:54:43 cpqbld Exp $ +partial alphanumeric_keys alternate_group +xkb_symbols "basic101" { + // Part 3 of ISO9995 specifies a common alternate character set + // This file adds that common set to any keyboard for which a + // second group is not defined. It does *not* specify any of + // 9995's special modifiers (ISO lock, group locks, etc). + // If you want a fully compliant ISO keyboard, add "iso9995-full" + // instead + name[Group2]= "ISO9995-3"; + key { [], [ notsign ] }; + key { [], [ onesuperior, exclamdown ] }; + key { [], [ twosuperior, oneeighth ] }; + key { [], [ threesuperior, sterling ] }; + key { [], [ onequarter, dollar ] }; + key { [], [ onehalf, threeeighths ] }; + key { [], [ threequarters, fiveeighths ] }; + key { [], [ braceleft, seveneighths ] }; + key { [], [ bracketleft, trademark ] }; + key { [], [ bracketright, plusminus ] }; + key { [], [ braceright, degree ] }; + key { [], [ backslash, questiondown ] }; + key { [], [ dead_cedilla, dead_ogonek ] }; + + key { [], [ at, Greek_OMEGA ] }; + key { [], [ lstroke, Lstroke ] }; +// key { [], [ oe, OE ] }; + key { [], [ paragraph, registered ] }; + key { [], [ tslash, Tslash ] }; + key { [], [ leftarrow, yen ] }; + key { [], [ downarrow, uparrow ] }; + key { [], [ rightarrow, idotless ] }; + key { [], [ oslash, Ooblique ] }; + key { [], [ thorn, Thorn ] }; + key { [], [ dead_diaeresis, dead_abovering ] }; + key { [], [ dead_tilde, dead_macron ] }; + + key { [], [ ae, AE ] }; + key { [], [ ssharp, section ] }; + key { [], [ eth, Eth ] }; + key { [], [ dstroke, ordfeminine ] }; + key { [], [ eng, ENG ] }; + key { [], [ hstroke, Hstroke ] }; +// key { [], [ ij, IJ ] }; + key { [], [ kra, ampersand ] }; + key { [], [ lstroke, Lstroke ] }; + key { [], [ dead_acute, dead_doubleacute] }; + key { [], [ dead_circumflex, dead_caron ] }; + key { [], [ dead_grave, dead_breve ] }; + + key { [], [ guillemotleft, less ] }; + key { [], [ guillemotright, greater ] }; + key { [], [ cent, copyright ] }; + key { [], [ leftdoublequotemark, quoteleft ] }; + key { [], [ rightdoublequotemark, quoteright ] }; +// key { [], [ apostrophe_small_n, musicalnote ] }; + key { [], [ mu, masculine ] }; + key { [], [ horizconnector, multiply ] }; + key { [], [ periodcentered, division ] }; + key { [], [ dead_belowdot, dead_abovedot ] }; +}; + +partial default alphanumeric_keys alternate_group +xkb_symbols "basic" { + include "iso9995-3(basic101)" + key { [], [ bar, brokenbar ] }; +}; + +hidden partial alphanumeric_keys alternate_group +xkb_symbols "nodeadkeys_common" { + + // Modifies the basic iso9995-3 layout to eliminate all dead keys + + key { [], [ cedilla, ogonek ] }; + + key { [], [ diaeresis, degree ] }; + key { [], [ asciitilde, macron ] }; + key { [], [ asciicircum, caron ] }; + key { [], [ grave, breve ] }; +// key { [], [ belowdot, abovedot] }; + override key {[], [ dead_belowdot, abovedot ] }; +}; + +partial alphanumeric_keys alternate_group +xkb_symbols "nodeadkeys101" { + include "iso9995-3(basic101)" + include "iso9995-3(nodeadkeys_common)" +}; + +partial alphanumeric_keys alternate_group +xkb_symbols "nodeadkeys" { + include "iso9995-3(basic)" + include "iso9995-3(nodeadkeys_common)" +}; + +hidden partial alphanumeric_keys modifier_keys alternate_group +xkb_symbols "full_common" { + // Defines the special modifier keys specified by 9995 part 3 + // Includes the iso9995-3 to get the common alternate set + + SetMods.latchToLock=True; + SetMods.clearLocks=True; + + override key { [ ISO_Lock ] }; + override key { + type="PC_BREAK", + [ Shift_L, ISO_Prev_Group ], + [ SetMods(modifiers=Shift), LockGroup(group= -1) ] + }; + override key { + type="PC_BREAK", + [ Shift_R, ISO_Next_Group ], + [ SetMods(modifiers=Shift), LockGroup(group= +1) ] + }; + + override key { + [ Control_L, ISO_Prev_Group ], + [ SetMods(modifiers=Shift), LockGroup(group= -1) ] + }; + override key { + [ Control_R, ISO_Next_Group ], + [ SetMods(modifiers=Shift), LockGroup(group= +1) ] + }; + override key { + [ Mode_switch, Multi_key ] + }; +}; +partial alphanumeric_keys modifier_keys alternate_group +xkb_symbols "full" { + include "iso9995-3(basic)" + include "iso9995-3(full_common)" +}; +partial alphanumeric_keys modifier_keys alternate_group +xkb_symbols "full101" { + include "iso9995-3(basic101)" + include "iso9995-3(full_common)" +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/it /opt/SUNWut/lib/xkb/symbols/it --- /opt/SUNWut.orig/lib/xkb/symbols/it 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/it 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,113 @@ +// $Xorg: it,v 1.3 2000/08/17 19:54:43 cpqbld Exp $ + + + + +// $XFree86: xc/programs/xkbcomp/symbols/it,v 3.5 2001/01/17 23:45:58 dawes Exp $ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + // Describes the differences between a very simple en_US + // keyboard and a very simple Italian keybaord + + name[Group1]= "Italian"; + + key { [ backslash, bar ], + [ notsign, brokenbar ] }; + key { [ 2, quotedbl ], + [ twosuperior, dead_doubleacute ] }; + key { [ 3, sterling ], + [ threesuperior, dead_tilde ] }; + key { [], + [ onequarter, oneeighth ] }; + key { [ 6, ampersand ] }; + key { [ 7, slash ] }; + key { [ 8, parenleft ] }; + key { [ 9, parenright ] }; + key { [ 0, equal ], + [ braceright, questiondown ] }; + key { [ apostrophe, question ], + [ grave, dead_grave ] }; + key { [ igrave, asciicircum ], + [ asciitilde, dead_circumflex ] }; + + key { [], + [ ntilde, Ntilde ] }; + key { [ comma, semicolon ], + [ dead_acute, multiply ] }; + key { [ period, colon ], + [ periodcentered, dead_diaeresis ] }; + key { [ minus, underscore ], + [ dead_macron, division ] }; + key { [ ograve, ccedilla ], + [ at, dead_cedilla ] }; + key { [ agrave, degree ], + [ numbersign, dead_abovering ] }; + key { [ egrave, eacute ], + [ bracketleft, braceleft ] }; + key { [ plus, asterisk ], + [ bracketright, braceright ] }; + key { [ less, greater ], + [ guillemotleft, guillemotright ] }; + key { [ ugrave, section ] }; + key { [ e, E ], + [ EuroSign, cent ] }; + + // End alphanumeric section + + // begin modifier mappings + + modifier_map Shift { Shift_L }; + modifier_map Lock { Caps_Lock }; + modifier_map Control{ Control_L }; + modifier_map Mod3 { Mode_switch }; +}; + +partial alphanumeric_keys +xkb_symbols "Sundeadkeys" { + + // For naming consistency + + include "it(basic)" +}; + +partial alphanumeric_keys +xkb_symbols "sundeadkeys" { + + // For naming consistency + + include "it(Sundeadkeys)" +}; + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + + // Modifies the basic italian layout to eliminate all dead keys + + include "it(basic)" + + key { [ 2, quotedbl ], + [ twosuperior, doubleacute ] }; + key { [ 3, sterling ], + [ threesuperior, asciitilde ] }; + key { [ apostrophe, question ], + [ grave, grave ] }; + key { [ igrave, asciicircum ], + [ asciitilde, asciicircum ] }; + + key { [ ograve, ccedilla ], + [ at, cedilla ] }; + key { [ agrave, degree ], + [ numbersign, degree ] }; + + key { [ comma, semicolon ], + [ acute, multiply ] }; + key { [ period, colon ], + [ periodcentered, diaeresis ] }; + key { [ minus, underscore ], + [ macron, division ] }; + + key { [ ugrave, section ], + [ grave, breve ] }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/iu /opt/SUNWut/lib/xkb/symbols/iu --- /opt/SUNWut.orig/lib/xkb/symbols/iu 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/iu 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,79 @@ +// +// Inuktitut keyboard for X11 +// written by Pablo Saratxaga +// + + +partial default alphanumeric_keys +xkb_symbols "basic" { + + // Describes the differences between a very simple en_US + // keyboard and a syllabic inuktitut keyboard ("Naamajut" layout) + + name[Group1]= "US/ASCII"; + name[Group2]= "Inuktitut"; + + key { [], [ 0x01001595, 1 ] }; + key { [], [ 0x01001449, 2 ] }; + key { [], [ 0x01001550, 3 ] }; + key { [], [ 0x01001483, 4 ] }; + key { [], [ 0x01001466, 5 ] }; + key { [], [ 0x01001585, 6 ] }; + key { [], [ 0x010014bb, 7 ] }; + key { [], [ 0x010014d0, 8 ] }; + key { [], [ 0x010014ea, 9 ] }; + key { [], [ 0x0100153e, 0 ] }; + key { [], [ minus, underscore ] }; + key { [], [ 0x0100155d, equal ] }; + + key { [], [ 0x0100158f, 0x0100148b ] }; + key { [], [ 0x01001403, 0x01001431 ] }; + key { [], [ 0x0100157f, 0x01001546 ] }; + key { [], [ 0x0100146d, 0x01001596 ] }; + key { [], [ 0x0100144e, 0x01001671 ] }; + key { [], [ 0x010014ef, 0x01001673 ] }; + key { [], [ 0x010014a5, 0x01001675 ] }; + key { [], [ 0x010014c2, 0x010015a4 ] }; + key { [], [ 0x010014d5, 0x010015a0 ] }; + key { [], [ 0x01001528, 0x010015a6 ] }; + key { [], [ 0x010014a1, 0x01001505 ] }; + key { [], [ dead_abovedot, 0x0100141e ] }; + + key { [], [ 0x01001591, 0x0100148d ] }; + key { [], [ 0x01001405, 0x01001433 ] }; + key { [], [ 0x01001581, 0x01001548 ] }; + key { [], [ 0x0100146f, 0x01001555 ] }; + key { [], [ 0x01001450, parenleft ] }; + key { [], [ 0x010014f1, parenright ] }; + key { [], [ 0x010014a7, 0x0100152a ] }; + key { [], [ 0x010014c4, 0x01001557 ] }; + key { [], [ 0x010014d7, 0x010015a2 ] }; + key { [], [ semicolon, colon ] }; + key { [], [ apostrophe, quotedbl ] }; + + key { [], [ 0x01001593, 0x01001490 ] }; + key { [], [ 0x0100140a, 0x01001438 ] }; + key { [], [ 0x01001583, 0x0100154b ] }; + key { [], [ 0x01001472, question ] }; + key { [], [ 0x01001455, 0x0100157c ] }; + key { [], [ 0x010014f4, 0x010014c7 ] }; + key { [], [ 0x010014aa, 0x010014da ] }; + key { [], [ comma, less ] }; + key { [], [ period, greater ] }; + key { [], [ 0x0100152d, 0x01001559 ] }; + + key { [], [ 0x0100157b, 0x01001575 ] }; + key { [], [ 0x01001579, 0x01001577 ] }; + key { [], [ backslash, bar ] }; + +// End alphanumeric section + + // Begin modifier mappings + + modifier_map Shift { Shift_L }; + modifier_map Lock { Caps_Lock, ISO_Lock }; + modifier_map Control{ Control_L }; + modifier_map Mod3 { Mode_switch }; +}; + + diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/jp /opt/SUNWut/lib/xkb/symbols/jp --- /opt/SUNWut.orig/lib/xkb/symbols/jp 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/jp 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,170 @@ +// $Xorg: jp,v 1.3 2000/08/17 19:54:43 cpqbld Exp $ + + +// symbols for a Japanese 106 keyboard(by tsuka@kawalab.dnj.ynu.ac.jp) + +// $XFree86: xc/programs/xkbcomp/symbols/jp,v 3.10 2003/10/25 13:24:05 pascal Exp $ + +default xkb_symbols "jp106" { + include "srvr_ctrl(xfree86)" + + name[Group1]= "US/ASCII"; + name[Group2]= "Japanese"; + + key { [ Escape ] }; + + // Alphanumeric section + key { + type="PC_SYSRQ", + symbols[Group1]= [ Zenkaku_Hankaku, Kanji ] + }; + key { [ 1, exclam ], [ kana_NU ] }; + key { [ 2, quotedbl ], [ kana_FU ] }; + key { [ 3, numbersign ], [ kana_A, kana_a ] }; + key { [ 4, dollar ], [ kana_U, kana_u ] }; + key { [ 5, percent ], [ kana_E, kana_e ] }; + key { [ 6, ampersand ], [ kana_O, kana_o ] }; + key { [ 7, apostrophe ], [ kana_YA, kana_ya ] }; + key { [ 8, parenleft ], [ kana_YU, kana_yu ] }; + key { [ 9, parenright ], [ kana_YO, kana_yo ] }; + key { [ 0,asciitilde ], [ kana_WA, kana_WO ] }; + key { [ minus, equal ], [ kana_HO ] }; + key { [ asciicircum, asciitilde], [ kana_HE ] }; + key { [ backslash, bar ], [ prolongedsound ] }; + key { + type="CTRL+ALT", + symbols[Group1]= [ BackSpace, Terminate_Server ] + }; + + key { [ Tab, ISO_Left_Tab ] }; + key { [ q, Q ], [ kana_TA ] }; + key { [ w, W ], [ kana_TE ] }; + key { [ e, E ], [ kana_I, kana_i ] }; + key { [ r, R ], [ kana_SU ] }; + key { [ t, T ], [ kana_KA ] }; + key { [ y, Y ], [ kana_N ] }; + key { [ u, U ], [ kana_NA ] }; + key { [ i, I ], [ kana_NI ] }; + key { [ o, O ], [ kana_RA ] }; + key { [ p, P ], [ kana_SE ] }; + key { [ at, grave ], [ voicedsound ] }; + key { [ bracketleft, braceleft ], [ semivoicedsound, kana_openingbracket ] }; + key { [ Return ] }; + + key { [ Eisu_toggle, Caps_Lock ] }; + key { [ a, A ], [ kana_CHI ] }; + key { [ s, S ], [ kana_TO ] }; + key { [ d, D ], [ kana_SHI ] }; + key { [ f, F ], [ kana_HA ] }; + key { [ g, G ], [ kana_KI ] }; + key { [ h, H ], [ kana_KU ] }; + key { [ j, J ], [ kana_MA ] }; + key { [ k, K ], [ kana_NO ] }; + key { [ l, L ], [ kana_RI ] }; + key { [ semicolon, plus ], [ kana_RE ] }; + key { [ colon, asterisk ], [ kana_KE ] }; + key { [ bracketright, braceright ], [ kana_MU, kana_closingbracket ] }; + + key { [ Shift_L ] }; + key { [ z, Z ], [ kana_TSU, kana_tsu ] }; + key { [ x, X ], [ kana_SA ] }; + key { [ c, C ], [ kana_SO ] }; + key { [ v, V ], [ kana_HI ] }; + key { [ b, B ], [ kana_KO ] }; + key { [ n, N ], [ kana_MI ] }; + key { [ m, M ], [ kana_MO ] }; + key { [ comma, less ], [ kana_NE, kana_comma ] }; + key { [ period, greater ], [ kana_RU, kana_fullstop ] }; + key { [ slash, question ], [ kana_ME, kana_middledot ] }; + key { [ backslash, underscore], [ kana_RO ] }; + key { [ Shift_R ] }; + + key { [ Control_L ] }; + key { [ Alt_L,Meta_L ] }; + key { [ Muhenkan ] }; + key { [ space ] }; + key { + type="PC_SYSRQ", + symbols[Group1]= [ Henkan, Mode_switch ] + }; + key { + type="PC_SYSRQ", + symbols[Group1]= [ Hiragana_Katakana, Romaji ] + }; + key { [ Alt_R,Meta_R ] }; + key { [ Control_R ] }; + + // End alphanumeric section + + // Begin "Function" section + key { [ F1 ] }; + key { [ F2 ] }; + key { [ F3 ] }; + key { [ F4 ] }; + key { [ F5 ] }; + key { [ F6 ] }; + key { [ F7 ] }; + key { [ F8 ] }; + key { [ F9 ] }; + key { [ F10 ] }; + key { [ F11 ] }; + key { [ F12 ] }; + // End "Function" section + + + // Begin "Editing" section + key { + type= "PC_SYSRQ", + symbols[Group1]= [ Print, Execute ] + }; + key { [ Scroll_Lock ] }; + key { + type= "PC_BREAK", + symbols[Group1]= [ Pause, Break ] + }; + key { [ Insert ] }; + key { [ Home ] }; + key { [ Prior ] }; + key { [ Delete ] }; + key { [ End ] }; + key { [ Next ] }; + + key { [ Up ] }; + key { [ Left ] }; + key { [ Down ] }; + key { [ Right ] }; + + // End "Editing" section, begin "Keypad" + key { [ Num_Lock ] }; + key { [ KP_Divide ] }; + key { [ KP_Multiply ] }; + key { [ KP_Subtract ] }; + + key { [ KP_Home, KP_7 ] }; + key { [ KP_Up, KP_8 ] }; + key { [ KP_Prior, KP_9 ] }; + key { [ KP_Add ] }; + + key { [ KP_Left, KP_4 ] }; + key { [ KP_Begin, KP_5 ] }; + key { [ KP_Right, KP_6 ] }; + + key { [ KP_End, KP_1 ] }; + key { [ KP_Down, KP_2 ] }; + key { [ KP_Next, KP_3 ] }; + key { [ KP_Enter ] }; + + key { [ KP_Insert, KP_0 ] }; + key { [ KP_Delete, KP_Decimal ] }; + // End "Keypad" section + + + // begin modifier mappings + modifier_map Shift { Shift_L,Shift_R }; + modifier_map Lock { Caps_Lock }; + modifier_map Control{ Control_L,Control_R }; + modifier_map Mod1 { Alt_L, Alt_R, Meta_L, Meta_R }; + modifier_map Mod2 { Num_Lock }; + modifier_map Mod5 { Scroll_Lock }; +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/kan /opt/SUNWut/lib/xkb/symbols/kan --- /opt/SUNWut.orig/lib/xkb/symbols/kan 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/kan 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,72 @@ +// $XFree86$ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + // Inscript layout for Kannada + // Author : G Karunakar + // Date : Wed Nov 13 17:22:58 IST 2002 + // Kannada digits mapped in basic only + + name[Group2]= "Kannada"; + + key { [], [ 0x01000cca, 0x01000c92 ] }; + key { [], [ 0x01000ce7, 0x01000c8d ] }; + key { [], [ 0x01000ce8, 0x01000cc5 ] }; + key { [], [ 0x01000ce9 ] }; + key { [], [ 0x01000cea ] }; + key { [], [ 0x01000ceb ] }; + key { [], [ 0x01000cec ] }; + key { [], [ 0x01000ced ] }; + key { [], [ 0x01000cee ] }; + key { [], [ 0x01000cef ] }; + key { [], [ 0x01000ce6 ] }; + key { [], [ 0x01000c83 ] }; + key { [], [ 0x01000cc3, 0x01000c8b ] }; + + key { [], [ 0x01000ccc, 0x01000c94 ] }; + key { [], [ 0x01000cc8, 0x01000c90 ] }; + key { [], [ 0x01000cbe, 0x01000c86 ] }; + key { [], [ 0x01000cc0, 0x01000c88 ] }; + key { [], [ 0x01000cc2, 0x01000c8a ] }; + key { [], [ 0x01000cac, 0x01000cad ] }; + key { [], [ 0x01000cb9, 0x01000c99 ] }; + key { [], [ 0x01000c97, 0x01000c98 ] }; + key { [], [ 0x01000ca6, 0x01000ca7 ] }; + key { [], [ 0x01000c9c, 0x01000c9d ] }; + key { [], [ 0x01000ca1, 0x01000ca2 ] }; + key { [], [ 0x01000cbc, 0x01000c9e ] }; + + key { [], [ 0x01000ccb, 0x01000c93 ] }; + key { [], [ 0x01000cc7, 0x01000c8f ] }; + key { [], [ 0x01000ccd, 0x01000c85 ] }; + key { [], [ 0x01000cbf, 0x01000c87 ] }; + key { [], [ 0x01000cc1, 0x01000c89 ] }; + key { [], [ 0x01000caa, 0x01000cab ] }; + key { [], [ 0x01000cb0, 0x01000cb1 ] }; + key { [], [ 0x01000c95, 0x01000c96 ] }; + key { [], [ 0x01000ca4, 0x01000ca5 ] }; + key { [], [ 0x01000c9a, 0x01000c9b ] }; + key { [], [ 0x01000c9f, 0x01000ca0 ] }; + + key { [], [ 0x01000cc6, 0x01000c8e ] }; + key { [], [ 0x01000c82, 0x01000c81 ] }; + key { [], [ 0x01000cae, 0x01000ca3 ] }; + key { [], [ 0x01000ca8, 0x01000ca9 ] }; + key { [], [ 0x01000cb5, 0x01000cb4 ] }; + key { [], [ 0x01000cb2, 0x01000cb3 ] }; + key { [], [ 0x01000cb8, 0x01000cb6 ] }; + key { [], [ comma , 0x01000cb7 ] }; + key { [], [ period , 0x01000ce4 ] }; + key { [], [ 0x01000caf, 0x01000040 ] }; + key { [], [ 0x01000cc9, 0x01000c91 ] }; + key { + symbols[Group1] = [ Mode_switch , Multi_key ], + virtualMods = AltGr + }; + + modifier_map Shift { Shift_L }; + modifier_map Lock { Caps_Lock }; + modifier_map Control{ Control_L }; + modifier_map Mod3 { Mode_switch }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/keypad /opt/SUNWut/lib/xkb/symbols/keypad --- /opt/SUNWut.orig/lib/xkb/symbols/keypad 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/keypad 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,90 @@ +// $XdotOrg +// $XKeyboardConfig: xkbdesc/symbols/keypad,v 1.2 2004/09/14 19:14:36 svu Exp $ +// $Xorg: keypad,v 1.3 2000/08/17 19:54:43 cpqbld Exp $ + +partial hidden keypad_keys +xkb_symbols "overlay" { + include "keypad(overlay1)" +}; + +partial hidden keypad_keys +xkb_symbols "overlay1" { + + // Begin "Keypad" section + + key { [ KP_Home ], overlay1= }; + key { [ KP_Up ], overlay1= }; + key { [ KP_Prior ], overlay1= }; + + key { [ KP_Left ], overlay1= }; + key { [ KP_Begin ], overlay1= }; + key { [ KP_Right ], overlay1= }; + + key { [ KP_End ], overlay1= }; + key { [ KP_Down ], overlay1= }; + key { [ KP_Next ], overlay1= }; + + key { [ KP_Insert ], overlay1= }; + key { [ KP_Delete ], overlay1= }; + + key { [ KP_7 ] }; + key { [ KP_8 ] }; + key { [ KP_9 ] }; + + key { [ KP_4 ] }; + key { [ KP_5 ] }; + key { [ KP_6 ] }; + + key { [ KP_1 ] }; + key { [ KP_2 ] }; + key { [ KP_3 ] }; + + key { [ KP_0 ] }; + key { [ KP_Decimal ] }; + + // End "Keypad" section +}; + +partial hidden keypad_keys +xkb_symbols "overlay2" { + + // Begin "Keypad" section + + key { [ KP_Home ], overlay2= }; + key { [ KP_Up ], overlay2= }; + key { [ KP_Prior ], overlay2= }; + + key { [ KP_Left ], overlay2= }; + key { [ KP_Begin ], overlay2= }; + key { [ KP_Right ], overlay2= }; + + key { [ KP_End ], overlay2= }; + key { [ KP_Down ], overlay2= }; + key { [ KP_Next ], overlay2= }; + + key { [ KP_Insert ], overlay2= }; + key { [ KP_Delete ], overlay2= }; + + key { [ KP_7 ] }; + key { [ KP_8 ] }; + key { [ KP_9 ] }; + + key { [ KP_4 ] }; + key { [ KP_5 ] }; + key { [ KP_6 ] }; + + key { [ KP_1 ] }; + key { [ KP_2 ] }; + key { [ KP_3 ] }; + + key { [ KP_0 ] }; + key { [ KP_Decimal ] }; + + // End "Keypad" section +}; + +// Some national standards use comma on the keypad instead of decimal dot +partial keypad_keys +xkb_symbols "comma" { + key { [ KP_Delete, KP_Separator ] }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/la /opt/SUNWut/lib/xkb/symbols/la --- /opt/SUNWut.orig/lib/xkb/symbols/la 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/la 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,85 @@ +// $XConsortium: es /main/3 1996/08/31 12:19:38 kaleb $ +// $XFree86: xc/programs/xkbcomp/symbols/la,v 1.1 2001/11/21 22:28:52 dawes Exp $ +// Modified for a real Latin American Keyboard by Fabian Mandelbaum +partial default alphanumeric_keys +xkb_symbols "basic" { + + // Describes the differences between a very simple en_US + // keyboard and a very simple Latin American keybaord + + name[Group1]= "Latin American"; + + key { [ bar, degree ], + [ notsign, notsign ] }; + key { [ less, greater ], + [ bar, brokenbar ] }; + key { [ 1, exclam ], + [ bar, exclamdown ] }; + key { [ 2, quotedbl ], + [ at, oneeighth ] }; + key { [ 3, numbersign ], + [ periodcentered, sterling ] }; + key { [ 4, dollar ], + [ asciitilde, dollar ] }; + key { [ 6, ampersand ], + [ notsign, fiveeighths ] }; + key { [ 7, slash ] }; + key { [ 8, parenleft ] }; + key { [ comma, semicolon ] }; + key { [ 0, equal ] }; + key { [ 9, parenright ] }; + key { [ period, colon ] }; + key { [ minus, underscore ] }; + key { [ ntilde, Ntilde ], + [ asciitilde,dead_doubleacute ] }; + key { [ apostrophe, question ] }; + key { [ braceleft, bracketleft ], + [ dead_circumflex, braceleft ] }; + key { [ braceright, bracketright ], + [ dead_grave, braceright ] }; + key { [ dead_acute, dead_diaeresis ] }; + key { [ questiondown, exclamdown ] }; + key { [ plus, asterisk ], + [ asciitilde, dead_macron ] }; + key { [ e, E ], + [ EuroSign, cent ] }; + + // End alphanumeric section + + // Begin modifier mappings + modifier_map Shift { Shift_L }; + modifier_map Lock { Caps_Lock }; + modifier_map Control{ Control_L }; + modifier_map Mod3 { Mode_switch }; +}; + +partial alphanumeric_keys +xkb_symbols "Sundeadkeys" { + include "la(basic)" + + key { [ SunFA_Acute, SunFA_Diaeresis ], + [ braceleft, braceleft ] }; + key { [ SunFA_Grave, SunFA_Circum ], + [ bracketleft, dead_abovering ] }; +}; + +partial alphanumeric_keys +xkb_symbols "sundeadkeys" { + include "la(Sundeadkeys)" +}; + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + include "la(basic)" + + key { [ ntilde, Ntilde ], + [ asciitilde, doubleacute ] }; + key { [ acute, diaeresis ], + [ braceleft, braceleft ] }; + key { [ ccedilla, Ccedilla ], + [ braceright, breve ] }; + key { [ grave, asciicircum ], + [ bracketleft, degree ] }; + key { [ plus, asterisk ], + [ bracketright, macron ] }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/level3 /opt/SUNWut/lib/xkb/symbols/level3 --- /opt/SUNWut.orig/lib/xkb/symbols/level3 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/level3 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,102 @@ +// $XdotOrg +// $XKeyboardConfig: xkbdesc/symbols/level3,v 1.6 2004/10/09 17:40:26 svu Exp $ + +// these variants assign various XKB keycodes to ISO_Level3_Shift so that +// the third shift level can be reached +// +// $XFree86: xc/programs/xkbcomp/symbols/level3,v 1.7 2003/09/08 14:25:32 eich Exp $ +// + +// the default behavior is for the right Alt key (AltGr) to generate the +// third engraved symbol +default partial modifier_keys +xkb_symbols "ralt_switch" { + key { + type[Group1]="ONE_LEVEL", + symbols[Group1] = [ ISO_Level3_Shift ] + }; + modifier_map Mod5 { ISO_Level3_Shift }; +}; + +partial modifier_keys +xkb_symbols "ralt_switch_multikey" { + key { + type[Group1]="TWO_LEVEL", + symbols[Group1] = [ ISO_Level3_Shift, Multi_key ] + }; +}; + +// using the level(alt_switch) map, either Alt key temporarily chooses +// the third shift level. (Mostly be used to imitate Mac OS functionality.) +partial modifier_keys +xkb_symbols "alt_switch" { + include "level3(lalt_switch)" + include "level3(ralt_switch)" +}; + +partial modifier_keys +xkb_symbols "lalt_switch" { + key { + type[Group1]="ONE_LEVEL", + symbols[Group1] = [ ISO_Level3_Shift ] + }; + modifier_map Mod5 { ISO_Level3_Shift }; +}; + +// using the level(switch) map, the right Control key temporarily +// chooses the third shift level (until it is released). +partial modifier_keys +xkb_symbols "switch" { + key { + type[Group1]="ONE_LEVEL", + symbols[Group1] = [ ISO_Level3_Shift ] + }; + modifier_map Mod5 { ISO_Level3_Shift }; +}; + +// using the level(menu_switch) map, the Menu key temporarily +// chooses the third shift level (until it is released). +partial modifier_keys +xkb_symbols "menu_switch" { + key { + type[Group1]="ONE_LEVEL", + symbols[Group1] = [ ISO_Level3_Shift ] + }; + modifier_map Mod5 { ISO_Level3_Shift }; +}; + +// using the level(win_switch) map, the either Windows' logo key +// temporarily chooses the third shift level. If you use this map, +// you should define your keyboard as pc101 or pc102 instead of pc104 +// or pc105. +partial modifier_keys +xkb_symbols "win_switch" { + include "level3(lwin_switch)" + include "level3(rwin_switch)" +}; + +// using the level(lwin_switch) map, the left Windows' logo key +// temporarily chooses the third shift level. If you use this map, +// you should define your keyboard as pc101 or pc102 instead of pc104 +// or pc105. +partial modifier_keys +xkb_symbols "lwin_switch" { + key { + type[Group1]="ONE_LEVEL", + symbols[Group1] = [ ISO_Level3_Shift ] + }; + modifier_map Mod5 { ISO_Level3_Shift }; +}; + +// using the level(rwin_switch) map, the right Windows' logo key +// temporarily chooses the third shift level. If you use this map, +// you should define your keyboard as pc101 or pc102 instead of pc104 +// or pc105. +partial modifier_keys +xkb_symbols "rwin_switch" { + key { + type[Group1]="ONE_LEVEL", + symbols[Group1] = [ ISO_Level3_Shift ] + }; + modifier_map Mod5 { ISO_Level3_Shift }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/lo /opt/SUNWut/lib/xkb/symbols/lo --- /opt/SUNWut.orig/lib/xkb/symbols/lo 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/lo 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,80 @@ +// $XConsortium: lo 2002/11/28 $ +// +// $XFree86$ +// +// Lao keymap, by Anousak Souphavanh +// +// +// + +partial default alphanumeric_keys +xkb_symbols "basic" { + + // Describes the differences between a very simple US/ASCII + // keyboard and a Lao keyboard + // This keymap uses the Lao keyboard standard [kind of] widely used inLaos + + name[Group2]= "Lao"; + + // Alphanumeric section + key { [], [ 0x100200D ]}; + key { [], [ 0x1000ea2, 0x1000ed1 ]}; + key { [], [ 0x1000ea2, 0x1000ed1 ]}; + key { [], [ 0x1000e9f, 0x1000ed2 ]}; + key { [], [ 0x1000ec2, 0x1000ed3 ]}; + key { [], [ 0x1000e96, 0x1000ed4 ]}; + key { [], [ 0x1000eb8, 0x1000ecc ]}; + key { [], [ 0x1000eb9, 0x1000ebc ]}; + key { [], [ 0x1000e84, 0x1000ed5 ]}; + key { [], [ 0x1000e95, 0x1000ed6 ]}; + key { [], [ 0x1000e88, 0x1000ed7 ]}; + key { [], [ 0x1000e82, 0x1000ed8 ]}; + key { [], [ 0x1000e8a, 0x1000ed9 ]}; + key { [], [ 0x1000ecd ]}; + + key { [], [ 0x1000ebb ]}; + key { [], [ 0x1000ec4, 0x1000ed0 ]}; + key { [], [ 0x1000eb3 ]}; + key { [], [ 0x1000e9e, underscore ]}; + key { [], [ 0x1000eb0, plus ]}; + key { [], [ 0x1000eb4 ]}; + key { [], [ 0x1000eb5 ]}; + key { [], [ 0x1000ea3, 0x1000eae ]}; + key { [], [ 0x1000e99 ]}; + key { [], [ 0x1000e8d, 0x1000ebd ]}; + key { [], [ 0x1000e9a, minus ]}; + key { [], [ 0x1000ea5, braceright ]}; + key { [], [ 0x1000edc, 0x1000edd ]}; + + key { [], [ 0x1000eb1 ]}; + key { [], [ 0x1000eab, semicolon ]}; + key { [], [ 0x1000e81, period ]}; + key { [], [ 0x1000e94, comma ]}; + key { [], [ 0x1000ec0, colon ]}; + key { [], [ 0x1000ec9, 0x1000eca ]}; + key { [], [ 0x1000ec8, 0x1000ecb ]}; + key { [], [ 0x1000eb2, exclam ]}; + key { [], [ 0x1000eaa, question ]}; + key { [], [ 0x1000ea7, percent ]}; + key { [], [ 0x1000e87, equal ]}; + + key { [], [ 0x1000e9c, 0x10020ad ]}; + key { [], [ 0x1000e9b, parenleft ]}; + key { [], [ 0x1000ec1, 0x1000eaf ]}; + key { [], [ 0x1000ead ]}; + key { [], [ 0x1000eb6 ]}; + key { [], [ 0x1000eb7 ]}; + key { [], [ 0x1000e97, 0x1000ec6 ]}; + key { [], [ 0x1000ea1, quoteleft ]}; + key { [], [ 0x1000ec3, dollar ]}; + key { [], [ 0x1000e9d, parenright ]}; + +override key { + type="PC_SYSRQ", + [ Shift_L, ISO_First_Group ] + }; +override key { + type="PC_SYSRQ", + [ Shift_R, ISO_Last_Group ] + }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/lock /opt/SUNWut/lib/xkb/symbols/lock --- /opt/SUNWut.orig/lib/xkb/symbols/lock 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/lock 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,22 @@ +// $Xorg: lock,v 1.3 2000/08/17 19:54:43 cpqbld Exp $ + + + + +// $XFree86: xc/programs/xkbcomp/symbols/lock,v 3.3 2000/08/03 12:24:03 dawes Exp $ + +partial hidden modifier_keys +xkb_symbols "shift" { + key { [ Shift_Lock ] }; + modifier_map Shift { Shift_Lock }; +}; +partial hidden modifier_keys +xkb_symbols "caps" { + key { [ Caps_Lock ] }; + modifier_map Lock { Caps_Lock }; +}; +partial hidden modifier_keys +xkb_symbols "group" { + key { [ ISO_Next_Group ] }; +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/lt /opt/SUNWut/lib/xkb/symbols/lt --- /opt/SUNWut.orig/lib/xkb/symbols/lt 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/lt 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,140 @@ +// $XFree86$ +// Lithuanian keyboard map by Ričardas Čepas + +// Describes popular Lithuanian keymap 'Baltic' aka querty/numeric +// Don't rename this file because it includes 'lt' +// Extensions: „ “ instead of 9 0 in Lithuanian mode, endash/Euro on 102nd key +// Usage: setxkbmap -option grp:shift_toggle 'lt' +// # +lt(left_switch) turns key between left ctrl and shift on "German" keyboards into AltGr +// Option "XkbModel" "pc105" +// Option "XkbLayout" "lt+lt(left_switch)" +// # Double shift toggles between numbers and Lithuanian letters, you may choose other keys +// Option "XkbOptions" "grp:shift_toggle" + +partial default alphanumeric_keys modifier_keys +xkb_symbols "basic" { + + name[Group1]= "US/ASCII"; + name[Group2]= "Lithuanian"; + include "lt(us_group2)" + + key { [ 1, exclam ], + [ aogonek, Aogonek ] }; + key { [ 2, at ], + [ ccaron, Ccaron ] }; + key { [ 3, numbersign ], + [ eogonek, Eogonek ] }; + key { [ 4, dollar ], + [ eabovedot, Eabovedot ] }; + key { [ 5, percent ], + [ iogonek, Iogonek ] }; + key { [ 6, asciicircum ], + [ scaron, Scaron ] }; + key { [ 7, ampersand ], + [ uogonek, Uogonek ] }; + key { [ 8, asterisk ], + [ umacron, Umacron ] }; + key { [ 9, parenleft ], + [ doublelowquotemark, parenleft ] }; + key { [ 0, parenright ], +// this is actually right quote for Lithuanian + [ leftdoublequotemark, parenright ] }; + + key { [ equal, plus ], + [ zcaron, Zcaron ] }; + key { [ endash, EuroSign ], + [ endash, EuroSign ] }; + + // End alphanumeric section + + // Begin modifier mappings + + modifier_map Shift { Shift_L }; + modifier_map Lock { Caps_Lock, ISO_Lock }; + modifier_map Control{ Control_L }; + modifier_map Mod3 { Mode_switch }; +}; + +partial alphanumeric_keys +xkb_symbols "us_group2" { + + // Keyboard must work as usual when "Lithuanian" group is locked. + key { [], [ quoteleft, asciitilde ] }; + key { [], [ 1, exclam ] }; + key { [], [ 2, at ] }; + key { [], [ 3, numbersign ] }; + key { [], [ 4, dollar ] }; + key { [], [ 5, percent ] }; + key { [], [ 6, asciicircum ] }; + key { [], [ 7, ampersand ] }; + key { [], [ 8, asterisk ] }; + key { [], [ 9, parenleft ] }; + key { [], [ 0, parenright ] }; + key { [], [ minus, underscore ] }; + key { [], [ equal, plus ] }; + + key { [], [ q, Q ] }; + key { [], [ w, W ] }; + key { [], [ e, E ] }; + key { [], [ r, R ] }; + key { [], [ t, T ] }; + key { [], [ y, Y ] }; + key { [], [ u, U ] }; + key { [], [ i, I ] }; + key { [], [ o, O ] }; + key { [], [ p, P ] }; + key { [], [ bracketleft, braceleft ] }; + key { [], [ bracketright, braceright ] }; + + key { [], [ a, A ] }; + key { [], [ s, S ] }; + key { [], [ d, D ] }; + key { [], [ f, F ] }; + key { [], [ g, G ] }; + key { [], [ h, H ] }; + key { [], [ j, J ] }; + key { [], [ k, K ] }; + key { [], [ l, L ] }; + key { [], [ semicolon, colon ] }; + key { [], [ quoteright, quotedbl ] }; + + key { [], [ z, Z ] }; + key { [], [ x, X ] }; + key { [], [ c, C ] }; + key { [], [ v, V ] }; + key { [], [ b, B ] }; + key { [], [ n, N ] }; + key { [], [ m, M ] }; + key { [], [ comma, less ] }; + key { [], [ period, greater ] }; + key { [], [ slash, question ] }; + key { [], [ backslash, bar ] }; + +}; + + + +partial alphanumeric_keys +xkb_symbols "Sundeadkeys" { + include "lt(basic)" // for consistent naming +}; + +partial alphanumeric_keys +xkb_symbols "sundeadkeys" { + include "lt(Sundeadkeys)" // for consistent naming +}; + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + include "lt(basic)" // for consistent naming +}; + +// definition for the extra key on 102-key keyboards between left Control and Alt +// in case you want use it as AltGr +xkb_symbols "left_switch" { + key { [ Mode_switch, Multi_key ], + [ Mode_switch, Multi_key ] }; + // Begin modifier mappings + modifier_map Mod3 { Mode_switch }; +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/lt_a /opt/SUNWut/lib/xkb/symbols/lt_a --- /opt/SUNWut.orig/lib/xkb/symbols/lt_a 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/lt_a 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,101 @@ +// $XConsortium: lt /main/3 1997/12/18 12:40:12 rch $ + +partial alphanumeric_keys modifier_keys +xkb_symbols "basic" { + + // Describes the differences between a very simple en_US + // keyboard and a very simple Lithuanian "azerty" keyboard + + name[Group1]= "Lithuanian"; + + key {[], [ grave, asciitilde ]}; + key {[ exclam, 1 ]}; + key {[ quotedbl, 2 ], + [ at ]}; + key {[ slash, 3 ], + [ numbersign ]}; + key {[ semicolon, 4 ], + [ dollar ]}; + key {[ colon, 5 ], + [ percent ]}; + key {[ comma, 6 ], + [ asciicircum ]}; + key {[ period, 7 ], + [ ampersand ]}; + key {[ question, 8 ], + [ asterisk ]}; + key {[ parenleft, 9 ]}; + key {[ parenright, 0 ]}; + key {[ underscore, minus ], + [ minus, underscore ]}; + key {[ plus, equal ], + [ equal, plus ]}; + key {[ Aogonek, aogonek ], + [ q, Q ]}; + key {[ zcaron, Zcaron ], + [ w, W ]}; + key {[ iogonek, Iogonek ], + [ bracketleft, braceleft ]}; + key {[ leftdoublequotemark, doublelowquotemark ], + [ bracketright, braceright ]}; + key {[ uogonek, Uogonek ], + [ semicolon, colon ]}; + key {[ eabovedot, Eabovedot ], + [ apostrophe, quotedbl ]}; + key {[ umacron, Umacron ], + [ x, X ]}; + key {[ ccaron, Ccaron ], + [ comma, less ]}; + key {[ scaron, Scaron ], + [ period, greater ]}; + key {[ eogonek, Eogonek ], + [ slash, question ]}; + + // End alphanumeric section + + // Begin modifier mappings + + modifier_map Shift { Shift_L }; + modifier_map Lock { Caps_Lock, ISO_Lock }; + modifier_map Control{ Control_L }; + modifier_map Mod3 { Mode_switch }; +}; + +xkb_symbols "generic101" { + include "lt(basic)" +}; + +xkb_symbols "pc101" { + include "lt(generic101)" +}; + +default +xkb_symbols "pc102" { + include "lt(pc101)" + include "lt(left_switch)" +}; + +partial alphanumeric_keys +xkb_symbols "Sundeadkeys" { + include "lt(basic)" // for consistent naming +}; + +partial alphanumeric_keys +xkb_symbols "sundeadkeys" { + include "lt(Sundeadkeys)" // for consistent naming +}; + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + include "lt(basic)" // for consistent naming +}; + +// definition for the extra key on 102-key keyboards +// between left Control and Alt +xkb_symbols "left_switch" { + key { [ Mode_switch, Multi_key ], + [ Mode_switch, Multi_key ] }; + // Begin modifier mappings + modifier_map Mod3 { Mode_switch }; +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/lt_p /opt/SUNWut/lib/xkb/symbols/lt_p --- /opt/SUNWut.orig/lib/xkb/symbols/lt_p 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/lt_p 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,75 @@ +// $XConsortium: lt_p /main/3 1997/12/18 12:40:12 rch $ +// +// $XFree86: xc/programs/xkbcomp/symbols/lt_p,v 1.2 2000/10/28 00:34:07 dawes Exp $ + +partial default alphanumeric_keys modifier_keys +xkb_symbols "basic" { + + // Describes the differences between a very simple en_US + // keyboard and a very simple Lithuanian "programmer's" keyboard + // (qwerty layout with Lithuanian letters on the closer ascii ones) + // Don't rename this file because it includes 'lt_p' + // Extentions: less/Euro/endash on 102nd key, AltGr+Space is nobreakspace + // Usage: setxkbmap lt_p + // Option "XkbModel" "pc105" + // Option "XkbLayout" "lt_p" + + name[Group1]= "US/ASCII"; + name[Group2]= "Lithuanian"; + + key { [ Return, ISO_Next_Group ]}; + key { [ q, Q ], + [ umacron, Umacron ]}; + key { [ w, W ], + [ eabovedot, Eabovedot ]}; + key { [ e, E ], + [ eogonek, Eogonek ]}; + key { [ u, U ], + [ uogonek, Uogonek ]}; + key { [ i, I ], + [ iogonek, Iogonek ]}; + key { [ a, A ], + [ aogonek, Aogonek ]}; + key { [ s, S ], + [ scaron, Scaron ]}; + key { [ quoteright, quotedbl ], +// this is actually right quote for Lithuanian + [ leftdoublequotemark, doublelowquotemark]}; + key { [ z, Z ], + [ zcaron, Zcaron ]}; + key { [ c, C ], + [ ccaron, Ccaron ]}; + key { [ space, space ], + [ nobreakspace, nobreakspace ]}; + + key { [ less, EuroSign ], + [ endash ]}; + + // End alphanumeric section + + // Begin modifier mappings + + modifier_map Shift { Shift_L }; + modifier_map Lock { Caps_Lock, ISO_Lock }; + modifier_map Control{ Control_L }; + modifier_map Mod3 { Mode_switch }; +}; + + + +partial alphanumeric_keys +xkb_symbols "Sundeadkeys" { + include "lt_p(basic)" // for consistent naming +}; + +partial alphanumeric_keys +xkb_symbols "sundeadkeys" { + include "lt_p(Sundeadkeys)" // for consistent naming +}; + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + include "lt_p(basic)" // for consistent naming +}; + + diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/lt_std /opt/SUNWut/lib/xkb/symbols/lt_std --- /opt/SUNWut.orig/lib/xkb/symbols/lt_std 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/lt_std 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,107 @@ +// $XFree86$ +// Lithuanian keyboard map by Gediminas Paulauskas +// Minor modification by Ričardas Čepas according to http://sun3.mif.vu.lt/cs/TK4/lithkeyb.html + +// Describes Lithuanian keymap LST 1582:2000 +// Don't rename this file because it includes 'lt_std' +// Extensions: B01 L3 is "<" , B02 L3 is ">" and B03 L3 is endash to make this +// layout usable with pc101 and pc104 keyboards. +// Usage: setxkbmap lt_std +// Option "XkbModel" "pc105" +// Option "XkbLayout" "lt_std" + +partial default alphanumeric_keys +xkb_symbols "basic" { + + name[ Group1]= "Lithuanian"; + + key {[ grave, asciitilde ], + [ acute ]}; + key {[ exclam, 1 ], + [ at ]}; + key {[ minus, 2 ], + [ underscore ]}; + key {[ slash, 3 ], + [ numbersign ]}; + key {[ semicolon, 4 ], + [ dollar ]}; + key {[ colon, 5 ], + [ section ]}; + key {[ comma, 6 ], + [ asciicircum ]}; + key {[ period, 7 ], + [ ampersand ]}; + key {[ equal, 8 ], + [ asterisk ]}; + key {[ parenleft, 9 ], + [ bracketleft ]}; + key {[ parenright, 0 ], + [ bracketright ]}; + key {[ question, plus ], + [ apostrophe ]}; + key {[ x, X ], + [ percent ]}; + key {[ aogonek, Aogonek ] + }; + key {[ zcaron, Zcaron ] + }; + key {[ e, E ], + [ EuroSign ]}; + key {[ iogonek, Iogonek ], + [ braceleft ]}; + key {[ w, W ], + [ braceright ]}; + key {[ scaron, Scaron ] + }; + key {[ uogonek, Uogonek ] + }; + key {[ eabovedot, Eabovedot ], + [ quotedbl ]}; + key {[ z, Z ], + [ less ]}; + key {[ umacron, Umacron ], + [ greater ]}; + key {[ c, C ], + [ endash ]}; + key {[ ccaron, Ccaron ], + [ doublelowquotemark ]}; + key {[ f, F ], +// this is actually right quote for Lithuanian + [ leftdoublequotemark ]}; + key {[ eogonek, Eogonek ], + [ backslash ]}; + key {[ q, Q ], + [ bar ]}; + key {[ space, space ], + [ nobreakspace, nobreakspace ]}; + + key {[ less, greater ], + [ endash ]}; + +// End alphanumeric section + +// Begin modifier mappings + + modifier_map Shift { Shift_L }; + modifier_map Lock { Caps_Lock, ISO_Lock }; + modifier_map Control{ Control_L }; + modifier_map Mod3 { Mode_switch }; +}; + + + +partial alphanumeric_keys +xkb_symbols "Sundeadkeys" { + include "lt_std(basic)" // for consistent naming +}; + +partial alphanumeric_keys +xkb_symbols "sundeadkeys" { + include "lt_std(Sundeadkeys)" // for consistent naming +}; + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + include "lt_std(basic)" // for consistent naming +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/lv /opt/SUNWut/lib/xkb/symbols/lv --- /opt/SUNWut.orig/lib/xkb/symbols/lv 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/lv 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,78 @@ +// Latvian keyboard map by Ilya Ketris +// +// $XFree86: xc/programs/xkbcomp/symbols/lv,v 1.1 2001/05/19 00:35:43 dawes Exp $ + +partial default alphanumeric_keys modifier_keys +xkb_symbols "basic" { + + // Describes the differences between a very simple en_US + // keyboard and a very simple Latvian keyboard + // Extentions: Euro on AltGr+4, nobreakspace on AltGr+Space, + // Rcedilla for diaspora Latvian, Omacron for Latgalian + + name[Group1]= "US/ASCII"; + name[Group2]= "Latvian"; + + key { [ Return, ISO_Next_Group ]}; + + key { [ 4, dollar ], + [ EuroSign, cent ]}; + key { [ e, E ], + [ emacron, Emacron ]}; + key { [ r, R ], + [ rcedilla, Rcedilla ]}; + key { [ u, U ], + [ umacron, Umacron ]}; + key { [ i, I ], + [ imacron, Imacron ]}; + key { [ o, O ], + [ omacron, Omacron ]}; + key { [ a, A ], + [ amacron, Amacron ]}; + key { [ s, S ], + [ scaron, Scaron ]}; + key { [ g, G ], + [ gcedilla, Gcedilla ]}; + key { [ k, K ], + [ kcedilla, Kcedilla ]}; + key { [ l, L ], + [ lcedilla, Lcedilla ]}; + key { [ quoteright, quotedbl ], + [ leftdoublequotemark, doublelowquotemark]}; + key { [ z, Z ], + [ zcaron, Zcaron ]}; + key { [ c, C ], + [ ccaron, Ccaron ]}; + key { [ n, N ], + [ ncedilla, Ncedilla ]}; + key { [ space, space ], + [ nobreakspace, nobreakspace ]}; + + // End alphanumeric section + + // Begin modifier mappings + + modifier_map Shift { Shift_L }; + modifier_map Lock { Caps_Lock, ISO_Lock }; + modifier_map Control{ Control_L }; + modifier_map Mod3 { Mode_switch }; +}; + + + +partial alphanumeric_keys +xkb_symbols "Sundeadkeys" { + include "lv(basic)" // for consistent naming +}; + +partial alphanumeric_keys +xkb_symbols "sundeadkeys" { + include "lv(Sundeadkeys)" // for consistent naming +}; + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + include "lv(basic)" // for consistent naming +}; + + diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/macintosh/de /opt/SUNWut/lib/xkb/symbols/macintosh/de --- /opt/SUNWut.orig/lib/xkb/symbols/macintosh/de 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/macintosh/de 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,144 @@ +// $XConsortium: de /main/4 1996/08/31 12:19:20 kaleb $ +// $XFree86: xc/programs/xkbcomp/symbols/de,v 3.7.2.2 1999/07/13 07:09:56 hohndel Exp $ + +// olh@suse.de very close to MacOS map + +default partial alphanumeric_keys +xkb_symbols "basic" { + + // Describes the differences between a very simple US/ASCII + // keyboard and a very simple German keybaord + + // Alphanumeric section + name[Group1]= "German"; + key { [ dead_circumflex, degree ], + [ notsign ] }; + key { [ 1, exclam ], + [ exclamdown, at ] }; + key { [ 2, quotedbl ], + [ twosuperior ] }; + key { [ 3, section ], + [ threesuperior,sterling ] }; + key { [ 4, dollar ], + [ onequarter, currency ] }; + key { [ 5, percent ], + [ bracketleft ] }; + key { [ 6, ampersand ], + [ bracketright ] }; + key { [ 7, slash ], + [ bar, backslash ] }; + key { [ 8, parenleft ], + [ braceleft, asciitilde ] }; + key { [ 9, parenright ], + [braceright ] }; + key { [ 0, equal ], + [ braceright, degree ] }; + key { [ ssharp, question ], + [ backslash, questiondown ] }; + key { [ dead_acute, dead_grave ], + [ dead_cedilla ] }; + + key { [ q, Q ], + [guillemotleft,guillemotright ] }; + key { [ e, E ], + [ EuroSign ] }; + key { [ r, R ], + [ registered ] }; + key { [ t, T ] }; + key { [ z, Z ] }; + key { [ u, U ], + [diaeresis, Aacute ] }; + key { [ i, I ], + [ slash, Ucircumflex ] }; + key { [ o, O ], + [ oslash, Ooblique ] }; + key { [ udiaeresis, Udiaeresis ], + [ periodcentered, degree ] }; + key { [ plus, asterisk ], + [ asciitilde ] }; + key { [ a, A ], + [ aring, Aring ] }; + key { [ f, F ] }; + key { [ g, G ], + [ copyright ] }; + key { [ h, H ], + [ ordfeminine ] }; + key { [ l, L ], + [ at ] }; + key { [ odiaeresis, Odiaeresis ], + [ dead_acute ] }; + key { [ adiaeresis, Adiaeresis ], + [ dead_circumflex ] }; + + key { [ less, greater ], + [ bar ] }; + key { [ y, Y ], + [ guillemotleft,less ] }; + key { [ n, N ], + [asciitilde ] }; + key { [ m, M ], + [ mu ] }; + key { [ comma, semicolon ] }; + key { [ period, colon ], + [ periodcentered, division ] }; + key { [ minus, underscore ] }; + key { [ numbersign, apostrophe ], + [ dead_grave ] }; + + // End alphanumeric section, begin "Keypad" + key { [ KP_Delete, KP_Separator ] }; + // End "Keypad" section + + // begin modifier mappings +// modifier_map Shift { Shift_L }; +// modifier_map Lock { Caps_Lock }; +// modifier_map Control{ Control_L }; +// modifier_map Mod3 { Mode_switch }; +}; + +partial alphanumeric_keys +xkb_symbols "Sundeadkeys" { + // modify the default German layout to use Sun dead keys + include "macintosh/de(basic)" + key { [ SunFA_Circum, degree ], + [ notsign ] }; + key { [ SunFA_Acute, SunFA_Grave ], + [ SunFA_Cedilla ] }; + key { [ udiaeresis, Udiaeresis ], + [ SunFA_Diaeresis ] }; + key { [ plus, asterisk ], + [ SunFA_Tilde, dead_macron ] }; + key { [ odiaeresis, Odiaeresis ], + [ SunFA_Acute ] }; + key { [ adiaeresis, Adiaeresis ], + [ SunFA_Circum ] }; + + key { [ numbersign, acute ], + [ SunFA_Grave ] }; +}; + +partial alphanumeric_keys +xkb_symbols "sundeadkeys" { + include "macintosh/de(Sundeadkeys)" +}; + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + // modify the default German layout to not have any dead keys + include "macintosh/de(basic)" + key { [ asciicircum, degree ], + [ notsign ] }; + key { [ acute, grave ], + [ cedilla ] }; + key { [ udiaeresis, Udiaeresis ], + [ diaeresis ] }; + key { [ plus, asterisk ], + [ asciitilde, macron ] }; + key { [ odiaeresis, Odiaeresis ], + [ acute ] }; + key { [ adiaeresis, Adiaeresis ], + [ asciicircum ] }; + + key { [ numbersign, apostrophe ], + [ grave ] }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/macintosh/de_CH /opt/SUNWut/lib/xkb/symbols/macintosh/de_CH --- /opt/SUNWut.orig/lib/xkb/symbols/macintosh/de_CH 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/macintosh/de_CH 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,150 @@ +// $XFree86$ +// +// 06.07.2000 +// Andreas Tobler a.tobler@schweiz.ch +// modified for Swiss German Apple Extended Keyboard II + +xkb_symbols "extended" { + + + name[Group1]= "Swiss German Apple Extended Keyboard II"; + // Alphanumeric section + key { [ less, greater ], + [ lessthanequal, greaterthanequal ] }; + key { [ section, degree ] }; + key { [ 1, plus ], + [ plusminus, onesuperior ] }; + key { [ 2, quotedbl ], + [ twosuperior, oneeighth ] }; + key { [ 3, asterisk ], + [ numbersign, threesuperior ] }; + key { [ 4, ccedilla ], + [ Ccedilla ] }; + key { [ 5, percent ], + [ bracketleft ] }; + key { [ 6, ampersand ], + [ bracketright ] }; + key { [ 7, slash ], + [ bar, backslash ] }; + key { [ 8, parenleft ], + [ braceleft, Ograve ] }; + key { [ 9, parenright ], + [ braceright, Ocircumflex ] }; + key { [ 0, equal ], + [ notequal, Uacute ] }; + key { [ apostrophe, question ], + [ questiondown ] }; + key { [ asciicircum, grave ], + [ dead_acute,asciitilde ] }; + + + key { [ q, Q ] }; + + key { [ w, W ], + [ Greek_SIGMA, Aacute ] }; + + key { [ e, E ], + [ trademark, Ediaeresis ] }; + + key { [ r, R ], + [ registered, Egrave ] }; + + key { [ t, T ], + [ dagger, Icircumflex ] }; + + key { [ z, Z ], + [ Greek_OMEGA, Iacute ] }; + + key { [ u, U ], + [ degree, Ugrave ] }; + + key { [ i, I ], + [ exclamdown ] }; + + key { [ o, O ], + [ oslash ] }; + + key { [ p, P ], + [ Greek_pi, Greek_PI ] }; + + key { [ udiaeresis, egrave ], + [ section, ydiaeresis ] }; + + + key { [ dead_diaeresis, exclam ], + [ quoteleft, quoteright ] }; + + key { [ dollar, sterling ], + [ paragraph, enfilledcircbullet ] }; + + + key { [ a, A ], + [ aring, Aring ] }; + + key { [ s, S ], + [ ssharp ] }; + + key { [ d, D ], + [ Greek_delta ] }; + + key { [ f, F ], + [ section, doubledagger ] }; + + key { [ g, G ], + [ at, comma ] }; + + key { [ h, H ], + [ ordfeminine, periodcentered ] }; + + key { [ j, J ], + [ masculine] }; + + key { [ k, K ] }; + + key { [ l, L ], + [ notsign ] }; + + key { [ odiaeresis, eacute ], + [ cent ] }; + + key { [ adiaeresis, agrave ], + [ ae, AE ] }; + + + + key { [ y, Y ], + [ yen, Ydiaeresis ] }; + + key { [ x, X ], + [similarequal, ydiaeresis ] }; + + key { [ c, C ], + [ copyright, diamond ] }; + + key { [ v, V ] }; + + key { [ b, B ], + [ ssharp ] }; + + key { [ n, N ], + [ dead_tilde ] }; + + key { [ m, M ], + [ mu ] }; + + key { [ comma, semicolon ], + [ guillemotleft, guillemotright ] }; + + key { [ period, colon ], + [ Nosymbol, division ] }; + + key { [ minus, underscore ], + [ emdash, endash ] }; + + key { [ space ], + [nobreakspace, nobreakspace ] }; + // End alphanumeric section + + key { [ KP_Separator , KP_Delete ] }; + +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/macintosh/dk /opt/SUNWut/lib/xkb/symbols/macintosh/dk --- /opt/SUNWut.orig/lib/xkb/symbols/macintosh/dk 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/macintosh/dk 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,92 @@ +// $XConsortium: dk /main/3 1996/08/31 12:19:29 kaleb $ +// $XFree86: xc/programs/xkbcomp/symbols/dk,v 3.3.2.1 1999/12/20 12:56:01 hohndel Exp $ +partial alphanumeric_keys +xkb_symbols "basic" { + + // Describes the differences between a very simple en_US + // keyboard and a Danish keyboard with dead key support + // and all of ISO-8859-1 characters available. + + name[Group1]= "Danish"; + + key { [ onehalf, section ], + [ threequarters, paragraph ]}; + key { [ less, greater ], + [ backslash, notsign ]}; + key { [ space, space ], + [ nobreakspace, nobreakspace ]}; + key { [ 1, exclam ], + [ exclamdown, onesuperior ]}; + key { [ 2, quotedbl ], + [ at, twosuperior ]}; + key { [ 3, numbersign ], + [ sterling, threesuperior ]}; + key { [ 4, currency ], + [ dollar, onequarter ]}; + key { [ 5, percent ], + [ NoSymbol, cent ]}; + key { [ 6, ampersand ], + [ yen, NoSymbol ]}; + key { [ 7, slash ], + [ braceleft, division ]}; + key { [ 8, parenleft ], + [ bracketleft, guillemotleft ]}; + key { [ 9, parenright ], + [ bracketright, guillemotright ]}; + key { [ 0, equal ], + [ braceright, degree ]}; + key { [ comma, semicolon ], + [ dead_cedilla, dead_ogonek ]}; + key { [ period, colon ], + [ periodcentered, dead_abovedot ]}; + key { [ c, C ], + [ copyright, NoSymbol ]}; + key { [ minus, underscore ], + [ hyphen, macron ]}; + key { [ a, A ], + [ ordfeminine, masculine ]}; + key { [ d, D ], + [ eth, ETH ]}; + key { [ e, E ], + [ NoSymbol, cent ]}; + key { [ r, R ], + [ registered, NoSymbol ]}; + key { [ t, T ], + [ thorn, THORN ]}; + key { [ i, I ], + [ NoSymbol, NoSymbol ]}; + key { [ o, O ], + [ oe, OE ]}; + key { [ ae, AE ]}; + key { [ plus, question ], + [ plusminus, questiondown ]}; + key { [ oslash, Ooblique ]}; + key { [ apostrophe, asterisk ], + [dead_doubleacute, multiply ]}; + key { [ aring, Aring ]}; + key { [ dead_acute, dead_grave ], + [ bar, brokenbar ]}; + key { [ dead_diaeresis, dead_circumflex ], + [ dead_tilde, dead_caron ]}; + + + // End alphanumeric section + +}; + + +partial default alphanumeric_keys +xkb_symbols "full" { + include "iso9995-3(full)" + include "dk(basic)" +}; + + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + include "macintosh/dk(basic)" + key { [ acute, grave ], + [ bar, ogonek ] }; + key { [ diaeresis, asciicircum ], + [ asciitilde, dead_macron ] }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/macintosh/es /opt/SUNWut/lib/xkb/symbols/macintosh/es --- /opt/SUNWut.orig/lib/xkb/symbols/macintosh/es 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/macintosh/es 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,50 @@ +// $XFree86$ +// + +partial default alphanumeric_keys +xkb_symbols "basic" { + + // Describes the differences between a very simple mac_US + // keyboard and a very simple Spanish keybaord + + name[Group1]= "Spanish"; + + key { [ bracketleft, bracketright ], + [ braceleft, braceright ] }; + key { [ less, greater ], + [ bracketleft, braceleft ] }; + key { [ 1, exclam ] }; + key { [ 2, exclamdown ], + [ at, oneeighth ] }; + key { [ 3, numbersign ], + [ guillemotleft, guillemotright ] }; + key { [ 4, dollar ], + [ yen, Icircumflex ] }; + key { [ 5, percent ] }; + key { [ 6, slash ], + [ backslash, Idiaeresis ] }; + key { [ 7, ampersand ], + [ bar, Iacute ] }; + key { [ 8, asterisk ], + [ degree ] }; + key { [ 9, parenleft ], + [ sterling, Ocircumflex ] }; + key { [ 0, parenright ] }; + key { [ minus, underscore ] }; + key { [ equal, plus ], + [ plusminus ] }; + key { [ dead_grave, degree ] }; + key { [ dead_acute, dead_diaeresis ], + [ bar ] }; + + key { [ comma, questiondown ] }; + key { [ period, question ] }; + key { [ ccedilla, Ccedilla ] }; + key { [ ntilde, Ntilde ], + [ asciitilde,dead_doubleacute ] }; + key { [ semicolon, colon ] }; + key { [ apostrophe, quotedbl ] }; + + // End alphanumeric section + +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/macintosh/fi /opt/SUNWut/lib/xkb/symbols/macintosh/fi --- /opt/SUNWut.orig/lib/xkb/symbols/macintosh/fi 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/macintosh/fi 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,19 @@ +// $XFree86$ +// + +partial default alphanumeric_keys +xkb_symbols "basic" { + + // Describes the differences between a very simple mac_US + // keyboard and a very simple Swedish(Finland) keybaord + + name[Group1]= "Finnish"; + include "macintosh/se(basic)" // for consistent naming + +}; + + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + include "macintosh/se(basic)" // for consistent naming +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/macintosh/fr /opt/SUNWut/lib/xkb/symbols/macintosh/fr --- /opt/SUNWut.orig/lib/xkb/symbols/macintosh/fr 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/macintosh/fr 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,101 @@ +// $XConsortium: macintosh /main/10 1996/01/29 19:54:54 kaleb $ +// $XFree86$ +// + +xkb_symbols "extended" { + + name[Group1]= "FR-1"; + + // Alphanumeric section + key { [ less, greater ] }; + key { [ at, numbersign ], + [ periodcentered ] }; + key { [ ampersand, 1 ], + [ dead_acute, dead_acute] }; + key { [ eacute, 2 ] }; + key { [ quotedbl, 3 ] }; + key { [ quoteright, 4 ], + [ quoteleft ] }; + key { [ parenleft, 5 ], + [ braceleft, bracketleft ] }; + key { [ section, 6 ], + [ paragraph ] }; + key { [ egrave, 7 ], + [ guillemotleft, guillemotright ] }; + key { [ exclam, 8 ], + [ exclamdown, Ucircumflex ] }; + key { [ ccedilla, 9 ], + [ Ccedilla, Aacute ] }; + key { [ agrave, 0 ], + [ oslash, Ooblique ] }; + key { [ parenright, degree ], + [ braceright, bracketright ] }; + key { [ minus, underscore ] }; + + key { [ a, A ], + [ ae, AE ] }; + key { [ z, Z ], + [ Acircumflex, Aring ] }; + key { [ e, E ], + [ ecircumflex, Ecircumflex ] }; + key { [ r, R ], + [ registered, currency ] }; + key { [ t, T ] }; + key { [ y, Y ], + [ Uacute, ydiaeresis ] }; + key { [ u, U ] }; + key { [ i, I ], + [ icircumflex, idiaeresis ] }; + key { [ o, O ] }; + key { [ p, P ] }; + key { [ dead_circumflex, dead_diaeresis ], + [ ocircumflex, Ocircumflex ] }; + key { [ dollar, asterisk ], + [ comma, yen ] }; + key { [ dead_grave, sterling ], + [ at, numbersign ] }; + + key { [ q, Q ] , + [ acircumflex, Acircumflex ] }; + key { [ s, S ], + [ Ograve, S ] }; + key { [ d, D ] }; + key { [ f, F ], + [ f, periodcentered ] }; + key { [ g, G ] }; + key { [ h, H ], + [ Igrave, Icircumflex ] }; + key { [ j, J ], + [ Idiaeresis, Iacute ] }; + key { [ k, K ], + [ Egrave, Ediaeresis ] }; + key { [ l, L ], + [ ssharp, bar ] }; + key { [ m, M ], + [ mu, Oacute ] }; + key { [ ugrave, percent ], + [ Ugrave, ucircumflex ] }; + key { [ Return, Return ], + [ hyphen, hyphen ] }; + + key { [ w, W ] }; + key { [ x, X ] }; + key { [ c, C ], + [ copyright, copyright ] }; + key { [ v, V ] }; + key { [ b, B ] }; + key { [ n, N ], + [ dead_tilde ] }; + key { [ comma, question ], + [ at, questiondown ] }; + key { [ semicolon, period ] }; + key { [ colon, slash ], + [ division, backslash ] }; + key { [ equal, plus ], + [ macron, plusminus ] }; + + // End alphanumeric section + key { [ KP_Separator , KP_Delete ] }; + +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/macintosh/fr_CH /opt/SUNWut/lib/xkb/symbols/macintosh/fr_CH --- /opt/SUNWut.orig/lib/xkb/symbols/macintosh/fr_CH 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/macintosh/fr_CH 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,28 @@ +// $XConsortium: fr_CH /main/3 1996/08/31 12:19:48 kaleb $ +// $XFree86: xc/programs/xkbcomp/symbols/macintosh/fr_CH,v 1.1 2000/09/19 12:46:25 eich Exp $ +partial default alphanumeric_keys +xkb_symbols "basic" { + + // Describes the differences between a very simple US/ASCII + // keyboard and a very simple Swiss/French keybaord + + include "macintosh/de_CH" + name[Group1]= "Swiss French"; + + override key { + [ egrave, udiaeresis ], + [ bracketleft ] + }; + override key { + [ eacute, odiaeresis ] + }; + override key { + [ agrave, adiaeresis ], + [ braceleft ] + }; +}; + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + include "macintosh/fr_CH" // for consistent naming +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/macintosh/gb /opt/SUNWut/lib/xkb/symbols/macintosh/gb --- /opt/SUNWut.orig/lib/xkb/symbols/macintosh/gb 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/macintosh/gb 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,20 @@ +// $XConsortium: gb /main/3 1996/08/31 12:19:51 kaleb $ +// $XFree86: xc/programs/xkbcomp/symbols/gb,v 3.3 1996/12/23 07:13:25 dawes Exp $ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + // Describe the differences between a U.S. Extended Macintosh keyboard + // and a U.K. Extended Macintosh keyboard. + + name[Group1]="Great Britain"; + + key { [ section, plusminus ] }; + key { [], + [ EuroSign ] }; + key { [ 3, sterling ], + [ numbersign ] }; + key { [ quoteleft, asciitilde ] }; + + include "group(switch)" +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/macintosh/it /opt/SUNWut/lib/xkb/symbols/macintosh/it --- /opt/SUNWut.orig/lib/xkb/symbols/macintosh/it 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/macintosh/it 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,93 @@ +// $XFree86$ + +xkb_symbols "extended" { + + name[Group1]= "italian"; + + // Alphanumeric section + key { [ less, greater ] }; + key { [ at, numbersign ], + [ periodcentered ] }; + key { [ ampersand, 1 ], + [guillemotleft,guillemotright ] }; + key { [ quotedbl, 2 ] }; + key { [ apostrophe, 3 ] }; + key { [ parenleft, 4 ], + [ braceleft, bracketleft ] }; + key { [ ccedilla, 5 ], + [ Ccedilla, Iacute ] }; + key { [ egrave, 6 ], + [ paragraph, periodcentered] }; + key { [ parenright, 7 ], + [ braceright, bracketright ] }; + key { [ sterling, 8 ], + [ infinity ] }; + key { [ agrave, 9 ], + [ acute, Ocircumflex ] }; + key { [ eacute, 0 ], + [ grave, Oacute ] }; + key { [ minus, underscore ] }; + key { [ equal, plus ], + [ notequal, plusminus ] }; + + key { [ q, Q ] }; + key { [ z, Z ] }; + key { [ e, E ] }; + key { [ r, R ], + [ registered ] }; + key { [ t, T ] }; + key { [ y, Y ], + [ Uacute, ydiaeresis ] }; + key { [ u, U ] }; + key { [ i, I ], + [ icircumflex, idiaeresis ] }; + key { [ o, O ] }; + key { [ p, P ] }; + key { [ igrave, asciicircum ] }; + key { [ dollar, asterisk ] }; + key { [ section, degree ], + [ at, numbersign ] }; + + key { [ a, A ] , + [ aring, Aring ] }; + key { [ s, S ], + [ ssharp ] }; + key { [ d, D ] }; + key { [ f, F ] }; + key { [ g, G ] }; + key { [ h, H ], + [ Igrave, Icircumflex ] }; + key { [ j, J ], + [ Idiaeresis, Iacute ] }; + key { [ k, K ], + [ Egrave, Ediaeresis ] }; + key { [ l, L ], + [ ssharp, bar ] }; + key { [ m, M ], + [ mu, Oacute ] }; + key { [ ugrave, percent ], + [ ae, AE ] }; + + key { [ w, W ] }; + key { [ x, X ] }; + key { [ c, C ], + [ copyright, copyright ] }; + key { [ v, V ] }; + key { [ b, B ] }; + key { [ n, N ], + [ dead_tilde ] }; + key { [ comma, question ], + [ questiondown ] }; + key { [ semicolon, period ] }; + key { [ colon, slash ], + [ bar, backslash ] }; + key { [ ograve, exclam ], + [ exclamdown ] }; + + // End alphanumeric section + + key { [ KP_Decimal , KP_Delete ] }; + // End "Keypad" section + +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/macintosh/nl /opt/SUNWut/lib/xkb/symbols/macintosh/nl --- /opt/SUNWut.orig/lib/xkb/symbols/macintosh/nl 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/macintosh/nl 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,15 @@ +// $XFree86$ +// + +partial default alphanumeric_keys +xkb_symbols "basic" { + + // Describes the differences between a very simple mac_US + // keyboard and a very simple netherland keybaord + + name[Group1]= "Netherland"; + +// do just nothing + +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/macintosh/no /opt/SUNWut/lib/xkb/symbols/macintosh/no --- /opt/SUNWut.orig/lib/xkb/symbols/macintosh/no 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/macintosh/no 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,58 @@ +// $XConsortium: no /main/3 1996/08/31 12:20:02 kaleb $ +// $XFree86: xc/programs/xkbcomp/symbols/no,v 3.3.2.1 1997/07/26 06:31:01 dawes Exp $ +partial default alphanumeric_keys +xkb_symbols "basic" { + + // Describes the differences between a very simple en_US + // keyboard and a very simple Norwegian keybaord + + name[Group1]= "Norwegian"; + + key { [ bar, section ] }; + key { [ 2, quotedbl ], + [ at, oneeighth ] }; + key { [ 4, currency ], + [ dollar, dollar ] }; + key { [ 3, numbersign ], + [ sterling, sterling ] }; + key { [ 6, ampersand ] }; + key { [ 7, slash ], + [ bar, backslash ] }; + key { [ 8, parenleft ], + [ bracketleft, braceleft ] }; + key { [ 9, parenright ], + [ bracketright, braceright ] }; + key { [ 0, equal ] }; + + key { [ comma, semicolon ] }; + key { [ period, colon ] }; + key { [ minus, underscore ] }; + key { [ oslash, Ooblique ], + [ odiaeresis, Odiaeresis ] }; + key { [ plus, question ] }; + key { [ ae, AE ] }; + key { [ aring, Aring ] }; + key { [ dead_grave, dead_acute ], + [ acute, dead_ogonek ] }; + key { [ diaeresis, asciicircum ], + [ asciitilde, dead_macron ] }; + key { [ at, asterisk ] }; + key { [ less, greater ] }; + + // End alphanumeric section + +}; + + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + + // Modifies the basic Norwegian layout to eliminate dead keys + + include "macintosh/no(basic)" + key { [ grave, acute ], + [ acute, ogonek ] }; + key { [ diaeresis, asciicircum ], + [ asciitilde, macron ] }; + +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/macintosh/pt /opt/SUNWut/lib/xkb/symbols/macintosh/pt --- /opt/SUNWut.orig/lib/xkb/symbols/macintosh/pt 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/macintosh/pt 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,66 @@ +// $XConsortium: pt /main/3 1996/08/31 12:20:08 kaleb $ +// $XFree86: xc/programs/xkbcomp/symbols/pt,v 3.3.2.1 1999/11/18 15:37:37 hohndel Exp $ +// mac version from Ricardo Cabral + +partial default alphanumeric_keys +xkb_symbols "basic" { + + // Describes the differences between a very simple en_US + // keyboard and a very simple Portuguese keybaord + + name[Group1]= "Portuguese"; + + key { [ less, greater ], + [ bar, brokenbar ] }; + key { [ 2, quotedbl ], + [ at, oneeighth ] }; + key { [ 4, dollar ], + [ section, dollar ] }; + key { [ 3, numbersign ], + [ sterling, sterling ] }; + key { [ 6, ampersand ] }; + key { [ 7, slash ] }; + key { [ 8, parenleft ], + [ bracketleft, braceleft ] }; + key { [ 9, parenright ], + [ bracketright, braceright ] }; + key { [ 0, equal ] }; + key { [ apostrophe, question ] }; + key { [ plus, asterisk ], + [ dead_diaeresis ] }; + key { [ comma, semicolon ] }; + key { [ period, colon ] }; + key { [ minus, underscore ] }; + key { [ ccedilla, Ccedilla ] }; + key { [ dead_tilde, dead_circumflex ] }; + key { [ backslash, bar ] }; + key { [ masculine, ordfeminine ] }; + key { [ dead_acute, dead_grave ] }; + // End alphanumeric section + +}; + +partial alphanumeric_keys +xkb_symbols "Sundeadkeys" { + include "macintosh/pt(basic)" // for consistent naming + + key { [ plus, asterisk ], + [ SunFA_Diaeresis, SunFA_Diaeresis ] }; + key { [ SunFA_Tilde, SunFA_Circum ] }; + key { [ SunFA_Acute, SunFA_Grave ] }; +}; + +partial alphanumeric_keys +xkb_symbols "sundeadkeys" { + include "macintosh/pt(Sundeadkeys)" // for consistent naming +}; + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + include "macintosh/pt(basic)" // for consistent naming + + key { [ plus, asterisk ], + [ quotedbl, quotedbl ] }; + key { [ asciitilde, asciicircum ] }; + key { [ acute, grave ] }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/macintosh/se /opt/SUNWut/lib/xkb/symbols/macintosh/se --- /opt/SUNWut.orig/lib/xkb/symbols/macintosh/se 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/macintosh/se 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,56 @@ +// $XConsortium: se /main/3 1996/08/31 12:20:15 kaleb $ +// $XFree86: xc/programs/xkbcomp/symbols/macintosh/se,v 1.1 2000/09/19 12:46:26 eich Exp $ +partial default alphanumeric_keys +xkb_symbols "basic" { + + // Describes the differences between a very simple en_US + // keyboard and a very simple Swedish(Sweden) keybaord + + name[Group1]= "Swedish"; + + key { [ section, degree ] }; + + key { [ 1, exclam ], + [ copyright, exclamdown ] }; + key { [ 2, quotedbl ], + [ at, oneeighth ] }; + key { [ 3, numbersign ], + [ sterling, yen ] }; + key { [ 4, currency ], + [ dollar, cent ] }; + key { [ 6, ampersand ] }; + key { [ 7, slash ], + [ bar, backslash ] }; + key { [ 8, parenleft ], + [ bracketleft, braceleft ] }; + key { [ 9, parenright ], + [ bracketright, braceright ] }; + key { [ comma, semicolon ] }; + key { [ 0, equal ] }; + key { [ period, colon ] }; + key { [ minus, underscore ] }; + key { [ odiaeresis, Odiaeresis ], + [ oslash, Ooblique ] }; + key { [ plus, question ] }; + key { [ adiaeresis, Adiaeresis ], + [ ae, AE ] }; + key { [ aring, Aring ] }; + key { [ acute, grave ] }; + key { [ diaeresis, asciicircum ], + [ asciitilde ] }; + key { [ apostrophe, asterisk ], + [ at ] }; + key { [ less, greater ], + [ bar, brokenbar ] }; + key { [ KP_Delete, KP_Separator ] }; + + + // End alphanumeric section + +}; + + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + include "macintosh/se(basic)" // for consistent naming +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/macintosh/us /opt/SUNWut/lib/xkb/symbols/macintosh/us --- /opt/SUNWut.orig/lib/xkb/symbols/macintosh/us 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/macintosh/us 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,205 @@ +// $XConsortium: macintosh /main/10 1996/01/29 19:54:54 kaleb $ +// $XFree86: xc/programs/xkbcomp/symbols/macintosh/us,v 1.8 2003/08/04 10:32:31 eich Exp $ + +// symbols definition for a Macintosh "Extended" keyboard + +xkb_symbols "extended" { + + name[Group1]= "US/ASCII"; + key { [ Escape ] }; + + // Alphanumeric section + key { [ quoteleft, asciitilde ] }; + key { [ 1, exclam ] }; + key { [ 2, at ] }; + key { [ 3, numbersign ] }; + key { [ 4, dollar ] }; + key { [ 5, percent ] }; + key { [ 6, asciicircum ] }; + key { [ 7, ampersand ] }; + key { [ 8, asterisk ] }; + key { [ 9, parenleft ] }; + key { [ 0, parenright ] }; + key { [ minus, underscore ] }; + key { [ equal, plus ] }; + key { [ BackSpace ] }; + + key { [ Tab, ISO_Left_Tab ] }; + key { [ q, Q ] }; + key { [ w, W ] }; + key { [ e, E ] }; + key { [ r, R ] }; + key { [ t, T ] }; + key { [ y, Y ] }; + key { [ u, U ] }; + key { [ i, I ] }; + key { [ o, O ] }; + key { [ p, P ] }; + key { [ bracketleft, braceleft ] }; + key { [ bracketright, braceright ] }; + key { [ backslash, bar ] }; + + key { [ Caps_Lock ] }; + key { [ a, A ] }; + key { [ s, S ] }; + key { [ d, D ] }; + key { [ f, F ] }; + key { [ g, G ] }; + key { [ h, H ] }; + key { [ j, J ] }; + key { [ k, K ] }; + key { [ l, L ] }; + key { [ semicolon, colon ] }; + key { [ quoteright, quotedbl ] }; + key { [ Return ] }; + + key { [ z, Z ] }; + key { [ x, X ] }; + key { [ c, C ] }; + key { [ v, V ] }; + key { [ b, B ] }; + key { [ n, N ] }; + key { [ m, M ] }; + key { [ comma, less ] }; + key { [ period, greater ] }; + key { [ slash, question ] }; + + key { [ space ] }; + // End alphanumeric section + + // Begin "Function" section + key { [ F1 ] }; + key { [ F2 ] }; + key { [ F3 ] }; + key { [ F4 ] }; + key { [ F5 ] }; + key { [ F6 ] }; + key { [ F7 ] }; + key { [ F8 ] }; + key { [ F9 ] }; + key { [ F10 ] }; + key { [ F11 ] }; + key { [ F12 ] }; + key { [ Print ] }; + key { [ Scroll_Lock ] }; + key { [ Pause ] }; + // End "Function" section + + // Begin "Editing" section + key { [ Insert ] }; + key { [ Home ] }; + key { [ Prior ] }; + key { [ Delete ] }; + key { [ End ] }; + key { [ Next ] }; + + key { [ Up ] }; + key { [ Left ] }; + key { [ Down ] }; + key { [ Right ] }; + // End "Editing" section + + // Begin "Keypad" section + key { [ Num_Lock, Pointer_EnableKeys ] }; + key { [ KP_Equal ] }; + key { [ KP_Divide ] }; + key { [ KP_Multiply ] }; + + key { [ KP_7, KP_Home ] }; + key { [ KP_8, KP_Up ] }; + key { [ KP_9, KP_Prior ] }; + key { [ KP_Subtract ] }; + + key { [ KP_4, KP_Left ] }; + key { [ KP_5, KP_Begin ] }; + key { [ KP_6, KP_Right ] }; + key { [ KP_Add ] }; + + key { [ KP_1, KP_End ] }; + key { [ KP_2, KP_Down ] }; + key { [ KP_3, KP_Next ] }; + key { [ KP_Enter ] }; + + key { [ KP_0, KP_Insert ] }; + key { [ KP_Decimal, KP_Delete ] }; + // End "Keypad" section + + // Begin "Modifier" section + key { [ Shift_L ] }; + key { [ Shift_R ] }; + key { [ Control_L ] }; + key { [ Control_R ] }; + key { [ Alt_L, Meta_L ] }; + key { [ Alt_R, Meta_R ] }; + key { [ Super_L ] }; + key { [ Super_R ] }; + // End "Modifier" section + + // begin modifier mappings + modifier_map Shift { Shift_L , Shift_R }; + modifier_map Lock { Caps_Lock }; + modifier_map Control{ Control_L, Control_R }; + modifier_map Mod1 { Alt_L, Alt_R, Meta_L, Meta_R }; + modifier_map Mod2 { Num_Lock }; + modifier_map Mod4 { Super_L, Super_R }; + modifier_map Mod5 { Scroll_Lock }; + // end modifier mappings + + include "compose(rwin)" + include "apple(extended)" + include "srvr_ctrl(xfree86)" + +// *** FIXME +// key { [ quoteleft, asciitilde ] }; +// key { [ 1, exclam ], +// [exclamdown, slash ] }; +// key { [ 2, at ], +// [ trademark, eth ] }; +// key { [ 3, numbersign ], +// [ sterling ] }; +// key { [ 4, dollar ], +// [ cent ] }; +// key { [ 5, percent ], +// [ infinity ] }; +// key { [ 6, asciicircum ], +// [ section ] }; +// key { [ 7, ampersand ], +// [ paragraph ] }; +// key { [ 8, asterisk ], +// [periodcentered ] }; +// key { [ 9, parenleft ], +// [ordfeminine ] }; +// key { [ equal, plus ], +// [ notequal, plusminus ] }; +// key { [ q, Q ], +// [ oe, OE ] }; +// key { [ r, R ], +// [registered ] }; +// key { [ t, T ], +// [ dagger ] }; +// key { [ backslash, bar ], +// [guillemotleft,guillemotright ] }; +// key { [ a, A ], +// [ aring, Aring ] }; +// key { [ s, S ], +// [ ssharp, Iacute ] }; +// key { [ d, D ], +// eth, Icircumflex ] }; +// key { [ f, F ], +// [ Idiaeresis ] }; +// key { [ g, G ], +// [ copyright ] }; +// key { [ l, L ], +// [ notsign, Ograve ] }; +// key { [ quoteright, quotedbl ], +// [ ae, AE ] }; +// key { [ c, C ], +// [ ccedilla, Ccedilla ] }; +// key { [ n, N ], +// [asciitilde ] }; +// key { [ m, M ], +// [ mu, Acircumflex ] }; +// key { [ Mode_switch, Multi_key ] }; +// modifier_map Mod3 { Mode_switch }; + +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/mk /opt/SUNWut/lib/xkb/symbols/mk --- /opt/SUNWut.orig/lib/xkb/symbols/mk 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/mk 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,130 @@ +// Author: Damjan Georgievski +// Revision: 1.4 +// Quick usage: setxkbmap -layout mk +// +// shift-leftALT and win95 menu key toggles cyrillic/latin +// rightALT and left win95-logo keys are Mode_switch +// right win95-logo key is Multi_key (Compose) +// +// $XFree86$ +// +partial default alphanumeric_keys +xkb_symbols "basic" { + name[Group2]= "Macedonian"; + key { [ ], [ Cyrillic_ze, Cyrillic_ZE ] }; + key { [ ], [ Cyrillic_es, Cyrillic_ES ] }; + key { [ ], [ Cyrillic_a, Cyrillic_A ] }; + key { [ ], [ Cyrillic_lje, Cyrillic_LJE ] }; + key { [ ], [ Cyrillic_nje, Cyrillic_NJE ] }; + key { [ ], [ Cyrillic_tse, Cyrillic_TSE ] }; + key { [ ], [ Cyrillic_dzhe, Cyrillic_DZHE ] }; + key { [ ], [ Cyrillic_de, Cyrillic_DE ] }; + key { [ ], [ Cyrillic_ie, Cyrillic_IE ] }; + key { [ ], [ Cyrillic_ve, Cyrillic_VE ] }; + key { [ ], [ Cyrillic_ef, Cyrillic_EF ] }; + key { [ ], [ Cyrillic_te, Cyrillic_TE ] }; + key { [ ], [ Cyrillic_er, Cyrillic_ER ] }; + key { [ ], [ Cyrillic_en, Cyrillic_EN ] }; + key { [ ], [ Cyrillic_be, Cyrillic_BE ] }; + key { [ ], [ Cyrillic_ha, Cyrillic_HA ] }; + key { [ ], [ Cyrillic_ghe, Cyrillic_GHE ] }; + key { [ ], [ Macedonia_dse, Macedonia_DSE ] }; + key { [ ], [ Cyrillic_em, Cyrillic_EM ] }; + key { [ ], [ Cyrillic_je, Cyrillic_JE ] }; + key { [ ], [ Cyrillic_u, Cyrillic_U ] }; + key { [ ], [ Cyrillic_ka, Cyrillic_KA ] }; + key { [ ], [ Cyrillic_i, Cyrillic_I ] }; + key { [ ], [ Cyrillic_o, Cyrillic_O ] }; + key { [ ], [ Cyrillic_el, Cyrillic_EL ] }; + key { [ ], [ Cyrillic_che, Cyrillic_CHE ] }; + key { [ ], [ Cyrillic_pe, Cyrillic_PE ] }; + key { [ ], [ Macedonia_kje, Macedonia_KJE ] }; + key { [ ], [ Cyrillic_sha, Cyrillic_SHA ] }; + key { [ ], [ Macedonia_gje, Macedonia_GJE ] }; + key { [ ], [ Cyrillic_zhe, Cyrillic_ZHE ] }; + key { [ ], [ equal, plus ] }; + key { [ ], [ minus, underscore ] }; + key { [ ], [ grave, asciitilde ] }; + key { [ ], [ 1, exclam ] }; + key { [ ], [ 2, doublelowquotemark ] }; + key { [ ], [ 3, leftdoublequotemark ] }; + key { [ ], [ 4, dollar ] }; + key { [ ], [ 5, percent ] }; + key { [ ], [ 6, asciicircum ] }; + key { [ ], [ 7, ampersand ] }; + key { [ ], [ 8, asterisk ] }; + key { [ ], [ 9, parenleft ] }; + key { [ ], [ 0, parenright ] }; + key { [ ], [ comma, semicolon ] }; + key { [ ], [ period, colon ] }; + key { [ ], [ slash, question ] }; + +}; + +partial alphanumeric_keys +xkb_symbols "group1" { + name[Group1]= "Macedonian"; + name[Group2]= "US/ASCII"; + key { [ Cyrillic_ze, Cyrillic_ZE ], [ z, Z ] }; + key { [ Cyrillic_es, Cyrillic_ES ], [ s, S ] }; + key { [ Cyrillic_a, Cyrillic_A ], [ a, A ] }; + key { [ Cyrillic_lje, Cyrillic_LJE ], [ q, Q ] }; + key { [ Cyrillic_nje, Cyrillic_NJE ], [ w, W ] }; + key { [ Cyrillic_ie, Cyrillic_IE ], [ e, E ] }; + key { [ Cyrillic_er, Cyrillic_ER ], [ r, R ] }; + key { [ Cyrillic_tse, Cyrillic_TSE ], [ c, C ] }; + key { [Cyrillic_dzhe, Cyrillic_DZHE ], [ x, X ] }; + key { [ Cyrillic_de, Cyrillic_DE ], [ d, D ] }; + key { [ Cyrillic_ve, Cyrillic_VE ], [ v, V ] }; + key { [ Cyrillic_ef, Cyrillic_EF ], [ f, F ] }; + key { [ Cyrillic_te, Cyrillic_TE ], [ t, T ] }; + key { [ Cyrillic_en, Cyrillic_EN ], [ n, N ] }; + key { [ Cyrillic_be, Cyrillic_BE ], [ b, B ] }; + key { [ Cyrillic_ha, Cyrillic_HA ], [ h, H ] }; + key { [ Cyrillic_ghe, Cyrillic_GHE ], [ g, G ] }; + key { [Macedonia_dse, Macedonia_DSE ], [ y, Y ] }; + key { [ Cyrillic_em, Cyrillic_EM ], [ m, M ] }; + key { [ Cyrillic_je, Cyrillic_JE ], [ j, J ] }; + key { [ Cyrillic_u, Cyrillic_U ], [ u, U ] }; + key { [ Cyrillic_ka, Cyrillic_KA ], [ k, K ] }; + key { [ Cyrillic_i, Cyrillic_I ], [ i, I ] }; + key { [ Cyrillic_o, Cyrillic_O ], [ o, O ] }; + key { [ Cyrillic_pe, Cyrillic_PE ], [ p, P ] }; + key { [ Cyrillic_el, Cyrillic_EL ], [ l, L ] }; + + key { [ Cyrillic_che, Cyrillic_CHE ], [ semicolon, colon ] }; + key { [Macedonia_kje, Macedonia_KJE ], [ quoteright, quotedbl ] }; + key { [ Cyrillic_sha, Cyrillic_SHA ], [ bracketleft, braceleft ] }; + key { [Macedonia_gje, Macedonia_GJE ], [bracketright, braceright] }; + key { [ Cyrillic_zhe, Cyrillic_ZHE ], [ backslash, bar ] }; + + key { [ slash, question ], [ slash, question ] }; + key { [ equal, plus ], [ equal, plus ] }; + key { [ minus, underscore ], [ minus, underscore ] }; + key { [ grave, asciitilde ], [ grave, asciitilde ] }; + key { [ 1, exclam ], [ 1, exclam ] }; + key { [ 2, doublelowquotemark ], [ 2, at ] }; + key { [ 3, leftdoublequotemark ], [ 3, numbersign ] }; + key { [ 4, dollar ], [ 4, dollar ] }; + key { [ 5, percent ], [ 5, percent ] }; + key { [ 6,asciicircum ], [ 6,asciicircum ] }; + key { [ 7, ampersand ], [ 7, ampersand ] }; + key { [ 8, asterisk ], [ 8, asterisk ] }; + key { [ 9, parenleft ], [ 9, parenleft ] }; + key { [ 0, parenright ], [ 0, parenright ] }; + key { [ comma, semicolon ], [ comma, less ] }; + key { [ period, colon ], [ period, greater ] }; +}; + +partial alphanumeric_keys +xkb_symbols "pc104" { + include "mk(basic)" + include "mk(win)" +}; + +partial alphanumeric_keys +xkb_symbols "win" { + key { [ ISO_Next_Group ] }; + key { [ Multi_key ] }; + key { [ Mode_switch ] }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/ml /opt/SUNWut/lib/xkb/symbols/ml --- /opt/SUNWut.orig/lib/xkb/symbols/ml 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/ml 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,107 @@ +default partial alphanumeric_keys +xkb_symbols "basic" { + +// Description : A keymap for Malayalam +// Encoding : Unicode (http://www.unicode.org) +// Author : Baiju M +// Date : Sat Aug 17 21:10:48 IST 2002 +// Mapping: +// +// $XFree86$ + + name[Group1] = "US/ASCII"; + name[Group2] = "Malayalam"; + + //From grave to backslash (\) + + key { [],[ 0x01000d4a , 0x01000d12 ] }; + key { [],[1 , exclam ] }; + key { [],[2 , at ] }; + key { [],[3 , numbersign ] }; + key { [],[4 , dollar ] }; + key { [],[5 , percent ] }; + key { [],[6 ,asciicircum ] }; + key { [],[7 , ampersand ] }; + key { [],[8 , 0x01000d7e ] }; + key { [],[9 , parenleft ] }; + key { [],[0 , parenright ] }; + key { [],[ minus , 0x01000d03 ] }; + key { [],[ 0x01000d43 , 0x01000d0b ] }; + key { [],[ 0x01000d7c ] }; + + + // From 'q' to right bracket (]) + + key { [],[ 0x01000d4c , 0x01000d14 ] }; + key { [],[ 0x01000d48 , 0x01000d10 ] }; + key { [],[ 0x01000d3e , 0x01000d06 ] }; + key { [],[ 0x01000d40 , 0x01000d08 ] }; + key { [],[ 0x01000d42 , 0x01000d0a ] }; + key { [],[ 0x01000d2c , 0x01000d2d ] }; + key { [],[ 0x01000d39 , 0x01000d19 ] }; + key { [],[ 0x01000d17 , 0x01000d18 ] }; + key { [],[ 0x01000d26 , 0x01000d27 ] }; + key { [],[ 0x01000d1c , 0x01000d1d ] }; + key { [],[ 0x01000d21 , 0x01000d22 ] }; + key { [],[ 0x0100200d , 0x01000d1e ] }; + + + // From 'a' to apostrophe (') + + key { [],[ 0x01000d4b , 0x01000d13 ] }; + key { [],[ 0x01000d47 , 0x01000d0f ] }; + key { [],[ 0x01000d4d , 0x01000d05 ] }; + key { [],[ 0x01000d3f , 0x01000d07 ] }; + key { [],[ 0x01000d41 , 0x01000d09 ] }; + key { [],[ 0x01000d2a , 0x01000d2b ] }; + key { [],[ 0x01000d30 , 0x01000d31 ] }; + key { [],[ 0x01000d15 , 0x01000d16 ] }; + key { [],[ 0x01000d24 , 0x01000d25 ] }; + key { [],[ 0x01000d1a , 0x01000d1b ] }; + key { [],[ 0x01000d1f , 0x01000d20 ] }; + + // From 'z' to slash (/) + + key { [],[ 0x01000d46 , 0x01000d0e ] }; + key { [],[ 0x01000d02 , 0x01000d7a ] }; + key { [],[ 0x01000d2e , 0x01000d23 ] }; + key { [],[ 0x01000d28 , 0x01000d7b ] }; + key { [],[ 0x01000d35 , 0x01000d34 ] }; + key { [],[ 0x01000d32 , 0x01000d33 ] }; + key { [],[ 0x01000d38 , 0x01000d36 ] }; + key { [],[ comma , 0x01000d37 ] }; + key { [],[ period , 0x01000d7d ] }; + key { [],[ 0x01000d2f , question ] }; + + key { + symbols[Group1] = [ Mode_switch , Multi_key ], + virtualMods = AltGr + }; + + // begin modifier mappings + + modifier_map Shift { Shift_L }; + modifier_map Lock { Caps_Lock }; + modifier_map Control{ Control_L }; + modifier_map Mod3 { Mode_switch }; + +}; + +partial alphanumeric_keys +xkb_symbols "mlplusnum" { + + // Modifies the basic layout to include malayalam numbers + + include "ml(basic)" + + key { [],[ 0x01000d67 , exclam ] }; + key { [],[ 0x01000d68 , at ] }; + key { [],[ 0x01000d69 , numbersign ] }; + key { [],[ 0x01000d6a , dollar ] }; + key { [],[ 0x01000d6b , percent ] }; + key { [],[ 0x01000d6c , asciicircum ] }; + key { [],[ 0x01000d6d , ampersand ] }; + key { [],[ 0x01000d6e , 0x01000d7e ] }; + key { [],[ 0x01000d6f , parenleft ] }; + key { [],[ 0x01000d66 , parenright ] }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/mm /opt/SUNWut/lib/xkb/symbols/mm --- /opt/SUNWut.orig/lib/xkb/symbols/mm 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/mm 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,67 @@ +// $XConsortium: th /main/3 1996/08/31 12:20:18 kaleb $ +// $XFree86: xc/programs/xkbcomp/symbols/th,v 3.1.2.1 1997/07/19 13:28:20 dawes Exp $ +partial default alphanumeric_keys +xkb_symbols "basic" { + name[Group2]= "Burmese"; + key { [], [ ] }; + + // Mainly numbers. + key { [], [ 0x1001041, exclam ] }; + key { [], [ 0x1001042 ] }; + key { [], [ 0x1001043 ] }; + key { [], [ 0x1001044 ] }; + key { [], [ 0x1001045 ] }; + key { [], [ 0x1001046 ] }; + key { [], [ 0x1001047 ] }; + key { [], [ 0x1001048 ] }; + key { [], [ 0x1001049, parenleft ] }; + key { [], [ 0x1001040, parenright ] }; + key { [], [ minus, 0x1001038 ] }; + key { [], [ 0x1001052, 0x1001056 ] }; + +// Mainly long vowels + + key { [], [ 0x100102A, 0x100102A ] }; + key { [], [ 0x1001032, 0x1001032 ] }; + key { [], [ 0x100102C, 0x1001021 ] }; + key { [], [ 0x100102E, 0x1001024 ] }; + key { [], [ 0x1001030, 0x1001026 ] }; + +// Mainly voiced consonants + + key { [], [ 0x1001017, 0x1001018 ] }; + key { [], [ 0x100101F, 0x1001004 ] }; + key { [], [ 0x1001002, 0x1001003 ] }; + key { [], [ 0x1001012, 0x1001013 ] }; + key { [], [ 0x1001007, 0x1001008 ] }; + key { [], [ 0x100100d, 0x100100e ] }; + key { [], [ 0x100100a, 0x1001009 ] }; + +// Mainly short vowels + key { [], [ 0x1001029, 0x1001029 ] }; + key { [], [ 0x1001027, 0x1001027 ] }; + key { [], [ 0x1001039, 0x1001021 ] }; + key { [], [ 0x100102D, 0x1001023 ] }; + key { [], [ 0x100102F, 0x1001025 ] }; + +// Mainly unvoiced consonants + + key { [], [ 0x1001015, 0x1001016 ] }; + key { [], [ 0x100101B, 0x100101B ] }; + key { [], [ 0x1001000, 0x1001001 ] }; + key { [], [ 0x1001010, 0x1001011 ] }; + key { [], [ 0x1001005, 0x1001006 ] }; + key { [], [ 0x100100b, 0x100100c ] }; + key { [], [ 0x100104E, 0x100104F ] }; + + key { [], [ 0x100104C, 0x100104D ] }; + key { [], [ 0x1001037, 0x1001036 ] }; + key { [], [ 0x1001019, 0x100100f ] }; + key { [], [ 0x1001014, 0x1001014 ] }; + key { [], [ 0x1001017, 0x1001017 ] }; + key { [], [ 0x100101C, 0x100101C ] }; + key { [], [ 0x100101E, 0x1001050 ] }; + key { [], [ comma, 0x1001051 ] }; + key { [], [ period, 0x100104A ] }; + key { [], [ slash, 0x100101A ] }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/mn /opt/SUNWut/lib/xkb/symbols/mn --- /opt/SUNWut.orig/lib/xkb/symbols/mn 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/mn 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,253 @@ +// Mongolian standard keyboard +// Author Sanlig Badral +// 2002/12/7 Version 1.0 + +// $XFree86: xc/programs/xkbcomp/symbols/mn,v 1.1 2003/01/04 02:57:14 dawes Exp $ + +partial default alphanumeric_keys +xkb_symbols "basic" { + +// Describes the differences between a very simple en_US keyboard +// and a very simple Mongolian (cyrillic) keyboard + + name[Group1]= "Latin"; + name[Group2]= "Mongolian"; + + key.type = "THREE_LEVEL"; + + key {[ quoteleft, asciitilde, degree ], + [ equal, plus, degree ]}; + key {[ 1, exclam, multiply ], + [ 1, numerosign, multiply ]}; + key {[ 2, at, division ], + [ 2, minus, division ]}; + key {[ 3, numbersign, plusminus ], + [ 3, quotedbl, plusminus ]}; + key {[ 4, dollar, notsign ], + [ 4, 0x010020ae, notsign ]}; + key {[ 5, percent, NoSymbol ], + [ 5, colon, NoSymbol ]}; + key {[ 6, asciicircum, notequal ], + [ 6, period, notequal ]}; + key {[ 7, ampersand, ampersand ], + [ 7, underscore, ampersand ]}; + key {[ 8, asterisk, asterisk ], + [ 8, comma, asterisk ]}; + key {[ 9, parenleft, bracketleft ], + [ 9, percent, bracketleft ]}; + key {[ 0, parenright, bracketright ], + [ 0, question, bracketright ]}; + key {[ minus, underscore, X ], + [ Cyrillic_ie, Cyrillic_IE, X ]}; + key {[ equal, plus, L ], + [ Cyrillic_shcha, Cyrillic_SHCHA, L ]}; + + key {[ q, Q, apostrophe ], + [ Cyrillic_ef, Cyrillic_EF, apostrophe ]}; + key {[ w, W, grave ], + [ Cyrillic_tse, Cyrillic_TSE, grave ]}; + key {[ e, E, EuroSign ], + [ Cyrillic_u, Cyrillic_U, EuroSign ]}; + key {[ r, R, registered ], + [ Cyrillic_zhe, Cyrillic_ZHE, registered ]}; + key {[ t, T, trademark ], + [ Cyrillic_e, Cyrillic_E, trademark ]}; + key {[ y, Y, yen ], + [ Cyrillic_en, Cyrillic_EN, yen ]}; + key {[ u, U, doublelowquotemark ], + [ Cyrillic_ghe, Cyrillic_GHE, doublelowquotemark ]}; + key {[ i, I, leftdoublequotemark ], + [ Cyrillic_sha, Cyrillic_SHA, leftdoublequotemark ]}; + // mongolian (ue) straight u + key {[ o, O, rightdoublequotemark ], + [ 0x010004af, 0x010004ae, rightdoublequotemark ]}; + key {[ p, P, NoSymbol ], + [ Cyrillic_ze, Cyrillic_ZE, NoSymbol ]}; + key {[ bracketleft, braceleft, braceleft ], + [ Cyrillic_ka, Cyrillic_KA, braceleft ]}; + key {[ bracketright, braceright, braceright ], + [ Cyrillic_hardsign, Cyrillic_HARDSIGN, braceright ]}; + + key {[ a, A, mu ], + [ Cyrillic_shorti, Cyrillic_SHORTI, mu ]}; + key {[ s, S, sterling ], + [ Cyrillic_yeru, Cyrillic_YERU, sterling ]}; + key {[ d, D, dollar ], + [ Cyrillic_be, Cyrillic_BE, dollar ]}; + //oe mongolian (oe) barred o + key {[ f, F, cent ], + [ 0x010004e9, 0x010004e8, rightdoublequotemark ]}; + key {[ g, G, Cyrillic_yeru ], + [ Cyrillic_a, Cyrillic_A, Cyrillic_yeru ]}; + key {[ h, H, Cyrillic_YERU ], + [ Cyrillic_ha, Cyrillic_HA, Cyrillic_YERU ]}; + key {[ j, J, Cyrillic_e ], + [ Cyrillic_er, Cyrillic_ER, Cyrillic_e ]}; + key {[ k, K, Cyrillic_E ], + [ Cyrillic_o, Cyrillic_O, Cyrillic_E ]}; + key {[ l, L, numerosign ], + [ Cyrillic_el, Cyrillic_EL, numerosign ]}; + key {[ semicolon, colon, section ], + [ Cyrillic_de, Cyrillic_DE, section ]}; + key {[ quoteright, quotedbl, ellipsis ], + [ Cyrillic_pe, Cyrillic_PE, ellipsis ]}; + key {[ backslash, bar, bar ], + [ exclam, bar, bar ]}; + + key {[ less, greater, NoSymbol ], + [ parenleft, parenright, NoSymbol ]}; + key {[ z, Z, emdash ], + [ Cyrillic_ya, Cyrillic_YA, emdash ]}; + key {[ x, X, endash ], + [ Cyrillic_che, Cyrillic_CHE, endash ]}; + key {[ c, C, copyright ], + [ Cyrillic_io, Cyrillic_IO, copyright ]}; + key {[ v, V, NoSymbol ], + [ Cyrillic_es, Cyrillic_ES, NoSymbol ]}; + key {[ b, B, NoSymbol ], + [ Cyrillic_em, Cyrillic_EM, NoSymbol ]}; + key {[ n, N, less ], + [ Cyrillic_i, Cyrillic_I, less ]}; + key {[ m, M, greater ], + [ Cyrillic_te, Cyrillic_TE, greater ]}; + key {[ comma, less, guillemotleft ], + [ Cyrillic_softsign, Cyrillic_SOFTSIGN, guillemotleft ]}; + key {[ period, greater, guillemotright ], + [ Cyrillic_ve, Cyrillic_VE, guillemotright ]}; + key {[ slash, question, backslash ], + [ Cyrillic_yu, Cyrillic_YU, backslash ]}; + + // End alphanumeric section + + key {[ space, space, nobreakspace ]}; + key { type="TWO_LEVEL",[ Mode_switch, Multi_key ]}; + + // Begin modifier mappings + + modifier_map Shift { Shift_L }; + modifier_map Lock { Caps_Lock, ISO_Lock }; + modifier_map Control{ Control_L }; + modifier_map Mod3 { Mode_switch }; +}; + +partial alphanumeric_keys +xkb_symbols "mn(basic)" { + + // Describes the differences between a very simple en_US keyboard + // and a very simple mongolian keyboard with publishing + // symbols in the third level. + + name[Group1]= "Latin"; + name[Group2]= "Mongolian"; + + key {[ quoteleft, asciitilde ], + [ equal, plus ]}; + key {[ 1, exclam ], + [ 1, numerosign ]}; + key {[ 2, at ], + [ 2, minus ]}; + key {[ 3, numbersign ], + [ 3, quotedbl ]}; + key {[ 4, dollar ], + [ 4, 0x010020ae ]}; + key {[ 5, percent ], + [ 5, colon ]}; + key {[ 6, asciicircum ], + [ 6, period ]}; + key {[ 7, ampersand ], + [ 7, underscore ]}; + key {[ 8, asterisk ], + [ 8, comma ]}; + key {[ 9, parenleft ], + [ 9, percent ]}; + key {[ 0, parenright ], + [ 0, question ]}; + key {[ minus, underscore ], + [ Cyrillic_ie, Cyrillic_IE ]}; + key {[ equal, plus ], + [ Cyrillic_shcha, Cyrillic_SHCHA ]}; + + key {[ q, Q ], + [ Cyrillic_ef, Cyrillic_EF ]}; + key {[ w, W ], + [ Cyrillic_tse, Cyrillic_TSE ]}; + key {[ e, E ], + [ Cyrillic_u, Cyrillic_U ]}; + key {[ r, R ], + [ Cyrillic_zhe, Cyrillic_ZHE ]}; + key {[ t, T ], + [ Cyrillic_e, Cyrillic_E ]}; + key {[ y, Y ], + [ Cyrillic_en, Cyrillic_EN ]}; + key {[ u, U ], + [ Cyrillic_ghe, Cyrillic_GHE ]}; + key {[ i, I ], + [ Cyrillic_sha, Cyrillic_SHA ]}; + // mongolian (ue) straight u + key {[ o, O ], + [ 0x010004af, 0x010004ae ]}; + key {[ p, P ], + [ Cyrillic_ze, Cyrillic_ZE ]}; + key {[ bracketleft, braceleft ], + [ Cyrillic_ka, Cyrillic_KA ]}; + key {[ bracketright, braceright ], + [ Cyrillic_hardsign, Cyrillic_HARDSIGN ]}; + + key {[ a, A ], + [ Cyrillic_shorti, Cyrillic_SHORTI ]}; + key {[ s, S ], + [ Cyrillic_yeru, Cyrillic_YERU ]}; + key {[ d, D ], + [ Cyrillic_be, Cyrillic_BE ]}; + //oe mongolian (oe) barred o + key {[ f, F ], + [ 0x010004e9, 0x010004e8 ]}; + key {[ g, G ], + [ Cyrillic_a, Cyrillic_A ]}; + key {[ h, H ], + [ Cyrillic_ha, Cyrillic_HA ]}; + key {[ j, J ], + [ Cyrillic_er, Cyrillic_ER ]}; + key {[ k, K ], + [ Cyrillic_o, Cyrillic_O ]}; + key {[ l, L ], + [ Cyrillic_el, Cyrillic_EL ]}; + key {[ semicolon, colon ], + [ Cyrillic_de, Cyrillic_DE ]}; + key {[ quoteright, quotedbl ], + [ Cyrillic_pe, Cyrillic_PE ]}; + key {[ backslash, bar ], + [ parenleft, parenright ]}; + + key {[ less, greater ], + [ less, greater ]}; + key {[ z, Z ], + [ Cyrillic_ya, Cyrillic_YA ]}; + key {[ x, X ], + [ Cyrillic_che, Cyrillic_CHE ]}; + key {[ c, C ], + [ Cyrillic_io, Cyrillic_IO ]}; + key {[ v, V ], + [ Cyrillic_es, Cyrillic_ES ]}; + key {[ b, B ], + [ Cyrillic_em, Cyrillic_EM ]}; + key {[ n, N ], + [ Cyrillic_i, Cyrillic_I ]}; + key {[ m, M ], + [ Cyrillic_te, Cyrillic_TE ]}; + key {[ comma, less ], + [ Cyrillic_softsign, Cyrillic_SOFTSIGN ]}; + key {[ period, greater ], + [ Cyrillic_ve, Cyrillic_VE ]}; + key {[ slash, question ], + [ Cyrillic_yu, Cyrillic_YU ]}; + + key {[ Alt_R, Meta_R ]}; + + // Begin modifier mappings + + modifier_map Shift { Shift_L }; + modifier_map Lock { Caps_Lock, ISO_Lock }; + modifier_map Control{ Control_L }; + modifier_map Mod3 { Mode_switch }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/mt /opt/SUNWut/lib/xkb/symbols/mt --- /opt/SUNWut.orig/lib/xkb/symbols/mt 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/mt 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,47 @@ +// Maltese keyboard map (based on MSA Standard DMS100) +// by Ramon Casha (ramon.casha@linux.org.mt) +// +// $XFree86$ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + // Describes the differences between the en_GB + // keyboard and the Maltese keyboard. + + include "gb(basic)" + name[Group1]= "Maltese"; + + // the following four sets are the four additional letters (C. G. H- Z.) + // Group 2 contains the UK equivalents + key { [ cabovedot, Cabovedot ], + [ grave, notsign ] }; + key { [ gabovedot, Gabovedot ], + [ bracketleft, braceleft ] }; + key { [ hstroke, Hstroke ], + [ bracketright, braceright ] }; + key { [ zabovedot, Zabovedot ], + [ backslash, bar ] }; + + // Euro symbol + key { [ 3, EuroSign ], + [ sterling ] }; + // Long accent + key { [], [ dead_circumflex, dead_circumflex ] }; + + // Normal accented vowels + key { [], [ egrave, Egrave ] }; + key { [], [ ugrave, Ugrave ] }; + key { [], [ igrave, Igrave ] }; + key { [], [ ograve, Ograve ] }; + key { [], [ agrave, Agrave ] }; + + // End alphanumeric section + + // begin modifier mappings + + modifier_map Shift { Shift_L }; + modifier_map Lock { Caps_Lock }; + modifier_map Control{ Control_L }; + modifier_map Mod3 { Mode_switch }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/mt_us /opt/SUNWut/lib/xkb/symbols/mt_us --- /opt/SUNWut.orig/lib/xkb/symbols/mt_us 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/mt_us 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,47 @@ +// Maltese keyboard map (based on MSA Standard DMS100, annex A) +// by Ramon Casha (ramon.casha@linux.org.mt) +// +// $XFree86$ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + // Describes the differences between the en_US + // keyboard and the Maltese keyboard. + + include "us(basic)" + name[Group1]= "Maltese (US layout)"; + + // the following four sets are the four additional letters (C. G. H- Z.) + // Group 2 contains the UK equivalents + key { [ cabovedot, Cabovedot ], + [ grave, asciitilde ] }; + key { [ gabovedot, Gabovedot ], + [ bracketleft, braceleft ] }; + key { [ hstroke, Hstroke ], + [ bracketright, braceright ] }; + key { [ zabovedot, Zabovedot ], + [ backslash, bar ] }; + + // Euro symbol + key { [ 3, EuroSign ], + [ numbersign ] }; + // Long accent + key { [], [ dead_circumflex, dead_circumflex ] }; + + // Normal accented vowels + key { [], [ egrave, Egrave ] }; + key { [], [ ugrave, Ugrave ] }; + key { [], [ igrave, Igrave ] }; + key { [], [ ograve, Ograve ] }; + key { [], [ agrave, Agrave ] }; + + // End alphanumeric section + + // begin modifier mappings + + modifier_map Shift { Shift_L }; + modifier_map Lock { Caps_Lock }; + modifier_map Control{ Control_L }; + modifier_map Mod3 { Mode_switch }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/nec/jp /opt/SUNWut/lib/xkb/symbols/nec/jp --- /opt/SUNWut.orig/lib/xkb/symbols/nec/jp 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/nec/jp 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,167 @@ +// $Xorg: jp,v 1.4 2001/02/09 02:05:53 xorgcvs Exp $ +// +//Copyright 1996, 1998 The Open Group +// +//Permission to use, copy, modify, distribute, and sell this software and its +//documentation for any purpose is hereby granted without fee, provided that +//the above copyright notice appear in all copies and that both that +//copyright notice and this permission notice appear in supporting +//documentation. +// +//The above copyright notice and this permission notice shall be +//included in all copies or substantial portions of the Software. +// +//THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +//EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +//MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +//IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +//OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +//ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +//OTHER DEALINGS IN THE SOFTWARE. +// +//Except as contained in this notice, the name of The Open Group shall +//not be used in advertising or otherwise to promote the sale, use or +//other dealings in this Software without prior written authorization +//from The Open Group. +// +// $XFree86: xc/programs/xkbcomp/symbols/nec/jp,v 3.9 2001/01/17 23:46:03 dawes Exp $ +// +// symbols for a NEC PC98 keyboard +default xkb_symbols "pc98" { + + key { [ Escape ] }; + + // Alphanumeric section + key { [ 1, exclam ], [ kana_NU ] }; + key { [ 2, quotedbl ], [ kana_FU ] }; + key { [ 3, numbersign ], [ kana_A, kana_a ] }; + key { [ 4, dollar ], [ kana_U, kana_u ] }; + key { [ 5, percent ], [ kana_E, kana_e ] }; + key { [ 6, ampersand ], [ kana_O, kana_o ] }; + key { [ 7, apostrophe ], [ kana_YA, kana_ya ] }; + key { [ 8, parenleft ], [ kana_YU, kana_yu ] }; + key { [ 9, parenright ], [ kana_YO, kana_yo ] }; + key { [ 0 ], [ kana_WA, kana_WO ] }; + key { [ minus, equal ], [ kana_HO ] }; + key { [ asciicircum, quoteleft ], [ kana_HE ] }; + key { [ backslash, bar ], [ prolongedsound ] }; + key { [ BackSpace ] }; + + key { [ Tab, ISO_Left_Tab ] }; + key { [ q, Q ], [ kana_TA ] }; + key { [ w, W ], [ kana_TE ] }; + key { [ e, E ], [ kana_I, kana_i ] }; + key { [ r, R ], [ kana_SU ] }; + key { [ t, T ], [ kana_KA ] }; + key { [ y, Y ], [ kana_N ] }; + key { [ u, U ], [ kana_NA ] }; + key { [ i, I ], [ kana_NI ] }; + key { [ o, O ], [ kana_RA ] }; + key { [ p, P ], [ kana_SE ] }; + key { [ at, asciitilde ], [ voicedsound ] }; + key { [ bracketleft, braceleft ], [ semivoicedsound, kana_openingbracket ] }; + key { [ Return ] }; + + key { [ Control_L ] }; + key { [ Caps_Lock ] }; + key { [ a, A ], [ kana_CHI ] }; + key { [ s, S ], [ kana_TO ] }; + key { [ d, D ], [ kana_SHI ] }; + key { [ f, F ], [ kana_HA ] }; + key { [ g, G ], [ kana_KI ] }; + key { [ h, H ], [ kana_KU ] }; + key { [ j, J ], [ kana_MA ] }; + key { [ k, K ], [ kana_NO ] }; + key { [ l, L ], [ kana_RI ] }; + key { [ semicolon, plus ], [ kana_RE ] }; + key { [ colon, asterisk ], [ kana_KE ] }; + key { [ bracketright, braceright ], [ kana_MU, kana_closingbracket ] }; + + key { [ Shift_L ] }; + key { [ z, Z ], [ kana_TSU, kana_tsu ] }; + key { [ x, X ], [ kana_SA ] }; + key { [ c, C ], [ kana_SO ] }; + key { [ v, V ], [ kana_HI ] }; + key { [ b, B ], [ kana_KO ] }; + key { [ n, N ], [ kana_MI ] }; + key { [ m, M ], [ kana_MO ] }; + key { [ comma, less ], [ kana_NE, kana_comma ] }; + key { [ period, greater ], [ kana_RU, kana_fullstop ] }; + key { [ slash, question ], [ kana_ME, kana_middledot ] }; + key { [ NoSymbol, underscore ], [ kana_RO ] }; +// key { [ Shift_R ] }; + + key { [ Mode_switch ] }; + key { [ Alt_L ] }; + key { [ Muhenkan ] }; + key { [ space ] }; + key { [ Henkan, Kanji ] }; + + // End alphanumeric section + + // Begin "Function" section + key { [ Break ] }; + key { [ Print ] }; + key { [ F1 ] }; + key { [ F2 ] }; + key { [ F3 ] }; + key { [ F4 ] }; + key { [ F5 ] }; + key { [ F6 ] }; + key { [ F7 ] }; + key { [ F8 ] }; + key { [ F9 ] }; + key { [ F10 ] }; + key { [ F11 ] }; + key { [ F12 ] }; + key { [ F13 ] }; + key { [ F14 ] }; + key { [ F15 ] }; + // End "Function" section + + // Begin "Editing" section + key { [ Insert ] }; + key { [ Delete ] }; + key { [ Prior ] }; + key { [ Next ] }; + key { [ Up ] }; + key { [ Left ] }; + key { [ Right ] }; + key { [ Down ] }; + // End "Editing" section + + // Begin "Keypad" section + key { [ Clear, Home ] }; + key { [ Help ] }; + key { [ KP_Subtract ] }; + key { [ KP_Divide ] }; + + key { [ KP_7 ] }; + key { [ KP_8 ] }; + key { [ KP_9 ] }; + key { [ KP_Multiply ] }; + + key { [ KP_4 ] }; + key { [ KP_5 ] }; + key { [ KP_6 ] }; + key { [ KP_Add ] }; + + key { [ KP_1 ] }; + key { [ KP_2 ] }; + key { [ KP_3 ] }; + key { [ KP_Equal ] }; + + key { [ KP_0 ] }; + key { [ KP_Separator ] }; + key { [ KP_Decimal ] }; +// key { [ KP_Enter ] }; + // End "Keypad" section + + // begin modifier mappings + modifier_map Shift { Shift_L }; + modifier_map Lock { Caps_Lock }; + modifier_map Control{ Control_L }; + modifier_map Mod1 { Alt_L }; + modifier_map Mod2 { Mode_switch }; +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/nl /opt/SUNWut/lib/xkb/symbols/nl --- /opt/SUNWut.orig/lib/xkb/symbols/nl 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/nl 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,98 @@ +// Converted keytable file to xkb/symbols/ file +// with mk_xkb by root@linux.chanae.stben.be Tue Sep 30 00:53:29 MET DST 1997 + +// converted from the nl-latin.map of the Linux kbd package by +// Pablo Saratxaga + +default partial alphanumeric_keys +xkb_symbols "basic" { + + // Describes the differences between a very simple US/ASCII + // keyboard and a very simple Nederland keyboard + + // Alphanumeric section + name[Group1]= "Nederland"; + + key { [ 1, exclam ], + [ onesuperior ] }; + key { [ 2, quotedbl ], + [ twosuperior ] }; + key { [ 3, numbersign ], + [ threesuperior ] }; + key { [ 4, dollar ], + [ onequarter ] }; + key { [ 5, percent ], + [ EuroSign ] }; + key { [ 6, ampersand ], + [ threequarters ] }; + key { [ 7, underscore ], + [ sterling ] }; + key { [ 8, parenleft ], + [ braceleft ] }; + key { [ 9, parenright ], + [ braceright ] }; + key { [ 0, apostrophe ] }; + key { [ slash, question ], + [ backslash ] }; + key { [ degree, dead_tilde ], + [ dead_cedilla ] }; + key { [ e, E ], + [ EuroSign, cent ] }; + key { [ r, R ], + [ paragraph, registered ] }; + key { [ t, T ], + [ thorn, THORN ] }; + key { [ y, Y ], + [ ydiaeresis, yen ] }; + key { [ u, U ], + [ udiaeresis, Udiaeresis ] }; + key { [ i, I ], + [ idiaeresis, Idiaeresis ] }; + key { [ o, O ], + [ ograve, Ograve ] }; + key { [ p, P ], + [ paragraph ] }; + key { [ dead_diaeresis, dead_circumflex ], + [ asciitilde, asciicircum ] }; + key { [ asterisk, bar ] }; + key { [ a, A ], + [ aacute, Aacute ] }; + key { [ s, S ], + [ ssharp ] }; + key { [ d, D ], + [ eth, ETH ] }; + key { [ f, F ], + [ ordfeminine, ordfeminine ] }; + key { [ plus, plusminus ] }; + key { [ apostrophe, grave ], + [ dead_acute, dead_grave ] }; + key { [ at, section ], + [ notsign ] }; + key { [ less, greater ] }; + key { [ z, Z ], + [ guillemotleft ] }; + key { [ x, X ], + [ guillemotright ] }; + key { [ c, C ], + [ cent, copyright ] }; + key { [ n, N ], + [ ntilde, Ntilde ] }; + key { [ m, M ], + [ Greek_mu, masculine ] }; + key { [ comma, semicolon ], + [ cedilla, guillemotleft ] }; + key { [ period, colon ], + [ periodcentered, guillemotright ] }; + key { [ minus, equal ], + [ hyphen ] }; + key { [ bracketright, bracketleft ], + [ bar ] }; + + // End alphanumeric section + + // begin modifier mappings + modifier_map Shift { Shift_L }; + modifier_map Lock { Caps_Lock }; + modifier_map Control{ Control_L }; + modifier_map Mod3 { Mode_switch }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/no /opt/SUNWut/lib/xkb/symbols/no --- /opt/SUNWut.orig/lib/xkb/symbols/no 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/no 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,119 @@ +// $Xorg: no,v 1.3 2000/08/17 19:54:43 cpqbld Exp $ + + + + +// $XFree86: xc/programs/xkbcomp/symbols/no,v 3.9 2001/01/17 23:45:59 dawes Exp $ + +partial alphanumeric_keys + xkb_symbols "basic" { + + // Describes the differences between a very simple en_US + // keyboard and a Norwegian keyboard with dead key support + // and all of ISO-8859-1 characters available. + + name[Group1]= "Norwegian"; + + key { [ bar, section ], + [ brokenbar, paragraph ]}; + key { [ less, greater ], + [ onehalf, threequarters ]}; + key { [ space, space ], + [ nobreakspace, nobreakspace ]}; + key { [ 1, exclam ], + [ exclamdown, onesuperior ]}; + key { [ 2, quotedbl ], + [ at, twosuperior ]}; + key { [ 3, numbersign ], + [ sterling, threesuperior ]}; + key { [ 4, currency ], + [ dollar, onequarter ]}; + key { [ 5, percent ], + [ NoSymbol, cent ]}; + key { [ 6, ampersand ], + [ yen, NoSymbol ]}; + key { [ 7, slash ], + [ braceleft, division ]}; + key { [ 8, parenleft ], + [ bracketleft, guillemotleft ]}; + key { [ 9, parenright ], + [ bracketright, guillemotright ]}; + key { [ 0, equal ], + [ braceright, degree ]}; + key { [ comma, semicolon ], + [ dead_cedilla, dead_ogonek ]}; + key { [ period, colon ], + [ periodcentered, dead_abovedot ]}; + key { [ c, C ], + [ copyright, NoSymbol ]}; + key { [ minus, underscore ], + [ hyphen, macron ]}; + key { [ a, A ], + [ ordfeminine, masculine ]}; + key { [ d, D ], + [ eth, ETH ]}; + key { [ e, E ], + [ EuroSign, cent ]}; + key { [ r, R ], + [ registered, NoSymbol ]}; + key { [ t, T ], + [ thorn, THORN ]}; + key { [ i, I ], + [ NoSymbol, NoSymbol ]}; + key { [ o, O ], + [ oe, OE ]}; + key { [ oslash, Ooblique ]}; + key { [ plus, question ], + [ plusminus, questiondown ]}; + key { [ ae, AE ]}; + key { [ apostrophe, asterisk ], + [dead_doubleacute, multiply ]}; + key { [ aring, Aring ]}; + key { [ backslash, dead_grave ], + [ dead_acute, notsign ]}; + key { [ dead_diaeresis, dead_circumflex ], + [ dead_tilde, dead_caron ]}; + + + // End alphanumeric section, begin "Keypad" + key { [ KP_Delete, KP_Separator ] }; + // End "Keypad" section + + // begin modifier mappings + + modifier_map Shift { Shift_L }; + modifier_map Lock { Caps_Lock }; + modifier_map Control{ Control_L }; + modifier_map Mod3 { Mode_switch }; +}; + +partial alphanumeric_keys +xkb_symbols "Sundeadkeys" { + + // For naming consistency + + include "no(basic)" + +}; + +partial alphanumeric_keys +xkb_symbols "sundeadkeys" { + + // For naming consistency + + include "no(Sundeadkeys)" + +}; + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + + // Modifies the basic Norwegian layout to eliminate dead keys + + include "no(basic)" + key { [ backslash, grave ], + [ acute, ogonek ] }; + key { [ diaeresis, asciicircum ], + [ asciitilde, macron ] }; + +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/ogham /opt/SUNWut/lib/xkb/symbols/ogham --- /opt/SUNWut.orig/lib/xkb/symbols/ogham 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/ogham 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,206 @@ +// $XFree86: xc/programs/xkbcomp/symbols/ogham,v 1.2 2002/12/19 00:49:41 dawes Exp $ +// +// Ogham keyboard map for XFree86 +// +// Seamus O Ciardhuain (17 December 2002) +// +// Ogham keyboard layout as recommended in I.S. 434:1999. +// Suitable for multi-layout xkbcomp. +// Character names are given as in the Unicode standard, +// range U+1680 to U+169F. + + +default partial alphanumeric_keys +xkb_symbols "basic" { + + name[Group1] = "Ogham"; + + key.type[Group1] = "ONE_LEVEL"; + + key { type[Group1]="TWO_LEVEL", + [ 0x100169B, 0x100169C ] }; + // OGHAM FEATHER MARK, OGHAM REVERSED FEATHER MARK + + key { [ 0x1001680 ] }; // OGHAM SPACE MARK + + key { [ 0x100169C ] }; // OGHAM REVERSED FEATHER MARK + + key { [ space ] }; + + // + // Top Row QWERTYUIOP + // + key { [ 0x100168A ] }; // OGHAM LETTER CEIRT + key { [ 0x1001695 ] }; // OGHAM LETTER EABHADH + key { [ 0x1001693 ] }; // OGHAM LETTER EADHADH + key { [ 0x100168F ] }; // OGHAM LETTER RUIS + key { [ 0x1001688 ] }; // OGHAM LETTER TINNE + key { [ 0x1001698 ] }; // OGHAM LETTER IFIN + key { [ 0x1001692 ] }; // OGHAM LETTER UR + key { [ 0x1001694 ] }; // OGHAM LETTER IODHADH + key { [ 0x1001691 ] }; // OGHAM LETTER ONN + key { [ 0x100169A ] }; // OGHAM LETTER PEITH + + // + // Middle Row ASDFGHJKL + // + key { [ 0x1001690 ] }; // OGHAM LETTER AILM + key { [ 0x1001684 ] }; // OGHAM LETTER SAIL + key { [ 0x1001687 ] }; // OGHAM LETTER DAIR + key { [ 0x1001683 ] }; // OGHAM LETTER FEARN + key { [ 0x100168C ] }; // OGHAM LETTER GORT + key { [ 0x1001686 ] }; // OGHAM LETTER UATH + key { [ 0x1001697 ] }; // OGHAM LETTER UILLEANN + key { [ 0x1001696 ] }; // OGHAM LETTER OR + key { [ 0x1001682 ] }; // OGHAM LETTER LUIS + + // + // Bottom Row ZXCVBNM + // + key { [ 0x100168E ] }; // OGHAM LETTER STRAIF + key { [ 0x1001699 ] }; // OGHAM LETTER EAMHANCHOLL + key { [ 0x1001689 ] }; // OGHAM LETTER COLL + key { [ 0x100168D ] }; // OGHAM LETTER NGEADAL + key { [ 0x1001681 ] }; // OGHAM LETTER BEITH + key { [ 0x1001685 ] }; // OGHAM LETTER NION + key { [ 0x100168B ] }; // OGHAM LETTER MUIN + + // As an extension because and may not be + // available or sensible. These are also a bit more + // intuitive on a standard Irish keyboard. + key { [ 0x100169C ] }; // OGHAM REVERSED FEATHER MARK + key { [ 0x100169B ] }; // OGHAM FEATHER MARK + key { [ 0x1001680 ] }; // OGHAM SPACE MARK + + key { type[Group1]="TWO_LEVEL", [ Multi_key, ISO_Next_Group ] }; + +}; + +partial alphanumeric_keys +xkb_symbols "laptop" { + // For laptops which don't have the RWIN key but are otherwise + // the same as 105-key layouts. + include "ogham(basic)" + key { type[Group1]="TWO_LEVEL", [ Multi_key, ISO_Next_Group ] }; +}; + + +partial alphanumeric_keys +xkb_symbols "is434" { + + // This has the full layout of IS434 with an Irish QWERTY keyboard, + // and the Ogham characters accessed when CAPS LOCK is on. + + name[Group1] = "Ogham (IS434)"; + + key.type[Group1] = "THREE_LEVEL"; + + key { type[Group1] = "FOUR_LEVEL_ALPHABETIC", + [ backslash, bar, 0x100169B, 0x100169C ] }; + // OGHAM FEATHER MARK, OGHAM REVERSED FEATHER MARK + + key { [ numbersign, asciitilde, 0x1001680 ] }; // OGHAM SPACE MARK + key { [ grave, notsign, 0x100169C ] }; // OGHAM REVERSED FEATHER MARK + key { [ space, space, space ] }; + + // + // Numeric row + // + key { type[Group1]="TWO_LEVEL", [ 1, exclam ] }; + key { type[Group1]="TWO_LEVEL", [ 2, quotedbl ] }; + key { type[Group1]="TWO_LEVEL", [ 3, sterling ] }; + key { [ 4, dollar, EuroSign ] }; + key { type[Group1]="TWO_LEVEL", [ 5, percent ] }; + key { type[Group1]="TWO_LEVEL", [ 6, asciicircum ] }; + key { [ 7, ampersand, 0x100204A ] }; // Tironian Et + key { type[Group1]="TWO_LEVEL", [ 8, asterisk ] }; + key { type[Group1]="TWO_LEVEL", [ 9, parenleft ] }; + key { type[Group1]="TWO_LEVEL", [ 0, parenright ] }; + key { type[Group1]="TWO_LEVEL", [ minus, underscore ] }; + key { type[Group1]="TWO_LEVEL", [ equal, plus ] }; + + // + // Top Row QWERTYUIOP + // + key { [ q, Q, 0x100168A ] }; // OGHAM LETTER CEIRT + key { [ w, W, 0x1001695 ] }; // OGHAM LETTER EABHADH + key { [ e, E, 0x1001693 ] }; // OGHAM LETTER EADHADH + key { [ r, R, 0x100168F ] }; // OGHAM LETTER RUIS + key { [ t, T, 0x1001688 ] }; // OGHAM LETTER TINNE + key { [ y, Y, 0x1001698 ] }; // OGHAM LETTER IFIN + key { [ u, U, 0x1001692 ] }; // OGHAM LETTER UR + key { [ i, I, 0x1001694 ] }; // OGHAM LETTER IODHADH + key { [ o, O, 0x1001691 ] }; // OGHAM LETTER ONN + key { [ p, P, 0x100169A ] }; // OGHAM LETTER PEITH + + // + // Middle Row ASDFGHJKL + // + key { [ a, A, 0x1001690 ] }; // OGHAM LETTER AILM + key { [ s, S, 0x1001684 ] }; // OGHAM LETTER SAIL + key { [ d, D, 0x1001687 ] }; // OGHAM LETTER DAIR + key { [ f, F, 0x1001683 ] }; // OGHAM LETTER FEARN + key { [ g, G, 0x100168C ] }; // OGHAM LETTER GORT + key { [ h, H, 0x1001686 ] }; // OGHAM LETTER UATH + key { [ j, J, 0x1001697 ] }; // OGHAM LETTER UILLEANN + key { [ k, K, 0x1001696 ] }; // OGHAM LETTER OR + key { [ l, L, 0x1001682 ] }; // OGHAM LETTER LUIS + + // + // Bottom Row ZXCVBNM + // + key { [ z, Z, 0x100168E ] }; // OGHAM LETTER STRAIF + key { [ x, X, 0x1001699 ] }; // OGHAM LETTER EAMHANCHOLL + key { [ c, C, 0x1001689 ] }; // OGHAM LETTER COLL + key { [ v, V, 0x100168D ] }; // OGHAM LETTER NGEADAL + key { [ b, B, 0x1001681 ] }; // OGHAM LETTER BEITH + key { [ n, N, 0x1001685 ] }; // OGHAM LETTER NION + key { [ m, M, 0x100168B ] }; // OGHAM LETTER MUIN + + // As an extension because and may not be + // available or sensible. These are also a bit more + // intuitive on a standard Irish keyboard. + key { [ comma, less, 0x100169C ] }; // OGHAM REVERSED FEATHER MARK + key { [ period, greater, 0x100169B ] }; // OGHAM FEATHER MARK + key { [ slash, question, 0x1001680 ] }; // OGHAM SPACE MARK + + // The standard says the Ogham characters should be accessed when + // Caps Lock is down; not clear if this means it should lock but + // seems logical. + + key { type[Group1] = "ONE_LEVEL", [ ISO_Level3_Lock ] }; + + // Also allow access to Ogham characters using RALT for convenience + key { type[Group1] = "ONE_LEVEL", [ ISO_Level3_Shift ] }; + + modifier_map Mod5 { ISO_Level3_Shift, ISO_Level3_Lock }; + + // Redefine Scroll Lock as locking shift in case that's needed. + // Also overcomes annoying use of Scroll Lock LED inherited from + // US symbols but not relevant here since we're not changing group. + key {type[Group1] = "ONE_LEVEL", [ Shift_Lock ] }; + modifier_map Shift { Shift_Lock }; + + key { type[Group1]="TWO_LEVEL", [ Multi_key, ISO_Next_Group ] }; +}; + +partial alphanumeric_keys +xkb_symbols "IS434" { + // just has uppercase in the name + include "ogham(is434)" +}; + +partial alphanumeric_keys +xkb_symbols "is434laptop" { + // For laptops which don't have the RWIN key but are otherwise + // the same as 105-key layouts. + include "ogham(is434)" + key { type[Group1]="TWO_LEVEL", [ Multi_key, ISO_Next_Group ] }; +}; + +partial alphanumeric_keys +xkb_symbols "IS434laptop" { + // just has uppercase in the name + include "ogham(is434)" + key { type[Group1]="TWO_LEVEL", [ Multi_key, ISO_Next_Group ] }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/ori /opt/SUNWut/lib/xkb/symbols/ori --- /opt/SUNWut.orig/lib/xkb/symbols/ori 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/ori 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,71 @@ +// $XFree86$ + +partial default alphanumeric_keys +xkb_symbols "basic" { + // Inscript layout for Oriya + // Author: G Karunakar + // Date: Wed Nov 13 18:16:19 IST 2002 + + name[Group2]= "Oriya"; + + key { [], [ 0x01000b4a, 0x01000b12 ] }; + key { [], [ 0x01000b67, 0x01000b0d ] }; + key { [], [ 0x01000b68, 0x01000b45 ] }; + key { [], [ 0x01000b69 ] }; + key { [], [ 0x01000b6a ] }; + key { [], [ 0x01000b6b ] }; + key { [], [ 0x01000b6c ] }; + key { [], [ 0x01000b6d ] }; + key { [], [ 0x01000b6e ] }; + key { [], [ 0x01000b6f ] }; + key { [], [ 0x01000b66 ] }; + key { [], [ 0x01000b03 ] }; + key { [], [ 0x01000b43, 0x01000b0b ] }; + + key { [], [ 0x01000b4c, 0x01000b14 ] }; + key { [], [ 0x01000b48, 0x01000b10 ] }; + key { [], [ 0x01000b3e, 0x01000b06 ] }; + key { [], [ 0x01000b40, 0x01000b08 ] }; + key { [], [ 0x01000b42, 0x01000b0a ] }; + key { [], [ 0x01000b2c, 0x01000b2d ] }; + key { [], [ 0x01000b39, 0x01000b19 ] }; + key { [], [ 0x01000b17, 0x01000b18 ] }; + key { [], [ 0x01000b26, 0x01000b27 ] }; + key { [], [ 0x01000b1c, 0x01000b1d ] }; + key { [], [ 0x01000b21, 0x01000b22 ] }; + key { [], [ 0x01000b3c, 0x01000b1e ] }; + + key { [], [ 0x01000b4b, 0x01000b13 ] }; + key { [], [ 0x01000b47, 0x01000b0f ] }; + key { [], [ 0x01000b4d, 0x01000b05 ] }; + key { [], [ 0x01000b3f, 0x01000b07 ] }; + key { [], [ 0x01000b41, 0x01000b09 ] }; + key { [], [ 0x01000b2a, 0x01000b2b ] }; + key { [], [ 0x01000b30, 0x01000b31 ] }; + key { [], [ 0x01000b15, 0x01000b16 ] }; + key { [], [ 0x01000b24, 0x01000b25 ] }; + key { [], [ 0x01000b1a, 0x01000b1b ] }; + key { [], [ 0x01000b1f, 0x01000b20 ] }; + + key { [], [ 0x01000b46, 0x01000b0e ] }; + key { [], [ 0x01000b02, 0x01000b01 ] }; + key { [], [ 0x01000b2e, 0x01000b23 ] }; + key { [], [ 0x01000b28, 0x01000b29 ] }; + key { [], [ 0x01000b35, 0x01000b34 ] }; + key { [], [ 0x01000b32, 0x01000b33 ] }; + key { [], [ 0x01000b38, 0x01000b36 ] }; + key { [], [ comma , 0x01000b37 ] }; + key { [], [ period , 0x01000b64 ] }; + key { [], [ 0x01000b2f, 0x01000040 ] }; + key { [], [ 0x01000b49, 0x01000b11 ] }; + + key { + symbols[Group1] = [ Mode_switch, Multi_key ], + virtualMods = AltGr + }; + + modifier_map Shift { Shift_L }; + modifier_map Lock { Caps_Lock }; + modifier_map Control{ Control_L }; + modifier_map Mod3 { Mode_switch }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/pc/al /opt/SUNWut/lib/xkb/symbols/pc/al --- /opt/SUNWut.orig/lib/xkb/symbols/pc/al 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/pc/al 2006-04-18 08:31:52.000000000 +0200 @@ -0,0 +1,43 @@ +// $XdotOrg$ +// based on +// albanian keyboard layout +// done by Pablo Saratxaga +// +// $XFree86: xc/programs/xkbcomp/symbols/pc/al,v 1.2 2002/11/22 04:03:28 dawes Exp $ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + include "pc/latin(type3)" + + name[Group1]="Albania"; + + key { [ 1, exclam, asciitilde, dead_tilde ] }; + key { [ 2, quotedbl, dead_caron, oneeighth ] }; + key { [ 3, numbersign, dead_circumflex, sterling ] }; + key { [ 4, dollar, dead_breve, dollar ] }; + key { [ 5, percent, dead_abovering, threeeighths] }; + key { [ 6, asciicircum, dead_ogonek, fiveeighths ] }; + key { [ 7, ampersand, grave, dead_grave ] }; + key { [ 8, asterisk, dead_abovedot, trademark ] }; + key { [ 9, parenleft, dead_acute, plusminus ] }; + key { [ 0, parenright, dead_doubleacute, degree ] }; + key { [ minus, underscore, dead_diaeresis, questiondown] }; + + key { [ e, E, EuroSign, EuroSign ] }; + key { [ ccedilla, Ccedilla, division, dead_abovering ] }; + key { [ at, apostrophe, multiply, dead_macron ] }; + + key { [ s, S, dstroke, section ] }; + key { [ d, D, Dstroke, ETH ] }; + key { [ediaeresis, Ediaeresis, dollar, dead_doubleacute ] }; + key { [bracketleft, braceleft, ssharp, dead_caron ] }; + key { [ backslash, bar, notsign, notsign ] }; + + key { [bracketright, braceright, currency, dead_breve ] }; + key { [ comma, semicolon, less, multiply ] }; + key { [ period, colon, greater, division ] }; + key { [ slash, question, dead_belowdot, dead_abovedot ] }; + + include "level3(ralt_switch)" +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/pc/am /opt/SUNWut/lib/xkb/symbols/pc/am --- /opt/SUNWut.orig/lib/xkb/symbols/pc/am 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/pc/am 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,123 @@ +// $XdotOrg$ +// based on a keyboard map from an 'xkb/symbols/am' file +// +// $XFree86: xc/programs/xkbcomp/symbols/pc/am,v 1.4 2003/05/29 12:41:58 pascal Exp $ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + name[Group1]= "Armenia"; + + // Alphanumeric section + key { [ 0x100055d, 0x100055c ] }; + key { [ question, 0x100058a ] }; + key { [ guillemotright, guillemotleft ] }; + + key { [ 0x1000586, 0x1000556 ] }; + key { [ 0x1000571, 0x1000541 ] }; + key { [ 0x1002013, 0x1002014 ] }; + key { [ comma, dollar ] }; + key { [ 0x1000589, 0x1002026 ] }; + key { [ 0x100055e, percent ] }; + key { [ period, 0x1000587 ] }; + key { [ 0x100055b, 0x10002bc ] }; + key { [ parenright, parenleft ] }; + key { [ 0x1000585, 0x1000555 ] }; + key { [ 0x1000567, 0x1000537 ] }; + key { [ 0x1000572, 0x1000542 ] }; + + + key { [ 0x1000573, 0x1000543 ] }; + key { [ 0x1000583, 0x1000553 ] }; + key { [ 0x1000562, 0x1000532 ] }; + key { [ 0x100057d, 0x100054d ] }; + key { [ 0x1000574, 0x1000544 ] }; + key { [ 0x1000578, 0x1000548 ] }; + key { [ 0x1000582, 0x1000552 ] }; + key { [ 0x100056f, 0x100053f ] }; + key { [ 0x1000568, 0x1000538 ] }; + key { [ 0x1000569, 0x1000539 ] }; + key { [ 0x100056e, 0x100053e ] }; + key { [ 0x1000581, 0x1000551 ] }; + + key { [ 0x100057b, 0x100054b ] }; + key { [ 0x100057e, 0x100054e ] }; + key { [ 0x1000563, 0x1000533 ] }; + key { [ 0x1000565, 0x1000535 ] }; + key { [ 0x1000561, 0x1000531 ] }; + key { [ 0x1000576, 0x1000546 ] }; + key { [ 0x100056b, 0x100053b ] }; + key { [ 0x100057f, 0x100054f ] }; + key { [ 0x1000570, 0x1000540 ] }; + key { [ 0x100057a, 0x100054a ] }; + key { [ 0x1000580, 0x1000550 ] }; + + key { [ 0x100056a, 0x100053a ] }; + key { [ 0x1000564, 0x1000534 ] }; + key { [ 0x1000579, 0x1000549 ] }; + key { [ 0x1000575, 0x1000545 ] }; + key { [ 0x1000566, 0x1000536 ] }; + key { [ 0x100056c, 0x100053c ] }; + key { [ 0x1000584, 0x1000554 ] }; + key { [ 0x100056d, 0x100053d ] }; + key { [ 0x1000577, 0x1000547 ] }; + key { [ 0x100057c, 0x100054c ] }; + +}; + +xkb_symbols "phonetic" { + include "pc/am(basic)" + name[Group1]= "Armenia - Phonetic"; + + key { [ 0x1000577, 0x1000547 ] }; + + key { [ 0x1000567, 0x1000537 ] }; + key { [ 0x1000569, 0x1000539 ] }; + key { [ 0x1000583, 0x1000553 ] }; + key { [ 0x1000571, 0x1000541 ] }; + key { [ 0x100057b, 0x100054b ] }; + key { [ 0x1000582, 0x1000552 ] }; + key { [ 0x1000587, 0x1000587 ] }; + key { [ 0x1000580, 0x1000550 ] }; + key { [ 0x1000579, 0x1000549 ] }; + key { [ 0x1000573, 0x1000543 ] }; + key { [ 0x100002D, 0x1002015 ] }; + key { [ 0x100056a, 0x100053a ] }; + + key { [ 0x1000584, 0x1000554 ] }; + key { [ 0x1000578, 0x1000548 ] }; + key { [ 0x1000565, 0x1000535 ] }; + key { [ 0x100057c, 0x100054c ] }; + key { [ 0x100057f, 0x100054f ] }; + key { [ 0x1000568, 0x1000538 ] }; + key { [ 0x1000582, 0x1000552 ] }; + key { [ 0x100056b, 0x100053b ] }; + key { [ 0x1000585, 0x1000555 ] }; + key { [ 0x100057a, 0x100054a ] }; + key { [ 0x100056d, 0x100053d ] }; + key { [ 0x100056e, 0x100053e ] }; + + key { [ 0x1000561, 0x1000531 ] }; + key { [ 0x100057d, 0x100054d ] }; + key { [ 0x1000564, 0x1000534 ] }; + key { [ 0x1000586, 0x1000556 ] }; + key { [ 0x1000563, 0x1000533 ] }; + key { [ 0x1000570, 0x1000540 ] }; + key { [ 0x1000575, 0x1000545 ] }; + key { [ 0x100056f, 0x100053f ] }; + key { [ 0x100056c, 0x100053c ] }; + key { [ semicolon, 0x1000589 ] }; + key { [ 0x100055b, 0x1000022 ] }; + + key { [ 0x1000566, 0x1000536 ] }; + key { [ 0x1000572, 0x1000542 ] }; + key { [ 0x1000581, 0x1000551 ] }; + key { [ 0x100057e, 0x100054e ] }; + key { [ 0x1000562, 0x1000532 ] }; + key { [ 0x1000576, 0x1000546 ] }; + key { [ 0x1000574, 0x1000544 ] }; + key { [ 0x100002C, 0x10000AB ] }; + key { [ 0x1002024, 0x10000BB ] }; + key { [ 0x100002F, 0x100055e ] }; + +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/pc/ara /opt/SUNWut/lib/xkb/symbols/pc/ara --- /opt/SUNWut.orig/lib/xkb/symbols/pc/ara 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/pc/ara 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,146 @@ +// $XdotOrg$ +// based on a keyboard map from an 'xkb/symbols/ar' file +// +// $XFree86$ + +partial default alphanumeric_keys +xkb_symbols "basic" { + name[Group1]= "Arabic"; + +// NOTES: +// +// there is also combined shadda diacritis in AltGr position of simple +// diacritics fatha, fathatan, damma, dammatan, kasra and kasratan +// should a third state be added to Group2 ? +// + + key { [ Arabic_thal, Arabic_shadda ] }; + key { [ 1, exclam ] }; + key { [ 2, at ] }; + key { [ 3, numbersign ] }; + key { [ 4, dollar ] }; + key { [ 5, percent ] }; + key { [ 6, asciicircum ] }; + key { [ 7, ampersand ] }; + key { [ 8, asterisk ] }; + key { [ 9, parenleft ] }; + key { [ 0, parenright ] }; + key { [ minus, underscore ] }; + key { [ equal, plus ] }; + + key { [ Arabic_dad, Arabic_fatha ] }; + key { [ Arabic_sad, Arabic_fathatan ] }; + key { [ Arabic_theh, Arabic_damma ] }; + key { [ Arabic_qaf, Arabic_dammatan ] }; + key { [ Arabic_feh, 0x100fef9 ] }; + key { [ Arabic_ghain, Arabic_hamzaunderalef ] }; + key { [ Arabic_ain, grave ] }; + key { [ Arabic_ha, division ] }; + key { [ Arabic_khah, multiply ] }; + key { [ Arabic_hah, Arabic_semicolon ] }; + key { [ Arabic_jeem, braceleft ] }; + key { [ Arabic_dal, braceright ] }; + + key { [ Arabic_sheen, backslash ] }; + key { [ Arabic_seen, S ] }; + key { [ Arabic_yeh, bracketleft ] }; + key { [ Arabic_beh, bracketright ] }; + key { [ Arabic_lam, 0x100fef7 ] }; + key { [ Arabic_alef, Arabic_hamzaonalef ] }; + key { [ Arabic_teh, Arabic_tatweel ] }; + key { [ Arabic_noon, Arabic_comma ] }; + key { [ Arabic_meem, slash ] }; + key { [ Arabic_kaf, colon ] }; + key { [ Arabic_tah, quotedbl ] }; + key { [ less, greater ] }; + + key { [ bar, brokenbar ] }; + key { [Arabic_hamzaonyeh, asciitilde ] }; + key { [ Arabic_hamza, Arabic_sukun ] }; + key { [Arabic_hamzaonwaw, Arabic_kasra ] }; + key { [ Arabic_ra, Arabic_kasratan ] }; + key { [ 0x100fefb, 0x100fef5 ] }; + key { [Arabic_alefmaksura, Arabic_maddaonalef ] }; + key { [Arabic_tehmarbuta, apostrophe ] }; + key { [ Arabic_waw, comma ] }; + key { [ Arabic_zain, period ] }; + key { [ Arabic_zah, Arabic_question_mark ] }; + + // End alphanumeric section +}; + +partial alphanumeric_keys +xkb_symbols "qwerty" { + include "pc/ar(basic)" + name[Group1]= "Arabic - qwerty"; +}; + +partial alphanumeric_keys +xkb_symbols "azerty" { + include "pc/ar(basic)" + name[Group1]= "Arabic - azerty"; + // the north african arabic keyboard differs from the middle east one + // by the numeric row; it follows French keyboard style + // + // PROBLEM: some chars are inaccessible: ! @ # $ % ^ * + // should they go elsewhere? replace " ' that are now in double ? + // also, dead_circumflex and dead_diaeresis from French keyboard + // as well as ugrave are missing, which questions the utility of the + // other accentuated latin letters. Maybe this is useful only with + // a French keyboard in Group1 ? Then, shouldn't Group1 be filled ? + + key { [ ampersand, 1 ] }; + key { [ eacute, 2 ] }; + key { [ quotedbl, 3 ] }; + key { [ apostrophe, 4 ] }; + key { [ parenleft, 5 ] }; + key { [ minus, 6 ] }; + key { [ egrave, 7 ] }; + key { [ underscore, 8 ] }; + key { [ ccedilla, 9 ] }; + key { [ agrave, 0 ] }; + key { [ parenright, degree ] }; +}; + +partial alphanumeric_keys +xkb_symbols "digits" { + include "pc/ar(basic)" + name[Group1]= "Arabic - digits"; + + // use arabic script digits + + key { [ 0x1000661, exclam ] }; + key { [ 0x1000662, at ] }; + key { [ 0x1000663, numbersign ] }; + key { [ 0x1000664, dollar ] }; + key { [ 0x1000665, percent ] }; + key { [ 0x1000666, asciicircum ] }; + key { [ 0x1000667, ampersand ] }; + key { [ 0x1000668, asterisk ] }; + key { [ 0x1000669, parenleft ] }; + key { [ 0x1000660, parenright ] }; +}; + +partial alphanumeric_keys +xkb_symbols "qwerty_digits" { + include "pc/ar(digits)" + name[Group1]= "Arabic - qwerty/digits"; +}; + +partial alphanumeric_keys +xkb_symbols "azerty_digits" { + include "pc/ar(azerty)" + name[Group1]= "Arabic - azerty/digits"; + + key { [ ampersand, 0x1000661 ] }; + key { [ eacute, 0x1000662 ] }; + key { [ quotedbl, 0x1000663 ] }; + key { [ apostrophe, 0x1000664 ] }; + key { [ parenleft, 0x1000665 ] }; + key { [ minus, 0x1000666 ] }; + key { [ egrave, 0x1000667 ] }; + key { [ underscore, 0x1000668 ] }; + key { [ ccedilla, 0x1000669 ] }; + key { [ agrave, 0x1000660 ] }; +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/pc/az /opt/SUNWut/lib/xkb/symbols/pc/az --- /opt/SUNWut.orig/lib/xkb/symbols/pc/az 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/pc/az 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,94 @@ +// $XdotOrg$ + +// based on: +// symbols definition for a very simple Azerbaidjani keyboard layout. +// 2001 - Pablo Saratxaga + +partial default alphanumeric_keys +xkb_symbols "latin" { + + include "pc/us" + + name[Group1]= "Azerbaijan"; + + key { [ grave, asciitilde, dead_grave, dead_tilde ] }; + + key { [ 3, numbersign, U2166 ] }; + key { [ 6, colon, EuroSign, periodcentered ] }; + key { [ 7, question ] }; + + key { [ 8, asterisk, asciicircum, dead_circumflex ] }; + key { [ minus, underscore, hyphen, emdash ] }; + + key { [ udiaeresis, Udiaeresis ] }; + key { [ r, R, registered ] }; + key { [ i, Iabovedot ] }; + key { [ odiaeresis, Odiaeresis, bracketleft, braceleft ] }; + key { [ gbreve, Gbreve, bracketright, braceright ] }; + + key { [ idotless, I ] }; + key { [ schwa, SCHWA ] }; + + key { [ c, C, copyright, division ] }; + key { [ m, M, periodcentered, currency ] }; + key { [ ccedilla, Ccedilla ] }; + key { [ scedilla, Scedilla ] }; + key { [ period, comma ] }; + // End alphanumeric section + + include "level3(ralt_switch)" +}; + +partial alphanumeric_keys +xkb_symbols "cyrillic" { + + name[Group1]= "Azerbaijan - Cyrillic"; + + key {[ 2, quotedbl ] }; + key {[ 3, numbersign ] }; + key {[ 4, semicolon ] }; + key {[ 6, colon ] }; + key {[ 7, question ] }; + key {[ 8, asterisk, braceleft ] }; + key {[ 9, parenleft, bracketleft ] }; + key {[ 0, parenright, bracketright ] }; + key {[ minus, underscore, braceright ] }; + + key {[ Cyrillic_je, Cyrillic_JE ] }; + key {[ Cyrillic_u_straight, Cyrillic_U_straight ] }; + key {[ Cyrillic_u, Cyrillic_U ] }; + key {[ Cyrillic_ka, Cyrillic_KA ] }; + key {[ Cyrillic_ie, Cyrillic_IE ] }; + key {[ Cyrillic_en, Cyrillic_EN ] }; + key {[ Cyrillic_ghe, Cyrillic_GHE ] }; + key {[ Cyrillic_sha, Cyrillic_SHA ] }; + key {[ Cyrillic_shha, Cyrillic_SHHA ] }; + key {[ Cyrillic_ze, Cyrillic_ZE ] }; + key {[ Cyrillic_ha, Cyrillic_HA ] }; + key {[ Cyrillic_che_vertstroke, Cyrillic_CHE_vertstroke ] }; + + key {[ Cyrillic_ef, Cyrillic_EF ] }; + key {[ Cyrillic_yeru, Cyrillic_YERU ] }; + key {[ Cyrillic_ve, Cyrillic_VE ] }; + key {[ Cyrillic_a, Cyrillic_A ] }; + key {[ Cyrillic_pe, Cyrillic_PE ] }; + key {[ Cyrillic_er, Cyrillic_ER ] }; + key {[ Cyrillic_o, Cyrillic_O ] }; + key {[ Cyrillic_el, Cyrillic_EL ] }; + key {[ Cyrillic_de, Cyrillic_DE ] }; + key {[ Cyrillic_zhe, Cyrillic_ZHE ] }; + key {[ Cyrillic_ka_vertstroke,Cyrillic_KA_vertstroke ] }; + + key {[ Cyrillic_schwa, Cyrillic_SCHWA ] }; + key {[ Cyrillic_che, Cyrillic_CHE ] }; + key {[ Cyrillic_es, Cyrillic_ES ] }; + key {[ Cyrillic_em, Cyrillic_EM ] }; + key {[ Cyrillic_i, Cyrillic_I ] }; + key {[ Cyrillic_te, Cyrillic_TE ] }; + key {[ Cyrillic_ghe_bar, Cyrillic_GHE_bar ] }; + key {[ Cyrillic_be, Cyrillic_BE ] }; + key {[ Cyrillic_o_bar, Cyrillic_O_bar ] }; + key {[ period, comma ] }; + + // End alphanumeric section +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/pc/ba /opt/SUNWut/lib/xkb/symbols/pc/ba --- /opt/SUNWut.orig/lib/xkb/symbols/pc/ba 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/pc/ba 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,61 @@ +// $XdotOrg$ +// Bosnian keyboards +// Amila Akagic, +// Zadnja promjena: 07.05.2002. +// $XFree86: xc/programs/xkbcomp/symbols/bs,v 1.1 2002/12/13 04:18:03 dawes Exp $ +// $XKeyboardConfig: xkbdesc/symbols/ba,v 1.3 2004/12/22 21:51:19 svu Exp $ + +default partial alphanumeric_keys +xkb_symbols "basic" { + + include "pc/latin" + // Alphanumeric section + name[Group1]= "Bosnia and Herzegovina"; + + key { [ dead_cedilla, dead_diaeresis ] }; + key { [ 1, exclam, asciitilde, dead_tilde ] }; + key { [ 2, quotedbl, dead_caron, caron ] }; + key { [ 3, numbersign, asciicircum, dead_circumflex ] }; + key { [ 4, dollar, dead_breve, breve ] }; + key { [ 5, percent, degree, dead_abovering ] }; + key { [ 6, ampersand, dead_ogonek, ogonek ] }; + key { [ 7, slash, quoteleft, dead_grave ] }; + key { [ 8, parenleft, dead_abovedot, abovedot ] }; + key { [ 9, parenright, dead_acute, quoteright ] }; + key { [ 0, equal, dead_doubleacute, doubleacute] }; + key { [ apostrophe, question, dead_diaeresis, diaeresis ] }; + key { [ plus, asterisk, dead_cedilla, cedilla ] }; + + key { [ q, Q, backslash ] }; + key { [ w, W, bar ] }; + key { [ e, E, EuroSign ] }; + key { [ t, T ] }; + key { [ z, Z ] }; + key { [ u, U ] }; + key { [ i, I ] }; + key { [ scaron, Scaron, division ] }; + key { [ dstroke, Dstroke, multiply, dead_macron ] }; + key { [ f, F, bracketleft ] }; + key { [ g, G, bracketright] }; + key { [ k, K, lstroke ] }; + key { [ l, L, Lstroke ] }; + key { [ ccaron, Ccaron ] }; + key { [ cacute, Cacute, ssharp ] }; + + key { [ less, greater,bar ] }; + key { [ y, Y ] }; + key { [ v, V, at ] }; + key { [ b, B, braceleft ] }; + key { [ n, N, braceright ] }; + key { [ m, M, section ] }; + key { [ comma, semicolon ] }; + key { [ period, colon, periodcentered] }; + key { [ minus, underscore ] }; + key { [ zcaron, Zcaron, currency ] }; + + // End alphanumeric section + + include "keypad(comma)" +}; + + diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/pc/bd /opt/SUNWut/lib/xkb/symbols/pc/bd --- /opt/SUNWut.orig/lib/xkb/symbols/pc/bd 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/pc/bd 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,15 @@ +// $XdotOrg$ +// $XKeyboardConfig: xkbdesc/symbols/bd,v 1.3 2005/08/01 00:01:54 svu Exp $ + +default partial alphanumeric_keys +xkb_symbols "basic" { + include "pc/in(ben)" + name[Group1]= "Bangladesh"; +// TODO(svu): change iNSCRIPT to Jatiaya +// according to http://ekushey.org/projects/shadhinota/national.html +}; + +xkb_symbols "probhat" { + include "pc/in(ben_probhat)" + name[Group1]= "Bangladesh - Probhat"; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/pc/be /opt/SUNWut/lib/xkb/symbols/pc/be --- /opt/SUNWut.orig/lib/xkb/symbols/pc/be 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/pc/be 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,98 @@ +// $XdotOrg$ +// based on a keyboard map from an 'xkb/symbols/be' file +// +// $XFree86: xc/programs/xkbcomp/symbols/pc/be,v 1.3 2003/04/12 10:53:48 pascal Exp $ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + include "pc/latin" + + name[Group1]="Belgium"; + + key { [ ampersand, 1, bar, exclamdown ] }; + key { [ eacute, 2, at, oneeighth ] }; + key { [ quotedbl, 3, numbersign, sterling ] }; + key { [apostrophe, 4, onequarter, dollar ] }; + key { [ parenleft, 5, onehalf, threeeighths ] }; + key { [ section, 6, asciicircum, fiveeighths ] }; + key { [ egrave, 7, braceleft, seveneighths ] }; + key { [ exclam, 8, bracketleft, trademark ] }; + key { [ ccedilla, 9, braceleft, plusminus ] }; + key { [ agrave, 0, braceright, degree ] }; + key { [parenright, degree, backslash, questiondown ] }; + key { [ minus, underscore, dead_cedilla, dead_ogonek ] }; + + key { [ a, A, at, Greek_OMEGA ] }; + key { [ z, Z, lstroke, Lstroke ] }; + key { [ e, E, EuroSign, cent ] }; + key { [dead_circumflex, dead_diaeresis, bracketleft, dead_abovering ] }; + key { [ dollar, asterisk, bracketright, dead_macron ] }; + + key { [ q, Q, ae, AE ] }; + key { [ m, M, dead_acute, dead_doubleacute ] }; + key { [ ugrave, percent, dead_acute, dead_caron ] }; + key { [twosuperior, threesuperior, notsign, notsign ] }; + + key { [ mu, sterling, dead_grave, dead_breve ] }; + key { [ w, W, guillemotleft, less ] }; + key { [ comma, question, dead_cedilla, masculine ] }; + key { [ semicolon, period, horizconnector, multiply ] }; + key { [ colon, slash, periodcentered, division ] }; + key { [ equal, plus, dead_tilde, dead_abovedot] }; + key { [ less, greater, backslash, backslash ] }; + + include "level3(ralt_switch)" +}; + +partial alphanumeric_keys +xkb_symbols "iso-alternate" { + include "pc/be(basic)" + name[Group1]="Belgium - ISO Alternate"; + key { [ a, A, ae, AE ] }; + key { [ z, Z, guillemotleft, less ] }; + key { [ q, Q, at, Greek_OMEGA ] }; + key { [ m, M, mu, masculine ] }; + key { [ w, W, lstroke, Lstroke ] }; + key { [ comma, question, dead_cedilla, dead_doubleacute ] }; +}; + +partial alphanumeric_keys +xkb_symbols "sundeadkeys" { + + // Use the Sun dead keys + + include "pc/be(basic)" + name[Group1]="Belgium - Sun dead keys"; + key { [SunFA_Circum, SunFA_Diaeresis, bracketleft, bracketleft] }; + key { [ ugrave, percent, SunFA_Acute, SunFA_Acute ] }; + key { [ mu, sterling, SunFA_Grave, SunFA_Grave ] }; + key { [ comma, question, SunFA_Cedilla, SunFA_Cedilla] }; + key { [ equal, plus, SunFA_Tilde, SunFA_Tilde ] }; +}; + +partial alphanumeric_keys +xkb_symbols "Sundeadkeys" { + + // Use the Sun dead keys + + include "pc/be(sundeadkeys)" + +}; + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + + // Eliminates dead keys from the basic Belgian layout + + include "pc/be(basic)" + name[Group1]="Belgium - Eliminate dead keys"; + key { [ minus, underscore, cedilla, ogonek ] }; + key { [asciicircum, diaeresis, bracketleft, bracketleft] }; + key { [ dollar, asterisk, bracketright, macron ] }; + key { [ m, M, acute, doubleacute ] }; + key { [ ugrave, percent, quoteright, quoteright ] }; + key { [ mu, sterling, quoteleft, quoteleft ] }; + key { [ comma, question, cedilla, masculine ] }; + key { [ equal, plus, asciitilde, asciitilde ] }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/pc/bg /opt/SUNWut/lib/xkb/symbols/pc/bg --- /opt/SUNWut.orig/lib/xkb/symbols/pc/bg 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/pc/bg 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,138 @@ +// $XdotOrg$ +// based on a keyboard map: +// +////////////////////////////////////////////////////////////////////////// +// Copyright (C) 1999, 2000 by Anton Zinoviev +// +// This software may be used, modified, copied, distributed, and sold, +// in both source and binary form provided that the above copyright +// and these terms are retained. Under no circumstances is the author +// responsible for the proper functioning of this software, nor does +// the author assume any responsibility for damages incurred with its +// use. +// +////////////////////////////////////////////////////////////////////////// +// Version 1.6r1 +// +// $XFree86$ + +partial default alphanumeric_keys +xkb_symbols "bds" { +// BDS is the Bulgarian Institute for Standardization + + name[Group1]= "Bulgaria"; + + key { [ parenleft, parenright ] }; + key { [ 1, exclam ] }; + key { [ 2, question ] }; + key { [ 3, plus ] }; + key { [ 4, quotedbl ] }; + key { [ 5, percent ] }; + key { [ 6, equal ] }; + key { [ 7, colon ] }; + key { [ 8, slash ] }; + key { [ 9, emdash ] }; + key { [ 0, numerosign ] }; + key { [ minus, I ] }; + key { [ period, V ] }; + + key { [ comma, Cyrillic_yeru ] }; + key { [ Cyrillic_u, Cyrillic_U ] }; + key { [ Cyrillic_ie, Cyrillic_IE ] }; + key { [ Cyrillic_i, Cyrillic_I ] }; + key { [ Cyrillic_sha, Cyrillic_SHA ] }; + key { [ Cyrillic_shcha, Cyrillic_SHCHA ] }; + key { [ Cyrillic_ka, Cyrillic_KA ] }; + key { [ Cyrillic_es, Cyrillic_ES ] }; + key { [ Cyrillic_de, Cyrillic_DE ] }; + key { [ Cyrillic_ze, Cyrillic_ZE ] }; + key { [ Cyrillic_tse, Cyrillic_TSE ] }; + key { [ semicolon, section ] }; + + key { [ Cyrillic_softsign, Cyrillic_SOFTSIGN ] }; + key { [ Cyrillic_ya, Cyrillic_YA ] }; + key { [ Cyrillic_a, Cyrillic_A ] }; + key { [ Cyrillic_o, Cyrillic_O ] }; + key { [ Cyrillic_zhe, Cyrillic_ZHE ] }; + key { [ Cyrillic_ghe, Cyrillic_GHE ] }; + key { [ Cyrillic_te, Cyrillic_TE ] }; + key { [ Cyrillic_en, Cyrillic_EN ] }; + key { [ Cyrillic_ve, Cyrillic_VE ] }; + key { [ Cyrillic_em, Cyrillic_EM ] }; + key { [ Cyrillic_che, Cyrillic_CHE ] }; + key { [ apostrophe, Cyrillic_YERU ] }; + + key { [ Cyrillic_yu, Cyrillic_YU ] }; + key { [ Cyrillic_shorti, Cyrillic_SHORTI ] }; + key { [ Cyrillic_hardsign, Cyrillic_HARDSIGN ] }; + key { [ Cyrillic_e, Cyrillic_E ] }; + key { [ Cyrillic_ef, Cyrillic_EF ] }; + key { [ Cyrillic_ha, Cyrillic_HA ] }; + key { [ Cyrillic_pe, Cyrillic_PE ] }; + key { [ Cyrillic_er, Cyrillic_ER ] }; + key { [ Cyrillic_el, Cyrillic_EL ] }; + key { [ Cyrillic_be, Cyrillic_BE ] }; + + // End alphanumeric section + +}; + +partial alphanumeric_keys +xkb_symbols "phonetic" { + + name[Group1]= "Bulgaria - Phonetic"; + + key { [ Cyrillic_che, Cyrillic_CHE ] }; + key { [ 1, exclam ] }; + key { [ 2, at ] }; + key { [ 3, numbersign ] }; + key { [ 4, dollar ] }; + key { [ 5, percent ] }; + key { [ 6, asciicircum ] }; + key { [ 7, ampersand ] }; + key { [ 8, asterisk ] }; + key { [ 9, parenleft ] }; + key { [ 0, parenright ] }; + key { [ minus, underscore ] }; + key { [ equal, plus ] }; + + key { [ Cyrillic_ya, Cyrillic_YA ] }; + key { [ Cyrillic_ve, Cyrillic_VE ] }; + key { [ Cyrillic_ie, Cyrillic_IE ] }; + key { [ Cyrillic_er, Cyrillic_ER ] }; + key { [ Cyrillic_te, Cyrillic_TE ] }; + key { [ Cyrillic_hardsign, Cyrillic_HARDSIGN ] }; + key { [ Cyrillic_u, Cyrillic_U ] }; + key { [ Cyrillic_i, Cyrillic_I ] }; + key { [ Cyrillic_o, Cyrillic_O ] }; + key { [ Cyrillic_pe, Cyrillic_PE ] }; + key { [ Cyrillic_sha, Cyrillic_SHA ] }; + key { [ Cyrillic_shcha, Cyrillic_SHCHA ] }; + + key { [ Cyrillic_a, Cyrillic_A ] }; + key { [ Cyrillic_es, Cyrillic_ES ] }; + key { [ Cyrillic_de, Cyrillic_DE ] }; + key { [ Cyrillic_ef, Cyrillic_EF ] }; + key { [ Cyrillic_ghe, Cyrillic_GHE ] }; + key { [ Cyrillic_ha, Cyrillic_HA ] }; + key { [ Cyrillic_shorti, Cyrillic_SHORTI ] }; + key { [ Cyrillic_ka, Cyrillic_KA ] }; + key { [ Cyrillic_el, Cyrillic_EL ] }; + key { [ semicolon, colon ] }; + key { [ quoteright, quotedbl ] }; + key { [ Cyrillic_yu, Cyrillic_YU ] }; + + key { [ Cyrillic_ze, Cyrillic_ZE ] }; + key { [ Cyrillic_softsign, Cyrillic_SOFTSIGN ] }; + key { [ Cyrillic_tse, Cyrillic_TSE ] }; + key { [ Cyrillic_zhe, Cyrillic_ZHE ] }; + key { [ Cyrillic_be, Cyrillic_BE ] }; + key { [ Cyrillic_en, Cyrillic_EN ] }; + key { [ Cyrillic_em, Cyrillic_EM ] }; + key { [ comma, less ] }; + key { [ period, greater ] }; + key { [ slash, question ] }; + + // End alphanumeric section + +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/pc/br /opt/SUNWut/lib/xkb/symbols/pc/br --- /opt/SUNWut.orig/lib/xkb/symbols/pc/br 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/pc/br 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,63 @@ + +// based on +// "a very simple Brasilian ABNT2 keybaord +// by Ricardo Y. Igarashi (iga@that.com.br) +// Adds suport for dead-keys in I18N applications +// by Conectiva (http://www.conectiva.com.br)" +// +// $XdotOrg: xc/programs/xkbcomp/symbols/pc/br,v 1.4 2003/12/09 13:51:34 pascal Exp $ +// $XFree86: xc/programs/xkbcomp/symbols/pc/br,v 1.3 2003/04/19 12:22:11 pascal Exp $ + +xkb_symbols "abnt2" { + + include "pc/latin" + + name[Group1]="Brazil"; + + key { [ 2, at, twosuperior, onehalf ] }; + key { [ 3, numbersign, threesuperior, threequarters ] }; + key { [ 4, dollar, sterling, onequarter ] }; + key { [ 5, percent, cent, threeeighths ] }; + key { [ 6, dead_diaeresis, notsign, diaeresis ] }; + key { [ equal, plus, section, dead_ogonek ] }; + + key { [ e, E, EuroSign, EuroSign ] }; + key { [ r, R, registered, registered ] }; + key { [dead_acute, dead_grave, acute, grave ] }; + key { [bracketleft, braceleft, ordfeminine, dead_macron ] }; + + key { [ ccedilla, Ccedilla, dead_acute, dead_doubleacute] }; + key { [dead_tilde, dead_circumflex, asciitilde, asciicircum ] }; + key { [bracketright, braceright, masculine, masculine ] }; + + key { [apostrophe, quotedbl, notsign, notsign ] }; + + key { [ backslash, bar, masculine, dead_breve ] }; + key { [ c, C, copyright, copyright ] }; + key { [ m, M, mu, mu ] }; + key { [ semicolon, colon, dead_belowdot, dead_abovedot ] }; + +// ABNT-2 keyboard has this special key + + key { [ slash, question, degree, questiondown ] }; + + key { [ KP_Decimal ] }; + key { [ KP_Delete, KP_Separator ] }; + + include "keypad(comma)" + + include "level3(ralt_switch)" +}; + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + + include "pc/br(abnt2)" // for consistent naming + name[Group1]="Brazil - Eliminate dead keys"; + + key { [ 6, diaeresis, notsign, notsign ] }; + key { [apostrophe, grave ] }; + key { [ ccedilla, Ccedilla, acute, doubleacute ] }; + key { [asciitilde, asciicircum ] }; + key { [ semicolon, colon, dead_belowdot, abovedot ] }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/pc/bt /opt/SUNWut/lib/xkb/symbols/pc/bt --- /opt/SUNWut.orig/lib/xkb/symbols/pc/bt 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/pc/bt 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,88 @@ +// $XdotOrg$ +// +// Dzongkha / Tibetan layout for Bhutanese keyboard +// +///////////////////////////////////////////////////////////////// +// +// Based on the official layout for Dzongkha +// approved by the Department of Information Technology & +// Dzongkha Development Authority of the Government of Bhutan +// +// Copyright (C) 2004, Gregory Mokhin +// Layout map provided by Chris Fynn +///////////////////////////////////////////////////////////////// +// Version 0.97. Last modified: 09 Jan 2004 +///////////////////////////////////////////////////////////////// + +partial default alphanumeric_keys +xkb_symbols "basic" { + name[Group1]= "Bhutan"; + + key { [ U0F09, U0F0A, U0F6C, U0F6B ] }; + +// numbers e.a. + key { [ U0F21, U0F04, 1, exclam ] }; + key { [ U0F22, U0F05, 2, at ] }; + key { [ U0F23, U0F06, 3, numbersign ] }; + key { [ U0F24, U0F24, 4, dollar ] }; + key { [ U0F25, U0F25, 5, percent ] }; + key { [ U0F26, U0F08, 6, U0F01 ] }; + key { [ U0F27, U0F38, 7, ampersand ] }; + key { [ U0F28, U0F34, 8, asterisk ] }; + key { [ U0F29, U0F3C, 9, parenleft ] }; + key { [ U0F20, U0F3D, 0, parenright ] }; + key { [ U0F14, U0F7F, minus, underscore ] }; + key { [ U0F0D, U0F11, equal, plus ] }; + +// consonants ( ka kha ga nga ) + key { [ U0F40, U0F90, U0F88 ] }; + key { [ U0F41, U0F91, U0F89 ] }; + key { [ U0F42, U0F92 ] }; + key { [ U0F44, U0F94, U0F83, U0F82 ] }; + +// vowels ( i u e o ) + key { [ U0F72, U0F80, U0F1A ] }; + key { [ U0F74, U0F84, U0F1B ] }; + key { [ U0F7A, U0F7B, U0F1C ] }; + key { [ U0F7C, U0F7D, U0F1D, U0F17 ] }; + +// consonants ( ca cha ja nya ) + key { [ U0F45, U0F95, U0F1E, U0F18 ] }; + key { [ U0F46, U0F96, U0F1F, U0F19 ] }; + key { [ U0F47, U0F97, bracketleft, U0F3E ] }; + key { [ U0F49, U0F99, bracketright, U0F3F ] }; + +// consonants ( ta tha da na pa pha ba ma tsa tsha dza wa ) + key { [ U0F4F, U0F9F, U0F4A, U0F9A ] }; + key { [ U0F50, U0FA0, U0F4B, U0F9B ] }; + key { [ U0F51, U0FA1, U0F4C, U0F9C ] }; + key { [ U0F53, U0FA3, U0F4E, U0F9E ] }; + key { [ U0F54, U0FA4, U2039, U00AB ] }; + key { [ U0F55, U0FA5, U203A, U00BB ] }; + key { [ U0F56, U0FA6, U0F37, U0F35 ] }; + key { [ U0F58, U0FA8, U0F7E ] }; + key { [ U0F59, U0FA9, U0F39 ] }; + key { [ U0F5A, U0FAA, colon, semicolon ] }; + key { [ U0F5B, U0FAB, apostrophe, quotedbl ] }; + +// TODO: BKSL and LSGT are from gb layout, are there any variants? + key { [ U0F5D, U0FAD, backslash, U0FBA ] }; + key { [ U0F0D, U0F11, U0F10, U0F0F ] }; + +// consonants ( zha za 'a ya ra la sha sa ha a ) + key { [ U0F5E, U0FAE, U0F13, U0F36 ] }; + key { [ U0F5F, U0FAF, U0FBE, U0FBF ] }; + key { [ U0F60, U0F71, U0F03, U0FB0 ] }; + key { [ U0F61, U0FB1, U0F12, U0FBB ] }; + key { [ U0F62, U0FB2, U0F6A, U0FBC ] }; + key { [ U0F63, U0FB3, U0F8A, U0F88 ] }; + key { [ U0F64, U0FB4, U0F65, U0FB5 ] }; + key { [ U0F66, U0FB6, comma, less ] }; + key { [ U0F67, U0FB7, period, greater ] }; + key { [ U0F68, U0FB8, slash, question ] }; + +// space + key { [ U0F0B, space, U0F0C, U00A0 ] }; + + include "level3(ralt_switch)" +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/pc/by /opt/SUNWut/lib/xkb/symbols/pc/by --- /opt/SUNWut.orig/lib/xkb/symbols/pc/by 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/pc/by 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,76 @@ +// $XdotOrg$ +// based on +// belarusian standard keyboard +// Alexander Mikhailian +// +// +// $XFree86$ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + name[Group1]= "Belarus"; + + key { [ Cyrillic_io, Cyrillic_IO ] }; + key { [ bar, brokenbar ] }; + + key { [ 2, quotedbl ] }; + key { [ 4, semicolon ] }; + key { [ 5, percent ] }; + key { [ 6, colon ] }; + key { [ 7, question ] }; + + key { [ Cyrillic_shorti, Cyrillic_SHORTI ] }; + key { [ Cyrillic_tse, Cyrillic_TSE ] }; + key { [ Cyrillic_u, Cyrillic_U ] }; + key { [ Cyrillic_ka, Cyrillic_KA ] }; + key { [ Cyrillic_ie, Cyrillic_IE ] }; + key { [ Cyrillic_en, Cyrillic_EN ] }; + key { [Cyrillic_softsign,Cyrillic_SOFTSIGN ] }; + key { [ Cyrillic_ghe, Cyrillic_GHE ] }; + key { [ Cyrillic_sha, Cyrillic_SHA ] }; + key { [ Byelorussian_shortu, Byelorussian_SHORTU ]}; + key { [ Cyrillic_ze, Cyrillic_ZE ] }; + key { [ Cyrillic_ha, Cyrillic_HA ] }; + key { [ apostrophe, apostrophe ] }; + + key { [ Cyrillic_ef, Cyrillic_EF ] }; + key { [ Cyrillic_yeru, Cyrillic_YERU ] }; + key { [ Cyrillic_ve, Cyrillic_VE ] }; + key { [ Cyrillic_a, Cyrillic_A ] }; + key { [ Cyrillic_pe, Cyrillic_PE ] }; + key { [ Cyrillic_er, Cyrillic_ER ] }; + key { [ Cyrillic_o, Cyrillic_O ] }; + key { [ Cyrillic_el, Cyrillic_EL ] }; + key { [ Cyrillic_de, Cyrillic_DE ] }; + key { [ Cyrillic_zhe, Cyrillic_ZHE ] }; + key { [ Cyrillic_e, Cyrillic_E ] }; + + key { [ Cyrillic_ya, Cyrillic_YA ] }; + key { [ Cyrillic_che, Cyrillic_CHE ] }; + key { [ Cyrillic_es, Cyrillic_ES ] }; + key { [ Cyrillic_em, Cyrillic_EM ] }; + key { [ Ukrainian_i, Ukrainian_I ] }; + key { [ Cyrillic_te, Cyrillic_TE ] }; + key { [ Cyrillic_be, Cyrillic_BE ] }; + key { [ Cyrillic_yu, Cyrillic_YU ] }; + key { [ period, comma ] }; + + key { [ slash, bar ] }; + + // End alphanumeric section +}; + +partial alphanumeric_keys +xkb_symbols "winkeys" { + include "pc/by(basic)" + name[Group1]= "Belarus - Winkeys"; + key { [ 4, semicolon ] }; + key { [ 3, numbersign ] }; + key { [ 5, percent ] }; + key { [ 6, colon ] }; + key { [ 7, question ] }; + key { [ 8, asterisk ] }; + key { [ period, comma ] }; + key { [ slash, bar ] }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/pc/ca /opt/SUNWut/lib/xkb/symbols/pc/ca --- /opt/SUNWut.orig/lib/xkb/symbols/pc/ca 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/pc/ca 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,331 @@ +// $XdotOrg$ +// $XKeyboardConfig: xkbdesc/symbols/ca,v 1.10 2005/07/31 00:28:39 svu Exp $ + +default partial +xkb_symbols "fr" { + name[Group1] = "Canada"; + + key { [ numbersign, bar, backslash ] }; + key { [ 1, exclam, plusminus ] }; + key { [ 2, quotedbl, at ] }; + key { [ 3, slash, sterling ] }; + key { [ 4, dollar, cent ] }; + key { [ 5, percent, currency ] }; + key { [ 6, question, notsign ] }; + key { [ 7, ampersand, brokenbar ] }; + key { [ 8, asterisk, twosuperior ] }; + key { [ 9, parenleft, threesuperior ] }; + key { [ 0, parenright, onequarter ] }; + key { [ minus, underscore, onehalf ] }; + key { [ equal, plus, threequarters ] }; + + key { [ q, Q ] }; + key { [ w, W ] }; + key { [ e, E ] }; + key { [ r, R ] }; + key { [ t, T ] }; + key { [ y, Y ] }; + key { [ u, U ] }; + key { [ i, I ] }; + key { [ o, O, section ] }; + key { [ p, P, paragraph ] }; + key { [dead_circumflex, dead_circumflex, bracketleft ] }; + key { [ dead_cedilla, dead_diaeresis, bracketright ] }; + + key { [ a, A ] }; + key { [ s, S ] }; + key { [ d, D ] }; + key { [ f, F ] }; + key { [ g, G ] }; + key { [ h, H ] }; + key { [ j, J ] }; + key { [ k, K ] }; + key { [ l, L ] }; + key { [ semicolon, colon, asciitilde ] }; + key { [dead_grave, dead_grave, braceleft ] }; + key { [ less, greater, braceright ] }; + + key { [guillemotleft, guillemotright, degree] }; + key { [ z, Z ] }; + key { [ x, X ] }; + key { [ c, C ] }; + key { [ v, V ] }; + key { [ b, B ] }; + key { [ n, N ] }; + key { [ m, M, mu ] }; + key { [ comma, apostrophe, macron ] }; + key { [ period, period, hyphen ] }; + key { [ eacute, Eacute, dead_acute ] }; + + key { [ space, space, nobreakspace ] }; + + include "level3(ralt_switch)" +}; + +xkb_symbols "fr-dvorak" { + name[Group1] = "Canada - French Dvorak"; + + key { [ numbersign, bar, backslash ] }; + key { [ 1, exclam, plusminus ] }; + key { [ 2, quotedbl, at ] }; + key { [ 3, slash, sterling ] }; + key { [ 4, dollar, cent ] }; + key { [ 5, percent, currency ] }; + key { [ 6, question, notsign ] }; + key { [ 7, ampersand, brokenbar ] }; + key { [ 8, asterisk, twosuperior ] }; + key { [ 9, parenleft, threesuperior ] }; + key { [ 0, parenright, onequarter ] }; + key { [dead_circumflex, dead_circumflex, bracketleft ] }; + key { [ dead_cedilla, dead_diaeresis, bracketright ] }; + + key { [dead_grave, dead_grave, braceleft ] }; + key { [ comma, apostrophe, macron ] }; + key { [ period, period, hyphen ] }; + key { [ p, P, paragraph ] }; + key { [ y, Y ] }; + key { [ f, F ] }; + key { [ g, G ] }; + key { [ c, C ] }; + key { [ r, R ] }; + key { [ l, L ] }; + key { [ eacute, Eacute, dead_acute ] }; + key { [ equal, plus, threequarters ] }; + + key { [ a, A ] }; + key { [ o, O, section ] }; + key { [ e, E ] }; + key { [ u, U ] }; + key { [ i, I ] }; + key { [ d, D ] }; + key { [ h, H ] }; + key { [ t, T ] }; + key { [ n, N ] }; + key { [ s, S ] }; + key { [ minus, underscore, onehalf ] }; + key { [ less, greater, braceright ] }; + + key { [guillemotleft, guillemotright, degree] }; + key { [ semicolon, colon, asciitilde ] }; + key { [ q, Q ] }; + key { [ j, J ] }; + key { [ k, K ] }; + key { [ x, X ] }; + key { [ b, B ] }; + key { [ m, M, mu ] }; + key { [ w, W ] }; + key { [ v, V ] }; + key { [ z, Z ] }; + + key { [ space, space, nobreakspace ] }; + + include "level3(ralt_switch)" +}; + +partial +xkb_symbols "fr-legacy" { + + name[Group1] = "Canada - French (legacy)"; + + include "pc/ca(fr)" + + key { [ degree, degree, notsign ] }; + key { [ 1, exclam, onesuperior ] }; + + key { [ 3, numbersign, threesuperior ] }; + key { [ 4, dollar, onequarter ] }; + key { [ 5, percent, onehalf ] }; + key { [ 6, question, threequarters ] }; + key { [ 7, ampersand, braceleft ] }; + key { [ 8, asterisk, bracketleft ] }; + key { [ 9, parenleft, bracketright, plusminus ] }; + key { [ 0, parenright, braceright ] }; + key { [ minus, underscore, bar, questiondown] }; + key { [ equal, plus, dead_cedilla ] }; + + key { [ r, R, paragraph, registered ] }; + key { [ y, Y, yen ] }; + key { [ o, O, oslash, Ooblique ] }; + key { [ p, P, thorn, THORN ] }; + key { [dead_circumflex, dead_circumflex, degree ] }; + key { [ ccedilla, Ccedilla, dead_tilde, dead_diaeresis ] }; + + key { [ a, A, ae, AE ] }; + key { [ s, S, ssharp, section ] }; + key { [ d, D, eth, ETH ] }; + key { [ f, F, ordfeminine ] }; + key { [ semicolon, colon, dead_acute, dead_acute ] }; + key { [ egrave, Egrave ] }; + key { [ agrave, Agrave, dead_grave ] }; + + key { [ ugrave, Ugrave, backslash, bar ] }; + key { [ z, Z, guillemotleft ] }; + key { [ x, X, guillemotright ] }; + key { [ c, C, cent, copyright ] }; + key { [ m, M, mu, masculine ] }; + key { [ comma, apostrophe, less ] }; + key { [ period, period, greater ] }; + key { [ eacute, Eacute, slash ] }; +}; + +partial +xkb_symbols "multi" { + + name[Group1] = "Canada - Multilingual"; + + include "pc/ca(fr)" + + key { [ slash, backslash, bar ] }; + key { [ 1, exclam ] }; + key { [ 2, at ] }; + key { [ 3, numbersign ] }; + key { [ 4, dollar ] }; + key { [ 5, percent ] }; + key { [ 6, question ] }; + key { [ 7, ampersand, braceleft ] }; + key { [ 8, asterisk, braceright ] }; + key { [ 9, parenleft, bracketleft ] }; + key { [ 0, parenright, bracketright ] }; + key { [ minus, underscore ] }; + key { [ equal, plus, notsign ] }; + + key { [ o, O ] }; + key { [ p, P ] }; + key { [dead_circumflex, dead_diaeresis, dead_grave ] }; + key { [ ccedilla, Ccedilla, asciitilde ] }; + + key { [ semicolon, colon, degree ] }; + key { [ egrave, Egrave ] }; + key { [ agrave, Agrave ] }; + + key { [ ugrave, Ugrave ] }; + key { [ z, Z, guillemotleft ] }; + key { [ x, X, guillemotright ] }; + key { [ comma, apostrophe, less ] }; + key { [ period, quotedbl, greater ] }; + key { [ eacute, Eacute ] }; +}; + +partial +xkb_symbols "multi-2gr" { + + name[Group1] = "Canada - Multilingual, second part"; + + key { [ VoidSymbol, hyphen ] }; + key { [ onesuperior, exclamdown ] }; + key { [ twosuperior, VoidSymbol ] }; + key { [ threesuperior, sterling ] }; + key { [ onequarter, currency ] }; + key { [ onehalf,threeeighths ] }; + key { [ threequarters, fiveeighths ] }; + key { [ VoidSymbol,seveneighths ] }; + key { [ VoidSymbol, trademark ] }; + key { [ VoidSymbol, plusminus ] }; + + key { [ VoidSymbol, questiondown] }; + key { [ dead_cedilla, dead_ogonek ] }; + + key { [ VoidSymbol, Greek_OMEGA ] }; + key { [ lstroke, Lstroke ] }; + key { [ oe, OE ] }; + key { [ paragraph, registered ] }; + key { [ tslash, Tslash ] }; + key { [ leftarrow, yen ] }; + key { [ downarrow, uparrow ] }; + key { [ rightarrow, idotless ] }; + key { [ oslash, Ooblique ] }; + key { [ thorn, THORN ] }; + key { [ VoidSymbol, dead_abovering ] }; + key { [ dead_tilde, dead_macron ] }; + + key { [ ae, AE ] }; + key { [ ssharp, section ] }; + key { [ eth, ETH ] }; + key { [ VoidSymbol, ordfeminine ] }; + key { [ eng, ENG ] }; + key { [ hstroke, Hstroke ] }; + key { [ U0133, U0132 ] }; + key { [ kra, VoidSymbol ] }; + key { [ U0140, U013F ] }; + key { [ dead_acute, dead_doubleacute ] }; + key { [ VoidSymbol, dead_caron ] }; + key { [ VoidSymbol, dead_breve ] }; + + + key { [ VoidSymbol, brokenbar ] }; + + key { [ cent, copyright ] }; + key { [ leftdoublequotemark, leftsinglequotemark ] }; + key { [ rightdoublequotemark, rightsinglequotemark ] }; + key { [ U0149, U266A ] }; + key { [ mu, masculine ] }; + key { [ Greek_horizbar, multiply ] }; + key { [ periodcentered, division ] }; + key { [ VoidSymbol, dead_abovedot ] }; + +}; + +// based on +// Inuktitut keyboard for X11 +// written by Pablo Saratxaga + +alphanumeric_keys +xkb_symbols "ike" { + + name[Group1]= "Canada - Inuktitut"; + + key { [ 0x01001595, 1 ] }; + key { [ 0x01001449, 2 ] }; + key { [ 0x01001550, 3 ] }; + key { [ 0x01001483, 4 ] }; + key { [ 0x01001466, 5 ] }; + key { [ 0x01001585, 6 ] }; + key { [ 0x010014bb, 7 ] }; + key { [ 0x010014d0, 8 ] }; + key { [ 0x010014ea, 9 ] }; + key { [ 0x0100153e, 0 ] }; + key { [ minus, underscore ] }; + key { [ 0x0100155d, equal ] }; + + key { [ 0x0100158f, 0x0100148b ] }; + key { [ 0x01001403, 0x01001431 ] }; + key { [ 0x0100157f, 0x01001546 ] }; + key { [ 0x0100146d, 0x01001596 ] }; + key { [ 0x0100144e, 0x01001671 ] }; + key { [ 0x010014ef, 0x01001673 ] }; + key { [ 0x010014a5, 0x01001675 ] }; + key { [ 0x010014c2, 0x010015a4 ] }; + key { [ 0x010014d5, 0x010015a0 ] }; + key { [ 0x01001528, 0x010015a6 ] }; + key { [ 0x010014a1, 0x01001505 ] }; + key { [ dead_abovedot, 0x0100141e] }; + + key { [ 0x01001591, 0x0100148d ] }; + key { [ 0x01001405, 0x01001433 ] }; + key { [ 0x01001581, 0x01001548 ] }; + key { [ 0x0100146f, 0x01001555 ] }; + key { [ 0x01001450, parenleft ] }; + key { [ 0x010014f1, parenright ] }; + key { [ 0x010014a7, 0x0100152a ] }; + key { [ 0x010014c4, 0x01001557 ] }; + key { [ 0x010014d7, 0x010015a2 ] }; + key { [ semicolon, colon ] }; + key { [ apostrophe, quotedbl ] }; + + key { [ 0x01001593, 0x01001490 ] }; + key { [ 0x0100140a, 0x01001438 ] }; + key { [ 0x01001583, 0x0100154b ] }; + key { [ 0x01001472, question ] }; + key { [ 0x01001455, 0x0100157c ] }; + key { [ 0x010014f4, 0x010014c7 ] }; + key { [ 0x010014aa, 0x010014da ] }; + key { [ comma, less ] }; + key { [ period, greater ] }; + key { [ 0x0100152d, 0x01001559 ] }; + + key { [ 0x0100157b, 0x01001575 ] }; + key { [ 0x01001579, 0x01001577 ] }; + key { [ backslash, bar ] }; + +// End alphanumeric section +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/pc/ch /opt/SUNWut/lib/xkb/symbols/pc/ch --- /opt/SUNWut.orig/lib/xkb/symbols/pc/ch 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/pc/ch 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,123 @@ +// $XdotOrg$ +// $XKeyboardConfig: xkbdesc/symbols/ch,v 1.8 2005/01/16 02:18:20 svu Exp $ + +// $Xorg: ch,v 1.3 2000/08/17 19:54:42 cpqbld Exp $ + + + + +// $XFree86: xc/programs/xkbcomp/symbols/ch,v 3.6 2002/11/25 14:05:06 eich Exp $ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + include "pc/latin" + + // Alphanumeric section + name[Group1]= "Switzerland"; + key { [ section, degree ] }; + key { [ 1, plus, bar, exclamdown ] }; + key { [ 2, quotedbl, at, oneeighth ] }; + key { [ 3, asterisk, numbersign ] }; + key { [ 4, ccedilla ] }; + key { [ 5, percent ] }; + key { [ 6, ampersand, notsign ] }; + key { [ 7, slash, brokenbar ] }; + key { [ 8, parenleft, cent ] }; + key { [ 9, parenright ] }; + key { [ 0, equal ] }; + key { [ apostrophe, question, dead_acute ] }; + key { [ dead_circumflex, dead_grave, dead_tilde ] }; + + key { [ e, E, EuroSign ] }; + key { [ z, Z ] }; + key { [ udiaeresis, egrave, bracketleft ] }; + key { [ dead_diaeresis, exclam, bracketright ] }; + + key { [ odiaeresis, eacute ] }; + key { [ adiaeresis, agrave, braceleft ] }; + key { [ dollar, sterling, braceright ] }; + + key { [ less, greater, backslash, brokenbar ] }; + key { [ y, Y ] }; + key { [ comma, semicolon ] }; + key { [ period, colon ] }; + key { [ minus, underscore ] }; + + include "level3(ralt_switch)" +}; + +partial alphanumeric_keys +xkb_symbols "de" { + include "pc/ch(basic)" +}; + +partial alphanumeric_keys +xkb_symbols "de_Sundeadkeys" { + // modify the basic Swiss German layout to use Sun dead keys + include "pc/ch(basic)" + key { [ apostrophe, question, SunFA_Acute ] }; + key { [ SunFA_Circum, SunFA_Grave, SunFA_Tilde ] }; + key { [ SunFA_Diaeresis, exclam, bracketright ] }; +}; + +partial alphanumeric_keys +xkb_symbols "de_sundeadkeys" { + include "pc/ch(de_Sundeadkeys)" + name[Group1]= "Switzerland - German, Sun dead keys"; +}; + +partial alphanumeric_keys +xkb_symbols "de_nodeadkeys" { + // modify the basic Swiss German layout not to have any dead keys + include "pc/ch(basic)" + name[Group1]= "Switzerland - German, eliminate dead keys"; + key { [ apostrophe, question, acute ] }; + key { [ asciicircum, grave, asciitilde ] }; + key { [ diaeresis, exclam, bracketright ] }; +}; + +partial alphanumeric_keys +xkb_symbols "fr" { + + // Describes the differences between a very simple US/ASCII + // keyboard and a very simple Swiss/French keybaord + + include "pc/ch(basic)" + name[Group1]= "Switzerland - French"; + + override key { + [ egrave, udiaeresis, bracketleft ] + }; + override key { + [ eacute, odiaeresis ] + }; + override key { + [ agrave, adiaeresis, braceleft ] + }; +}; + +partial alphanumeric_keys +xkb_symbols "fr_Sundeadkeys" { + // modify the basic Swiss French layout to use Sun dead keys + include "pc/ch(fr)" + key { [ apostrophe, question, SunFA_Acute ] }; + key { [ SunFA_Circum, SunFA_Grave, SunFA_Tilde ] }; + key { [ SunFA_Diaeresis, exclam, bracketright ] }; +}; + +partial alphanumeric_keys +xkb_symbols "fr_sundeadkeys" { + include "pc/ch(fr_Sundeadkeys)" + name[Group1]= "Switzerland - French, Sun dead keys"; +}; + +partial alphanumeric_keys +xkb_symbols "fr_nodeadkeys" { + // modify the basic Swiss French layout not to have any dead keys + include "pc/ch(fr)" + name[Group1]= "Switzerland - French, eliminate dead keys"; + key { [ apostrophe, question, acute ] }; + key { [ asciicircum, grave, asciitilde ] }; + key { [ diaeresis, exclam, bracketright ] }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/pc/cz /opt/SUNWut/lib/xkb/symbols/pc/cz --- /opt/SUNWut.orig/lib/xkb/symbols/pc/cz 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/pc/cz 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,108 @@ +// $XdotOrg$ +// $XFree86: xc/programs/xkbcomp/symbols/pc/cz,v 1.2 2002/11/22 04:02:22 dawes Exp $ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + // This layout conforms to a new cz compromise standard designed + // to satisfy most unix, windows and mac users. + // 2001 by Kamil Toman + + include "pc/latin" + + name[Group1]= "Czech"; + + key { [ semicolon, dead_abovering, grave, asciitilde ] }; + key { [ plus, 1, exclam, dead_tilde ] }; + key { [ ecaron, 2, at, dead_caron ] }; + key { [ scaron, 3, numbersign, dead_circumflex ] }; + key { [ ccaron, 4, dollar, dead_breve ] }; + key { [ rcaron, 5, percent, dead_abovering ] }; + key { [ zcaron, 6, asciicircum, dead_ogonek ] }; + key { [ yacute, 7, ampersand, dead_grave ] }; + key { [ aacute, 8, asterisk, dead_abovedot] }; + key { [ iacute, 9, braceleft, dead_acute ] }; + key { [ eacute, 0, braceright, dead_doubleacute ] }; + key { [ equal, percent, NoSymbol, dead_diaeresis ] }; + key { [dead_acute, dead_caron, dead_macron, dead_cedilla ] }; + + key { [ q, Q, backslash, NoSymbol ] }; + key { [ w, W, bar, Nosymbol ] }; + key { [ e, E, EuroSign, NoSymbol ] }; + key { [ r, R, NoSymbol, NoSymbol ] }; + key { [ t, T, NoSymbol, NoSymbol ] }; + key { [ z, Z, NoSymbol, NoSymbol ] }; + key { [ u, U, NoSymbol, NoSymbol ] }; + key { [ i, I, NoSymbol, NoSymbol ] }; + key { [ o, O, NoSymbol, NoSymbol ] }; + key { [ p, P, NoSymbol, NoSymbol ] }; + + key { [ uacute, slash, bracketleft, division ] }; + key { [parenright, parenleft, bracketright, multiply ] }; + + key { [ a, A, asciitilde, NoSymbol ] }; + key { [ s, S, dstroke, NoSymbol ] }; + key { [ d, D, Dstroke, NoSymbol ] }; + key { [ f, F, bracketleft, NoSymbol ] }; + key { [ g, G, bracketright, NoSymbol ] }; + key { [ h, H, grave, NoSymbol ] }; + key { [ j, J, apostrophe, NoSymbol ] }; + key { [ k, K, lstroke, NoSymbol ] }; + key { [ l, L, Lstroke, NoSymbol ] }; + + key { [ uring, quotedbl, dollar, NoSymbol ] }; + key { [ section, exclam, apostrophe, ssharp ] }; + key { [ EuroSign, dead_diaeresis, NoSymbol, NoSymbol ] }; + key { [dead_diaeresis, apostrophe, backslash, bar ] }; + + key { [ backslash, bar, slash, NoSymbol ] }; + key { [ y, Y, degree, NoSymbol ] }; + key { [ x, X, numbersign, Nosymbol ] }; + key { [ c, C, ampersand, NoSymbol ] }; + key { [ v, V, at, NoSymbol ] }; + key { [ b, B, braceleft, NoSymbol ] }; + key { [ n, N, braceright, NoSymbol ] }; + key { [ m, M, asciicircum, NoSymbol ] }; + key { [ comma, question, less, NoSymbol ] }; + key { [ period, colon, greater, NoSymbol ] }; + key { [ minus, underscore, asterisk, NoSymbol ] }; + + key { [ space, space, nobreakspace, nobreakspace ] }; + + key { type[Group1]="FOUR_LEVEL_KEYPAD", + [ KP_Delete, comma, KP_Delete, KP_Decimal ] }; + + include "level3(ralt_switch)" +}; + + +// Use instead of (useful for keyboard without key) +xkb_symbols "bksl" { + include "pc/cz(basic)" + name[Group1]= "Czechia - With <\|> key"; + + key { [ backslash, bar, slash, NoSymbol ] }; +}; + +partial alphanumeric_keys +xkb_symbols "qwerty" { + + // This layout should work exactly as a cz with the exception + // of 'Z' and 'Y' keys, which are in the qwerty style (ie. swapped). + // 2001 by Kamil Toman + + include "pc/cz(basic)" + name[Group1]= "Czechia - qwerty"; + + key { [ z, Z, degree, NoSymbol ] }; + key { [ y, Y, NoSymbol, NoSymbol ] }; +}; + +// Use instead of (useful for keyboard without key) +xkb_symbols "qwerty_bksl" { + include "pc/cz(qwerty)" + + name[Group1]= "Czechia - qwerty, extended Backslash"; + + key { [ backslash, bar, slash, NoSymbol ] }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/pc/de /opt/SUNWut/lib/xkb/symbols/pc/de --- /opt/SUNWut.orig/lib/xkb/symbols/pc/de 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/pc/de 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,172 @@ +// $XdotOrg$ +// based on a keyboard map from an 'xkb/symbols/de' file +// +// $XFree86: xc/programs/xkbcomp/symbols/pc/de,v 1.6 2003/09/08 13:12:51 pascal Exp $ + +default +xkb_symbols "basic" { + + include "pc/latin(type4)" + + name[Group1]="Germany"; + + key { [ 2, quotedbl, twosuperior, oneeighth ] }; + key { [ 3, section, threesuperior, sterling ] }; + key { [ 4, dollar, onequarter, currency ] }; + key { [ ssharp, question, backslash, questiondown ] }; + key { [dead_acute, dead_grave, dead_cedilla, dead_ogonek ] }; + + key { [ e, E, EuroSign, EuroSign ] }; + key { [ z, Z, leftarrow, yen ] }; + key { [udiaeresis, Udiaeresis, dead_diaeresis, dead_abovering ] }; + key { [ plus, asterisk, dead_tilde, dead_macron ] }; + + key { [odiaeresis, Odiaeresis, dead_doubleacute, dead_doubleacute ] }; + key { [adiaeresis, Adiaeresis, dead_circumflex, dead_caron] }; + key { [dead_circumflex, degree, notsign, notsign ] }; + + key { [numbersign, apostrophe, dead_grave, dead_breve ] }; + key { [ y, Y, guillemotleft, less ] }; + + include "keypad(comma)" + + include "level3(ralt_switch)" +}; + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + + // modify the basic German layout to not have any dead keys + + include "pc/de(basic)" + name[Group1]="Germany - Eliminate dead keys"; + + key { [asciicircum, degree, notsign, notsign ] }; + key { [apostrophe, grave, cedilla, cedilla ] }; + key { [udiaeresis, Udiaeresis, diaeresis, diaeresis ] }; + key { [ plus, asterisk, asciitilde, macron ] }; + key { [odiaeresis, Odiaeresis, doubleacute, doubleacute ] }; + key { [adiaeresis, Adiaeresis, asciicircum, asciicircum ] }; + key { [numbersign, apostrophe, grave, grave ] }; + key { [ minus, underscore, dead_belowdot, abovedot ] }; +}; + +partial alphanumeric_keys +xkb_symbols "deadgraveacute" { + // modify the basic German layout to have only acute and grave + // as dead keys (tilde and circumflex are needed as spacing characters + // in many programming languages) + + include "pc/de(basic)" + name[Group1]="Germany - Dead grave acute"; + + key { [asciicircum, degree, notsign, notsign ] }; + key { [ plus, asterisk, asciitilde, dead_macron ] }; + key { [numbersign, apostrophe, grave, grave ] }; +}; + +partial alphanumeric_keys +xkb_symbols "deadacute" { + // modify the basic German layout to have only acute as + // dead keys (ASCII grave, tilde and circumflex are needed as + // spacing characters in many programming languages and text formatters) + + include "pc/de(deadgraveacute)" + + name[Group1]="Germany - Dead acute"; + + key { [dead_acute, grave, dead_cedilla, dead_ogonek ] }; + key { [numbersign, apostrophe, dead_grave, dead_grave ] }; +}; + +partial alphanumeric_keys +xkb_symbols "ro" { + // add romanian-specific letters to the basic German layout. + // Romanian symbols are accessible with combination of and + // 'a', 's', 't', 'i', ' (ä)' (+ for capital letters). + // To view romanian-specific symbols, add "export LC_CTYPE=ro_RO" + // or "export LC_CTYPE=de_DE.utf8" to your .profile. + + include "pc/de(basic)" + + name[Group1]="Germany - Romanian keyboard with German letters"; + + key { [ t, T, tcedilla, Tcedilla ] }; + key { [ i, I, icircumflex, Icircumflex ] }; + key { [ a, A, acircumflex, Acircumflex ] }; + key { [ s, S, scedilla, Scedilla ] }; + key { [ adiaeresis, Adiaeresis, abreve, Abreve ] }; +}; + +partial alphanumeric_keys +xkb_symbols "ro_nodeadkeys" { + // add romanian-specific letters to the German nodeadkeys layout. + // Read the comment for de_ro ! + + include "pc/de(nodeadkeys)" + name[Group1]="Germany - Romanian keyboard with German letters, eliminate dead keys"; + + key { [ t, T, tcedilla, Tcedilla ] }; + key { [ i, I, icircumflex, Icircumflex ] }; + key { [ a, A, acircumflex, Acircumflex ] }; + key { [ s, S, scedilla, Scedilla ] }; + key { [ adiaeresis, Adiaeresis, abreve, Abreve ] }; +}; + +// German Dvorak keymap by Thorsten Staerk (www.staerk.de/thorsten) +// Have acute and grave as dead keys, tilde and circumflex alive as they are needed +// in many programming languages. +// to use this keymap, use a 105-key-keyboard and the command setxkbmap -model pc105 -layout dvorak -variant de +// source: http://www-lehre.informatik.uni-osnabrueck.de/~rfreund/dvorak.php +partial alphanumeric_keys +xkb_symbols "dvorak" { + include "pc/us(dvorak)" + + name[Group1]="Germany - Dvorak"; + + key { [ asciicircum, degree ] }; + + key { [ 1, exclam, onesuperior ] }; + key { [ 2, quotedbl, twosuperior ] }; + key { [ 3, section, threesuperior ] }; + key { [ 4, dollar, bar ] }; + key { [ 5, percent, bar ] }; + key { [ 6, ampersand, brokenbar ] }; + key { [ 7, slash, braceleft ] }; + key { [ 8, parenleft, bracketleft ] }; + key { [ 9, parenright, bracketright ] }; + key { [ 0, equal, braceright ] }; + key { [ plus, asterisk, asciitilde ] }; + key { [ less, greater, dead_grave ] }; + + key { [ udiaeresis, Udiaeresis, at ] }; + key { [ comma, semicolon, dead_diaeresis ] }; + key { [ period, colon ] }; + key { [ c, C, copyright, Cacute ] }; + key { [ t, T, trademark ] }; + key { [ z, Z, zabovedot, Zabovedot ] }; + key { [ question, ssharp ] }; + key { [ slash, backslash, dead_acute ] }; + + key { [ a, A, at, aogonek ] }; + key { [ o, O, oacute, Oacute ] }; + key { [ e, E, EuroSign, eogonek ] }; + key { [ i, I ] }; + key { [ u, U ] }; + key { [ h, H ] }; + key { [ d, D ] }; + key { [ r, R, registered ] }; + key { [ n, N, nacute, Nacute ] }; + key { [ s, S, sacute, Sacute] }; + key { [ l, L, lstroke, Lstroke ] }; + + key { [ odiaeresis, Odiaeresis ] }; + key { [ q, Q, at ] }; + key { [ m, M, mu ] }; + key { [ numbersign, apostrophe ] }; + + key { [ minus, underscore, hyphen, diaeresis] }; + + key { [ adiaeresis, Adiaeresis, bar ] }; + +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/pc/dk /opt/SUNWut/lib/xkb/symbols/pc/dk --- /opt/SUNWut.orig/lib/xkb/symbols/pc/dk 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/pc/dk 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,46 @@ +// $XdotOrg$ +// based on a keyboard map from an 'xkb/symbols/dk' file +// +// $XFree86: xc/programs/xkbcomp/symbols/pc/dk,v 1.3 2002/12/19 01:07:56 dawes Exp $ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + include "pc/latin(type2)" + + name[Group1]="Denmark"; + + key { [ plus, question, plusminus, questiondown ] }; + key { [dead_acute, dead_grave, bar, brokenbar ] }; + + + key { [ ae, AE, dead_acute, dead_doubleacute ] }; + key { [ oslash, Ooblique, dead_circumflex, dead_caron ] }; + key { [ onehalf, section, threequarters, paragraph ] }; + + key { [apostrophe, asterisk, dead_doubleacute, multiply ] }; + + key { [ less, greater, backslash, notsign ] }; + + include "keypad(comma)" + + include "level3(ralt_switch)" +}; + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + + include "pc/dk(basic)" + + name[Group1]="Denmark - Eliminate dead keys"; + + key { [ acute, grave, bar, ogonek ] }; + key { [ aring, Aring, diaeresis, degree ] }; + key { [ diaeresis, asciicircum, asciitilde, macron ] }; + key { [ ae, AE, acute, doubleacute ] }; + key { [ oslash, Ooblique, asciicircum, caron ] }; + key { [apostrophe, asterisk, doubleacute, multiply ] }; + key { [ comma, semicolon, cedilla, ogonek ] }; + key { [ period, colon, periodcentered, abovedot ] }; + +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/pc/ee /opt/SUNWut/lib/xkb/symbols/pc/ee --- /opt/SUNWut.orig/lib/xkb/symbols/pc/ee 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/pc/ee 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,56 @@ +// $XdotOrg$ +// based on +// Estonian XKB-keymap by Ville Hallik +// +// $XFree86: xc/programs/xkbcomp/symbols/pc/ee,v 1.2 2002/11/22 04:03:28 dawes Exp $ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + // Describes the differences between a very simple en_US + // keyboard and a very simple Estonian keyboard + // This layout conforms to both EVS8:1993 and EVS8:2000 standards + + include "pc/latin(type4)" + + name[Group1]="Estonia"; + + key { [ 3, numbersign, sterling, sterling ] }; + key { [ 4, currency, dollar, dollar ] }; + key { [ plus, question, backslash, questiondown ] }; + key { [dead_acute, dead_grave, grave, apostrophe ] }; + + key { [ e, E, EuroSign, EuroSign ] }; + key { [udiaeresis, Udiaeresis, dead_diaeresis, dead_abovering ] }; + key { [ otilde, Otilde, section, dead_macron ] }; + + key { [ s, S, scaron, Scaron ] }; + key { [odiaeresis, Odiaeresis, dead_acute, dead_doubleacute ] }; + key { [adiaeresis, Adiaeresis, asciicircum, dead_caron ] }; + key { [dead_caron, dead_tilde, notsign, notsign ] }; + + key { [apostrophe, asterisk, onehalf, dead_breve ] }; + key { [ z, Z, zcaron, Zcaron ] }; + key { [ comma, semicolon, less, multiply ] }; + key { [ period, colon, greater, division ] }; + + include "level3(ralt_switch)" +}; + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + + // Modifies the basic Estonian layout to eliminate all dead keys + + include "pc/ee(basic)" + name[Group1]="Estonia - Eliminate dead keys"; + + key { [asciicircum,asciitilde ] }; + key { [apostrophe, grave ] }; + key { [udiaeresis, Udiaeresis, diaeresis, degree ] }; + key { [ otilde, Otilde, section, macron ] }; + key { [odiaeresis, Odiaeresis, acute, doubleacute ] }; + key { [adiaeresis, Adiaeresis, asciicircum, caron ] }; + key { [apostrophe, asterisk, onehalf, breve ] }; + key { [ minus, underscore, dead_belowdot, abovedot ] }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/pc/es /opt/SUNWut/lib/xkb/symbols/pc/es --- /opt/SUNWut.orig/lib/xkb/symbols/pc/es 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/pc/es 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,125 @@ +// $XdotOrg$ +// based on a keyboard +// Modified for a real Spanish Keyboard by Jon Tombs +// +// $XFree86: xc/programs/xkbcomp/symbols/pc/es,v 1.2 2002/11/22 04:03:28 dawes Exp $ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + include "pc/latin(type4)" + + name[Group1]="Spain"; + + key { [ 1, exclam, bar, exclamdown ] }; + key { [ 3, periodcentered, numbersign, sterling ] }; + key { [ 4, dollar, asciitilde, dollar ] }; + key { [ 6, ampersand, notsign, fiveeighths ] }; + key { [apostrophe, question, backslash, questiondown ] }; + key { [exclamdown, questiondown, asciitilde, asciitilde ] }; + + key { [dead_grave, dead_circumflex, bracketleft, dead_abovering ] }; + key { [ plus, asterisk, bracketright, dead_macron ] }; + + key { [ ntilde, Ntilde, asciitilde, dead_doubleacute ] }; + key { [dead_acute, dead_diaeresis, braceleft, braceleft ] }; + key { [ masculine, ordfeminine, backslash, backslash ] }; + + key { [ ccedilla, Ccedilla, braceright, dead_breve ] }; + + include "level3(ralt_switch)" +}; + +partial alphanumeric_keys +xkb_symbols "Sundeadkeys" { + + include "pc/es(basic)" + + name[Group1]="Spain - Sun dead keys"; + + key { [SunFA_Acute, SunFA_Diaeresis, braceleft, braceleft ] }; + key { [SunFA_Grave, SunFA_Circum, bracketleft, dead_abovering ] }; +}; + +partial alphanumeric_keys +xkb_symbols "sundeadkeys" { + + include "pc/es(Sundeadkeys)" +}; + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + + include "pc/es(basic)" + + name[Group1]="Spain - Eliminate dead keys"; + + key { [ grave, asciicircum, bracketleft, degree ] }; + key { [ plus, asterisk, bracketright, macron ] }; + key { [ ntilde, Ntilde, asciitilde, doubleacute ] }; + key { [ acute, diaeresis, braceleft, braceleft ] }; + key { [ ccedilla, Ccedilla, braceright, breve ] }; + key { [ minus, underscore, dead_belowdot, abovedot ] }; +}; + +// Spanish mapping (note R-H exchange) +partial alphanumeric_keys +xkb_symbols "dvorak" { + + name[Group1]="Spain - Dvorak"; + + // Alphanumeric section + key {[ masculine, ordfeminine, backslash, degree ]}; + key {[ 1, exclam, bar, onesuperior ]}; + key {[ 2, quotedbl, at, twosuperior ]}; + key {[ 3, periodcentered, numbersign, threesuperior ]}; + key {[ 4, dollar, asciitilde, onequarter ]}; + key {[ 5, percent, brokenbar, fiveeighths ]}; + key {[ 6, ampersand, notsign, threequarters ]}; + key {[ 7, slash, onehalf, seveneighths ]}; + key {[ 8, parenleft, oneeighth, threeeighths ]}; + key {[ 9, parenright, asciicircum ]}; + key {[ 0, equal, grave, dead_doubleacute ]}; + key {[ apostrophe, question, dead_macron, dead_ogonek ]}; + key {[ exclamdown, questiondown, dead_breve, dead_abovedot ]}; + + key {[ period, colon ]}; + key {[ comma, semicolon ]}; + key {[ ntilde, Ntilde, lstroke, Lstroke ]}; + key {[ p, P, paragraph ]}; + key {[ y, Y, yen ]}; + key {[ f, F, tslash, Tslash ]}; + key {[ g, G, dstroke, Dstroke ]}; + key {[ c, C, cent, copyright ]}; + key {[ h, H, hstroke, Hstroke ]}; + key {[ l, L, sterling ]}; + key {[ dead_grave, dead_circumflex, bracketleft, dead_caron ]}; + key {[ plus, asterisk, bracketright, plusminus ]}; + + key {[ a, A, ae, AE ]}; + key {[ o, O, oslash, Oslash ]}; + key {[ e, E, EuroSign ]}; + key {[ u, U, aring, Aring ]}; + key {[ i, I, oe, OE ]}; + key {[ d, D, eth, ETH ]}; + key {[ r, R, registered, trademark ]}; + key {[ t, T, thorn, THORN ]}; + key {[ n, N, eng, ENG ]}; + key {[ s, S, ssharp, section ]}; + key {[ dead_acute, dead_diaeresis, braceleft, dead_tilde ]}; + key {[ ccedilla, Ccedilla, braceright, dead_cedilla ]}; + + key {[ less, greater, guillemotleft, guillemotright ]}; + key {[ minus, underscore, hyphen, macron ]}; + key {[ q, Q, currency ]}; + key {[ j, J ]}; + key {[ k, K, kra ]}; + key {[ x, X, multiply, division ]}; + key {[ b, B ]}; + key {[ m, M, mu ]}; + key {[ w, W ]}; + key {[ v, V ]}; + key {[ z, Z ]}; + + include "level3(ralt_switch)" +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/pc/fi /opt/SUNWut/lib/xkb/symbols/pc/fi --- /opt/SUNWut.orig/lib/xkb/symbols/pc/fi 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/pc/fi 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,90 @@ +// $XdotOrg$ +// based on a keyboard map from an 'xkb/symbols/fi' file +// +// $XFree86: xc/programs/xkbcomp/symbols/pc/fi,v 1.9 2003/01/29 17:17:31 dawes Exp $ + + +partial default alphanumeric_keys +xkb_symbols "basic" { + include "pc/latin(type2)" + include "pc/fi(fi)" +}; + +partial alphanumeric_keys +xkb_symbols "fi" { + + // a Finnish keyboard with dead key support and all of + // ISO-8859-1 and ISO-8859-15 characters available. + + name[Group1]="Finland"; + + key { [ section, onehalf, onequarter, threequarters ] }; + key { [ less, greater, bar, brokenbar ] }; + // AltGr+ is pressed accidentally too often after AltGr+, + // hence AltGr+ produces now space, not nobreakspace. + key { [ space, space, space, nobreakspace ] }; + key { [ 1, exclam, exclamdown, onesuperior ] }; + key { [ 2, quotedbl, at, twosuperior ] }; + key { [ 3, numbersign, sterling, threesuperior ] }; + key { [ 4, currency, dollar, cent ] }; + key { [ 5, percent, EuroSign, masculine ] }; + key { [ 6, ampersand, yen, ordfeminine ] }; + key { [ 7, slash, braceleft, plusminus ] }; + key { [ 8, parenleft, bracketleft, guillemotleft ] }; + key { [ 9, parenright, bracketright, guillemotright ] }; + key { [ 0, equal, braceright, degree ] }; + key { [ period, colon, periodcentered, notsign ] }; + key { [ z, Z, zcaron, Zcaron ] }; + key { [ x, X, multiply, division ] }; + key { [ c, C, copyright, cent ] }; + key { [ b, B, ssharp, NoSymbol ] }; + key { [ n, N, ntilde, Ntilde ] }; + key { [ m, M, mu, NoSymbol ] }; + key { [ minus, underscore, hyphen, macron ] }; + key { [ s, S, scaron, Scaron ] }; + key { [ d, D, eth, ETH ] }; + key { [ e, E, EuroSign, cent ] }; + key { [ r, R, registered, NoSymbol ] }; + key { [ t, T, thorn, THORN ] }; + key { [ p, P, paragraph, NoSymbol ] }; + key { [ odiaeresis, Odiaeresis, oslash, Ooblique ] }; + key { [ plus, question, backslash, questiondown ] }; + key { [ adiaeresis, Adiaeresis, ae, AE ] }; + key { [ apostrophe, asterisk ] }; + key { [ aring, Aring, oe, OE ] }; + key { [ dead_acute, dead_grave ] }; + key { [ dead_diaeresis, dead_circumflex, dead_tilde, dead_caron ] }; + + // End alphanumeric section, begin "Keypad" + include "keypad(comma)" + // End "Keypad" section + + include "level3(ralt_switch)" +}; + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + include "pc/latin(type2)" + include "pc/latin(type2_nodeadkeys)" + include "pc/fi(fi)" + + name[Group1]="Finland - Eliminate dead keys"; + + key { [ acute, grave ] }; + key { [ diaeresis, asciicircum, asciitilde, caron ] }; +}; + +xkb_symbols "smi" { + + // Describes the differences between a Norwegian Northern Sami + // (keyboard with dead key support) and a Swedish/Finnish Sami + // keyboard according to the specs at: + // http://www.hum.uit.no/a/trond/se-lat9-sefi-keys.html + + include "pc/no(smi)" + + name[Group1]= "Finland - Northern Saami"; + + key { [odiaeresis, Odiaeresis, oslash, Ooblique ] }; + key { [adiaeresis, Adiaeresis, ae, AE ] }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/pc/fo /opt/SUNWut/lib/xkb/symbols/pc/fo --- /opt/SUNWut.orig/lib/xkb/symbols/pc/fo 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/pc/fo 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,51 @@ +// $XdotOrg$ +// $XFree86$ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + include "pc/latin(type2)" + + name[Group1]= "Faroe Islands"; + + key { [ onehalf, section, threequarters, paragraph ] }; + key { [ less, greater, backslash, notsign ] }; + key { [ space, space, nobreakspace, nobreakspace ] }; + + key { [ 5, percent, NoSymbol, cent ] }; + key { [ 6, ampersand, yen, NoSymbol ] }; + key { [ plus, question, plusminus, questiondown ] }; + key { [dead_acute, dead_grave, bar, brokenbar ] }; + + key { [ c, C, copyright, NoSymbol ] }; + key { [ minus, underscore, hyphen, macron ] }; + + key { [ d, D, eth, ETH ] }; + key { [ ae, AE ] }; + key { [ oslash, Ooblique ] }; + + key { [ i, I ] }; + key { [ aring, Aring, dead_diaeresis, dead_circumflex ] }; + key { [ eth, ETH, dead_tilde, dead_caron ] }; + + key { [apostrophe, asterisk, dead_doubleacute, multiply ] }; + + include "level3(ralt_switch)" +}; + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + + include "pc/fo(basic)" + + name[Group1]= "Faroe Islands - Eliminate dead keys"; + + key { [ acute, grave, bar, ogonek ] }; + key { [ aring, Aring, diaeresis, degree ] }; + key { [ diaeresis, asciicircum, asciitilde, macron ] }; + key { [ ae, AE, acute, doubleacute ] }; + key { [ oslash, Ooblique, asciicircum, caron ] }; + key { [apostrophe, asterisk, doubleacute, multiply ] }; + key { [ comma, semicolon, cedilla, ogonek ] }; + key { [ period, colon, periodcentered, abovedot ] }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/pc/fr /opt/SUNWut/lib/xkb/symbols/pc/fr --- /opt/SUNWut.orig/lib/xkb/symbols/pc/fr 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/pc/fr 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,320 @@ +// $XdotOrg$ +// based on a keyboard map from an 'xkb/symbols/fr' file +// +// $XFree86: xc/programs/xkbcomp/symbols/pc/fr,v 1.2 2002/11/22 04:03:28 dawes Exp $ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + include "pc/latin" + + name[Group1]="France"; + + key { [ ampersand, 1, onesuperior, exclamdown ] }; + key { [ eacute, 2, asciitilde, oneeighth ] }; + key { [ quotedbl, 3, numbersign, sterling ] }; + key { [apostrophe, 4, braceleft, dollar ] }; + key { [ parenleft, 5, bracketleft, threeeighths ] }; + key { [ minus, 6, bar, fiveeighths ] }; + key { [ egrave, 7, grave, seveneighths ] }; + key { [underscore, 8, backslash, trademark ] }; + key { [ ccedilla, 9, asciicircum, plusminus ] }; + key { [ agrave, 0, at, degree ] }; + key { [parenright, degree, bracketright, questiondown ] }; + key { [ equal, plus, braceright, dead_ogonek ] }; + + key { [ a, A, ae, AE ] }; + key { [ z, Z, guillemotleft, less ] }; + key { [ e, E, EuroSign, cent ] }; + key { [dead_circumflex, dead_diaeresis, dead_diaeresis, dead_abovering ] }; + key { [ dollar, sterling, currency, dead_macron ] }; + + key { [ q, Q, at, Greek_OMEGA ] }; + key { [ m, M, mu, masculine ] }; + key { [ ugrave, percent, dead_circumflex, dead_caron] }; + key { [twosuperior, asciitilde, notsign, notsign ] }; + + key { [ asterisk, mu, dead_grave, dead_breve ] }; + key { [ w, W, lstroke, Lstroke ] }; + key { [ comma, question, dead_acute, dead_doubleacute ] }; + key { [ semicolon, period, horizconnector, multiply ] }; + key { [ colon, slash, periodcentered, division ] }; + key { [ exclam, section, dead_belowdot, dead_abovedot ] }; + + include "level3(ralt_switch)" +}; + +partial alphanumeric_keys +xkb_symbols "Sundeadkeys" { + + // Modifies the basic French layout to use the Sun dead keys + + include "pc/fr(basic)" + + name[Group1]="France - Sun dead keys"; + + key { [SunFA_Circum, SunFA_Diaeresis ] }; + key { [comma, question, SunFA_Acute, dead_doubleacute ] }; +}; + +partial alphanumeric_keys +xkb_symbols "sundeadkeys" { + include "pc/fr(Sundeadkeys)" + +}; + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + + // Modifies the basic French layout to eliminate all dead keys + + include "pc/fr(basic)" + + name[Group1]="France - Eliminate dead keys"; + + key { [ equal, plus, braceright, ogonek ] }; + key { [asciicircum, diaeresis ] }; + key { [ dollar, sterling, currency, macron ] }; + key { [ ugrave, percent, asciicircum, caron ] }; + key { [ asterisk, mu, grave, breve ] }; + key { [ comma, question, acute, doubleacute ] }; + key { [ exclam, section, dead_belowdot, abovedot ] }; +}; + +// Historic Linux French keyboard layout (fr-latin9) +// Copyright (c) 199x, 2002 Rene Cougnenc (original work) +// Guylhem Aznar (maintainer) +// Nicolas Mailhot +// (XFree86 submission) +// +// $XFree86: xc/programs/xkbcomp/symbols/fr-latin9,v 1.1 2002/12/20 02:07:11 dawes Exp $ +// +// This layout has long been distributed and refined outside official channels. +// To this day it remains more feature-rich and popular than the 'fr' layout. +// +// This file is derived from an original version by Guylhem Aznar. The +// original version is always available from: +// http://en.tldp.org/HOWTO/Francophones-HOWTO.html +// and is distributed under a GPL license. +// +// The author has given permission for this derived version to be distributed +// under the standard XFree86 license. He would like all changes to this +// version be send to him at so he can sync the +// identically named linux console map (kbd, linux-console) and this +// fileout-of-tree GPL version. +// +// Now follows the keyboard design description in French. +// (If you can't read it you probably have no business changing this file anyway:) +// +// Les accents circonflexes des principales voyelles sont obtenus avec +// la touche Alt_Gr, les trmas sont obtenus par Alt_Gr + Shift. +// +// ____ _________ _____________ _______ +// | S A| S = Shift, A = AltGr + Shift | Imprime | Arrt dfil | Pause | +// | s a| s = normal, a = AltGr | Exec | | Halte | +// +// ____ ____ ____ ____ ____ ____ ____ ____ ____ ____ ____ ____ ____ _______ +// | "| 1 | 2 | 3 ,| 4 '| 5 "| 6 || 7 | 8 | 9 | 0 | | + | <-- | +// | "| & '| ~| " #| ' {| ( [| - || `| _ \| ^| @| ) ]| = }| | +// ======================================================================== +// | |<- | A | Z | E | R | T | Y | U | I | O | P '| " `| $ | , | +// | ->| | a | z | e | r | t | y | u | i | o | p | ^ ~| | <-' | +// =================================================================== | +// | | Q | S | D | F | G | H | J | K | L | M | % | | | +// | MAJ | q | s | d | f | g | h | j | k | l | m | | * | | +// ======================================================================== +// | ^ | > | W | X | C | V | B | N | ? | . | / | | ^ | +// | | | < || w | x | c | v | b | n | , | ; | : | ! | | | +// ======================================================================== +// | | | | | | | | | +// | Ctrl | Meta | Alt | Space Nobreakspace | AltGr | Multi|Menu | Ctrl | +// +// +// +// Si les touches mortes fonctionnent, utiliser les accents dits +// morts , i.e. fonctionnant comme l'accent circonflexe & le +// trma des machines crire ; sont disponibles : +// +// (^) : accent circonflexe, +// Shift+(^) : trma, +// Shift+AltGr (^) : tilde, +// AltGr (1) : accent aigu, +// AltGr (7) : accent grave +// +// Pour s'en servir, procder comme avec l'accent circonflexe & le trma +// sur les vielles machines crire : +// +// AltGr (1) puis e : +// Shift+AltGr (1) puis e : ... + +partial alphanumeric_keys + +xkb_symbols "latin9" { + + include "pc/latin" + + name[Group1]="France - Alternative"; + + key { [ oe, OE, leftdoublequotemark, rightdoublequotemark ] }; + key { [ ampersand, 1, dead_acute, periodcentered ] }; + key { [ eacute, 2, asciitilde, Eacute ] }; + key { [ quotedbl, 3, numbersign, cedilla ] }; + key { [ apostrophe, 4, braceleft, acute ] }; + key { [ parenleft, 5, bracketleft, diaeresis ] }; + key { [ minus, 6, bar, brokenbar ] }; + key { [ egrave, 7, dead_grave, Egrave ] }; + key { [ underscore, 8, backslash, macron ] }; + key { [ ccedilla, 9, asciicircum, Ccedilla ] }; + key { [ agrave, 0, at, Agrave ] }; + key { [ parenright, degree, bracketright, ydiaeresis ] }; + key { [ equal, plus, braceright, dead_abovering ] }; + + key { [ a, A, acircumflex, adiaeresis ] }; + key { [ z, Z, aring, Aring ] }; + key { [ e, E, EuroSign, cent ] }; + key { [ r, R, ccedilla, Ccedilla ] }; + key { [ t, T, thorn, THORN ] }; + key { [ y, Y, yacute, Yacute ] }; + key { [ u, U, ucircumflex, udiaeresis ] }; + key { [ i, I, icircumflex, idiaeresis ] }; + key { [ o, O, ocircumflex, odiaeresis ] }; + key { [ p, P, paragraph, quoteleft ] }; + key { [ dead_circumflex, dead_diaeresis, dead_tilde, quoteright ] }; + key { [ dollar, sterling, ecircumflex, ediaeresis ] }; + + key { [ q, Q, Acircumflex, Adiaeresis ] }; + key { [ s, S, oslash, Ooblique ] }; + key { [ d, D, Ecircumflex, Ediaeresis ] }; + key { [ f, F, plusminus, ordfeminine ] }; + key { [ g, G, ae, AE ] }; + key { [ h, H, eth, ETH ] }; + key { [ j, J, Ucircumflex, Udiaeresis ] }; + key { [ k, K, Icircumflex, Idiaeresis ] }; + key { [ l, L, Ocircumflex, Odiaeresis ] }; + key { [ m, M, onesuperior, masculine ] }; + key { [ ugrave, percent, twosuperior, Ugrave ] }; + key { [ asterisk, mu, threesuperior, yen ] }; + + key { [ less, greater, bar ] }; + key { [ w, W, guillemotleft ] }; + key { [ x, X, guillemotright ] }; + key { [ c, C, copyright ] }; + key { [ v, V, registered ] }; + key { [ b, B, ssharp ] }; + key { [ n, N, notsign ] }; + key { [ comma, question, questiondown ] }; + key { [ semicolon, period, multiply ] }; + key { [ colon, slash, division ] }; + key { [ exclam, section, exclamdown ] }; + + key { [ space, space, nobreakspace ] }; + + // French uses a comma as decimal separator, but keyboards are labeled with a period + // Will take effect when KP_Decimal is mapped to the locale decimal separator + key { [ KP_Delete, period, KP_Delete, KP_Decimal ] }; + + include "level3(ralt_switch)" +}; + +partial alphanumeric_keys +xkb_symbols "latin9_Sundeadkeys" { + + // Modifies the basic fr-latin9 layout to use the Sun dead keys + + include "pc/fr(latin9)" + + key { [ ampersand, 1, SunFA_Acute, periodcentered ] }; + key { [ egrave, 7, SunFA_Grave, Egrave ] }; + key { [ SunFA_Circum, SunFA_Diaeresis, SunFA_Tilde, quoteright ] }; + +}; + +partial alphanumeric_keys +xkb_symbols "latin9_sundeadkeys" { + + include "pc/fr(latin9_Sundeadkeys)" + + name[Group1]="France - Alternative, Sun dead keys"; +}; + +partial alphanumeric_keys +xkb_symbols "latin9_nodeadkeys" { + + // Modifies the basic fr-latin9 layout to eliminate all dead keys + + include "pc/fr(latin9)" + + name[Group1]="France - Alternative, eliminate dead keys"; + + key { [ ampersand, 1, apostrophe, periodcentered ] }; + key { [ egrave, 7, grave, Egrave ] }; + key { [ equal, plus, braceright ] }; + key { [ asciicircum, diaeresis, asciitilde, quoteright ] }; +}; + +// Keymap Dvorak pour le Franais +// par Josselin Mouette . + +partial alphanumeric_keys +xkb_symbols "dvorak" { + + name[Group1]= "France - Dvorak"; + + key { [ oe, OE, ae, AE ] }; + + key { [ slash, 1, ampersand, onesuperior ] }; + key { [ plus, 2, asciitilde, twosuperior ] }; + key { [ minus, 3, numbersign, threesuperior ] }; + key { [ asterisk, 4, less, guillemotleft ] }; + key { [ equal, 5, greater, guillemotright ] }; + key { [ backslash, 6, at, notsign ] }; + key { [ parenleft, 7, dead_circumflex, multiply ] }; + key { [ grave, 8, dead_grave, division ] }; + key { [ parenright, 9, asciicircum, plusminus ] }; + key { [ quotedbl, 0, dead_diaeresis, dead_diaeresis ] }; + key { [bracketleft, braceleft, bar, degree ] }; + key { [bracketright, braceright, percent, percent ] }; + + key { [ colon, question, question, questiondown ] }; + key { [ agrave, Agrave, aring, Aring ] }; + key { [ eacute, Eacute, EuroSign, cent ] }; + key { [ g, G, oslash, Ooblique ] }; + key { [ period, exclam, periodcentered, exclamdown ] }; + key { [ h, H, eth, ETH ] }; + key { [ v, V ] }; + key { [ c, C, copyright, registered ] }; + key { [ m, M, mu, mu ] }; + key { [ k, K, dollar, dollar ] }; + key { [ egrave, Egrave, sterling, sterling ] }; + key { [ z, Z, yen, yen ] }; + + key { [ o, O, ocircumflex, Ocircumflex ] }; + key { [ a, A, acircumflex, Acircumflex ] }; + key { [ u, U, ucircumflex, Ucircumflex ] }; + key { [ e, E, ecircumflex, Ecircumflex ] }; + key { [ b, B, ssharp, ssharp ] }; + key { [ f, F ] }; + key { [ s, S ] }; + key { [ t, T, thorn, THORN ] }; + key { [ n, N, ntilde, Ntilde ] }; + key { [ d, D, section, section ] }; + key { [ w, W, paragraph, paragraph ] }; + key { [ ugrave, Ugrave, masculine, ordfeminine ] }; + + key { [ apostrophe, underscore, dead_acute, macron ] }; + key { [ q, Q, guillemotleft, guillemotleft ] }; + key { [ comma, semicolon, guillemotright, guillemotright ] }; + key { [ i, I, icircumflex, Icircumflex ] }; + key { [ y, Y, ydiaeresis, Ydiaeresis ] }; + key { [ x, X, ediaeresis, Ediaeresis ] }; + key { [ r, R, udiaeresis, Udiaeresis ] }; + key { [ l, L, adiaeresis, Adiaeresis ] }; + key { [ p, P, odiaeresis, Odiaeresis ] }; + key { [ j, J, idiaeresis, Idiaeresis ] }; + + key { [ space, space, nobreakspace, nobreakspace ] }; + key { [ ccedilla, Ccedilla ] }; + + include "level3(ralt_switch)" +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/pc/gb /opt/SUNWut/lib/xkb/symbols/pc/gb --- /opt/SUNWut.orig/lib/xkb/symbols/pc/gb 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/pc/gb 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,78 @@ +// $XdotOrg$ +// based on a keyboard map from an 'xkb/symbols/gb' file +// +// $XFree86: xc/programs/xkbcomp/symbols/pc/gb,v 1.6 2003/10/04 10:25:14 pascal Exp $ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + // Describes the differences between a very simple en_US + // keyboard and a very simple U.K. keyboard layout defined by + // the SVR4 European Language Supplement and sometimes also + // known as the IBM 166 layout. + + include "pc/latin" + + name[Group1]="United Kingdom"; + + key { [ 2, quotedbl, twosuperior, oneeighth ] }; + key { [ 3, sterling, threesuperior, sterling ] }; + key { [ 4, dollar, EuroSign, onequarter ] }; + + key { [apostrophe, at, dead_circumflex, dead_caron] }; + key { [ grave, notsign, bar, bar ] }; + + key { [numbersign, asciitilde, dead_grave, dead_breve ] }; + key { [ backslash, bar, bar, brokenbar ] }; + + include "level3(ralt_switch)" +}; + +partial alphanumeric_keys +xkb_symbols "intl" { + + // Describes the differences between a very simple en_US + // keyboard and a very simple U.K. keyboard layout with + // dead keys. By Phil Jones (philjones1@blueyonder.co.uk) + + // Includes the following keys: + // dead_grave + // dead_acute + // dead_circumflex + // dead_tilde + // dead_diaeresis + + include "pc/latin" + + name[Group1]="United Kingdom - International (with dead keys)"; + + key { [ 2, dead_diaeresis, twosuperior, onehalf ] }; + key { [ 3, sterling, threesuperior, onethird ] }; + key { [ 4, dollar, EuroSign, onequarter ] }; + key { [ 6, dead_circumflex, NoSymbol, onesixth ] }; + + key { [ dead_acute, at, apostrophe, bar ] }; + key { [ dead_grave, notsign, bar, bar ] }; + + key { [ numbersign, dead_tilde, bar, bar ] }; + key { [ backslash, bar, bar, bar ] }; + + include "level3(ralt_switch)" +}; + +// Dvorak (UK) keymap (by odaen) allowing the usage of +// the and ? key and swapping the @ and " keys. + +partial alphanumeric_keys +xkb_symbols "dvorak" { + include "pc/us(dvorak)" + + name[Group1]="United Kingdom - Dvorak"; + + key { [ numbersign, asciitilde ] }; + key { [ 2, quotedbl, twosuperior, NoSymbol ] }; + key { [ 3, sterling, threesuperior, NoSymbol ] }; + key { [ 4, dollar, EuroSign, NoSymbol ] }; + key { [ backslash, bar ] }; + key { [ apostrophe, at ] }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/pc/ge /opt/SUNWut/lib/xkb/symbols/pc/ge --- /opt/SUNWut.orig/lib/xkb/symbols/pc/ge 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/pc/ge 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,116 @@ +// $XdotOrg$ +// based on +// Georgian keyboard map, in the so called "latin" layout. +// 1999, Pablo Saratxaga +// +// $XdotOrg: xc/programs/xkbcomp/symbols/pc/ge_la,v 1.3 2003/12/18 14:14:39 pascal Exp $ +// $XFree86: xc/programs/xkbcomp/symbols/pc/ge_la,v 1.2 2002/11/22 04:03:28 dawes Exp $ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + name[Group1]= "Georgia"; + + key { [ 0x010010e5, q ] }; + key { [ 0x010010ec, 0x010010ed ] }; + key { [ 0x010010d4, e ] }; + key { [ 0x010010e0, 0x010010e6 ] }; + key { [ 0x010010e2, 0x010010d7 ] }; + key { [ 0x010010e7, y ] }; + key { [ 0x010010e3, u ] }; + key { [ 0x010010d8, i ] }; + key { [ 0x010010dd, o ] }; + key { [ 0x010010de, p ] }; + key { [ bracketleft, braceleft ] }; + key { [ bracketright,braceright ] }; + + key { [ 0x010010d0, a ] }; + key { [ 0x010010e1, 0x010010e8 ] }; + key { [ 0x010010d3, d ] }; + key { [ 0x010010e4, f ] }; + key { [ 0x010010d2, g ] }; + key { [ 0x010010f0, h ] }; + key { [ 0x010010ef, 0x010010df ] }; + key { [ 0x010010d9, k ] }; + key { [ 0x010010da, l ] }; + key { [ semicolon, colon ] }; + key { [ apostrophe, quotedbl ] }; + key { [ backslash, bar ] }; + + key { [ guillemotleft,guillemotright ] }; + key { [ 0x010010d6, 0x010010eb ] }; + key { [ 0x010010ee, x ] }; + key { [ 0x010010ea, 0x010010e9 ] }; + key { [ 0x010010d5, v ] }; + key { [ 0x010010d1, b ] }; + key { [ 0x010010dc, n ] }; + key { [ 0x010010db, m ] }; + key { [ comma, less ] }; + key { [ period, greater ] }; + key { [ slash, question ] }; + +}; + +partial alphanumeric_keys +xkb_symbols "la" { + include "pc/ge(basic)" +}; + +partial alphanumeric_keys +xkb_symbols "ru" { + + name[Group1]= "Georgia - Russian"; + + key { [ asciicircum, asciitilde ] }; + key { [ 1, exclam ] }; + key { [ 2, at ] }; // 2 0xeb + key { [ 3, numbersign ] }; // 3 0xec + key { [ 4, semicolon ] }; + key { [ 5, colon ] }; + key { [ 6, comma ] }; + key { [ 7, period ] }; + key { [ 8, asterisk ] }; + key { [ 9, parenleft ] }; + key { [ 0, parenright ] }; + key { [ minus, underscore ] }; + key { [ numbersign, bar ] }; + + key { [ 0x010010e6, q ] }; + key { [ 0x010010ea, w ] }; + key { [ 0x010010e3, e ] }; + key { [ 0x010010d9, r ] }; + key { [ 0x010010d4, t ] }; + key { [ 0x010010dc, y ] }; + key { [ 0x010010d2, u ] }; + key { [ 0x010010e8, i ] }; + key { [ 0x010010ec, o ] }; + key { [ 0x010010d6, p ] }; + key { [ 0x010010ee, bracketleft ] }; + key { [ 0x010010ef, bracketright ] }; + + key { [ 0x010010e4, a ] }; + key { [ 0x010010d7, s ] }; + key { [ 0x010010d5, d ] }; + key { [ 0x010010d0, f ] }; + key { [ 0x010010de, g ] }; + key { [ 0x010010e0, h ] }; + key { [ 0x010010dd, j ] }; + key { [ 0x010010da, k ] }; + key { [ 0x010010d3, l ] }; + key { [ 0x010010df, semicolon ] }; + key { [ 0x010010eb, percent ] }; + key { [ backslash, bar ] }; // 0xe9 0xea + + key { [ guillemotleft,guillemotright ] }; // 0xab 0xbb 0xe7 0xe8 + key { [ 0x010010ed, z ] }; + key { [ 0x010010e9, x ] }; + key { [ 0x010010e1, c ] }; + key { [ 0x010010db, v ] }; + key { [ 0x010010d8, b ] }; + key { [ 0x010010e2, n ] }; + key { [ 0x010010e5, m ] }; + key { [ 0x010010d1, less ] }; + key { [ 0x010010e7, greater ] }; + key { [ 0x010010f0, question ] }; + +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/pc/gr /opt/SUNWut/lib/xkb/symbols/pc/gr --- /opt/SUNWut.orig/lib/xkb/symbols/pc/gr 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/pc/gr 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,128 @@ +// $XdotOrg$ +// $XKeyboardConfig: xkbdesc/symbols/gr,v 1.6 2005/01/21 23:16:05 svu Exp $ +// $XFree86: xc/programs/xkbcomp/symbols/pc/el,v 1.2 2002/11/15 02:26:41 dawes Exp $ +// +// Hellenic keyboard map for XFree86 +// Original version: +// Kostas Gewrgiou +// Heavily modified and maintained by: +// Vasilis Vasaitis +// Originally converted to single group form by: +// Ivan Pascal + +default partial alphanumeric_keys alternate_group +xkb_symbols "basic" { + + include "pc/el(bare)" + + name[Group1] = "Greece"; + + key { [ grave, asciitilde ] }; + key { [ 1, exclam ] }; + key { [ 2, at ] }; + key { [ 3, numbersign ] }; + key { [ 4, dollar ] }; + key { [ 5, percent ] }; + key { [ 6, asciicircum ] }; + key { [ 7, ampersand ] }; + key { [ 8, asterisk ] }; + key { [ 9, parenleft ] }; + key { [ 0, parenright ] }; + key { [ minus, underscore ] }; + key { [ equal, plus ] }; + + key { [ bracketleft, braceleft ] }; + key { [ bracketright, braceright ] }; + + key { [ apostrophe, quotedbl ] }; + + key { [ comma, less ] }; + key { [ period, greater ] }; + key { [ slash, question ] }; + key { [ backslash, bar ] }; + +}; + +hidden partial alphanumeric_keys alternate_group +xkb_symbols "bare" { + + key { [ semicolon, colon ] }; + key { [ Greek_finalsmallsigma, Greek_SIGMA ] }; + key { [ Greek_epsilon, Greek_EPSILON ] }; + key { [ Greek_rho, Greek_RHO ] }; + key { [ Greek_tau, Greek_TAU ] }; + key { [ Greek_upsilon, Greek_UPSILON ] }; + key { [ Greek_theta, Greek_THETA ] }; + key { [ Greek_iota, Greek_IOTA ] }; + key { [ Greek_omicron, Greek_OMICRON ] }; + key { [ Greek_pi, Greek_PI ] }; + + key { [ Greek_alpha, Greek_ALPHA ] }; + key { [ Greek_sigma, Greek_SIGMA ] }; + key { [ Greek_delta, Greek_DELTA ] }; + key { [ Greek_phi, Greek_PHI ] }; + key { [ Greek_gamma, Greek_GAMMA ] }; + key { [ Greek_eta, Greek_ETA ] }; + key { [ Greek_xi, Greek_XI ] }; + key { [ Greek_kappa, Greek_KAPPA ] }; + key { [ Greek_lamda, Greek_LAMDA ] }; + key { [ dead_acute, dead_diaeresis ] }; + + key { [ Greek_zeta, Greek_ZETA ] }; + key { [ Greek_chi, Greek_CHI ] }; + key { [ Greek_psi, Greek_PSI ] }; + key { [ Greek_omega, Greek_OMEGA ] }; + key { [ Greek_beta, Greek_BETA ] }; + key { [ Greek_nu, Greek_NU ] }; + key { [ Greek_mu, Greek_MU ] }; + + key { [ guillemotleft, guillemotright ] }; + +}; + +partial alphanumeric_keys alternate_group +xkb_symbols "extended" { + + include "pc/el(basic)" + name[Group1] = "Greece - Extended"; + + key.type = "THREE_LEVEL"; + + key { [ 5, percent, EuroSign ] }; + + key { [ semicolon, colon, periodcentered ] }; + key { [ Greek_epsilon, Greek_EPSILON, EuroSign ] }; + + key { [ comma, less, guillemotleft ] }; + key { [ period, greater, guillemotright ] }; + + include "level3(ralt_switch)" +}; + +partial alphanumeric_keys alternate_group +xkb_symbols "polytonic" { + + include "pc/el(extended)" + + name[Group1] = "Greece - Polytonic"; + + key.type = "THREE_LEVEL"; + + key { [ dead_tilde, dead_diaeresis, dead_macron ] }; + key { [ dead_iota, VoidSymbol, dead_breve ] }; + + key { [ dead_acute, dead_horn ] }; + key { [ dead_grave, dead_ogonek ] }; + +}; + +partial alphanumeric_keys alternate_group +xkb_symbols "nodeadkeys" { + + include "pc/el(basic)" + name[Group1] = "Greece - Eliminate dead keys"; + + key { [ semicolon, colon ] }; + +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/pc/hr /opt/SUNWut/lib/xkb/symbols/pc/hr --- /opt/SUNWut.orig/lib/xkb/symbols/pc/hr 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/pc/hr 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,92 @@ +// $XdotOrg$ +// based on +// Croatian keyboards +// by Vlatko Kosturjak (kost at linux.hr) +// Taken from Slovenian keyboards +// by Marko Samastur (markos@elite.org) and +// Primoz Peterlin (primoz.peterlin@biofiz.mf.uni-lj.si) +// +// Changelog +// ========= +// 2003-04-03 Added (Delete/Separator) +// 2000-02-06 Initial version +// +// $XFree86: xc/programs/xkbcomp/symbols/pc/hr,v 1.3 2003/04/13 18:22:21 dawes Exp $ + +default partial alphanumeric_keys +xkb_symbols "basic" { + + include "pc/latin(type3)" + + name[Group1]="Croatia"; + + key { [ 1, exclam, asciitilde, dead_tilde ] }; + key { [ 2, quotedbl, dead_caron, caron ] }; + key { [ 3, numbersign, asciicircum, dead_circumflex ] }; + key { [ 4, dollar, dead_breve, breve ] }; + key { [ 5, percent, degree, dead_abovering ] }; + key { [ 6, ampersand, dead_ogonek, ogonek ] }; + key { [ 7, slash, grave, dead_grave ] }; + key { [ 8, parenleft, dead_abovedot, abovedot ] }; + key { [ 9, parenright, dead_acute, apostrophe ] }; + key { [ 0, equal, dead_doubleacute, doubleacute ] }; + key { [apostrophe, question, dead_diaeresis, diaeresis ] }; + key { [ plus, asterisk, dead_cedilla, cedilla ] }; + + key { [ e, E, EuroSign, EuroSign ] }; + key { [ scaron, Scaron, division, dead_abovering ] }; + key { [ dstroke, Dstroke, multiply, dead_macron ] }; + + key { [ ccaron, Ccaron, dead_acute, dead_doubleacute ] }; + key { [ cacute, Cacute, ssharp, dead_caron ] }; + key { [ minus, underscore, dead_belowdot, dead_abovedot ] }; + key { [dead_cedilla, dead_diaeresis, notsign, notsign ] }; + + key { [ zcaron, Zcaron, currency, dead_breve ] }; + + include "keypad(comma)" + + include "level3(ralt_switch)" +}; + +partial alphanumeric_keys +xkb_symbols "us" { + + // Describes the differences between US/ASCII + // keyboard and a Croatian-US keyboard + // by Vlatko Kosturjak (kost at linux.hr) + + // Alphanumeric section + name[Group1]= "Croatia - US keyboard with Croatian letters"; + key { [ backslash ] }; + key { [ bar ] }; + key { [ EuroSign ] }; + key { [ scaron, Scaron ] }; + key { [ dstroke, Dstroke ] }; + key { [ bracketleft ] }; + key { [ bracketright ] }; + key { [ lstroke ] }; + key { [ Lstroke ] }; + key { [ ccaron, Ccaron ] }; + key { [ cacute, Cacute ] }; + + + key { [ bar ] }; + key { [ y, Y ] }; + key { [ at ] }; + key { [ braceleft ] }; + key { [ braceright ] }; + key { [ section ] }; + key { [ semicolon ] }; + key { [ colon ] }; + key { [ minus, underscore ] }; + key { [ zcaron, Zcaron ] }; + + // End alphanumeric section + + // begin modifier mappings + modifier_map Shift { Shift_L }; + modifier_map Lock { Caps_Lock }; + modifier_map Control{ Control_L }; + modifier_map Mod3 { Mode_switch }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/pc/hu /opt/SUNWut/lib/xkb/symbols/pc/hu --- /opt/SUNWut.orig/lib/xkb/symbols/pc/hu 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/pc/hu 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,433 @@ +// $XdotOrg$ +// New style XKB layout for some widely used Hungarian keyboard layouts +// +// Based on old style 'xkb/symbols/hu" +// +// $XKeyboardConfig: xkbdesc/symbols/hu,v 1.6 2005/01/16 02:18:20 svu Exp $ +// (C) 2002-2004 Sos Pter +// +// Permission is granted to anyone to use, distribute and modify +// this file in any way, provided that the above copyright notice +// is left intact and the author of the modification summarizes +// the changes in this header. +// +// This file is distributed without any expressed or implied warranty. +// +// Changes: +// 2004-04-17 - Moved to new style (only Unicode based layouts) +// - Added consistent dead key support +// - Fixed abovedot +// - Added adiaeresis +// - Added EuroSign and cent symbol + + +// Default layout +default partial +xkb_symbols "basic" { +include "pc/hu(102_qwertz_comma_dead)" +name[Group1] = "Hungary"; +}; + +// Standard layout +partial +xkb_symbols "standard" { +include "pc/hu(102_qwertz_comma_dead)" +name[Group1] = "Hungary - Standard"; +}; + +// Standard layout without dead key support +partial +xkb_symbols "nodeadkeys" { +include "pc/hu(102_qwertz_comma_nodead)" +name[Group1] = "Hungary - Eliminate dead keys"; +}; + +// Qwerty layout +partial +xkb_symbols "qwerty" { +include "pc/hu(101_qwerty_comma_dead)" +name[Group1] = "Hungary - qwerty"; +}; + +// Main layouts + +// 101_qwertz_comma_dead +// 101 key qwertz layout +// with decimal comma on keypad +// and with dead key support +partial +xkb_symbols "101_qwertz_comma_dead" { +name[Group1] = "Hungary - 101/qwertz/comma/Dead keys"; +include "pc/latin" +include "pc/hu(def_101)" +include "pc/hu(def_qwertz)" +include "keypad(comma)" +include "pc/hu(def_dead)" +include "pc/hu(def_common)" +include "level3(ralt_switch)" +}; + +// 101_qwertz_comma_nodead +// 101 key qwertz layout +// with decimal comma on keypad +// and without dead key support +partial +xkb_symbols "101_qwertz_comma_nodead" { + name[Group1] = "Hungary - 101/qwertz/comma/Eliminate dead keys"; + include "pc/latin" + include "pc/hu(def_101)" + include "pc/hu(def_qwertz)" + include "keypad(comma)" + include "pc/hu(def_nodead)" + include "pc/hu(def_common)" + include "level3(ralt_switch)" +}; + +// 101_qwertz_dot_dead +// 101 key qwertz layout +// with decimal dot on keypad +// and with dead key support +partial +xkb_symbols "101_qwertz_dot_dead" { + name[Group1] = "Hungary - 101/qwertz/dot/Dead keys"; + include "pc/latin" + include "pc/hu(def_101)" + include "pc/hu(def_qwertz)" + include "pc/hu(def_dot)" + include "pc/hu(def_dead)" + include "pc/hu(def_common)" + include "level3(ralt_switch)" +}; + +// 101_qwertz_dot_nodead +// 101 key qwertz layout +// with decimal dot on keypad +// and without dead key support +partial +xkb_symbols "101_qwertz_dot_nodead" { + name[Group1] = "Hungary - 101/qwertz/dot/Eliminate dead keys"; + include "pc/latin" + include "pc/hu(def_101)" + include "pc/hu(def_qwertz)" + include "pc/hu(def_dot)" + include "pc/hu(def_nodead)" + include "pc/hu(def_common)" + include "level3(ralt_switch)" +}; + +// 101_qwerty_comma_dead +// 101 key qwerty layout +// with decimal comma on keypad +// and with dead key support +partial +xkb_symbols "101_qwerty_comma_dead" { + name[Group1] = "Hungary - 101/qwerty/comma/Dead keys"; + include "pc/latin" + include "pc/hu(def_101)" + include "pc/hu(def_qwerty)" + include "keypad(comma)" + include "pc/hu(def_dead)" + include "pc/hu(def_common)" + include "level3(ralt_switch)" +}; + +// 101_qwerty_comma_nodead +// 101 key qwerty layout +// with decimal comma on keypad +// and without dead key support +partial +xkb_symbols "101_qwerty_comma_nodead" { + name[Group1] = "Hungary - 101/qwerty/comma/Eliminate dead keys"; + include "pc/latin" + include "pc/hu(def_101)" + include "pc/hu(def_qwerty)" + include "keypad(comma)" + include "pc/hu(def_nodead)" + include "pc/hu(def_common)" + include "level3(ralt_switch)" +}; + +// 101_qwerty_dot_dead +// 101 key qwerty layout +// with decimal dot on keypad +// and with dead key support +partial +xkb_symbols "101_qwerty_dot_dead" { + name[Group1] = "Hungary - 101/qwerty/dot/Dead keys"; + include "pc/latin" + include "pc/hu(def_101)" + include "pc/hu(def_qwerty)" + include "pc/hu(def_dot)" + include "pc/hu(def_dead)" + include "pc/hu(def_common)" + include "level3(ralt_switch)" +}; + +// 101_qwerty_dot_nodead +// 101 key qwerty layout +// with decimal dot on keypad +// and without dead key support +partial +xkb_symbols "101_qwerty_dot_nodead" { + name[Group1] = "Hungary - 101/qwerty/dot/Eliminate dead keys"; + include "pc/latin" + include "pc/hu(def_101)" + include "pc/hu(def_qwerty)" + include "pc/hu(def_dot)" + include "pc/hu(def_nodead)" + include "pc/hu(def_common)" + include "level3(ralt_switch)" +}; + +// 102_qwertz_comma_dead +// 102 key qwertz layout +// with decimal comma on keypad +// and with dead key support +partial +xkb_symbols "102_qwertz_comma_dead" { + name[Group1] = "Hungary - 102/qwertz/comma/Dead keys"; + include "pc/latin" + include "pc/hu(def_102)" + include "pc/hu(def_qwertz)" + include "pc/hu(def_comma)" + include "pc/hu(def_dead)" + include "pc/hu(def_common)" + include "level3(ralt_switch)" +}; + +// 102_qwertz_comma_nodead +// 102 key qwertz layout +// with decimal comma on keypad +// and without dead key support +partial +xkb_symbols "102_qwertz_comma_nodead" { + name[Group1] = "Hungary - 102/qwertz/comma/Eliminate dead keys"; + include "pc/latin" + include "pc/hu(def_102)" + include "pc/hu(def_qwertz)" + include "pc/hu(def_comma)" + include "pc/hu(def_nodead)" + include "pc/hu(def_common)" + include "level3(ralt_switch)" +}; + +// 102_qwertz_dot_dead +// 102 key qwertz layout +// with decimal dot on keypad +// and with dead key support +partial +xkb_symbols "102_qwertz_dot_dead" { + name[Group1] = "Hungary - 102/qwertz/dot/Dead keys"; + include "pc/latin" + include "pc/hu(def_102)" + include "pc/hu(def_qwertz)" + include "pc/hu(def_dot)" + include "pc/hu(def_dead)" + include "pc/hu(def_common)" + include "level3(ralt_switch)" +}; + +// 102_qwertz_dot_nodead +// 102 key qwertz layout +// with decimal dot on keypad +// and without dead key support +partial +xkb_symbols "102_qwertz_dot_nodead" { + name[Group1] = "Hungary - 102/qwertz/dot/Eliminate dead keys"; + include "pc/latin" + include "pc/hu(def_102)" + include "pc/hu(def_qwertz)" + include "pc/hu(def_dot)" + include "pc/hu(def_nodead)" + include "pc/hu(def_common)" + include "level3(ralt_switch)" +}; + +// 102_qwerty_comma_dead +// 102 key qwerty layout +// with decimal comma on keypad +// and with dead key support +partial +xkb_symbols "102_qwerty_comma_dead" { + name[Group1] = "Hungary - 102/qwerty/comma/Dead keys"; + include "pc/latin" + include "pc/hu(def_102)" + include "pc/hu(def_qwerty)" + include "pc/hu(def_comma)" + include "pc/hu(def_dead)" + include "pc/hu(def_common)" + include "level3(ralt_switch)" +}; + +// 102_qwerty_comma_nodead +// 102 key qwerty layout +// with decimal comma on keypad +// and without dead key support +partial +xkb_symbols "102_qwerty_comma_nodead" { + name[Group1] = "Hungary - 102/qwerty/comma/Eliminate dead keys"; + include "pc/latin" + include "pc/hu(def_102)" + include "pc/hu(def_qwerty)" + include "pc/hu(def_comma)" + include "pc/hu(def_nodead)" + include "pc/hu(def_common)" + include "level3(ralt_switch)" +}; + +// 102_qwerty_dot_dead +// 102 key qwerty layout +// with decimal dot on keypad +// and with dead key support +partial +xkb_symbols "102_qwerty_dot_dead" { + name[Group1] = "Hungary - 102/qwerty/dot/Dead keys"; + include "pc/latin" + include "pc/hu(def_102)" + include "pc/hu(def_qwerty)" + include "pc/hu(def_dot)" + include "pc/hu(def_dead)" + include "pc/hu(def_common)" + include "level3(ralt_switch)" +}; + +// 102_qwerty_dot_nodead +// 102 key qwerty layout +// with decimal dot on keypad +// and without dead key support +partial +xkb_symbols "102_qwerty_dot_nodead" { + name[Group1] = "Hungary - 102/qwerty/dot/Eliminate dead keys"; + include "pc/latin" + include "pc/hu(def_102)" + include "pc/hu(def_qwerty)" + include "pc/hu(def_dot)" + include "pc/hu(def_nodead)" + include "pc/hu(def_common)" + include "level3(ralt_switch)" +}; + +// Partial layouts + +// def_102: +// The standard Hungarian 102 key layout +hidden partial alphanumeric_keys +xkb_symbols "def_102" { + key { [ 0, section, notsign ] }; + key { [ iacute, Iacute, less, greater ] }; + +}; + +// def_101: +// An alternative layout for 101 key keyboards +hidden partial alphanumeric_keys +xkb_symbols "def_101" { + key { [ iacute, Iacute, 0, section ] }; + key { [ less, greater ] }; +}; + +// def_qwertz: +// The standard Hungaryan qwertz layout +hidden partial alphanumeric_keys +xkb_symbols "def_qwertz" { + key { [ z, Z ] }; + key { [ y, Y, greater ] }; +}; + + +// def_qwerty: +// The qwerty layout for people who familiar with the standard US layout +hidden partial alphanumeric_keys +xkb_symbols "def_qwerty" { + key { [ y, Y ] }; + key { [ z, Z, greater ] }; +}; + +// def_comma: +// The Hungarian standard is the comma on the keypad not decimal dot +hidden partial keypad_keys +xkb_symbols "def_comma" { + key { [ KP_Delete, comma ] }; +}; + +// def_dot: +// The Hungarian standard is the comma on the keypad not decimal dot, +// but programmers hate it +hidden partial keypad_keys +xkb_symbols "def_dot" { + key { [ KP_Delete, KP_Decimal ] }; +}; + + +// def_dead: +// Dead keys support part +hidden partial alphanumeric_keys +xkb_symbols "def_dead" { + key { [ 1, apostrophe, asciitilde, dead_tilde ] }; + key { [ 2, quotedbl, dead_caron, caron ] }; + key { [ 3, plus, asciicircum, dead_circumflex ] }; + key { [ 4, exclam, dead_breve, breve ] }; + key { [ 5, percent, dead_abovering, degree ] }; + key { [ 6, slash, dead_ogonek, ogonek ] }; + key { [ 7, equal, grave, dead_grave ] }; + key { [ 8, parenleft, dead_abovedot, abovedot ] }; + key { [ 9, parenright, dead_acute, acute ] }; + key { [ odiaeresis, Odiaeresis, dead_doubleacute, doubleacute ] }; + key { [ udiaeresis, Udiaeresis, dead_diaeresis, diaeresis ] }; + key { [ oacute, Oacute, dead_cedilla, cedilla ] }; +}; + +// def_nodead: +// Without dead keys support +hidden partial alphanumeric_keys +xkb_symbols "def_nodead" { + key { [ 1, apostrophe, asciitilde ] }; + key { [ 2, quotedbl, caron ] }; + key { [ 3, plus, asciicircum ] }; + key { [ 4, exclam, breve ] }; + key { [ 5, percent, degree ] }; + key { [ 6, slash, ogonek ] }; + key { [ 7, equal, grave ] }; + key { [ 8, parenleft, abovedot ] }; + key { [ 9, parenright, acute ] }; + key { [ odiaeresis, Odiaeresis, doubleacute ] }; + key { [ udiaeresis, Udiaeresis, diaeresis ] }; + key { [ oacute, Oacute, cedilla ] }; +}; + + +// def_common: +// The common part of all Hungarian layout above +hidden partial alphanumeric_keys +xkb_symbols "def_common" { + key { [ q, Q, backslash ] }; + key { [ w, W, bar ] }; + key { [ u, U, EuroSign ] }; + key { [ i, I, Iacute, iacute ] }; + key { [ odoubleacute, Odoubleacute, division ] }; + key { [ uacute, Uacute, multiply ] }; + + key { [ a, A, adiaeresis, Adiaeresis ] }; + key { [ s, S, dstroke ] }; + key { [ d, D, Dstroke ] }; + key { [ f, F, bracketleft ] }; + key { [ g, G, bracketright ] }; + key { [ j, J, iacute, Iacute ] }; + key { [ k, K, lstroke ] }; + key { [ l, L, Lstroke ] }; + key { [ eacute, Eacute, dollar, cent ] }; + key { [ aacute, Aacute, ssharp ] }; + + key { [ udoubleacute, Udoubleacute, currency ] }; + + key { [ x, X, numbersign ] }; + key { [ c, C, ampersand ] }; + key { [ v, V, at ] }; + key { [ b, B, braceleft ] }; + key { [ n, N, braceright ] }; + key { [ m, M, less ] }; + key { [ comma, question, semicolon ] }; + key { [ period, colon, greater ] }; + key { [ minus, underscore, asterisk ] }; + +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/pc/ie /opt/SUNWut/lib/xkb/symbols/pc/ie --- /opt/SUNWut.orig/lib/xkb/symbols/pc/ie 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/pc/ie 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,410 @@ +// $XdotOrg$ +// $XFree86: xc/programs/xkbcomp/symbols/pc/ie,v 1.3 2002/12/31 02:07:04 dawes Exp $ + +// Irish keyboard map + +// Support for Irish (old and new orthography) and English +// Seamus O Ciardhuain (19 December 2002) + +// The general idea is to provide the characters in ISO 8859-1, +// ISO 8859-15, ISO 8859-14, CP1252 and "Extended Latin-8". +// However, not all are accessible directly because there aren't +// enough keys; some need deadkeys to access them, others the +// "Multi_key" compose sequences. + +// Designed to be similar to the layouts used on Windows +// and the Macintosh. + +// Everything is in Group 1 to be compatible with the +// multi-layout keyboard support in XFree86 4.3. + +// The basic layout is a modern keyboard, but dotted consonants are +// accessible using a deadkey (AltGr+H or AltGr+W). +// If a proper Clo Gaelach keyboard is needed, then use the layout +// defined below as ie(CloGaelach), which gives dotted consonants +// without use of a deadkey. + + +partial default alphanumeric_keys +xkb_symbols "basic" { + + // Modern keyboard for Irish and English + // - acute-accented vowels as AltGr+vowel and AltGr+Shift+vowel + // - euro currency sign as AltGr+4 + // - Comhartha Agus (Tironian Sign Et) as AltGr+Shift+7 + // - non-breaking space as AltGr+Space and AltGr+Shift+Space + // - matches hardware (keys and engraved symbols) for Irish keyboards + + name[Group1] = "Ireland"; + + // + // Numeric row `1234567890-= + // + key { [ grave, notsign, brokenbar, NoSymbol ] }; + key { [ 1, exclam, exclamdown, onesuperior ] }; + key { [ 2, quotedbl, trademark, twosuperior ] }; + key { [ 3, sterling, copyright, threesuperior ] }; + key { [ 4, dollar, EuroSign, cent ] }; + key { [ 5, percent, section, dagger ] }; + key { [ 6, asciicircum, dead_circumflex, 0x1002030 ] }; + // per thousand + key { [ 7, ampersand, paragraph, 0x100204A ] }; + // Tironian Et + key { [ 8, asterisk, dead_diaeresis, enfilledcircbullet ] }; + key { [ 9, parenleft, ordfeminine, periodcentered ] }; + key { [ 0, parenright, masculine, degree ] }; + key { [ minus, underscore, endash, emdash ] }; + key { [ equal, plus, notequal, plusminus ] }; + + // + // QWERTYUIOP[] + // + key { [ q, Q, oe, OE ] }; + key { [ w, W, dead_abovedot, dead_abovedot ] }; + key { [ e, E, eacute, Eacute ] }; + key { [ r, R, registered, 0x1002030 ] }; + // per thousand + key { [ t, T, thorn, THORN ] }; + key { [ y, Y, yen, mu ] }; + key { [ u, U, uacute, Uacute ] }; + key { [ i, I, iacute, Iacute ] }; + key { [ o, O, oacute, Oacute ] }; + key { [ p, P, singlelowquotemark, NoSymbol ] }; + key { [ bracketleft, braceleft, leftdoublequotemark, rightdoublequotemark ] }; + key { [ bracketright, braceright, leftsinglequotemark, rightsinglequotemark ] }; + + // + // ASDFGHJKL;'# + // + key { [ a, A, aacute, Aacute ] }; + key { [ s, S, ssharp, NoSymbol ] }; + key { [ d, D, eth, ETH ] }; + key { [ f, F, 0x1000192, NoSymbol ] }; + // f with hook + key { [ g, G, copyright, NoSymbol ] }; + key { [ h, H, dead_abovedot, dead_abovedot ] }; + key { [ j, J, idotless, onequarter ] }; + key { [ k, K, dead_abovering, onehalf ] }; + key { [ l, L, acute, threequarters ] }; + key { [ semicolon, colon, ellipsis, doubledagger ] }; + key { [ apostrophe, at, ae, AE ] }; + key { [ numbersign, asciitilde, guillemotleft, guillemotright ] }; + + + // + // \ZXCVBNM,./ + // + key { [ backslash, bar, dead_grave, dead_acute ] }; + key { [ z, Z, leftanglebracket, rightanglebracket ] }; + key { [ x, X, multiply, approximate ] }; + key { [ c, C, dead_cedilla, cedilla ] }; + key { [ v, V, dead_caron, NoSymbol ] }; + key { [ b, B, diaeresis, NoSymbol ] }; + key { [ n, N, dead_tilde, NoSymbol ] }; + key { [ m, M, macron, NoSymbol ] }; + key { [ comma, less, lessthanequal, doublelowquotemark ] }; + key { [ period, greater, greaterthanequal, singlelowquotemark ] }; + key { [ slash, question, division, questiondown ] }; + + + key { [ space, space, nobreakspace, nobreakspace ] }; + + include "level3(ralt_switch)" + + // NB: putting Shift+ as Multi_key gives odd behaviour since the + // order of pressing keys affects the result. + + include "compose(rwin)" +}; + +partial alphanumeric_keys +xkb_symbols "CloGaelach" { + + // Adds support for Clo Gaelach (old orthography for Irish). + // Changes from "basic": + // - dotted consonants as AltGr+consonant or AltGr+Shift+consonant (TPSDFGCBM) + // - long lowercase r as AltGr+R + // - long lowercase s as AltGr+Z + // - long lowercase s dotted as AltGr+Shift+Z + // - some symbols moved around to retain them + // - several characters unlikely to be used are lost + // The long letters are needed only where the font provides + // both the long and short forms as different glyphs. + + include "pc/ie(basic)" + + name[Group1] = "Ireland - CloGaelach"; + + key { [ grave, notsign, brokenbar, ssharp ] }; + key { [ r, R, 0x100027C, registered ] }; + // long r + key { [ t, T, tabovedot, Tabovedot ] }; + key { [ p, P, pabovedot, Pabovedot ] }; + + key { [ s, S, sabovedot, Sabovedot ] }; + key { [ d, D, dabovedot, Dabovedot ] }; + key { [ f, F, fabovedot, Fabovedot ] }; + key { [ g, G, gabovedot, Gabovedot ] }; + + key { [ z, Z, 0x100017F, 0x1001E9B ] }; + // long s, long s dot + key { [ c, C, cabovedot, Cabovedot ] }; + key { [ b, B, babovedot, Babovedot ] }; + key { [ m, M, mabovedot, Mabovedot ] }; + + key { [ backslash, bar, dead_grave, dead_cedilla ] }; +}; + +partial alphanumeric_keys +xkb_symbols "UnicodeExpert" { + +// This should eventually be a "Unicode Expert" layout like the Mac one. + + name[Group1] = "Ireland - UnicodeExpert"; + + // + // Numeric row `1234567890-= + // + key { [ grave, notsign, 0x10000A6, 0x10000A6 ] }; + // broken bar + key { [ 1, exclam, NoSymbol, NoSymbol ] }; + key { [ 2, quotedbl, dead_doubleacute, dead_doubleacute ] }; + key { [ 3, sterling, NoSymbol, NoSymbol ] }; + key { [ 4, dollar, EuroSign, EuroSign ] }; + key { [ 5, percent, NoSymbol, NoSymbol ] }; + key { [ 6, asciicircum, dead_circumflex, dead_circumflex ] }; + key { [ 7, ampersand, 0x100204A, 0x100204A ] }; + // Tironian Et + key { [ 8, asterisk, dead_abovering, dead_abovering ] }; + key { [ 9, parenleft, dead_breve, dead_breve ] }; + key { [ 0, parenright, dead_ogonek, dead_ogonek ] }; + key { [ minus, underscore, dead_macron, dead_macron ] }; + key { [ equal, plus, NoSymbol, NoSymbol ] }; + + // + // QWERTYUIOP[] + // + key { [ q, Q, NoSymbol, NoSymbol ] }; + key { [ w, W, NoSymbol, NoSymbol ] }; + key { [ e, E, eacute, Eacute ] }; + key { [ r, R, 0x100027C, 0x100027C ] }; + // long r + key { [ t, T, NoSymbol, NoSymbol ] }; + key { [ y, Y, NoSymbol, NoSymbol ] }; + key { [ u, U, uacute, Uacute ] }; + key { [ i, I, iacute, Iacute ] }; + key { [ o, O, oacute, Oacute ] }; + key { [ p, P, NoSymbol, NoSymbol ] }; + key { [ bracketleft, braceleft, dead_hook, dead_hook ] }; + key { [ bracketright, braceright, dead_horn, dead_horn ] }; + + // + // ASDFGHJKL;'# + // + key { [ a, A, aacute, Aacute ] }; + key { [ s, S, NoSymbol, NoSymbol ] }; + key { [ d, D, NoSymbol, NoSymbol ] }; + key { [ f, F, NoSymbol, NoSymbol ] }; + key { [ g, G, NoSymbol, NoSymbol ] }; + key { [ h, H, dead_abovedot, dead_abovedot ] }; + key { [ j, J, NoSymbol, NoSymbol ] }; + key { [ k, K, NoSymbol, NoSymbol ] }; + key { [ l, L, NoSymbol, NoSymbol ] }; + key { [ semicolon, colon, dead_diaeresis, dead_diaeresis ] }; + key { [ apostrophe, at, dead_acute, dead_acute ] }; + key { [ numbersign, asciitilde, dead_tilde, dead_tilde ] }; + + // + // \ZXCVBNM,./ + // + key { [ backslash, bar, dead_grave, dead_grave ] }; + key { [ z, Z, 0x100017F, 0x1001E9B ] }; + // long s, long s dot + key { [ x, X, NoSymbol, NoSymbol ] }; + key { [ c, C, NoSymbol, NoSymbol ] }; + key { [ v, V, dead_caron, dead_caron ] }; + key { [ b, B, NoSymbol, NoSymbol ] }; + key { [ n, N, NoSymbol, NoSymbol ] }; + key { [ m, M, NoSymbol, NoSymbol ] }; + key { [ comma, less, dead_cedilla, dead_cedilla ] }; + key { [ period, greater, dead_abovedot, dead_abovedot ] }; + key { [ slash, question, dead_belowdot, dead_belowdot ] }; + + key { [ space, space, space, nobreakspace ] }; + + include "level3(ralt_switch)" + + include "compose(rwin)" +}; + +// +// Ogham keyboard map for XFree86 +// +// Seamus O Ciardhuain (17 December 2002) +// +// Ogham keyboard layout as recommended in I.S. 434:1999. +// Suitable for multi-layout xkbcomp. +// Character names are given as in the Unicode standard, +// range U+1680 to U+169F. + +partial alphanumeric_keys +xkb_symbols "ogam" { + + name[Group1] = "Ireland - Ogham"; + + key.type[Group1] = "ONE_LEVEL"; + + key { type[Group1]="TWO_LEVEL", + [ 0x100169B, 0x100169C ] }; + // OGHAM FEATHER MARK, OGHAM REVERSED FEATHER MARK + + key { [ 0x1001680 ] }; // OGHAM SPACE MARK + + key { [ 0x100169C ] }; // OGHAM REVERSED FEATHER MARK + + key { [ space ] }; + + // + // Top Row QWERTYUIOP + // + key { [ 0x100168A ] }; // OGHAM LETTER CEIRT + key { [ 0x1001695 ] }; // OGHAM LETTER EABHADH + key { [ 0x1001693 ] }; // OGHAM LETTER EADHADH + key { [ 0x100168F ] }; // OGHAM LETTER RUIS + key { [ 0x1001688 ] }; // OGHAM LETTER TINNE + key { [ 0x1001698 ] }; // OGHAM LETTER IFIN + key { [ 0x1001692 ] }; // OGHAM LETTER UR + key { [ 0x1001694 ] }; // OGHAM LETTER IODHADH + key { [ 0x1001691 ] }; // OGHAM LETTER ONN + key { [ 0x100169A ] }; // OGHAM LETTER PEITH + + // + // Middle Row ASDFGHJKL + // + key { [ 0x1001690 ] }; // OGHAM LETTER AILM + key { [ 0x1001684 ] }; // OGHAM LETTER SAIL + key { [ 0x1001687 ] }; // OGHAM LETTER DAIR + key { [ 0x1001683 ] }; // OGHAM LETTER FEARN + key { [ 0x100168C ] }; // OGHAM LETTER GORT + key { [ 0x1001686 ] }; // OGHAM LETTER UATH + key { [ 0x1001697 ] }; // OGHAM LETTER UILLEANN + key { [ 0x1001696 ] }; // OGHAM LETTER OR + key { [ 0x1001682 ] }; // OGHAM LETTER LUIS + + // + // Bottom Row ZXCVBNM + // + key { [ 0x100168E ] }; // OGHAM LETTER STRAIF + key { [ 0x1001699 ] }; // OGHAM LETTER EAMHANCHOLL + key { [ 0x1001689 ] }; // OGHAM LETTER COLL + key { [ 0x100168D ] }; // OGHAM LETTER NGEADAL + key { [ 0x1001681 ] }; // OGHAM LETTER BEITH + key { [ 0x1001685 ] }; // OGHAM LETTER NION + key { [ 0x100168B ] }; // OGHAM LETTER MUIN + + // As an extension because and may not be + // available or sensible. These are also a bit more + // intuitive on a standard Irish keyboard. + key { [ 0x100169C ] }; // OGHAM REVERSED FEATHER MARK + key { [ 0x100169B ] }; // OGHAM FEATHER MARK + key { [ 0x1001680 ] }; // OGHAM SPACE MARK + + include "compose(rwin)" +}; + +partial alphanumeric_keys +xkb_symbols "ogam_is434" { + + // This has the full layout of IS434 with an Irish QWERTY keyboard, + // and the Ogham characters accessed when CAPS LOCK is on. + + name[Group1] = "Ireland - Ogham IS434"; + + key.type[Group1] = "THREE_LEVEL"; + + key { type[Group1] = "FOUR_LEVEL_ALPHABETIC", + [ backslash, bar, 0x100169B, 0x100169C ] }; + // OGHAM FEATHER MARK, OGHAM REVERSED FEATHER MARK + + key { [ numbersign, asciitilde, 0x1001680 ] }; // OGHAM SPACE MARK + key { [ grave, notsign, 0x100169C ] }; // OGHAM REVERSED FEATHER MARK + key { [ space, space, space ] }; + + // + // Numeric row + // + key { type[Group1]="TWO_LEVEL", [ 1, exclam ] }; + key { type[Group1]="TWO_LEVEL", [ 2, quotedbl ] }; + key { type[Group1]="TWO_LEVEL", [ 3, sterling ] }; + key { [ 4, dollar, EuroSign ] }; + key { type[Group1]="TWO_LEVEL", [ 5, percent ] }; + key { type[Group1]="TWO_LEVEL", [ 6, asciicircum ] }; + key { [ 7, ampersand, 0x100204A ] }; // Tironian Et + key { type[Group1]="TWO_LEVEL", [ 8, asterisk ] }; + key { type[Group1]="TWO_LEVEL", [ 9, parenleft ] }; + key { type[Group1]="TWO_LEVEL", [ 0, parenright ] }; + key { type[Group1]="TWO_LEVEL", [ minus, underscore ] }; + key { type[Group1]="TWO_LEVEL", [ equal, plus ] }; + + // + // Top Row QWERTYUIOP + // + key { [ q, Q, 0x100168A ] }; // OGHAM LETTER CEIRT + key { [ w, W, 0x1001695 ] }; // OGHAM LETTER EABHADH + key { [ e, E, 0x1001693 ] }; // OGHAM LETTER EADHADH + key { [ r, R, 0x100168F ] }; // OGHAM LETTER RUIS + key { [ t, T, 0x1001688 ] }; // OGHAM LETTER TINNE + key { [ y, Y, 0x1001698 ] }; // OGHAM LETTER IFIN + key { [ u, U, 0x1001692 ] }; // OGHAM LETTER UR + key { [ i, I, 0x1001694 ] }; // OGHAM LETTER IODHADH + key { [ o, O, 0x1001691 ] }; // OGHAM LETTER ONN + key { [ p, P, 0x100169A ] }; // OGHAM LETTER PEITH + + // + // Middle Row ASDFGHJKL + // + key { [ a, A, 0x1001690 ] }; // OGHAM LETTER AILM + key { [ s, S, 0x1001684 ] }; // OGHAM LETTER SAIL + key { [ d, D, 0x1001687 ] }; // OGHAM LETTER DAIR + key { [ f, F, 0x1001683 ] }; // OGHAM LETTER FEARN + key { [ g, G, 0x100168C ] }; // OGHAM LETTER GORT + key { [ h, H, 0x1001686 ] }; // OGHAM LETTER UATH + key { [ j, J, 0x1001697 ] }; // OGHAM LETTER UILLEANN + key { [ k, K, 0x1001696 ] }; // OGHAM LETTER OR + key { [ l, L, 0x1001682 ] }; // OGHAM LETTER LUIS + + // + // Bottom Row ZXCVBNM + // + key { [ z, Z, 0x100168E ] }; // OGHAM LETTER STRAIF + key { [ x, X, 0x1001699 ] }; // OGHAM LETTER EAMHANCHOLL + key { [ c, C, 0x1001689 ] }; // OGHAM LETTER COLL + key { [ v, V, 0x100168D ] }; // OGHAM LETTER NGEADAL + key { [ b, B, 0x1001681 ] }; // OGHAM LETTER BEITH + key { [ n, N, 0x1001685 ] }; // OGHAM LETTER NION + key { [ m, M, 0x100168B ] }; // OGHAM LETTER MUIN + + // As an extension because and may not be + // available or sensible. These are also a bit more + // intuitive on a standard Irish keyboard. + key { [ comma, less, 0x100169C ] }; // OGHAM REVERSED FEATHER MARK + key { [ period, greater, 0x100169B ] }; // OGHAM FEATHER MARK + key { [ slash, question, 0x1001680 ] }; // OGHAM SPACE MARK + + // The standard says the Ogham characters should be accessed when + // Caps Lock is down; not clear if this means it should lock but + // seems logical. + + key { type[Group1] = "ONE_LEVEL", [ ISO_Level3_Lock ] }; + + // Also allow access to Ogham characters using RALT for convenience + include "level3(ralt_switch)" + + // Redefine Scroll Lock as locking shift in case that's needed. + // Also overcomes annoying use of Scroll Lock LED inherited from + // US symbols but not relevant here since we're not changing group. + key {type[Group1] = "ONE_LEVEL", [ Shift_Lock ] }; + modifier_map Shift { Shift_Lock }; + + include "compose(rwin)" +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/pc/il /opt/SUNWut/lib/xkb/symbols/pc/il --- /opt/SUNWut.orig/lib/xkb/symbols/pc/il 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/pc/il 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,195 @@ +// $XdotOrg$ +// based on a keyboard map from an 'xkb/symbols/il' file +// +// $XFree86: xc/programs/xkbcomp/symbols/pc/il,v 1.3 2003/01/07 02:03:44 dawes Exp $ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + // uses the kbd layout in use in Israel. + + name[Group1]= "Israel"; + + key { [ semicolon, asciitilde ] }; + + key { [ slash, Q ] }; + key { [ apostrophe, W ] }; + key { [ hebrew_qoph, E ] }; + key { [ hebrew_resh, R ] }; + key { [ hebrew_aleph,T ] }; + key { [ hebrew_tet, Y ] }; + key { [ hebrew_waw, U ] }; + key { [ hebrew_finalnun, I ] }; + key { [ hebrew_finalmem, O ] }; + key { [ hebrew_pe, P ] }; + + key { [ hebrew_shin, A ] }; + key { [ hebrew_dalet,S ] }; + key { [ hebrew_gimel,D ] }; + key { [ hebrew_kaph, F ] }; + key { [ hebrew_ayin, G ] }; + key { [ hebrew_yod, H ] }; + key { [ hebrew_chet, J ] }; + key { [ hebrew_lamed, K ] }; + key { [ hebrew_finalkaph, L ] }; + key { [ hebrew_finalpe, colon ] }; + key { [ comma, quotedbl ] }; + + key { [ hebrew_zain, Z ] }; + key { [ hebrew_samech, X ] }; + key { [ hebrew_bet, C ] }; + key { [ hebrew_he, V ] }; + key { [ hebrew_nun, B ] }; + key { [ hebrew_mem, N ] }; + key { [ hebrew_zade, M ] }; + // Mirrored: + key { [ hebrew_taw, greater ] }; + key { [ hebrew_finalzade, less ] }; + key { [ period, question ] }; + + // Note the parens mirroring below: + key { [ bracketright, braceright ] }; + key { [ bracketleft, braceleft ] }; + key { [ 9 , parenright ] }; + key { [ 0 , parenleft ] }; + key { [ backslash, bar ] }; +}; + + +// nikud patter based on Dekel Tsur's Hebrew mapping for LyX +partial alphanumeric_keys +xkb_symbols "lyx" { + name[Group1]= "Israel - lyx"; + + key { [ semicolon, asciitilde ] }; + // On some key (e.g. AD01, right below) there is not yet mapping for the + // second shift level. Since I could not figure a simple way to map this + // to "emit nothing", it is currently mapped to the same letter of the + // first shift level (avoiding mapping may risk it be used by a character + // from a different group). + key { [ slash, slash ] }; + key { [ apostrophe, apostrophe ] }; + key { [ hebrew_qoph, 0x10005b8 ] }; // Qamats + key { [ hebrew_resh, 0x10005bc ] }; // Dagesh/Shuruq + key { [ hebrew_aleph, 0x100200e ] }; // LRM + key { [ hebrew_tet, 0x100200f ] }; // RLM + key { [ hebrew_waw, 0x10005b9 ] }; // Holam + key { [ hebrew_finalnun,hebrew_finalnun] }; + key { [ hebrew_finalmem,hebrew_finalmem] }; + key { [ hebrew_pe, 0x10005b7 ] }; // Patah + + key { [ hebrew_shin, 0x10005b0 ] }; // Sheva + key { [ hebrew_dalet, 0x10005bc ] }; // Dagesh/Shuruq + key { [ hebrew_gimel, hebrew_gimel ] }; + key { [ hebrew_kaph, hebrew_kaph ] }; + key { [ hebrew_ayin, 0x10005c2 ] }; // Sin dot + key { [ hebrew_yod, 0x10005c1 ] }; // Shin dot + key { [ hebrew_chet, 0x10005b4 ] }; // Hiriq + key { [ hebrew_lamed, 0x10020aa ] }; // NIS + key { [ hebrew_finalkaph,hebrew_finalkaph] }; + key { [ hebrew_finalpe, colon ] }; + key { [ comma, quotedbl ] }; + + key { [ hebrew_zain, hebrew_zain ] }; + key { [ hebrew_samech,0x10005b6 ] }; // Segol + key { [ hebrew_bet, 0x10005bb ] }; // Qubuts + key { [ hebrew_he, 0x10005b1 ] }; // H. Segol + key { [ hebrew_nun, 0x10005b2 ] }; // H. Patah + key { [ hebrew_mem, 0x10005b3 ] }; // H. Qamats + key { [ hebrew_zade, 0x10005b5 ] }; // Tsere + key { [ hebrew_taw, greater ] }; + key { [ hebrew_finalzade, less ] }; + key { [ period, question ] }; + + // Note the parens mirroring below: + key { [ bracketright, braceright ] }; + key { [ bracketleft, braceleft ] }; + key { [ 9 , parenright ] }; + key { [ 0 , parenleft ] }; + + key { [ minus, 0x10005be ] }; // H. Hiphen +}; + + + +// This is a partial implemetation of the Israeli standard SI-1452 +// It does not implement changes to the English layout ("Alt-English"), +// as I believe that it is not the job of this layout to modify the English +// layout. +partial alphanumeric_keys +xkb_symbols "si1452" { + name[Group1]= "Israel - si1452"; + + include "pc/il(basic)" + + key.type = "THREE_LEVEL"; + + key { [ semicolon, asciitilde,0x10005b0 ]}; // Sheva + key { [ period, question, 0x10005c3 ]}; // Sof Pasuq + + // The following may get overriden by the iso9995-3(basic101) symbols. + // therefore they are included here. + // Including them isn't a great idea (for instance: what if group 1 uses + // UK keyboard mapping, and maps shift-3 to sterling? This mapping won't + // preserve that, and I'm not sure that this is a good feature. + key { [ 1, exclam , 0x10005b1 ]}; // H. Segol + key { [ 2, at , 0x10005b2 ]}; // H. Patah + key { [ 3, numbersign , 0x10005b3 ]}; // H. Qamats + key { [ 4, dollar , 0x10005b4 ]}; // Hiriq + key { [ 5, percent , 0x10005b5 ]}; // Tsere + key { [ 6, asciicircum , 0x10005b6 ]}; // Segol + key { [ 7, ampersand , 0x10005b7 ]}; // Patah + key { [ 8, asterisk , 0x10005b8 ]}; // Qamats + // Mirrored!: + key { [ 9, parenright , 0x10005c2 ]}; // Sin dot + key { [ 0, parenleft , 0x10005c1 ]}; // Shin dot + key { [ minus, underscore , 0x10005b9 ]}; // Holam + key { [ equal, plus , 0x10005bc ]}; // Dagesh/Shuruq + + // Mirrored!: + key { [ bracketright, braceright, 0x10005bf ]}; // Rafe + key { [ bracketleft, braceleft, 0x10005bd ]}; // Meteg + + key { [ backslash, backslash, 0x10005bb ]}; // Qubuts +}; + +partial alphanumeric_keys +xkb_symbols "phonetic" { + + // uses the phonetic layout from old Slackware 'il.map' file + + name[Group1]= "Israel - Phonetic"; + + key { [ equal, plus, hebrew_doublelowline, hebrew_doublelowline ]}; + + key { [ hebrew_qoph, hebrew_qoph ] }; + key { [ hebrew_waw, hebrew_waw ] }; + key { [ hebrew_aleph, hebrew_aleph ] }; + key { [ hebrew_resh, hebrew_resh ] }; + key { [ hebrew_taw, hebrew_tet ] }; + key { [ hebrew_ayin, hebrew_ayin ] }; + key { [ hebrew_waw, hebrew_waw ] }; + key { [ hebrew_yod, hebrew_yod ] }; + key { [ hebrew_samech, hebrew_samech ] }; + key { [ hebrew_pe, hebrew_finalpe ] }; + + key { [ hebrew_aleph, hebrew_aleph ] }; + key { [ hebrew_shin, hebrew_shin ] }; + key { [ hebrew_dalet, hebrew_dalet ] }; + key { [ hebrew_pe, hebrew_finalpe ] }; + key { [ hebrew_gimel, hebrew_gimel ] }; + key { [ hebrew_he, hebrew_he ] }; + key { [ hebrew_yod, hebrew_yod ] }; + key { [ hebrew_kaph, hebrew_finalkaph ] }; + key { [ hebrew_lamed, hebrew_lamed ] }; + + key { [ hebrew_zain, hebrew_zain ] }; + key { [ hebrew_chet, hebrew_chet ] }; + key { [ hebrew_zade, hebrew_finalzade ] }; + key { [ hebrew_waw, hebrew_waw ] }; + key { [ hebrew_bet, hebrew_bet ] }; + key { [ hebrew_nun, hebrew_finalnun ] }; + key { [ hebrew_mem, hebrew_finalmem ] }; +}; + + diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/pc/in /opt/SUNWut/lib/xkb/symbols/pc/in --- /opt/SUNWut.orig/lib/xkb/symbols/pc/in 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/pc/in 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,892 @@ +// $XdotOrg$ +// $XKeyboardConfig: xkbdesc/symbols/in,v 1.9 2005/08/04 22:15:10 svu Exp $ + +// This layout includes all Indian layouts, including: +// - Bengali +// - Gujarati +// - Kannada +// - Malayalam +// - Oriya +// - Tamil +// - Telugu +// - Urdu + +// Links: +// - Indic INSCRIPT keyboard layout diagrams: +// http://java.sun.com/products/jfc/tsc/articles/InputMethod/indiclayout.html +// - Ekusheyr Shadhinota (Bengali layouts): +// http://ekushey.org/projects/shadhinota/index.html +// - Microsoft Windows XP SP2: Indic Language Standards - an Introduction: +// http://www.bhashaindia.com/MSProducts/XpSp2/Articles/IndicLanguageStandards.aspx + +// based on a keyboard map from an 'xkb/symbols/dev' file + +// Devangari is the default. Kill me if I am wrong:) +default partial alphanumeric_keys +xkb_symbols "deva" { + name[Group1]= "India"; + + key { [ 0x100094A, 0x1000912 ] }; + + // Mainly numbers. + key { [ 0x1000967, 0x100090D ] }; + key { [ 0x1000968, 0x1000945 ] }; + key { [ 0x1000969 ] }; + key { [ 0x100096A ] }; + key { [ 0x100096B ] }; + key { [ 0x100096C ] }; + key { [ 0x100096D ] }; + key { [ 0x100096e ] }; + key { [ 0x100096F, parenleft ] }; + key { [ 0x1000966, parenright ] }; + key { [ 0x1000903 ] }; + key { [ 0x1000943, 0x100090B ] }; + +// Mainly long vowels + + key { [ 0x100094C, 0x1000914 ] }; + key { [ 0x1000948, 0x1000910 ] }; + key { [ 0x100093E, 0x1000906 ] }; + key { [ 0x1000940, 0x1000908 ] }; + key { [ 0x1000942, 0x100090A ] }; + +// Mainly voiced consonants + + key { [ 0x100092C, 0x100092D ] }; + key { [ 0x1000939, 0x1000919 ] }; + key { [ 0x1000917, 0x1000918 ] }; + key { [ 0x1000926, 0x1000927 ] }; + key { [ 0x100091C, 0x100091D ] }; + key { [ 0x1000921, 0x1000922 ] }; + key { [ 0x100093C, 0x100091E ] }; + +// Mainly short vowels + key { [ 0x100094B, 0x1000913 ] }; + key { [ 0x1000947, 0x100090F ] }; + key { [ 0x100094D, 0x1000905 ] }; + key { [ 0x100093F, 0x1000907 ] }; + key { [ 0x1000941, 0x1000909 ] }; + +// Mainly unvoiced consonants + + key { [ 0x100092A, 0x100092B ] }; + key { [ 0x1000930, 0x1000931 ] }; + key { [ 0x1000915, 0x1000916 ] }; + key { [ 0x1000924, 0x1000925 ] }; + key { [ 0x100091A, 0x100091B ] }; + key { [ 0x100091F, 0x1000920 ] }; + key { [ 0x1000949, 0x1000911 ] }; + + key { [ 0x1000946, 0x100090E ] }; + key { [ 0x1000902, 0x1000901 ] }; + key { [ 0x100092E, 0x1000923 ] }; + key { [ 0x1000928, 0x1000929 ] }; + key { [ 0x1000935, 0x1000934 ] }; + key { [ 0x1000932, 0x1000933 ] }; + key { [ 0x1000938, 0x1000936 ] }; + key { [ comma, 0x1000937 ] }; + key { [ period, 0x1000964 ] }; + key { [ 0x100092F, question ] }; +}; + +// based on a keyboard map from an 'xkb/symbols/ben' file +// +// $XFree86: xc/programs/xkbcomp/symbols/ben,v 1.2 2002/11/22 04:03:28 dawes Exp $ + +partial alphanumeric_keys +xkb_symbols "ben" { + name[Group1]= "India - Bengali"; + + // Mainly numbers. + key { [ 0x10009E7 ] }; + key { [ 0x10009E8 ] }; + key { [ 0x10009E9 ] }; + key { [ 0x10009EA ] }; + key { [ 0x10009EB ] }; + key { [ 0x10009EC ] }; + key { [ 0x10009ED ] }; + key { [ 0x10009EE ] }; + key { [ 0x10009EF, parenleft ] }; + key { [ 0x10009E6, parenright ] }; + key { [ minus, 0x1000983 ] }; + key { [ 0x100098B, 0x10009C3 ] }; + +// Mainly long vowels + + key { [ 0x10009CC, 0x1000994 ] }; + key { [ 0x10009C8, 0x1000990 ] }; + key { [ 0x10009BE, 0x1000986 ] }; + key { [ 0x10009C0, 0x1000988 ] }; + key { [ 0x10009C2, 0x100098A ] }; + +// Mainly voiced consonants + + key { [ 0x10009AC, 0x10009AD ] }; + key { [ 0x10009B9, 0x1000999 ] }; + key { [ 0x1000997, 0x1000998 ] }; + key { [ 0x10009A6, 0x10009A7 ] }; + key { [ 0x100099C, 0x100099D ] }; + key { [ 0x10009A1, 0x10009A2 ] }; + key { [ 0x10009BC, 0x100099E ] }; + +// Mainly short vowels + key { [ 0x10009CB, 0x1000993 ] }; + key { [ 0x10009C7, 0x100098F ] }; + key { [ 0x10009CD, 0x1000985 ] }; + key { [ 0x10009BF, 0x1000987 ] }; + key { [ 0x10009C1, 0x1000989 ] }; + +// Mainly unvoiced consonants + + key { [ 0x10009AA, 0x10009AB ] }; + key { [ 0x10009B0, 0x10009DD ] }; + key { [ 0x1000995, 0x1000996 ] }; + key { [ 0x10009A4, 0x10009A5 ] }; + key { [ 0x100099A, 0x100099B ] }; + key { [ 0x100099F, 0x10009A0 ] }; + key { [ backslash, bar ] }; + + key { [ z, Z ] }; + key { [ 0x1000982, 0x1000981 ] }; + key { [ 0x10009AE, 0x10009A3 ] }; + key { [ 0x10009A8, 0x10009A8 ] }; + key { [ 0x10009AC, 0x10009AC ] }; + key { [ 0x10009B2, 0x10009B2 ] }; + key { [ 0x10009B8, 0x10009B6 ] }; + key { [ comma, 0x10009B7 ] }; + key { [ period, 0x1000964 ] }; + key { [ 0x10009DF, 0x10009AF ] }; +}; + +xkb_symbols "ben_probhat" { + name[Group1]= "India - Bengali Probhat"; + key { [ Escape ] }; + +// numbers + key { [ quoteleft, asciitilde ] }; + key { [ 0x10009E7, exclam ] }; + key { [ 0x10009E8, at ] }; + key { [ 0x10009E9, numbersign ] }; + key { [ 0x10009EA, 0x10009F3 ] }; + key { [ 0x10009EB, percent ] }; + key { [ 0x10009EC, asciicircum ] }; + key { [ 0x10009ED, 0x100099E ] }; + key { [ 0x10009EE, asterisk ] }; + key { [ 0x10009EF, parenleft ] }; + key { [ 0x10009E6, parenright ] }; + key { [ minus, 0x1000983 ] }; + key { [ 0x100098B, 0x10009C3 ] }; + key { [ BackSpace ] }; + +// tab, q to ] + key { [ Tab, ISO_Left_Tab ] }; + key { [ 0x10009A6, 0x10009A7 ] }; + key { [ 0x10009C2, 0x100098A ] }; + key { [ 0x10009C0, 0x1000988 ] }; + key { [ 0x10009B0, 0x10009DC ] }; + key { [ 0x100099F, 0x10009A0 ] }; + key { [ 0x100098F, 0x1000990 ] }; + key { [ 0x10009C1, 0x1000989 ] }; + key { [ 0x10009BF, 0x1000987 ] }; + key { [ 0x1000993, 0x1000994 ] }; + key { [ 0x10009AA, 0x10009AB ] }; + key { [ 0x10009C7, 0x10009C8 ] }; + key { [ 0x10009CB, 0x10009CC ] }; + key { [ Return ] }; + +// caps, a to ' +// key { [ Caps_Lock ] }; + key { [ 0x10009BE, 0x1000985 ] }; + key { [ 0x10009B8, 0x10009B7 ] }; + key { [ 0x10009A1, 0x10009A2 ] }; + key { [ 0x10009A4, 0x10009A5 ] }; + key { [ 0x1000997, 0x1000998 ] }; + key { [ 0x10009B9, 0x1000983 ] }; + key { [ 0x100099C, 0x100099D ] }; + key { [ 0x1000995, 0x1000996 ] }; + key { [ 0x10009B2, 0x1000982 ] }; + key { [ semicolon, colon ] }; + key { [ quoteright, quotedbl ] }; + +// shift, z to / +// key { [ Shift_L ] }; + key { [ 0x10009DF, 0x10009AF ] }; + key { [ 0x10009B6, 0x10009DD ] }; + key { [ 0x100099A, 0x100099B ] }; + key { [ 0x1000986, 0x100098B ] }; + key { [ 0x10009AC, 0x10009AD ] }; + key { [ 0x10009A8, 0x10009A3 ] }; + key { [ 0x10009AE, 0x1000999 ] }; + key { [ comma, 0x10009C3 ] }; + key { [ period, 0x1000981 ] }; + key { [ 0x10009CD, question ] }; + key { [ backslash, bar ] }; + +// key { [ Control_L ] }; +// key { [ space ] }; + +// modifier_map Shift { Shift_L }; +// modifier_map Lock { Caps_Lock }; +// modifier_map Control{ Control_L }; + +}; + +partial alphanumeric_keys +xkb_symbols "guj" { + name[Group1]= "India - Gujarati"; + + // Mainly numbers. + key { [ 0x1000AE7, 0x1000A8D ] }; + key { [ 0x1000AE8, 0x1000AC5 ] }; + key { [ 0x1000AE9 ] }; + key { [ 0x1000AEA ] }; + key { [ 0x1000AEB ] }; + key { [ 0x1000AEC ] }; + key { [ 0x1000AED ] }; + key { [ 0x1000AEE ] }; + key { [ 0x1000AEF, parenleft ] }; + key { [ 0x1000AE6, parenright ] }; + key { [ minus, 0x1000A83 ] }; + key { [ 0x1000A8B, 0x1000AC3 ] }; + +// Mainly long vowels + + key { [ 0x1000ACC, 0x1000A94 ] }; + key { [ 0x1000AC8, 0x1000A90 ] }; + key { [ 0x1000ABE, 0x1000A86 ] }; + key { [ 0x1000AC0, 0x1000A88 ] }; + key { [ 0x1000AC2, 0x1000A8A ] }; + +// Mainly voiced consonants + + key { [ 0x1000AAC, 0x1000AAD ] }; + key { [ 0x1000AB9, 0x1000A99 ] }; + key { [ 0x1000A97, 0x1000A98 ] }; + key { [ 0x1000AA6, 0x1000AA7 ] }; + key { [ 0x1000A9C, 0x1000A9D ] }; + key { [ 0x1000AA1, 0x1000AA2 ] }; + key { [ 0x1000ABC, 0x1000A9E ] }; + +// Mainly short vowels + key { [ 0x1000ACB, 0x1000A93 ] }; + key { [ 0x1000AC7, 0x1000A8F ] }; + key { [ 0x1000ACD, 0x1000A85 ] }; + key { [ 0x1000ABF, 0x1000A87 ] }; + key { [ 0x1000AC1, 0x1000A89 ] }; + +// Mainly unvoiced consonants + + key { [ 0x1000AAA, 0x1000AAB ] }; + key { [ 0x1000AB0, guj_rra ] }; + key { [ 0x1000A95, 0x1000A96 ] }; + key { [ 0x1000AA4, 0x1000AA5 ] }; + key { [ 0x1000A9A, 0x1000A9B ] }; + key { [ 0x1000A9F, 0x1000AA0 ] }; + key { [ 0x1000AC9, 0x1000A91 ] }; + + key { [ z , Z ] }; + key { [ 0x1000A82, 0x1000A81 ] }; + key { [ 0x1000AAE, 0x1000AA3 ] }; + key { [ 0x1000AA8, guj_nnna ] }; + key { [ 0x1000AB5, guj_llla ] }; + key { [ 0x1000AB2, 0x1000AB3 ] }; + key { [ 0x1000AB8, 0x1000AB6 ] }; + key { [ comma, 0x1000AB7 ] }; + key { [ period, 0x1000964 ] }; + key { [ 0x1000AAF, question ] }; +}; + +partial alphanumeric_keys +xkb_symbols "kan" { + + // Inscript layout for Kannada + // Author : G Karunakar + // Date : Wed Nov 13 17:22:58 IST 2002 + // Kannada digits mapped in basic only + + name[Group1]= "India - Kannada"; + + key { [ 0x01000cca, 0x01000c92 ] }; + key { [ 0x01000ce7, 0x01000c8d ] }; + key { [ 0x01000ce8, 0x01000cc5 ] }; + key { [ 0x01000ce9 ] }; + key { [ 0x01000cea ] }; + key { [ 0x01000ceb ] }; + key { [ 0x01000cec ] }; + key { [ 0x01000ced ] }; + key { [ 0x01000cee ] }; + key { [ 0x01000cef ] }; + key { [ 0x01000ce6 ] }; + key { [ 0x01000c83 ] }; + key { [ 0x01000cc3, 0x01000c8b ] }; + + key { [ 0x01000ccc, 0x01000c94 ] }; + key { [ 0x01000cc8, 0x01000c90 ] }; + key { [ 0x01000cbe, 0x01000c86 ] }; + key { [ 0x01000cc0, 0x01000c88 ] }; + key { [ 0x01000cc2, 0x01000c8a ] }; + key { [ 0x01000cac, 0x01000cad ] }; + key { [ 0x01000cb9, 0x01000c99 ] }; + key { [ 0x01000c97, 0x01000c98 ] }; + key { [ 0x01000ca6, 0x01000ca7 ] }; + key { [ 0x01000c9c, 0x01000c9d ] }; + key { [ 0x01000ca1, 0x01000ca2 ] }; + key { [ 0x01000cbc, 0x01000c9e ] }; + + key { [ 0x01000ccb, 0x01000c93 ] }; + key { [ 0x01000cc7, 0x01000c8f ] }; + key { [ 0x01000ccd, 0x01000c85 ] }; + key { [ 0x01000cbf, 0x01000c87 ] }; + key { [ 0x01000cc1, 0x01000c89 ] }; + key { [ 0x01000caa, 0x01000cab ] }; + key { [ 0x01000cb0, 0x01000cb1 ] }; + key { [ 0x01000c95, 0x01000c96 ] }; + key { [ 0x01000ca4, 0x01000ca5 ] }; + key { [ 0x01000c9a, 0x01000c9b ] }; + key { [ 0x01000c9f, 0x01000ca0 ] }; + + key { [ 0x01000cc6, 0x01000c8e ] }; + key { [ 0x01000c82, 0x01000c81 ] }; + key { [ 0x01000cae, 0x01000ca3 ] }; + key { [ 0x01000ca8, 0x01000ca9 ] }; + key { [ 0x01000cb5, 0x01000cb4 ] }; + key { [ 0x01000cb2, 0x01000cb3 ] }; + key { [ 0x01000cb8, 0x01000cb6 ] }; + key { [ comma , 0x01000cb7 ] }; + key { [ period , 0x01000ce4 ] }; + key { [ 0x01000caf, 0x01000040 ] }; + key { [ 0x01000cc9, 0x01000c91 ] }; + + key { + symbols[Group1] = [ Mode_switch, Multi_key ], + virtualMods = AltGr + }; + +}; + +// Description : A keymap for Malayalam +// Encoding : Unicode (http://www.unicode.org) +// Author : Baiju M +// Date : Sat Aug 17 21:10:48 IST 2002 +// Mapping: + +partial alphanumeric_keys +xkb_symbols "mal" { + + name[Group1] = "India - Malayalam"; + + //From grave to backslash (\) + + key { [ 0x01000d4a , 0x01000d12 ] }; + +// svu: +// These lines were in former "mal" variant - +// but the digits are replaced with the ones from 'mal_plusnum' - +// for the integrity of all Indian layouts +// +// key { [1 , exclam ] }; +// key { [2 , at ] }; +// key { [3 , numbersign ] }; +// key { [4 , dollar ] }; +// key { [5 , percent ] }; +// key { [6 ,asciicircum ] }; +// key { [7 , ampersand ] }; +// key { [8 , 0x01000d7e ] }; +// key { [9 , parenleft ] }; +// key { [0 , parenright ] }; + + key { [ 0x01000d67 , exclam ] }; + key { [ 0x01000d68 , at ] }; + key { [ 0x01000d69 , numbersign ] }; + key { [ 0x01000d6a , dollar ] }; + key { [ 0x01000d6b , percent ] }; + key { [ 0x01000d6c , asciicircum ] }; + key { [ 0x01000d6d , ampersand ] }; + key { [ 0x01000d6e , 0x01000d7e ] }; + key { [ 0x01000d6f , parenleft ] }; + key { [ 0x01000d66 , parenright ] }; + + key { [ minus , 0x01000d03 ] }; + key { [ 0x01000d43 , 0x01000d0b ] }; + key { [ 0x01000d7c ] }; + + // From 'q' to right bracket (]) + + key { [ 0x01000d4c , 0x01000d14 ] }; + key { [ 0x01000d48 , 0x01000d10 ] }; + key { [ 0x01000d3e , 0x01000d06 ] }; + key { [ 0x01000d40 , 0x01000d08 ] }; + key { [ 0x01000d42 , 0x01000d0a ] }; + key { [ 0x01000d2c , 0x01000d2d ] }; + key { [ 0x01000d39 , 0x01000d19 ] }; + key { [ 0x01000d17 , 0x01000d18 ] }; + key { [ 0x01000d26 , 0x01000d27 ] }; + key { [ 0x01000d1c , 0x01000d1d ] }; + key { [ 0x01000d21 , 0x01000d22 ] }; + key { [ 0x0100200d , 0x01000d1e ] }; + + // From 'a' to apostrophe (') + + key { [ 0x01000d4b , 0x01000d13 ] }; + key { [ 0x01000d47 , 0x01000d0f ] }; + key { [ 0x01000d4d , 0x01000d05 ] }; + key { [ 0x01000d3f , 0x01000d07 ] }; + key { [ 0x01000d41 , 0x01000d09 ] }; + key { [ 0x01000d2a , 0x01000d2b ] }; + key { [ 0x01000d30 , 0x01000d31 ] }; + key { [ 0x01000d15 , 0x01000d16 ] }; + key { [ 0x01000d24 , 0x01000d25 ] }; + key { [ 0x01000d1a , 0x01000d1b ] }; + key { [ 0x01000d1f , 0x01000d20 ] }; + + // From 'z' to slash (/) + + key { [ 0x01000d46 , 0x01000d0e ] }; + key { [ 0x01000d02 , 0x01000d7a ] }; + key { [ 0x01000d2e , 0x01000d23 ] }; + key { [ 0x01000d28 , 0x01000d7b ] }; + key { [ 0x01000d35 , 0x01000d34 ] }; + key { [ 0x01000d32 , 0x01000d33 ] }; + key { [ 0x01000d38 , 0x01000d36 ] }; + key { [ comma , 0x01000d37 ] }; + key { [ period , 0x01000d7d ] }; + key { [ 0x01000d2f , question ] }; + +}; + +partial alphanumeric_keys +xkb_symbols "ori" { + // Inscript layout for Oriya + // Author: G Karunakar + // Date: Wed Nov 13 18:16:19 IST 2002 + + name[Group1]= "India - Oriya"; + + key { [ 0x01000b4a, 0x01000b12 ] }; + key { [ 0x01000b67, 0x01000b0d ] }; + key { [ 0x01000b68, 0x01000b45 ] }; + key { [ 0x01000b69 ] }; + key { [ 0x01000b6a ] }; + key { [ 0x01000b6b ] }; + key { [ 0x01000b6c ] }; + key { [ 0x01000b6d ] }; + key { [ 0x01000b6e ] }; + key { [ 0x01000b6f ] }; + key { [ 0x01000b66 ] }; + key { [ 0x01000b03 ] }; + key { [ 0x01000b43, 0x01000b0b ] }; + + key { [ 0x01000b4c, 0x01000b14 ] }; + key { [ 0x01000b48, 0x01000b10 ] }; + key { [ 0x01000b3e, 0x01000b06 ] }; + key { [ 0x01000b40, 0x01000b08 ] }; + key { [ 0x01000b42, 0x01000b0a ] }; + key { [ 0x01000b2c, 0x01000b2d ] }; + key { [ 0x01000b39, 0x01000b19 ] }; + key { [ 0x01000b17, 0x01000b18 ] }; + key { [ 0x01000b26, 0x01000b27 ] }; + key { [ 0x01000b1c, 0x01000b1d ] }; + key { [ 0x01000b21, 0x01000b22 ] }; + key { [ 0x01000b3c, 0x01000b1e ] }; + + key { [ 0x01000b4b, 0x01000b13 ] }; + key { [ 0x01000b47, 0x01000b0f ] }; + key { [ 0x01000b4d, 0x01000b05 ] }; + key { [ 0x01000b3f, 0x01000b07 ] }; + key { [ 0x01000b41, 0x01000b09 ] }; + key { [ 0x01000b2a, 0x01000b2b ] }; + key { [ 0x01000b30, 0x01000b31 ] }; + key { [ 0x01000b15, 0x01000b16 ] }; + key { [ 0x01000b24, 0x01000b25 ] }; + key { [ 0x01000b1a, 0x01000b1b ] }; + key { [ 0x01000b1f, 0x01000b20 ] }; + + key { [ 0x01000b46, 0x01000b0e ] }; + key { [ 0x01000b02, 0x01000b01 ] }; + key { [ 0x01000b2e, 0x01000b23 ] }; + key { [ 0x01000b28, 0x01000b29 ] }; + key { [ 0x01000b35, 0x01000b34 ] }; + key { [ 0x01000b32, 0x01000b33 ] }; + key { [ 0x01000b38, 0x01000b36 ] }; + key { [ comma , 0x01000b37 ] }; + key { [ period , 0x01000b64 ] }; + key { [ 0x01000b2f, 0x01000040 ] }; + key { [ 0x01000b49, 0x01000b11 ] }; + + key { + symbols[Group1] = [ Mode_switch, Multi_key ], + virtualMods = AltGr + }; +}; + +// INSCRIPT +partial alphanumeric_keys +xkb_symbols "tam" { + name[Group1]= "India - Tamil"; + + key { [ 0x1000BCA, 0x1000B92 ] }; + + // Mainly numbers. + key { [ 0x1000BE7 ] }; + key { [ 0x1000BE8 ] }; + key { [ 0x1000BE9 ] }; + key { [ 0x1000BEA ] }; + key { [ 0x1000BEB ] }; + key { [ 0x1000BEC ] }; + key { [ 0x1000BED ] }; + key { [ 0x1000BEE ] }; + key { [ 0x1000BEF, parenleft ] }; + key { [ 0x1000BF0, parenright ] }; + key { [ 0x1000BF1, 0x1000B83 ] }; + key { [ 0x1000BF2, plus ] }; + +// Mainly long vowels + + key { [ 0x1000BCC, 0x1000B94 ] }; + key { [ 0x1000BC8, 0x1000B90 ] }; + key { [ 0x1000BBE, 0x1000B86 ] }; + key { [ 0x1000BC0, 0x1000B88 ] }; + key { [ 0x1000BC2, 0x1000B8A ] }; + +// Mainly voiced consonants + + key { [ 0x1000BB9, 0x1000B99 ] }; + key { [ 0x1000BBC, 0x1000B9E ] }; + +// Mainly short vowels + key { [ 0x1000BCB, 0x1000B93 ] }; + key { [ 0x1000BC7, 0x1000B8F ] }; + key { [ 0x1000BCD, 0x1000B85 ] }; + key { [ 0x1000BBF, 0x1000B87 ] }; + key { [ 0x1000BC1, 0x1000B89 ] }; + +// Mainly unvoiced consonants + + key { [ 0x1000BAA ] }; + key { [ 0x1000BB0, 0x1000BB1 ] }; + key { [ 0x1000B95 ] }; + key { [ 0x1000BA4 ] }; + key { [ 0x1000B9A ] }; + key { [ 0x1000B9F ] }; + key { [ backslash, bar ] }; + + key { [ 0x1000BC6, 0x1000B8E ] }; + key { [ 0x1000B82 ] }; + key { [ 0x1000BAE, 0x1000BA3 ] }; + key { [ 0x1000BA8, 0x1000BA9 ] }; + key { [ 0x1000BB5, 0x1000BB4 ] }; + key { [ 0x1000BB2, 0x1000BB3 ] }; + key { [ 0x1000BB8 ] }; + key { [ comma, 0x1000BB7 ] }; + key { [ period, 0x1000964 ] }; + key { [ 0x1000BAF, question ] }; +}; + +partial alphanumeric_keys +xkb_symbols "tam_unicode" { + +// Description: A keymap based on the TamilNet'99 typewriter keyboard +// Encoding: Unicode (http://www.unicode.org) +// Author: Thuraiappah Vaseeharan +// Date : Sat Feb 9 21:10:48 CST 2002 +// Mapping: + + name[Group1]= "India - Tamil Unicode"; + + // granthas + key { [ 0x1000b83 ] } ; + key { [ 0x1000b9c ] } ; + key { [ 0x1000bb7 ] } ; + key { [ 0x1000bb8 ] } ; + key { [ 0x1000bb9 ] } ; + + // Qrow + key { [ 0x1000b9e ] }; + key { [ 0x1000bb1 ] }; + key { [ 0x1000ba8 ] }; + key { [ 0x1000b9a ] }; + key { [ 0x1000bb5 ] }; + key { [ 0x1000bb2 ] }; + key { [ 0x1000bb0 ] }; + key { [ 0x1000bc8, 0x1000b90 ] }; + key { [ 0x1000bca, 0x1000bcb ] }; + key { [ 0x1000bbf, 0x1000bc0 ] }; + key { [ 0x1000bc1, 0x1000bc2 ] }; + + // Arow + key { [ 0x1000baf ] }; + key { [ 0x1000bb3 ] }; + key { [ 0x1000ba9 ] }; + key { [ 0x1000b95 ] }; + key { [ 0x1000baa ] }; + key { [ 0x1000bbe, 0x1000bb4 ] }; + key { [ 0x1000ba4 ] }; + key { [ 0x1000bae ] }; + key { [ 0x1000b9f ] }; + key { [ 0x1000bcd ] }; + key { [ 0x1000b99 ] }; + + // Zrow + key { [ 0x1000ba3 ] }; + key { [ 0x1000b92, 0x1000b93 ] }; + key { [ 0x1000b89, 0x1000b8a ] }; + key { [ 0x1000b8e, 0x1000b8f ] }; + key { [ 0x1000bc6, 0x1000bc7 ] }; + key { [ 0x1000b94, 0x1000bcc ] }; + key { [ 0x1000b85, 0x1000b86 ] }; + key { [ 0x1000b87, 0x1000b88 ] }; +}; + +partial alphanumeric_keys +xkb_symbols "tam_TSCII" { + +// Description : A Tamil typewrite-style keymap +// loosely based on TamilNet'99 reommendations +// Encoding : TSCII (http://www.tscii.org) +// Author : Thuraiappah Vaseeharan +// Last Modified: Sat Jan 5 17:11:26 CST 2002 + + name[Group1]= "India - Tamil TSCII Typewriter"; + + key { [ 0x10000b7, 0x10000a4 ] }; // aytham + key { [ 0x1000082, 0x10000a5 ] }; // shri + key { [ 0x1000083, 0x1000088 ] }; // ja + key { [ 0x1000084, 0x1000089 ] }; // sha + key { [ 0x1000085, 0x100008a ] }; // sa + key { [ 0x1000086, 0x100008b ] }; // ha + key { [ 0x1000087, 0x100008c ] }; // ksha + + // Qrow + key { [ 0x10000bb, 0x100009a ] }; // nja + key { [ 0x10000c8, 0x10000da ] }; // Ra + key { [ 0x10000bf, 0x10000d1 ] }; // NNa + key { [ 0x10000ba, 0x10000cd ] }; // ca + key { [ 0x10000c5, 0x10000d7 ] }; // va + key { [ 0x10000c4, 0x10000d6 ] }; // la + key { [ 0x10000c3, 0x10000d5 ] }; // ra + key { [ 0x10000a8, 0x10000b3 ] }; // sangili, ai + key { [ 0x10000ca, 0x10000cb ] }; // di, dI + key { [ 0x10000a2, 0x10000a3 ] }; // visiri + key { [ dead_acute, 0x10000a3 ] }; // Ukaaram + + // Arow + key { [ 0x10000c2, 0x10000d4 ] }; // ya + key { [ 0x10000c7, 0x10000d9 ] }; // La + key { [ 0x10000c9, 0x10000db ] }; // na + key { [ 0x10000b8, 0x10000cc ] }; // ka + key { [ 0x10000c0, 0x10000d2 ] }; // pa + key { [ dead_grave,0x10000a1 ] }; // pulli,aravu + key { [ 0x10000be, 0x10000d0 ] }; // tha + key { [ 0x10000c1, 0x10000d3 ] }; // ma + key { [ 0x10000bc, 0x10000ce ] }; // da + key { [ 0x10000c6, 0x10000d8 ] }; // zha + key { [ 0x10000b9, 0x1000099 ] }; // nga + + // Zrow + key { [ 0x10000bd, 0x10000cf ] }; // Na + key { [ 0x10000b4, 0x10000b5 ] }; // o, O + key { [ 0x10000af, 0x10000b0 ] }; // u, U + key { [ 0x10000b1, 0x10000b2 ] }; // e, E + key { [ 0x10000a6, 0x10000a7 ] }; // kombus + key { [ 0x10000b6, 0x10000aa ] }; // au + key { [ 0x10000ab, 0x10000ac ] }; // a, A + key { [ 0x10000fe, 0x10000ae ] }; // i, I + +}; + +partial alphanumeric_keys +xkb_symbols "tam_TAB" { + +// Description: A keymap based on the TamilNet'99 typewriter keyboard +// Encoding: TAB (http://www.tamilnet99.org) +// Author: Thuraiappah Vaseeharan +// Date : Sun Aug 12 02:23:00 CDT 2001 + + name[Group1]= "India - Tamil TAB Typewriter"; + + // numeral row + key { [ 0x10000e7, 0x10000a7 ] } ; + key { [ 0x10000fa, 0x10000a8 ] } ; + key { [ 0x10000fb ] } ; + key { [ 0x10000fc ] } ; + key { [ 0x10000fd ] } ; + key { [ 0x10000fe ] } ; + key { [ 0x10000ff ] } ; + + // q-row + key { [ 0x10000eb, 0x10000b3 ] }; + key { [ 0x10000f8, 0x10000c1 ] }; + key { [ 0x10000ef, 0x10000b8 ] }; + key { [ 0x10000ea, 0x10000b2 ] }; + key { [ 0x10000f5, 0x10000be ] }; + key { [ 0x10000f4, 0x10000bd ] }; + key { [ 0x10000f3, 0x10000bc ] }; + key { [ 0x10000ac, 0x10000e4 ] }; + key { [ 0x10000ae, 0x10000af ] }; + key { [ 0x10000a4, 0x10000a6 ] }; + key { [ dead_circumflex, 0x10000a6 ] }; // Ukaaram + + // a-row + key { [ 0x10000f2, 0x10000bb ] }; + key { [ 0x10000f7, 0x10000c0 ] }; + key { [ 0x10000f9, 0x10000c2 ] }; + key { [ 0x10000e8, 0x10000b0 ] }; + key { [ 0x10000f0, 0x10000b9 ] }; + key { [ 0x10000a2, 0x10000a3 ] }; + key { [ 0x10000ee, 0x10000b6 ] }; + key { [ 0x10000f1, 0x10000ba ] }; + key { [ 0x10000ec, 0x10000b4 ] }; + key { [ 0x10000f6, 0x10000bf ] }; + key { [ 0x10000e9, 0x10000b1 ] }; + + // z-row + key { [ 0x10000ed, 0x10000b5 ] }; + key { [ 0x10000e5, 0x10000e6 ] }; + key { [ 0x10000e0, 0x10000e1 ] }; + key { [ 0x10000e2, 0x10000e3 ] }; + key { [ 0x10000aa, 0x10000ab ] }; + key { [ 0x10000ac, 0x10000a3 ] }; + key { [ 0x10000dc, 0x10000dd ] }; + key { [ 0x10000de, 0x10000df ] }; +}; + +partial alphanumeric_keys +xkb_symbols "tel" { + + // Inscript layout for Telugu using Unicode + // Author: G Karunakar + // Date: + // See layout at http://www.indlinux.org/keymap/telugu.php + + name[Group1]= "India - Telugu"; + + key { [ 0x01000c4a, 0x01000c12 ] }; + key { [ 0x01000c67, 0x01000c0d ] }; + key { [ 0x01000c68, 0x01000c45 ] }; + key { [ 0x01000c69, numbersign ] }; + key { [ 0x01000c6a, dollar ] }; + key { [ 0x01000c6b, percent ] }; + key { [ 0x01000c6c, asciicircum ] }; + key { [ 0x01000c6d, ampersand ] }; + key { [ 0x01000c6e, asterisk ] }; + key { [ 0x01000c6f, parenleft ] }; + key { [ 0x01000c66, parenright ] }; + key { [ 0x01000c03, underscore ] }; + key { [ 0x01000c43, 0x01000c0b ] }; + key { [ BackSpace ] }; + + key { [ 0x01000c4c, 0x01000c14 ] }; + key { [ 0x01000c48, 0x01000c10 ] }; + key { [ 0x01000c3e, 0x01000c06 ] }; + key { [ 0x01000c40, 0x01000c08 ] }; + key { [ 0x01000c42, 0x01000c0a ] }; + key { [ 0x01000c2c, 0x01000c2d ] }; + key { [ 0x01000c39, 0x01000c19 ] }; + key { [ 0x01000c17, 0x01000c18 ] }; + key { [ 0x01000c26, 0x01000c27 ] }; + key { [ 0x01000c1c, 0x01000c1d ] }; + key { [ 0x01000c21, 0x01000c22 ] }; + key { [ 0x01000c3c, 0x01000c1e ] }; + + key { [ 0x01000c4b, 0x01000c13 ] }; + key { [ 0x01000c47, 0x01000c0f ] }; + key { [ 0x01000c4d, 0x01000c05 ] }; + key { [ 0x01000c3f, 0x01000c07 ] }; + key { [ 0x01000c41, 0x01000c09 ] }; + key { [ 0x01000c2a, 0x01000c2b ] }; + key { [ 0x01000c30, 0x01000c31 ] }; + key { [ 0x01000c15, 0x01000c16 ] }; + key { [ 0x01000c24, 0x01000c25 ] }; + key { [ 0x01000c1a, 0x01000c1b ] }; + key { [ 0x01000c1f, 0x01000c20 ] }; + + key { [ 0x01000c46, 0x01000c0e ] }; + key { [ 0x01000c02, 0x01000c01 ] }; + key { [ 0x01000c2e, 0x01000c23 ] }; + key { [ 0x01000c28, 0x01000c29 ] }; + key { [ 0x01000c35, 0x01000c34 ] }; + key { [ 0x01000c32, 0x01000c33 ] }; + key { [ 0x01000c38, 0x01000c36 ] }; + key { [ comma , 0x01000c37 ] }; + key { [ period , 0x01000c64 ] }; + key { [ 0x01000c2f, 0x01000040 ] }; + key { [ 0x01000c49, 0x01000c11 ] }; + + key { + symbols[Group1] = [ Mode_switch, Multi_key ], + virtualMods = AltGr + }; +}; + +partial alphanumeric_keys +xkb_symbols "urd" { + include "pc/pk(urd)" + name[Group1]= "India - Urdu"; +}; + +// based on a keyboard map from an 'xkb/symbols/gur' file + +partial alphanumeric_keys +xkb_symbols "guru" { + name[Group1]= "India - Gurmukhi"; + + // Mainly numbers. + key { [ 0x1000A67 ] }; + key { [ 0x1000A68 ] }; + key { [ 0x1000A69 ] }; + key { [ 0x1000A6A ] }; + key { [ 0x1000A6B ] }; + key { [ 0x1000A6C ] }; + key { [ 0x1000A6D ] }; + key { [ 0x1000A6e ] }; + key { [ 0x1000A6F, parenleft ] }; + key { [ 0x1000A66, parenright ] }; + key { [ gur_visarga ] }; + key { [ gur_v_r, gur_v_r_s ] }; + +// Mainly long vowels + + key { [ 0x1000A4C, 0x1000A14 ] }; + key { [ 0x1000A48, 0x1000A10 ] }; + key { [ 0x1000A3E, 0x1000A06 ] }; + key { [ 0x1000A40, 0x1000A08 ] }; + key { [ 0x1000A42, 0x1000A0A ] }; + +// Mainly voiced consonants + + key { [ 0x1000A2C, 0x1000A2D ] }; + key { [ 0x1000A39, 0x1000A19 ] }; + key { [ 0x1000A17, 0x1000A18 ] }; + key { [ 0x1000A26, 0x1000A27 ] }; + key { [ 0x1000A1C, 0x1000A1D ] }; + key { [ 0x1000A21, 0x1000A22 ] }; + key { [ 0x1000A3C, 0x1000A1E ] }; + +// Mainly short vowels + key { [ 0x1000A4B, 0x1000A13 ] }; + key { [ 0x1000A47, 0x1000A0F ] }; + key { [ 0x1000A4D, 0x1000A05 ] }; + key { [ 0x1000A3F, 0x1000A07 ] }; + key { [ 0x1000A41, 0x1000A09 ] }; + +// Mainly unvoiced consonants + + key { [ 0x1000A2A, 0x1000A2B ] }; + key { [ 0x1000A30, 0x1000A30 ] }; + key { [ 0x1000A15, 0x1000A16 ] }; + key { [ 0x1000A24, 0x1000A25 ] }; + key { [ 0x1000A1A, 0x1000A1B ] }; + key { [ 0x1000A1F, 0x1000A20 ] }; + key { [ backslash, bar ] }; + + key { [ z, Z ] }; + key { [ 0x1000A02, 0x1000A70 ] }; + key { [ 0x1000A2E, 0x1000A23 ] }; + key { [ 0x1000A28, 0x1000A28 ] }; + key { [ 0x1000A35, 0x1000A35 ] }; + key { [ 0x1000A32, 0x1000A33 ] }; + key { [ 0x1000A38, 0x1000A36 ] }; + key { [ comma, less ] }; + key { [ period, 0x1000964 ] }; + key { [ 0x1000A2F, question ] }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/pc/ir /opt/SUNWut/lib/xkb/symbols/pc/ir --- /opt/SUNWut.orig/lib/xkb/symbols/pc/ir 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/pc/ir 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,69 @@ +// $XdotOrg$ +// based on +// Iranian keymap, by Robert Brady +// Data supplied by Roozbeh Pournader +// Minor changes made by Arash Zeini , +// and Roozbeh Pournader. +// Last update: 2002-06-19 +// +// $XFree86$ + +partial default alphanumeric_keys +xkb_symbols "basic" { + name[Group1]= "Iran"; + + key { [ 0x100200d ] }; + + // Mainly numbers. + key { [ 0x10006f1, exclam ] }; + key { [ 0x10006f2, 0x100066c ] }; + key { [ 0x10006f3, 0x100066b ] }; + key { [ 0x10006f4, 0x100fdfc ] }; + key { [ 0x10006f5, 0x100066a ] }; + key { [ 0x10006f6, multiply ] }; + key { [ 0x10006f7, Arabic_comma ] }; + key { [ 0x10006f8, asterisk ] }; + key { [ 0x10006f9, parenright ] }; + key { [ 0x10006f0, parenleft ] }; + key { [ minus, Arabic_tatweel ] }; + key { [ equal, plus ] }; + + key { [ Arabic_dad, Arabic_sukun ] }; + key { [ Arabic_sad, Arabic_dammatan ] }; + key { [ Arabic_theh, Arabic_kasratan ] }; + key { [ Arabic_qaf, Arabic_fathatan ] }; + key { [ Arabic_feh, Arabic_damma ] }; + key { [ Arabic_ghain, Arabic_kasra ] }; + key { [ Arabic_ain, Arabic_fatha ] }; + key { [ Arabic_heh, Arabic_shadda ] }; + key { [ Arabic_khah, bracketright ] }; + key { [ Arabic_hah, bracketleft ] }; + key { [ Arabic_jeem, braceright ] }; + key { [ 0x1000686, braceleft ] }; + + key { [ Arabic_sheen, Arabic_hamzaonwaw ] }; + key { [ Arabic_seen, Arabic_hamzaonyeh ] }; + key { [ 0x10006cc, Arabic_yeh ] }; + key { [ Arabic_beh, Arabic_hamzaunderalef] }; + key { [ Arabic_lam, Arabic_hamzaonalef ] }; + key { [ Arabic_alef, Arabic_maddaonalef ] }; + key { [ Arabic_teh, Arabic_tehmarbuta ] }; + key { [ Arabic_noon, guillemotright ] }; + key { [ Arabic_meem, guillemotleft ] }; + key { [ 0x10006a9, colon ] }; + key { [ 0x10006af, Arabic_semicolon ] }; + + key { [ backslash, bar ] }; + key { [ space, 0x100200c ] }; + + key { [ Arabic_zah, Arabic_kaf ] }; + key { [ Arabic_tah ] }; + key { [ Arabic_zain, 0x1000698 ] }; + key { [ Arabic_ra ] }; + key { [ Arabic_thal, 0x100200c ] }; + key { [ Arabic_dal ] }; + key { [ 0x100067e, Arabic_hamza ] }; + key { [ Arabic_waw, greater ] }; + key { [ period, less ] }; + key { [ slash, Arabic_question_mark ] }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/pc/is /opt/SUNWut/lib/xkb/symbols/pc/is --- /opt/SUNWut.orig/lib/xkb/symbols/pc/is 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/pc/is 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,66 @@ +// $XdotOrg$ +// based on +// XKB keyboard by Hrafnkell Eiriksson - hkelle@rhi.hi.is +// fixes by Olafur Osvaldsson - oli@isnic.is +// +// $XFree86: xc/programs/xkbcomp/symbols/pc/is,v 1.3 2002/11/26 01:57:25 dawes Exp $ + +default partial alphanumeric_keys +xkb_symbols "basic" { + + include "pc/latin(type4)" + + name[Group1]="Iceland"; + + key { [ 2, quotedbl, twosuperior, oneeighth ] }; + key { [ 4, dollar, onequarter, currency ] }; + key { [odiaeresis, Odiaeresis, backslash, questiondown ] }; + key { [ minus, underscore, ccedilla, dead_ogonek ] }; + + key { [ eth, ETH, dead_diaeresis, dead_abovering ] }; + key { [apostrophe, question, asciitilde, dead_macron ] }; + + key { [ ae, AE, asciicircum, dead_doubleacute ] }; + key { [dead_acute, Adiaeresis, dead_circumflex, dead_caron] }; + key { [ degree, diaeresis, notsign, notsign ] }; + + key { [ plus, asterisk, grave, dead_breve ] }; + key { [ thorn, THORN, dead_belowdot, dead_abovedot ] }; + + include "level3(ralt_switch)" +}; + +partial alphanumeric_keys +xkb_symbols "Sundeadkeys" { + + // modify the basic Icelandic layout to use Sun dead keys + + include "pc/is(basic)" + name[Group1]="Iceland - Sun dead keys"; + + key { [SunFA_Circum, degree, notsign, notsign ] }; + key { [SunFA_Acute, SunFA_Grave, SunFA_Cedilla, SunFA_Cedilla ] }; + key { [udiaeresis, Udiaeresis, SunFA_Diaeresis, SunFA_Diaeresis ] }; + key { [ plus, asterisk, SunFA_Tilde, dead_macron ] }; + key { [odiaeresis, Odiaeresis, SunFA_Acute, SunFA_Acute ] }; + key { [adiaeresis, Adiaeresis, SunFA_Circum, SunFA_Circum ] }; + key { [numbersign, acute, SunFA_Grave, SunFA_Grave ] }; +}; + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + + // modify the basic Icelandic layout to not have any dead keys + + include "pc/is(basic)" + name[Group1]="Iceland - Eliminate dead keys"; + + key { [asciicircum, degree, notsign, notsign ] }; + key { [apostrophe, grave, cedilla, cedilla ] }; + key { [udiaeresis, Udiaeresis, diaeresis, diaeresis ] }; + key { [ plus, asterisk, asciitilde, macron ] }; + key { [odiaeresis, Odiaeresis, acute, acute ] }; + key { [adiaeresis, Adiaeresis, asciicircum, asciicircum ] }; + key { [numbersign, acute, grave, grave ] }; + key { [ thorn, THORN, dead_belowdot, abovedot ] }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/pc/it /opt/SUNWut/lib/xkb/symbols/pc/it --- /opt/SUNWut.orig/lib/xkb/symbols/pc/it 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/pc/it 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,64 @@ +// $XdotOrg$ +// based on a keyboard map from an 'xkb/symbols/it' file +// 17 May 2003 Modified by Sebastiano Vigna (vigna@dsi.unimi.it) +// +// $XFree86: xc/programs/xkbcomp/symbols/pc/it,v 1.4 2003/04/19 12:22:12 pascal Exp $ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + include "pc/latin(type4)" + + name[Group1]="Italy"; + + key { [ backslash, bar, notsign, brokenbar ] }; + + key { [ 2, quotedbl, twosuperior, dead_doubleacute ] }; + key { [ 3, sterling,threesuperior, dead_tilde ] }; + key { [ 4, dollar, onequarter, oneeighth ] }; + + key { [ 0, equal, braceright, dead_ogonek ] }; + key { [apostrophe, question, grave, questiondown ] }; + key { [ igrave, asciicircum, asciitilde, dead_circumflex ] }; + + key { [ egrave, eacute, bracketleft, braceleft ] }; + key { [ plus, asterisk, bracketright, braceright ] }; + + key { [ ograve, ccedilla, at, dead_cedilla ] }; + key { [ agrave, degree, numbersign, dead_abovering ] }; + + key { [ n, N, ntilde, Ntilde ] }; + key { [ comma, semicolon, dead_acute, multiply ] }; + key { [ period, colon,periodcentered, dead_diaeresis ] }; + key { [ minus, underscore, dead_macron, division ] }; + + key { [ ugrave, section, dead_grave, dead_breve ] }; + + key { [ less, greater,guillemotleft,guillemotright] }; + + include "level3(ralt_switch)" +}; + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + + // Modifies the basic italian layout to eliminate all dead keys + + include "pc/it(basic)" + name[Group1]="Italy - Eliminate dead keys"; + + key { [ 2, quotedbl, twosuperior, doubleacute ] }; + key { [ 3, sterling,threesuperior, asciitilde ] }; + + key { [ 0, equal, braceright, ogonek ] }; + key { [ igrave, asciicircum, asciitilde, asciicircum ] }; + + key { [ ograve, ccedilla, at, cedilla ] }; + key { [ agrave, degree, numbersign, degree ] }; + + key { [ comma, semicolon, acute, multiply ] }; + key { [ period, colon,periodcentered, diaeresis ] }; + key { [ minus, underscore, macron, division ] }; + + key { [ ugrave, section, grave, breve ] }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/pc/jp /opt/SUNWut/lib/xkb/symbols/pc/jp --- /opt/SUNWut.orig/lib/xkb/symbols/pc/jp 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/pc/jp 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,145 @@ +// $XdotOrg$ +// $XKeyboardConfig: xkbdesc/symbols/jp,v 1.4 2005/07/20 22:56:09 svu Exp $ + +// based on: +// symbols for a Japanese 106 keyboard(by tsuka@kawalab.dnj.ynu.ac.jp) + +default xkb_symbols "jp106" { + include "srvr_ctrl(xfree86)" + + name[Group1]= "Japan"; + + // Alphanumeric section + key { + type="PC_SYSRQ", + symbols[Group1]= [ Zenkaku_Hankaku, Kanji ] + }; + key { [ kana_NU ] }; + key { [ kana_FU ] }; + key { [ kana_A, kana_a ] }; + key { [ kana_U, kana_u ] }; + key { [ kana_E, kana_e ] }; + key { [ kana_O, kana_o ] }; + key { [ kana_YA, kana_ya ] }; + key { [ kana_YU, kana_yu ] }; + key { [ kana_YO, kana_yo ] }; + key { [ kana_WA, kana_WO ] }; + key { [ kana_HO ] }; + key { [ kana_HE ] }; + key { [ prolongedsound ] }; + + key { [ kana_TA ] }; + key { [ kana_TE ] }; + key { [ kana_I, kana_i ] }; + key { [ kana_SU ] }; + key { [ kana_KA ] }; + key { [ kana_N ] }; + key { [ kana_NA ] }; + key { [ kana_NI ] }; + key { [ kana_RA ] }; + key { [ kana_SE ] }; + key { [ voicedsound ] }; + key { [ semivoicedsound, kana_openingbracket ] }; + + key { [ Eisu_toggle, Caps_Lock ] }; + key { [ kana_CHI ] }; + key { [ kana_TO ] }; + key { [ kana_SHI ] }; + key { [ kana_HA ] }; + key { [ kana_KI ] }; + key { [ kana_KU ] }; + key { [ kana_MA ] }; + key { [ kana_NO ] }; + key { [ kana_RI ] }; + key { [ kana_RE ] }; + key { [ kana_KE ] }; + key { [ kana_MU, kana_closingbracket ] }; + + key { [ kana_TSU, kana_tsu ] }; + key { [ kana_SA ] }; + key { [ kana_SO ] }; + key { [ kana_HI ] }; + key { [ kana_KO ] }; + key { [ kana_MI ] }; + key { [ kana_MO ] }; + key { [ kana_NE, kana_comma ] }; + key { [ kana_RU, kana_fullstop ] }; + key { [ kana_ME, kana_middledot ] }; + key { [ kana_RO ] }; + + key { [ Muhenkan ] }; + + key { + type="PC_SYSRQ", + symbols[Group1]= [ Henkan, Mode_switch ] + }; + key { + type="PC_SYSRQ", + symbols[Group1]= [ Hiragana_Katakana, Romaji ] + }; + + // End alphanumeric section + + key { + type= "PC_SYSRQ", + symbols[Group1]= [ Print, Execute ] + }; + key { + type= "PC_SYSRQ", + symbols[Group1]= [ Print, Execute ] + }; +}; + +// latin part of jp keyboard map +partial hidden +xkb_symbols "latin" { + + include "pc/us" + // Alphanumeric section + key { + type="PC_SYSRQ", + symbols[Group1]= [ Zenkaku_Hankaku, Kanji ] + }; + + key { [ 2, quotedbl ] }; + + key { [ 6, ampersand ] }; + key { [ 7, apostrophe ] }; + key { [ 8, parenleft ] }; + key { [ 9, parenright ] }; + key { [ 0,asciitilde ] }; + key { [ minus, equal ] }; + key { [ asciicircum, asciitilde] }; + key { [ backslash, bar ] }; + + key { [ at, grave ] }; + key { [ bracketleft, braceleft ] }; + + key { [ Eisu_toggle, Caps_Lock ] }; + + key { [ semicolon, plus ] }; + key { [ colon, asterisk ] }; + key { [ bracketright, braceright ] }; + + key { [ backslash, underscore ] }; + + key { [ Muhenkan ] }; + + key { + type="PC_SYSRQ", + symbols[Group1]= [ Henkan, Mode_switch ] + }; + key { + type="PC_SYSRQ", + symbols[Group1]= [ Hiragana_Katakana, Romaji ] + }; + + key { + type= "PC_SYSRQ", + symbols[Group1]= [ Print, Execute ] + }; + key { + type= "PC_SYSRQ", + symbols[Group1]= [ Print, Execute ] + }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/pc/kg /opt/SUNWut/lib/xkb/symbols/pc/kg --- /opt/SUNWut.orig/lib/xkb/symbols/pc/kg 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/pc/kg 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,29 @@ +// $XdotOrg$ +// $XKeyboardConfig: xkbdesc/symbols/kg,v 1.3 2004/12/22 22:55:55 svu Exp $ + +// based on +// russian standard keyboard +// Yury Fedorov +// Last Changes 2004/10/25 by Yury Fedorov +// +// $XFree86: xc/programs/xkbcomp/symbols/pc/kg,v 0.0 Exp $ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + include "pc/ru(winkeys)" + + name[Group1]= "Kyrgyzstan"; + + key.type[group1]="FOUR_LEVEL_ALPHABETIC"; + + key { [ Cyrillic_o, Cyrillic_O, + Cyrillic_o_bar, Cyrillic_O_bar ] }; + key { [ Cyrillic_u, Cyrillic_U, + Cyrillic_u_straight, Cyrillic_U_straight ] }; + key { [ Cyrillic_en, Cyrillic_EN, + Cyrillic_en_descender, Cyrillic_EN_descender ] }; + + include "level3(ralt_switch)" +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/pc/la /opt/SUNWut/lib/xkb/symbols/pc/la --- /opt/SUNWut.orig/lib/xkb/symbols/pc/la 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/pc/la 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,76 @@ +// $XdotOrg$ +// $XConsortium: lo 2002/11/28 $ +// +// Lao keymap, by Anousak Souphavanh + +partial default alphanumeric_keys +xkb_symbols "basic" { + + // Describes the differences between a very simple US/ASCII + // keyboard and a Lao keyboard + // This keymap uses the Lao keyboard standard [kind of] widely used inLaos + + name[Group1]= "Laos"; + + // Alphanumeric section + key { [ 0x100200D ]}; + key { [ 0x1000ea2, 0x1000ed1 ]}; + key { [ 0x1000ea2, 0x1000ed1 ]}; + key { [ 0x1000e9f, 0x1000ed2 ]}; + key { [ 0x1000ec2, 0x1000ed3 ]}; + key { [ 0x1000e96, 0x1000ed4 ]}; + key { [ 0x1000eb8, 0x1000ecc ]}; + key { [ 0x1000eb9, 0x1000ebc ]}; + key { [ 0x1000e84, 0x1000ed5 ]}; + key { [ 0x1000e95, 0x1000ed6 ]}; + key { [ 0x1000e88, 0x1000ed7 ]}; + key { [ 0x1000e82, 0x1000ed8 ]}; + key { [ 0x1000e8a, 0x1000ed9 ]}; + key { [ 0x1000ecd ]}; + + key { [ 0x1000ebb ]}; + key { [ 0x1000ec4, 0x1000ed0 ]}; + key { [ 0x1000eb3 ]}; + key { [ 0x1000e9e, underscore ]}; + key { [ 0x1000eb0, plus ]}; + key { [ 0x1000eb4 ]}; + key { [ 0x1000eb5 ]}; + key { [ 0x1000ea3, 0x1000eae ]}; + key { [ 0x1000e99 ]}; + key { [ 0x1000e8d, 0x1000ebd ]}; + key { [ 0x1000e9a, minus ]}; + key { [ 0x1000ea5, braceright ]}; + key { [ 0x1000edc, 0x1000edd ]}; + + key { [ 0x1000eb1 ]}; + key { [ 0x1000eab, semicolon ]}; + key { [ 0x1000e81, period ]}; + key { [ 0x1000e94, comma ]}; + key { [ 0x1000ec0, colon ]}; + key { [ 0x1000ec9, 0x1000eca ]}; + key { [ 0x1000ec8, 0x1000ecb ]}; + key { [ 0x1000eb2, exclam ]}; + key { [ 0x1000eaa, question ]}; + key { [ 0x1000ea7, percent ]}; + key { [ 0x1000e87, equal ]}; + + key { [ 0x1000e9c, 0x10020ad ]}; + key { [ 0x1000e9b, parenleft ]}; + key { [ 0x1000ec1, 0x1000eaf ]}; + key { [ 0x1000ead ]}; + key { [ 0x1000eb6 ]}; + key { [ 0x1000eb7 ]}; + key { [ 0x1000e97, 0x1000ec6 ]}; + key { [ 0x1000ea1, quoteleft ]}; + key { [ 0x1000ec3, dollar ]}; + key { [ 0x1000e9d, parenright ]}; + +override key { + type="PC_SYSRQ", + [ Shift_L, ISO_First_Group ] + }; +override key { + type="PC_SYSRQ", + [ Shift_R, ISO_Last_Group ] + }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/pc/latam /opt/SUNWut/lib/xkb/symbols/pc/latam --- /opt/SUNWut.orig/lib/xkb/symbols/pc/latam 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/pc/latam 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,62 @@ +// $XdotOrg$ +// based on a keyboard +// Modified for a real Latin American Keyboard by Fabian Mandelbaum +// +// $XFree86: xc/programs/xkbcomp/symbols/la,v 1.2 2002/11/22 04:03:28 dawes Exp $ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + include "pc/latin(type4)" + + name[Group1]="Latin American"; + + key { [ 1, exclam, bar, exclamdown ] }; + key { [ 3, numbersign, periodcentered, sterling ] }; + key { [ 4, dollar, asciitilde, dollar ] }; + key { [ 6, ampersand, notsign, fiveeighths ] }; + key { [apostrophe, question, backslash, questiondown ] }; + key { [questiondown, exclamdown, dead_cedilla, dead_ogonek] }; + + key { [dead_acute, dead_diaeresis, dead_diaeresis, dead_abovering ] }; + key { [ plus, asterisk, asciitilde, dead_macron ] }; + + key { [ ntilde, Ntilde, asciitilde, dead_doubleacute ] }; + key { [ braceleft, bracketleft, dead_circumflex, braceleft] }; + key { [ bar, degree, notsign, notsign ] }; + + key { [braceright, bracketright, dead_grave, braceright ] }; + + include "level3(ralt_switch)" +}; + +partial alphanumeric_keys +xkb_symbols "Sundeadkeys" { + include "pc/latam(basic)" + + key { [SunFA_Acute, SunFA_Diaeresis, braceleft, braceleft ] }; + key { [SunFA_Grave, SunFA_Circum, bracketleft, dead_abovering ] }; +}; + +partial alphanumeric_keys +xkb_symbols "sundeadkeys" { + include "pc/latam(Sundeadkeys)" + name[Group1]="Latin American - Sun dead keys"; +}; + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + + include "pc/latam(basic)" + + name[Group1]="Latin American - Eliminate dead keys"; + + key { [questiondown, exclamdown, cedilla, ogonek ] }; + key { [ grave, asciicircum, bracketleft, degree ] }; + key { [ plus, asterisk, bracketright, macron ] }; + key { [ ntilde, Ntilde, asciitilde, doubleacute ] }; + key { [ acute, diaeresis, braceleft, braceleft ] }; + key { [ ccedilla, Ccedilla, braceright, breve ] }; + key { [ minus, underscore, dead_belowdot, abovedot ] }; +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/pc/latin /opt/SUNWut/lib/xkb/symbols/pc/latin --- /opt/SUNWut.orig/lib/xkb/symbols/pc/latin 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/pc/latin 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,180 @@ +// $XdotOrg$ +// Common Latin alphabet layout +// +// $XFree86: xc/programs/xkbcomp/symbols/pc/latin,v 1.3 2002/12/20 20:18:34 paulo Exp $ + +default partial +xkb_symbols "basic" { + + key { [ 1, exclam, onesuperior, exclamdown ] }; + key { [ 2, at, twosuperior, oneeighth ] }; + key { [ 3, numbersign, threesuperior, sterling ] }; + key { [ 4, dollar, onequarter, dollar ] }; + key { [ 5, percent, onehalf, threeeighths ] }; + key { [ 6, asciicircum, threequarters, fiveeighths ] }; + key { [ 7, ampersand, braceleft, seveneighths ] }; + key { [ 8, asterisk, bracketleft, trademark ] }; + key { [ 9, parenleft, bracketright, plusminus ] }; + key { [ 0, parenright, braceright, degree ] }; + key { [ minus, underscore, backslash, questiondown ] }; + key { [ equal, plus, dead_cedilla, dead_ogonek ] }; + + key { [ q, Q, at, Greek_OMEGA ] }; + key { [ w, W, lstroke, Lstroke ] }; + key { [ e, E ] }; + key { [ r, R, paragraph, registered ] }; + key { [ t, T, tslash, Tslash ] }; + key { [ y, Y, leftarrow, yen ] }; + key { [ u, U, downarrow, uparrow ] }; + key { [ i, I, rightarrow, idotless ] }; + key { [ o, O, oslash, Ooblique ] }; + key { [ p, P, thorn, THORN ] }; + key { [bracketleft, braceleft, dead_diaeresis, dead_abovering ] }; + key { [bracketright, braceright, dead_tilde, dead_macron ] }; + + key { [ a, A, ae, AE ] }; + key { [ s, S, ssharp, section ] }; + key { [ d, D, eth, ETH ] }; + key { [ f, F, dstroke, ordfeminine ] }; + key { [ g, G, eng, ENG ] }; + key { [ h, H, hstroke, Hstroke ] }; + key { [ j, J ] }; + key { [ k, K, kra, ampersand ] }; + key { [ l, L, lstroke, Lstroke ] }; + key { [ semicolon, colon, dead_acute, dead_doubleacute ] }; + key { [apostrophe, quotedbl, dead_circumflex, dead_caron ] }; + key { [ grave, asciitilde, notsign, notsign ] }; + + key { [ backslash, bar, dead_grave, dead_breve ] }; + key { [ z, Z, guillemotleft, less ] }; + key { [ x, X, guillemotright, greater ] }; + key { [ c, C, cent, copyright ] }; + key { [ v, V, leftdoublequotemark, grave ] }; + key { [ b, B, rightdoublequotemark, apostrophe ] }; + key { [ n, N ] }; + key { [ m, M, mu, masculine ] }; + key { [ comma, less, horizconnector, multiply ] }; + key { [ period, greater, periodcentered, division ] }; + key { [ slash, question, dead_belowdot, dead_abovedot ] }; + +}; + +// Northern Europe ( Danish, Finnish, Norwegian, Swedish) common layout + +partial +xkb_symbols "type2" { + + include "pc/latin" + + key { [ 1, exclam, exclamdown, onesuperior ] }; + key { [ 2, quotedbl, at, twosuperior ] }; + key { [ 3, numbersign, sterling, threesuperior] }; + key { [ 4, currency, dollar, onequarter ] }; + key { [ 5, percent, onehalf, cent ] }; + key { [ 6, ampersand, yen, fiveeighths ] }; + key { [ 7, slash, braceleft, division ] }; + key { [ 8, parenleft, bracketleft, guillemotleft] }; + key { [ 9, parenright, bracketright, guillemotright] }; + key { [ 0, equal, braceright, degree ] }; + + key { [ e, E, EuroSign, cent ] }; + key { [ r, R, registered, registered ] }; + key { [ t, T, thorn, THORN ] }; + key { [ o, O, oe, OE ] }; + key { [ aring, Aring, dead_diaeresis, dead_abovering ] }; + key { [dead_diaeresis, dead_circumflex, dead_tilde, dead_caron ] }; + + key { [ a, A, ordfeminine, masculine ] }; + + key { [ c, C, copyright, copyright ] }; + key { [ comma, semicolon, dead_cedilla, dead_ogonek ] }; + key { [ period, colon, periodcentered, dead_abovedot ] }; + key { [ minus, underscore, dead_belowdot, dead_abovedot ] }; +}; + +// Slavic Latin ( Albanian, Croatian, Polish, Slovene, Yugoslav) +// common layout + +partial +xkb_symbols "type3" { + + include "pc/latin" + + key { [ q, Q, backslash, Greek_OMEGA ] }; + key { [ w, W, bar, Lstroke ] }; + key { [ z, Z, leftarrow, yen ] }; + + key { [ f, F, bracketleft, ordfeminine ] }; + key { [ g, G, bracketright, ENG ] }; + key { [ k, K, lstroke, ampersand ] }; + + key { [ y, Y, guillemotleft, less ] }; + key { [ v, V, at, grave ] }; + key { [ b, B, braceleft, apostrophe ] }; + key { [ n, N, braceright, braceright ] }; + key { [ m, M, section, masculine ] }; + key { [ comma, semicolon, less, multiply ] }; + key { [ period, colon, greater, division ] }; + key { [ minus, underscore, dead_belowdot, dead_abovedot ] }; +}; + +// Another one Latin common layout +// (German, Estonian, Spanish, Icelandic, Italian, Latin American, Portuguese) + +partial +xkb_symbols "type4" { + + include "pc/latin" + + key { [ 2, quotedbl, at, oneeighth ] }; + key { [ 6, ampersand, notsign, fiveeighths ] }; + key { [ 7, slash, braceleft, seveneighths ] }; + key { [ 8, parenleft, bracketleft, trademark ] }; + key { [ 9, parenright, bracketright, plusminus ] }; + key { [ 0, equal, braceright, degree ] }; + + key { [ e, E, EuroSign, cent ] }; + + key { [ comma, semicolon, horizconnector, multiply ] }; + key { [ period, colon, periodcentered, division ] }; + key { [ minus, underscore, dead_belowdot, dead_abovedot ] }; +}; + +partial +xkb_symbols "nodeadkeys" { + + key { [ equal, plus, cedilla, ogonek ] }; + key { [bracketleft, braceleft, diaeresis, degree ] }; + key { [bracketright, braceright, asciitilde, macron ] }; + key { [ semicolon, colon, acute, doubleacute ] }; + key { [apostrophe, quotedbl, asciicircum, caron ] }; + key { [ backslash, bar, grave, breve ] }; + key { [ slash, question, dead_belowdot, abovedot ] }; +}; + +partial +xkb_symbols "type2_nodeadkeys" { + + include "pc/latin(nodeadkeys)" + + key { [ aring, Aring, diaeresis, degree ] }; + key { [ diaeresis, asciicircum, asciitilde, caron ] }; + key { [ comma, semicolon, cedilla, ogonek ] }; + key { [ period, colon, periodcentered, abovedot ] }; + key { [ minus, underscore, dead_belowdot, abovedot ] }; +}; + +partial +xkb_symbols "type3_nodeadkeys" { + + include "pc/latin(nodeadkeys)" +}; + +partial +xkb_symbols "type4_nodeadkeys" { + + include "pc/latin(nodeadkeys)" + + key { [ minus, underscore, dead_belowdot, abovedot ] }; +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/pc/lk /opt/SUNWut/lib/xkb/symbols/pc/lk --- /opt/SUNWut.orig/lib/xkb/symbols/pc/lk 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/pc/lk 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,110 @@ +// $XdotOrg$ +// $XKeyboardConfig: xkbdesc/symbols/lk,v 1.4 2005/08/04 22:15:10 svu Exp $ + +// X Keyboard Extension file for Sinhala (Sri Lanka) (2004-04-22) +// Maintainer : Harshula Jayasuriya +// Last Updated: 2004-11-14 +// This is a static phonetic mapping for a standard US-English keyboard +// (qwerty) +// http://www.nongnu.org/sinhala/doc/keymaps/sinhala-keyboard_3.html + +// Repaya, Rakaransaya and Yansaya aren't inserted with A-r, R and Y, +// respectively. The problem lies with the XKB infrastructure which +// only allows a one-to-one mapping of keycodes to Unicode codepoints. +// Unfortunately, the 3 mentioned glyphs actually consists of 3 +// Unicode codepoints each. The resultant is that the user must +// manually construct the glyph by typing each of the 3 codepoints. +// Alt-backslash represents the 'join' key, this requires +// two codepoints, hence it also has to be manually constructed. + +// Repaya = rayanna,AL,ZWJ +// Rakaransaya = AL,ZWJ,rayanna +// Yansaya = AL,ZWJ,yayanna +// join = AL,ZWJ + +// Where, +// AL = Al Lakuna = Alt-a +// ZWJ = Zero Width Joiner = Alt-Shift-Backslash +// rayanna = r +// yayanna = y + +partial default alphanumeric_keys +xkb_symbols "sin_phonetic" { + + include "pc/us" +// it is default - no details in the name + name[Group1] = "Sri Lanka"; + key.type = "FOUR_LEVEL"; + + // q - p + key { [ 0x01000d8d, 0x01000d8e, 0x01000dd8, 0x01000df2 ] }; + key { [ 0x01000d87, 0x01000d88, 0x01000dd0, 0x01000dd1 ] }; + key { [ 0x01000d91, 0x01000d92, 0x01000dd9, 0x01000dda ] }; + key { [ 0x01000dbb, 0x01000dca, 0x01000dbb, NoSymbol ] }; + key { [ 0x01000da7, 0x01000da8, 0x01000dad, 0x01000dae ] }; + key { [ 0x01000dba, 0x01000dca, NoSymbol, NoSymbol ] }; + key { [ 0x01000d8b, 0x01000d8c, 0x01000dd4, 0x01000dd6 ] }; + key { [ 0x01000d89, 0x01000d8a, 0x01000dd2, 0x01000dd3 ] }; + key { [ 0x01000d94, 0x01000d95, 0x01000ddc, 0x01000ddd ] }; + key { [ 0x01000db4, 0x01000db5, NoSymbol, NoSymbol ] }; + + // a - l + key { [ 0x01000d85, 0x01000d86, 0x01000dca, 0x01000dcf ] }; + key { [ 0x01000dc3, 0x01000dc2, 0x01000dc1, NoSymbol ] }; + key { [ 0x01000da9, 0x01000daa, 0x01000daf, 0x01000db0 ] }; + key { [ 0x01000dc6, 0x01000d93, 0x01000ddb, NoSymbol ] }; + key { [ 0x01000d9c, 0x01000d9d, 0x01000d9f, NoSymbol ] }; + key { [ 0x01000dc4, 0x01000d96, 0x01000dde, NoSymbol ] }; + key { [ 0x01000da2, 0x01000da3, 0x01000da6, NoSymbol ] }; + key { [ 0x01000d9a, 0x01000d9b, 0x01000d8f, 0x01000d90 ] }; + key { [ 0x01000dbd, 0x01000dc5, 0x01000ddf, 0x01000df3 ] }; + + // z - m + key { [ 0x01000da4, 0x01000da5, NoSymbol, NoSymbol ] }; + key { [ 0x01000dac, 0x01000db3, NoSymbol, NoSymbol ] }; + key { [ 0x01000da0, 0x01000da1, NoSymbol, NoSymbol ] }; + key { [ 0x01000dc0, 0x01000d82, 0x01000d83, NoSymbol ] }; + key { [ 0x01000db6, 0x01000db7, NoSymbol, NoSymbol ] }; + key { [ 0x01000db1, 0x01000dab, 0x01000d9e, NoSymbol ] }; + key { [ 0x01000db8, 0x01000db9, NoSymbol, NoSymbol ] }; + + // '.' - Fullstop + key { [ any, any, 0x01000df4, NoSymbol ] }; + + // Backslash + key { [ any, any, 0x01000dca, 0x0100200d ] }; + + // Space + key { [ space, nobreakspace, 0x0100200c, NoSymbol ] }; + + include "level3(ralt_switch)" +}; + +// based on a keyboard map from an 'xkb/symbols/tml' file +// +// $XFree86: xc/programs/xkbcomp/symbols/tml,v 1.2 2002/11/22 04:03:28 dawes Exp $ + +partial alphanumeric_keys +xkb_symbols "tam_unicode" { + include "pc/in(tam_unicode)" + name[Group1]= "Sri Lanka - Tamil Unicode"; +}; + +partial alphanumeric_keys +xkb_symbols "tam_INSCRIPT" { + include "pc/in(tam)" + name[Group1]= "Sri Lanka - Tamil INSCRIPT"; +}; + +partial alphanumeric_keys +xkb_symbols "tam_TSCII" { + include "pc/in(tam_TSCII)" + name[Group1]= "Sri Lanka - Tamil TSCII Typewriter"; +}; + +partial alphanumeric_keys +xkb_symbols "tam_TAB" { + include "pc/in(tam_TAB)" + name[Group1]= "Sri Lanka - Tamil TAB Typewriter"; +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/pc/lt /opt/SUNWut/lib/xkb/symbols/pc/lt --- /opt/SUNWut.orig/lib/xkb/symbols/pc/lt 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/pc/lt 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,111 @@ +// $XdotOrg$ +// based on +// Lithuanian keyboard map by Ričardas Čepas +// merged into one file by Nerijus Baliūnas +// +// $XFree86: xc/programs/xkbcomp/symbols/pc/lt,v 1.3 2002/12/14 22:26:11 dawes Exp $ + +// If you want to have 2 layouts, use +// Option "XkbLayout" "lt,lt(us)" + +// Lithuanian Baltic layout - Lithuanian letters on the numeric row +partial default alphanumeric_keys modifier_keys +xkb_symbols "basic" { + + include "pc/latin" + + name[Group1]="Lithuania"; + + key { [ aogonek, Aogonek, 1, exclam ] }; + key { [ ccaron, Ccaron, 2, at ] }; + key { [ eogonek, Eogonek, 3, numbersign ] }; + key { [ eabovedot, Eabovedot, 4, dollar ] }; + key { [ iogonek, Iogonek, 5, percent ] }; + key { [ scaron, Scaron, 6, asciicircum ] }; + key { [ uogonek, Uogonek, 7, ampersand ] }; + key { [ umacron, Umacron, 8, asterisk ] }; + key { [doublelowquotemark, parenleft, 9, parenleft ] }; + key { [leftdoublequotemark,parenright, 0, parenright ] }; + key { [ zcaron, Zcaron, equal, plus ] }; + + key { [ endash, EuroSign ] }; + + include "level3(ralt_switch)" +}; + +// Similar to the above, but you should use Right Alt + numeric row +// for Lithuanian letters +partial alphanumeric_keys modifier_keys +xkb_symbols "us" { + + include "pc/latin" + + name[Group1]="Lithuania - US keyboard with Lithuanian letters"; + + key { [ 1, exclam, aogonek, Aogonek ] }; + key { [ 2, at, ccaron, Ccaron ] }; + key { [ 3, numbersign, eogonek, Eogonek ] }; + key { [ 4, dollar, eabovedot, Eabovedot ] }; + key { [ 5, percent, iogonek, Iogonek ] }; + key { [ 6, asciicircum, scaron, Scaron ] }; + key { [ 7, ampersand, uogonek, Uogonek ] }; + key { [ 8, asterisk, umacron, Umacron ] }; + key { [ 9, parenleft, doublelowquotemark, parenleft ] }; + key { [ 0, parenright, leftdoublequotemark,parenright ] }; + key { [ equal, plus, zcaron, Zcaron ] }; + + key { [ e, E, endash, EuroSign ] }; + key { [ endash, EuroSign ] }; + + include "level3(ralt_switch)" +}; + +// Lithuanian keyboard map by Gediminas Paulauskas +// Minor modification by Ričardas Čepas according to http://sun3.mif.vu.lt/cs/TK4/lithkeyb.html + +// Describes Lithuanian keymap LST 1582:2000 +// Extensions: B01 L3 is "<" , B02 L3 is ">" and B03 L3 is endash to make this +// layout usable with pc101 and pc104 keyboards. + +partial alphanumeric_keys modifier_keys +xkb_symbols "std" { + + include "pc/latin" + + name[Group1]= "Lithuania - Standard"; + + key {[ grave, asciitilde, acute ]}; + key {[ exclam, 1, at ]}; + key {[ minus, 2, underscore ]}; + key {[ slash, 3, numbersign ]}; + key {[ semicolon, 4, dollar ]}; + key {[ colon, 5, section ]}; + key {[ comma, 6, asciicircum ]}; + key {[ period, 7, ampersand ]}; + key {[ equal, 8, asterisk ]}; + key {[ parenleft, 9, bracketleft ]}; + key {[ parenright, 0, bracketright ]}; + key {[ question, plus, apostrophe ]}; + key {[ x, X, percent ]}; + key {[ aogonek, Aogonek ]}; + key {[ zcaron, Zcaron ]}; + key {[ e, E, EuroSign ]}; + key {[ iogonek, Iogonek, braceleft ]}; + key {[ w, W, braceright ]}; + key {[ scaron, Scaron ]}; + key {[ uogonek, Uogonek ]}; + key {[ eabovedot, Eabovedot, quotedbl ]}; + key {[ z, Z, less ]}; + key {[ umacron, Umacron, greater ]}; + key {[ c, C, endash ]}; + key {[ ccaron, Ccaron, doublelowquotemark ]}; + key {[ f, F, leftdoublequotemark ]}; +// this is actually right quote for Lithuanian + key {[ eogonek, Eogonek, backslash ]}; + key {[ q, Q, bar ]}; + key {[ space, space, nobreakspace, nobreakspace ]}; + + key {[ less, greater, endash ]}; + + include "level3(ralt_switch)" +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/pc/lv /opt/SUNWut/lib/xkb/symbols/pc/lv --- /opt/SUNWut.orig/lib/xkb/symbols/pc/lv 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/pc/lv 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,130 @@ +// $XdotOrg$ + +// Latvian keymap version 1.1 +// Copyright (C) Dmitry Golubev , 2003-2004 +// +// Reworked to get rid of dead_keys (use of which in this case +// is a dirty hack). It is now not dependent on locale settings +// and GTK_IM_MODULES in Gnome. The map is also providing some of +// ISO9995-3 alternate characters. Note that this version works +// correctly under Gnome 2.6. This is to be put into symbols/ +// directory, or somewhere else. +// +// Permission to use, copy, modify, distribute, and sell this software and its +// documentation for any purpose is hereby granted without fee, provided that +// the above copyright notice appear in all copies and that both that +// copyright notice and this permission notice appear in supporting +// documentation, and that the name of the copyright holder(s) not be used in +// advertising or publicity pertaining to distribution of the software without +// specific, written prior permission. The copyright holder(s) makes no +// representations about the suitability of this software for any purpose. It +// is provided "as is" without express or implied warranty. +// +// THE COPYRIGHT HOLDER(S) DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, +// INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, IN NO +// EVENT SHALL THE COPYRIGHT HOLDER(S) BE LIABLE FOR ANY SPECIAL, INDIRECT OR +// CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, +// DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER +// TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR +// PERFORMANCE OF THIS SOFTWARE. + +partial default alphanumeric_keys modifier_keys +xkb_symbols "basic" { + + name[Group1]= "Latvia"; + + key {[grave, asciitilde, acute, asciitilde]}; + key {[1, exclam, onesuperior, exclamdown]}; + key {[2, at, twosuperior, oneeighth]}; + key {[3, numbersign, threesuperior, sterling]}; + key {[4, dollar, EuroSign, cent]}; + key {[5, percent, onehalf, threeeighths]}; + key {[6, asciicircum, threequarters, fiveeighths]}; + key {[7, ampersand, braceleft, seveneighths]}; + key {[8, asterisk, bracketleft, trademark]}; + key {[9, parenleft, bracketright, plusminus]}; + key {[0, parenright, braceright, degree]}; + key {[minus, underscore, backslash, questiondown]}; + key {[equal, plus, endash, emdash]}; + + key {[q, Q, q, Q]}; + key {[w, W, w, W]}; + key {[e, E, emacron, Emacron]}; + key {[r, R, rcedilla, Rcedilla]}; + key {[t, T, t, T]}; + key {[y, Y, y, Y]}; + key {[u, U, umacron, Umacron]}; + key {[i, I, imacron, Imacron]}; + key {[o, O, omacron, Omacron]}; + key {[p, P, p, P]}; + key {[bracketleft, braceleft, guillemotleft, leftdoublequotemark]}; + key {[bracketright, braceright, guillemotright, rightdoublequotemark]}; + + key {[a, A, amacron, Amacron]}; + key {[s, S, scaron, Scaron]}; + key {[d, D, d, D]}; + key {[f, F, f, F]}; + key {[g, G, gcedilla, Gcedilla]}; + key {[h, H, h, H]}; + key {[j, J, j, J]}; + key {[k, K, kcedilla, Kcedilla]}; + key {[l, L, lcedilla, Lcedilla]}; + key {[semicolon, colon, semicolon, colon]}; + key {[apostrophe, quotedbl, leftdoublequotemark, doublelowquotemark]}; + + key {[z, Z, zcaron, Zcaron]}; + key {[x, X, x, X]}; + key {[c, C, ccaron, Ccaron]}; + key {[v, V, v, V]}; + key {[b, B, b, B]}; + key {[n, N, ncedilla, Ncedilla]}; + key {[m, M, m, M]}; + key {[comma, less, horizconnector, multiply]}; + key {[period, greater, periodcentered, division]}; + key {[slash, question, slash, abovedot]}; + key {[backslash, bar, grave, breve]}; + + key {[space, space, space, space]}; + key {type[Group1]="ONE_LEVEL", [ISO_Level3_Shift]}; + modifier_map Mod5 { }; + +}; + +partial alphanumeric_keys modifier_keys +xkb_symbols "apostrophe" { + + include "pc/lv(basic)" + + name[Group1]= "Latvia - Apostrophe (') variant"; + + key {[ISO_Level3_Latch, quotedbl, apostrophe, quotedbl]}; + key {[space, space, apostrophe]}; + modifier_map Mod5 { }; + +}; + +partial alphanumeric_keys modifier_keys +xkb_symbols "tilde" { + + include "pc/lv(basic)" + + name[Group1]= "Latvia - Tilde (~) variant"; + + key {[ISO_Level3_Latch, asciitilde, grave, acute]}; + key {[space, space, asciitilde]}; + modifier_map Mod5 { }; + +}; + +partial alphanumeric_keys modifier_keys +xkb_symbols "fkey" { + + include "pc/lv(basic)" + + name[Group1]= "Latvia - F-letter (F) variant"; + + key {[ISO_Level3_Latch, ISO_Level3_Latch, f, F]}; + key {[space, space, f, F]}; + modifier_map Mod5 { }; + +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/pc/mao /opt/SUNWut/lib/xkb/symbols/pc/mao --- /opt/SUNWut.orig/lib/xkb/symbols/pc/mao 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/pc/mao 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,24 @@ +// $XdotOrg$ +// $XKeyboardConfig: xkbdesc/symbols/mao,v 1.2 2004/10/09 18:34:15 svu Exp $ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + // Adds the macrons needed for the Maori language to + // a simple us keyboard layout. + + include "pc/latin" + + name[Group1]="Maori"; + + key { [ a, A, amacron, Amacron ] }; + key { [ e, E, emacron, Emacron ] }; + key { [ i, I, imacron, Imacron ] }; + + key { [ o, O, omacron, Omacron ] }; + key { [ u, U, umacron, Umacron ] }; + + key { type[Group1]="TWO_LEVEL", + [ ISO_Level3_Shift, Multi_key ] }; + modifier_map Mod5 { }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/pc/mkd /opt/SUNWut/lib/xkb/symbols/pc/mkd --- /opt/SUNWut.orig/lib/xkb/symbols/pc/mkd 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/pc/mkd 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,66 @@ +// $XdotOrg$ +// based on keyboard map: +// Author: Damjan Georgievski +// Revision: 1.5 + +partial default alphanumeric_keys +xkb_symbols "basic" { + name[Group1]= "Macedonian"; + + key { [ Cyrillic_ze, Cyrillic_ZE ] }; + key { [ Cyrillic_es, Cyrillic_ES ] }; + key { [ Cyrillic_a, Cyrillic_A ] }; + key { [ Cyrillic_lje, Cyrillic_LJE ] }; + key { [ Cyrillic_nje, Cyrillic_NJE ] }; + key { [ Cyrillic_tse, Cyrillic_TSE ] }; + key { [ Cyrillic_dzhe, Cyrillic_DZHE ] }; + key { [ Cyrillic_de, Cyrillic_DE ] }; + key { [ Cyrillic_ie, Cyrillic_IE ] }; + key { [ Cyrillic_ve, Cyrillic_VE ] }; + key { [ Cyrillic_ef, Cyrillic_EF ] }; + key { [ Cyrillic_te, Cyrillic_TE ] }; + key { [ Cyrillic_er, Cyrillic_ER ] }; + key { [ Cyrillic_en, Cyrillic_EN ] }; + key { [ Cyrillic_be, Cyrillic_BE ] }; + key { [ Cyrillic_ha, Cyrillic_HA ] }; + key { [ Cyrillic_ghe, Cyrillic_GHE ] }; + key { [ Macedonia_dse, Macedonia_DSE ] }; + key { [ Cyrillic_em, Cyrillic_EM ] }; + key { [ Cyrillic_je, Cyrillic_JE ] }; + key { [ Cyrillic_u, Cyrillic_U ] }; + key { [ Cyrillic_ka, Cyrillic_KA ] }; + key { [ Cyrillic_i, Cyrillic_I ] }; + key { [ Cyrillic_o, Cyrillic_O ] }; + key { [ Cyrillic_el, Cyrillic_EL ] }; + key { [ Cyrillic_che, Cyrillic_CHE ] }; + key { [ Cyrillic_pe, Cyrillic_PE ] }; + key { [ Macedonia_kje, Macedonia_KJE ] }; + key { [ Cyrillic_sha, Cyrillic_SHA ] }; + key { [ Macedonia_gje, Macedonia_GJE ] }; + key { [ Cyrillic_zhe, Cyrillic_ZHE ] }; + key { [ equal, plus ] }; + key { [ minus, underscore ] }; + key { [ dead_grave, asciitilde ] }; + key { [ 1, exclam ] }; + key { [ 2, doublelowquotemark ] }; + key { [ 3, leftdoublequotemark ] }; + key { [ 4, dollar ] }; + key { [ 5, percent ] }; + key { [ 6, asciicircum ] }; + key { [ 7, ampersand ] }; + key { [ 8, asterisk ] }; + key { [ 9, parenleft ] }; + key { [ 0, parenright ] }; + key { [ comma, semicolon ] }; + key { [ period, colon ] }; + key { [ slash, question ] }; + + include "keypad(comma)" +}; + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + include "pc/mkd(basic)" + name[Group1]= "Macedonian - Eliminate dead keys"; + key { [ grave, asciitilde ] }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/pc/mm /opt/SUNWut/lib/xkb/symbols/pc/mm --- /opt/SUNWut.orig/lib/xkb/symbols/pc/mm 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/pc/mm 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,66 @@ +// $XdotOrg$ +// based on a keyboard map from an 'xkb/symbols/mm' file +// +// $XFree86$ + +partial default alphanumeric_keys +xkb_symbols "basic" { + name[Group1]= "Myanmar"; + +// Mainly numbers. + key { [ 0x1001041, exclam ] }; + key { [ 0x1001042 ] }; + key { [ 0x1001043 ] }; + key { [ 0x1001044 ] }; + key { [ 0x1001045 ] }; + key { [ 0x1001046 ] }; + key { [ 0x1001047 ] }; + key { [ 0x1001048 ] }; + key { [ 0x1001049, parenleft ] }; + key { [ 0x1001040, parenright ] }; + key { [ minus, 0x1001038 ] }; + key { [ 0x1001052, 0x1001056 ] }; + +// Mainly long vowels + key { [ 0x100102A, 0x100102A ] }; + key { [ 0x1001032, 0x1001032 ] }; + key { [ 0x100102C, 0x1001021 ] }; + key { [ 0x100102E, 0x1001024 ] }; + key { [ 0x1001030, 0x1001026 ] }; + +// Mainly voiced consonants + key { [ 0x1001017, 0x1001018 ] }; + key { [ 0x100101F, 0x1001004 ] }; + key { [ 0x1001002, 0x1001003 ] }; + key { [ 0x1001012, 0x1001013 ] }; + key { [ 0x1001007, 0x1001008 ] }; + key { [ 0x100100d, 0x100100e ] }; + key { [ 0x100100a, 0x1001009 ] }; + +// Mainly short vowels + key { [ 0x1001029, 0x1001029 ] }; + key { [ 0x1001027, 0x1001027 ] }; + key { [ 0x1001039, 0x1001021 ] }; + key { [ 0x100102D, 0x1001023 ] }; + key { [ 0x100102F, 0x1001025 ] }; + +// Mainly unvoiced consonants + key { [ 0x1001015, 0x1001016 ] }; + key { [ 0x100101B, 0x100101B ] }; + key { [ 0x1001000, 0x1001001 ] }; + key { [ 0x1001010, 0x1001011 ] }; + key { [ 0x1001005, 0x1001006 ] }; + key { [ 0x100100b, 0x100100c ] }; + key { [ 0x100104E, 0x100104F ] }; + + key { [ 0x100104C, 0x100104D ] }; + key { [ 0x1001037, 0x1001036 ] }; + key { [ 0x1001019, 0x100100f ] }; + key { [ 0x1001014, 0x1001014 ] }; + key { [ 0x1001017, 0x1001017 ] }; + key { [ 0x100101C, 0x100101C ] }; + key { [ 0x100101E, 0x1001050 ] }; + key { [ comma, 0x1001051 ] }; + key { [ period, 0x100104A ] }; + key { [ slash, 0x100101A ] }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/pc/mn /opt/SUNWut/lib/xkb/symbols/pc/mn --- /opt/SUNWut.orig/lib/xkb/symbols/pc/mn 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/pc/mn 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,71 @@ +// $XdotOrg$ +// $XKeyboardConfig: xkbdesc/symbols/mn,v 1.4 2004/12/22 21:51:19 svu Exp $ + +// based on: +// Mongolian standard keyboard +// Author Sanlig Badral +// 2002/12/7 Version 1.0 + +partial default alphanumeric_keys +xkb_symbols "basic" { + + name[Group1]= "Mongolia"; + + key { [ equal, plus, degree ] }; + key { [ 1, numerosign, multiply ] }; + key { [ 2, minus, division ] }; + key { [ 3, quotedbl, plusminus ] }; + key { [ 4, U20ae, notsign ] }; + key { [ 5, colon, NoSymbol ] }; + key { [ 6, period, notequal ] }; + key { [ 7, underscore, ampersand ] }; + key { [ 8, comma, asterisk ] }; + key { [ 9, percent, bracketleft ] }; + key { [ 0, question, bracketright ] }; + key { [ Cyrillic_ie, Cyrillic_IE, X ] }; + key { [ Cyrillic_shcha, Cyrillic_SHCHA, L ] }; + + key { [ Cyrillic_ef, Cyrillic_EF, apostrophe ] }; + key { [ Cyrillic_tse, Cyrillic_TSE, grave ] }; + key { [ Cyrillic_u, Cyrillic_U, EuroSign ] }; + key { [ Cyrillic_zhe, Cyrillic_ZHE, registered ] }; + key { [ Cyrillic_e, Cyrillic_E, trademark ] }; + key { [ Cyrillic_en, Cyrillic_EN, yen ] }; + key { [ Cyrillic_ghe, Cyrillic_GHE, doublelowquotemark ] }; + key { [ Cyrillic_sha, Cyrillic_SHA, leftdoublequotemark ] }; + key { [ Cyrillic_u_straight,Cyrillic_U_straight,rightdoublequotemark] }; + key { [ Cyrillic_ze, Cyrillic_ZE, NoSymbol ] }; + key { [ Cyrillic_ka, Cyrillic_KA, braceleft ] }; + key { [ Cyrillic_hardsign, Cyrillic_HARDSIGN, braceright ] }; + + key { [ Cyrillic_shorti, Cyrillic_SHORTI, mu ] }; + key { [ Cyrillic_yeru, Cyrillic_YERU, sterling ] }; + key { [ Cyrillic_be, Cyrillic_BE, dollar ] }; + key { [ Cyrillic_o_bar, Cyrillic_O_bar, rightdoublequotemark ] }; + key { [ Cyrillic_a, Cyrillic_A, Cyrillic_yeru ] }; + key { [ Cyrillic_ha, Cyrillic_HA, Cyrillic_YERU ] }; + key { [ Cyrillic_er, Cyrillic_ER, Cyrillic_e ] }; + key { [ Cyrillic_o, Cyrillic_O, Cyrillic_E ] }; + key { [ Cyrillic_el, Cyrillic_EL, numerosign ] }; + key { [ Cyrillic_de, Cyrillic_DE, section ] }; + key { [ Cyrillic_pe, Cyrillic_PE, ellipsis ] }; + key { [ exclam, bar, bar ] }; + + key { [ parenleft, parenright, NoSymbol ] }; + key { [ Cyrillic_ya, Cyrillic_YA, emdash ] }; + key { [ Cyrillic_che, Cyrillic_CHE, endash ] }; + key { [ Cyrillic_io, Cyrillic_IO, copyright ] }; + key { [ Cyrillic_es, Cyrillic_ES, NoSymbol ] }; + key { [ Cyrillic_em, Cyrillic_EM, NoSymbol ] }; + key { [ Cyrillic_i, Cyrillic_I, less ] }; + key { [ Cyrillic_te, Cyrillic_TE, greater ] }; + key { [ Cyrillic_softsign, Cyrillic_SOFTSIGN, guillemotleft ] }; + key { [ Cyrillic_ve, Cyrillic_VE, guillemotright ] }; + key { [ Cyrillic_yu, Cyrillic_YU, backslash ] }; + + // End alphanumeric section + + key { [ space, space, nobreakspace ] }; + + include "level3(ralt_switch)" +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/pc/mt /opt/SUNWut/lib/xkb/symbols/pc/mt --- /opt/SUNWut.orig/lib/xkb/symbols/pc/mt 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/pc/mt 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,57 @@ +// $XdotOrg$ + +// Maltese keyboard map (based on MSA Standard DMS100) +// by Ramon Casha (ramon.casha@linux.org.mt) +// +// $XFree86: xc/programs/xkbcomp/symbols/mt,v 1.3 2002/12/13 04:18:04 dawes Exp $ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + include "pc/latin" + + name[Group1]="Malta"; + + // The following four sets are the four additional letters, with the UK + // equivalents + key { [ cabovedot, Cabovedot, grave, notsign ] }; + key { [ gabovedot, Gabovedot, bracketleft, braceleft ] }; + key { [ hstroke, Hstroke, bracketright, braceright ] }; + key { [ zabovedot, Zabovedot, backslash, bar ] }; + + // Euro symbol + key { [ 3, EuroSign, sterling ] }; + + // Long accent + key { [ 6, asciicircum, dead_circumflex, dead_circumflex ] }; + + // Normal accented vowels + key { [ e, E, egrave, Egrave ] }; + key { [ u, U, ugrave, Ugrave ] }; + key { [ i, I, igrave, Igrave ] }; + key { [ o, O, ograve, Ograve ] }; + key { [ a, A, agrave, Agrave ] }; + + include "level3(ralt_switch)" +}; + +// Maltese keyboard map (based on MSA Standard DMS100, annex A) +// by Ramon Casha (ramon.casha@linux.org.mt) + +partial alphanumeric_keys +xkb_symbols "us" { + + include "pc/mt(basic)" + + // Describes the differences between the mt + // keyboard and a US-based physical keyboard + + name[Group1]="Malta - US keyboard with Maltian letters"; + + key { [ zabovedot, Zabovedot, backslash, bar ] }; + + key { [ cabovedot, Cabovedot, grave, asciitilde ] }; + + key { [ 3, EuroSign, numbersign ] }; + +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/pc/nl /opt/SUNWut/lib/xkb/symbols/pc/nl --- /opt/SUNWut.orig/lib/xkb/symbols/pc/nl 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/pc/nl 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,54 @@ +// $XdotOrg$ + +// based on +// Converted keytable file to xkb/symbols/ file +// with mk_xkb by root@linux.chanae.stben.be Tue Sep 30 00:53:29 MET DST 1997 + +// converted from the nl-latin.map of the Linux kbd package by +// Pablo Saratxaga +// +// $XFree86: xc/programs/xkbcomp/symbols/nl,v 1.2 2002/11/22 04:03:28 dawes Exp $ + +default partial alphanumeric_keys +xkb_symbols "basic" { + + include "pc/latin" + + name[Group1]="Netherlands"; + + key { [ 2, quotedbl, twosuperior, oneeighth ] }; + key { [ 6, ampersand, threequarters, fiveeighths ] }; + key { [ 7, underscore, sterling, seveneighths ] }; + key { [ 8, parenleft, braceleft, trademark ] }; + key { [ 9, parenright, braceright, plusminus ] }; + key { [ 0, apostrophe, braceright, degree ] }; + key { [ slash, question, backslash, questiondown ] }; + key { [ degree, dead_tilde, dead_cedilla, dead_ogonek ] }; + key { [ e, E, EuroSign, cent ] }; + key { [ t, T, thorn, THORN ] }; + key { [ y, Y, ydiaeresis, yen ] }; + key { [ u, U, udiaeresis, Udiaeresis ] }; + key { [ i, I, idiaeresis, Idiaeresis ] }; + key { [ o, O, ograve, Ograve ] }; + key { [ p, P, paragraph, THORN ] }; + key { [dead_diaeresis, dead_circumflex, asciitilde, asciicircum] }; + key { [ asterisk, bar, dead_tilde, dead_macron ] }; + + key { [ a, A, aacute, Aacute ] }; + key { [ f, F, ordfeminine, ordfeminine ] }; + key { [ plus, plusminus, dead_acute, dead_doubleacute ] }; + key { [apostrophe, grave, dead_acute, dead_grave ] }; + key { [ at, section, notsign, notsign ] }; + + key { [ less, greater, dead_grave, dead_breve ] }; + key { [ n, N, ntilde, Ntilde ] }; + key { [ m, M, Greek_mu, masculine ] }; + key { [ comma, semicolon, cedilla, guillemotleft] }; + key { [ period, colon, periodcentered, guillemotright ] }; + key { [ minus, equal, hyphen, dead_abovedot] }; + + key { [bracketright, bracketleft, bar, brokenbar ] }; + + include "level3(ralt_switch)" +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/pc/no /opt/SUNWut/lib/xkb/symbols/pc/no --- /opt/SUNWut.orig/lib/xkb/symbols/pc/no 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/pc/no 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,181 @@ +// $XdotOrg$ +// based on a keyboard map from an 'xkb/symbols/no' file +// +// $XFree86: xc/programs/xkbcomp/symbols/no,v 1.3 2002/12/19 01:07:56 dawes Exp $ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + // Describes the differences between a very simple en_US + // keyboard and a Norwegian keyboard with dead key support + // and all of ISO-8859-1 characters available. + + include "pc/latin(type2)" + + name[Group1]="Norway"; + + key { [ plus, question, plusminus, questiondown ] }; + key { [ backslash, dead_grave, dead_acute, notsign ] }; + + + key { [ oslash, Ooblique, dead_acute, dead_doubleacute ] }; + key { [ ae, AE, dead_circumflex, dead_caron] }; + key { [ bar, section, brokenbar, paragraph ] }; + + key { [apostrophe, asterisk, dead_doubleacute, multiply ] }; + key { [ less, greater, onehalf, threequarters] }; + + include "keypad(comma)" + + include "level3(ralt_switch)" +}; + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + + // Modifies the basic Norwegian layout to eliminate dead keys + + include "pc/no(basic)" + + name[Group1]="Norway - Eliminate dead keys"; + + key { [ backslash, grave, acute, ogonek ] }; + key { [ diaeresis, asciicircum, asciitilde, macron ] }; + key { [ oslash, Ooblique, acute, doubleacute ] }; + key { [ ae, AE, asciicircum, caron ] }; + key { [ comma, semicolon, cedilla, ogonek ] }; + key { [ period, colon, periodcentered, abovedot ] }; +}; + +// Norwegian Dvorak +partial alphanumeric_keys +xkb_symbols "dvorak" { + include "pc/us(dvorak)" + + name[Group1]="Norway - Dvorak"; + + key { [ bar, section, brokenbar, paragraph ] }; + + key { [ 1, exclam, exclamdown, onesuperior ] }; + key { [ 2, quotedbl, at, twosuperior ] }; + key { [ 3, numbersign, sterling, threesuperior ] }; + key { [ 4, dollar, currency,onequarter ] }; + key { [ 5, percent, onehalf, onehalf ] }; + key { [ 6, ampersand, threequarters, threequarters ] }; + key { [ 7, slash, braceleft, division ] }; + key { [ 8, parenleft, bracketleft ] }; + key { [ 9, parenright, bracketright ] }; + key { [ 0, equal, braceright ] }; + key { [ plus, question, plusminus, questiondown ] }; + key { [ backslash, grave, dead_acute, dead_grave ] }; + + key { [ aring, Aring, braceright, bracketright ] }; + key { [ comma, semicolon, dead_cedilla, cedilla ] }; + key { [ period, colon, periodcentered ] }; + key { [ p, P, thorn, THORN ] }; + key { [ y, Y, yen ] }; + key { [ f, F, ordfeminine ] }; + key { [ c, C, ccedilla, copyright ] }; + key { [ r, R, registered ] }; + key { [ apostrophe, asterisk, dead_circumflex, acute ] }; + key { [ asciitilde, asciicircum, dead_diaeresis, dead_tilde ] }; + + key { [ e, E, EuroSign, cent ] }; + key { [ i, I, idotless, Iabovedot] }; + key { [ d, D, eth, ETH ] }; + key { [ s, S, ssharp ] }; + key { [ minus, underscore, hyphen, diaeresis] }; + + key { [ ae, AE, braceleft, bracketleft] }; + key { [ x, X, multiply ] }; + key { [ m, M, mu ] }; + key { [ less, greater, guillemotleft, guillemotright ] }; + + key { [ space, space, nobreakspace, nobreakspace] }; + + key { [ oslash, Ooblique, bar, backslash ] }; + +}; + +// based on +// Northern Sami keyboards for Finland, Norway and Sweden +// +// Describes the differences between a very simple en_US +// keyboard and a Norwegian Northern Sami keyboard (with +// dead key support) according to the spec on +// http://www.hum.uit.no/a/trond/se-lat9-no-keys.html +// Written by Brre Gaup +// +// $XFree86: xc/programs/xkbcomp/symbols/sapmi,v 1.2 2002/11/22 04:03:28 dawes Exp $ + +partial alphanumeric_keys +xkb_symbols "smi" { + include "pc/latin" + + name[Group1]= "Norway - Northern Saami"; + + key { [ 1, exclam, copyright, exclamdown ] }; + key { [ 2, quotedbl, at, registered ] }; + key { [ 3, numbersign, sterling, less ] }; + key { [ 4, dollar, dollar, greater ] }; + key { [ 5, percent, U2022, U2030 ] }; + key { [ 6, ampersand, section, paragraph ] }; + key { [ 7, slash, braceleft, bar ] }; + key { [ 8, parenleft, bracketleft, braceleft ] }; + key { [ 9, parenright, bracketright, braceright ] }; + key { [ 0, equal, braceright, notequal ] }; + key { [ plus, question, division, questiondown ] }; + key { [ backslash, grave, acute, asciitilde ] }; + + key { [ aacute, Aacute, q, Q ] }; + key { [ scaron, Scaron, w, W ] }; + key { [ e, E, eacute, Eacute ] }; + key { [ r, R, registered, trademark ] }; + key { [ y, Y, yacute, Yacute ] }; + key { [ u, U, udiaeresis, Udiaeresis ] }; + key { [ i, I, idiaeresis, Idiaeresis ] }; + key { [ o, O, oe, OE ] }; + key { [ aring, Aring, acircumflex, Acircumflex ] }; + key { [ eng, ENG, quotedbl, asciicircum ] }; + + key { [ a, A, agrave, Agrave ] }; + key { [ s, S, ssharp, apostrophe ] }; + key { [ f, F, ordfeminine, ordfeminine ] }; + key { [ g, G, gcaron, Gcaron ] }; + key { [ h, H, U01E5, U01E4 ] }; + key { [ j, J, notsign, multiply ] }; + key { [ k, K, U01E9, U01E8 ] }; + key { [ l, L, degree, hyphen ] }; + key { [ oslash, Ooblique, odiaeresis, Odiaeresis ] }; + key { [ ae, AE, adiaeresis, Adiaeresis ] }; + key { [ bar, section, brokenbar, paragraph ] }; + + key { [ dstroke, Dstroke, apostrophe, asterisk ] }; + key { [ z, Z, U0292, U01B7 ] }; + key { [ ccaron, Ccaron, x, X ] }; + key { [ c, C, ccedilla, Ccedilla ] }; + key { [ v, V, lessthanequal, guillemotleft ] }; + key { [ b, B, greaterthanequal, guillemotright ] }; + key { [ n, N, leftsinglequotemark, leftdoublequotemark ] }; + key { [ m, M, rightsinglequotemark, rightdoublequotemark ] }; + key { [ comma, semicolon, singlelowquotemark, doublelowquotemark ] }; + key { [ period, colon, ellipsis, periodcentered ] }; + key { [ minus, underscore, endash, emdash ] }; + + key { type[Group1] = "FOUR_LEVEL", + [ zcaron, Zcaron, U01EF, U01EE ] }; + + include "level3(ralt_switch)" +}; + +partial alphanumeric_keys +xkb_symbols "smi_nodeadkeys" { + + // Modifies the basic Norwegian layout to eliminate dead keys + + include "pc/no(smi)" + + name[Group1]= "Norway - Northern Saami, eliminate dead keys"; + + key { [ backslash, grave, acute, ogonek ] }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/pc/pc /opt/SUNWut/lib/xkb/symbols/pc/pc --- /opt/SUNWut.orig/lib/xkb/symbols/pc/pc 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/pc/pc 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,262 @@ +// $XdotOrg$ +// +// $XFree86: xc/programs/xkbcomp/symbols/pc/pc,v 1.9 2003/06/09 19:59:46 dawes Exp $ + +partial hidden alphanumeric_keys modifier_keys +xkb_symbols "basic" { + + key { [ Escape ] }; + + // Alphanumeric section + key { [ grave, asciitilde ] }; + key { [ 1, exclam ] }; + key { [ 2, at ] }; + key { [ 3, numbersign ] }; + key { [ 4, dollar ] }; + key { [ 5, percent ] }; + key { [ 6, asciicircum ] }; + key { [ 7, ampersand ] }; + key { [ 8, asterisk ] }; + key { [ 9, parenleft ] }; + key { [ 0, parenright ] }; + key { [ minus, underscore ] }; + key { [ equal, plus ] }; + + key { + type="CTRL+ALT", + symbols[Group1]= [ BackSpace, Terminate_Server ] + }; + + key { [ Tab, ISO_Left_Tab ] }; + key { [ Return ] }; + + key { [ Caps_Lock ] }; + + key { [ Shift_L ] }; + key { [ backslash, bar ] }; + + key { [ Control_L ] }; + key { [ space ] }; + + key { [ Shift_R ] }; + key { [ Alt_L ] }; + key { [ Control_R ] }; + key { [ Alt_R ] }; + + // End alphanumeric section + + // Begin "Function" section + key { + type="CTRL+ALT", + symbols[Group1]= [ F1, XF86_Switch_VT_1 ] + }; + key { + type="CTRL+ALT", + symbols[Group1]= [ F2, XF86_Switch_VT_2 ] + }; + key { + type="CTRL+ALT", + symbols[Group1]= [ F3, XF86_Switch_VT_3 ] + }; + key { + type="CTRL+ALT", + symbols[Group1]= [ F4, XF86_Switch_VT_4 ] + }; + key { + type="CTRL+ALT", + symbols[Group1]= [ F5, XF86_Switch_VT_5 ] + }; + key { + type="CTRL+ALT", + symbols[Group1]= [ F6, XF86_Switch_VT_6 ] + }; + key { + type="CTRL+ALT", + symbols[Group1]= [ F7, XF86_Switch_VT_7 ] + }; + key { + type="CTRL+ALT", + symbols[Group1]= [ F8, XF86_Switch_VT_8 ] + }; + key { + type="CTRL+ALT", + symbols[Group1]= [ F9, XF86_Switch_VT_9 ] + }; + key { + type="CTRL+ALT", + symbols[Group1]= [ F10, XF86_Switch_VT_10 ] + }; + key { + type="CTRL+ALT", + symbols[Group1]= [ F11, XF86_Switch_VT_11 ] + }; + key { + type="CTRL+ALT", + symbols[Group1]= [ F12, XF86_Switch_VT_12 ] + }; + // End "Function" section + + // Begin "Editing" section + key { + type= "PC_SYSRQ", + symbols[Group1]= [ Print, Sys_Req ] + }; + key { + type= "PC_SYSRQ", + symbols[Group1]= [ Print, Sys_Req ] + }; + key { [ Scroll_Lock ] }; + key { + type= "PC_BREAK", + symbols[Group1]= [ Pause, Break ] + }; + key { + type= "PC_BREAK", + symbols[Group1]= [ Pause, Break ] + }; + key { [ Insert ] }; + key { [ Home ] }; + key { [ Prior ] }; + key { [ Delete ] }; + key { [ End ] }; + key { [ Next ] }; + + key { [ Up ] }; + key { [ Left ] }; + key { [ Down ] }; + key { [ Right ] }; + + // End "Editing" section, begin "Keypad" + key { [ Num_Lock, Pointer_EnableKeys ] }; + +// Ungrab cancels server/keyboard/pointer grabs + key { + type="CTRL+ALT", + symbols[Group1]= [ KP_Divide, XF86_Ungrab ] + }; + +// ClsGrb kills whichever client has a grab in effect + key { + type="CTRL+ALT", + symbols[Group1]= [ KP_Multiply, XF86_ClearGrab ] + }; + +// -VMode switches to the previous video mode + key { + type="CTRL+ALT", + symbols[Group1]= [ KP_Subtract, XF86_Prev_VMode ] + }; + + key { [ KP_Home, KP_7 ] }; + key { [ KP_Up, KP_8 ] }; + key { [ KP_Prior, KP_9 ] }; + +// +VMode switches to the next video mode + key { + type="CTRL+ALT", + symbols[Group1]= [ KP_Add, XF86_Next_VMode ] + }; + + key { [ KP_Left, KP_4 ] }; + key { [ KP_Begin, KP_5 ] }; + key { [ KP_Right, KP_6 ] }; + + key { [ KP_End, KP_1 ] }; + key { [ KP_Down, KP_2 ] }; + key { [ KP_Next, KP_3 ] }; + key { [ KP_Enter ] }; + key { [ KP_Equal ] }; + + key { [ KP_Insert, KP_0 ] }; + key { [ KP_Delete, KP_Decimal ] }; + // End "Keypad" section + + // begin modifier mappings + modifier_map Shift { Shift_L, Shift_R }; + modifier_map Lock { Caps_Lock, ISO_Lock }; + modifier_map Control{ Control_L, Control_R }; + modifier_map Mod2 { Num_Lock }; + + // Fake keys for virtual<->real modifiers mapping + key { [ ISO_Level3_Shift ] }; + key { [ Mode_switch ] }; + modifier_map Mod5 { , }; + + key { [ NoSymbol, Alt_L ] }; + modifier_map Mod1 { , }; + + key { [ NoSymbol, Meta_L ] }; + modifier_map Mod1 { }; + + key { [ NoSymbol, Super_L ] }; + modifier_map Mod4 { }; + + key { [ NoSymbol, Hyper_L ] }; + modifier_map Mod4 { }; +}; + +// definition for the PC-AT type 101 key keyboard +xkb_symbols "pc101" { + include "pc/pc(basic)" + key { [ Alt_L, Meta_L ] }; + key { [ Alt_R, Meta_R ] }; + +}; + +// definition for the extra key on 102-key keyboards +xkb_symbols "pc102" { + include "pc/pc(pc101)" + key { [ less, greater, bar, brokenbar ] }; +}; + +// definition for the extra keys on 104-key "Windows95" keyboards +default +xkb_symbols "pc104" { + include "pc/pc(basic)" + key { [ Alt_L, Meta_L ] }; + key { [ Alt_R, Meta_R ] }; + key { [ Super_L ] }; + key { [ Super_R ] }; + key { [ Menu ] }; + +}; + +// defintion which includes both the Windows95 keyboards _and_ +// the extra key on most European keyboards. +xkb_symbols "pc105" { + include "pc/pc(pc104)" + key { [ less, greater, bar, brokenbar ] }; +}; + +// common keys which can be overwritten in some layouts +xkb_symbols "common" { + + // Alphanumeric section + key { [ grave, asciitilde ] }; + key { [ 1, exclam ] }; + key { [ 2, at ] }; + key { [ 3, numbersign ] }; + key { [ 4, dollar ] }; + key { [ 5, percent ] }; + key { [ 6, asciicircum ] }; + key { [ 7, ampersand ] }; + key { [ 8, asterisk ] }; + key { [ 9, parenleft ] }; + key { [ 0, parenright ] }; + key { [ minus, underscore ] }; + key { [ equal, plus ] }; + + key { [ backslash, bar ] }; + key { [ space ] }; + + // "Keypad" section + key { [ KP_Delete, KP_Decimal ] }; + + // extra keys on 104-key "Windows95" keyboards + key { [ Super_L ] }; + key { [ Super_R ] }; + key { [ Menu ] }; + + // the extra key on most European keyboards + key { [ less, greater, bar, brokenbar ] }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/pc/pk /opt/SUNWut/lib/xkb/symbols/pc/pk --- /opt/SUNWut.orig/lib/xkb/symbols/pc/pk 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/pc/pk 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,86 @@ +// $XdotOrg$ +// $XKeyboardConfig: xkbdesc/symbols/pk,v 1.1 2005/07/30 02:32:00 svu Exp $ + +// Urdu keymap +// Developed by: +// Zaeem Arshad +// Last update: 2004-03-12 +//Notice: +//Alt key combinations are yet to be put in. The unavailable keys are those which do not have a corresponding //glyph in unicode. + +partial default alphanumeric_keys +xkb_symbols "urd" { + name[Group1]= "Pakistan"; + + // Keys '~' - '=' + // All keys checked and complete + key { [ 0x10006d4 ] }; + key { [ 0x1000661, exclam ] }; + key { [ 0x1000662, 0x1000040 ] }; + key { [ 0x1000663, 0x1000023 ] }; + key { [ 0x10006f4, 0x1000024 ] }; + key { [ 0x10006f5, 0x1000025 ] }; + key { [ 0x1000666, 0x100005e ] }; + key { [ 0x1000667, 0x1000026 ] }; + key { [ 0x1000668, asterisk ] }; + key { [ 0x1000669, parenleft ] }; + key { [ 0x1000660, parenright ] }; + key { [ minus, 0x100005f ] }; + key { [ equal, plus ] }; + + //Keys 'Q' - ']' + //Checked but incomplete with three shift sequences not available + key { [ Arabic_qaf, 0x10006e1 ] }; + key { [ 0x1000648, 0x100fdf9 ] }; //shift key not available + key { [ 0x1000639, 0x100fdf7 ] }; //shift key not available + key { [ 0x1000631, 0x1000691 ] }; + key { [ Arabic_teh, 0x1000679 ] }; + key { [ 0x10006d2, 0x100fe7c ] }; + key { [ 0x1000621, 0x100064c ] }; + key { [ 0x10006cc, 0x1000656 ] }; //shift key not available + key { [ 0x1000647, 0x1000629 ] }; + key { [ 0x100067e, 0x100064f ] }; + key { [ bracketright, braceright ] }; + key { [ bracketleft, braceleft ] }; + + + // Keys 'A' - ''' + // Checked but incomplete with two shift sequences not available + key { [ 0x1000627, 0x1000622 ] }; + key { [ Arabic_seen, 0x1000635 ] }; + key { [ 0x100062f, 0x1000688 ] }; + key { [ 0x1000641, 0x1000670 ] }; + key { [ 0x10006af, 0x100063a ] }; + key { [ 0x10006be, 0x100062d ] }; + key { [ 0x100062c, 0x1000636 ] }; + key { [ 0x10006a9, 0x100062e ] }; + key { [ 0x1000644, 0x1000612 ] };//shift key not available + key { [ 0x100061b, 0x100003a ] }; + key { [ 0x1000027 ] }; // shift key not available + + + // These two are fine + key { [ backslash, bar ] }; + key { [ space ] }; + + + // Keys: 'Z' - '/' + //Keys checked with two shift sequences not available + key { [ Arabic_zain, Arabic_thal ] }; + key { [ 0x1000634, 0x1000698 ] }; + key { [ 0x1000686 , 0x100062b ] }; + key { [ 0x1000637, 0x1000638 ] }; + key { [ 0x1000628, 0x1000628 ] };//shift key unavailable + key { [ 0x1000646, 0x10006ba ] }; + key { [ 0x1000645, 0x1000645 ] };//shift key not available + key { [ 0x100060c, 0x100064e ] }; + key { [ 0x10006d4, 0x1000650 ] }; + key { [ slash, Arabic_question_mark ] }; + + //End alphanumeric key mappings + + //Begin modifier mappings + + modifier_map Shift {Shift_L, Shift_R }; + modifier_map Lock {Caps_Lock }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/pc/pl /opt/SUNWut/lib/xkb/symbols/pc/pl --- /opt/SUNWut.orig/lib/xkb/symbols/pc/pl 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/pc/pl 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,134 @@ +// $XdotOrg$ + +// based on a keyboard map from an 'xkb/symbols/pl' file +// +// $XFree86: xc/programs/xkbcomp/symbols/pl,v 1.3 2003/04/19 12:22:12 pascal Exp $ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + include "pc/latin" + + name[Group1]="Poland"; + + key { [ e, E, eogonek, Eogonek ] }; + key { [ o, O, oacute, Oacute ] }; + + key { [ a, A, aogonek, Aogonek ] }; + key { [ s, S, sacute, Sacute ] }; + + key { [ z, Z, zabovedot, Zabovedot ] }; + key { [ x, X, zacute, Zacute ] }; + key { [ c, C, cacute, Cacute ] }; + key { [ n, N, nacute, Nacute ] }; + + include "keypad(comma)" + + // Begin keypad section + key { [ KP_Delete, KP_Separator ] }; + // End of keypad section + + include "level3(ralt_switch)" +}; + +partial alphanumeric_keys +xkb_symbols "qwertz" { + + // Describes the differences between a very simple en_US + // keyboard and a very simple QWERTZ Polish keybaord + + include "pc/latin(type3)" + + name[Group1]="Poland - qwertz"; + + key { [ 1, exclam, asciitilde, exclamdown ] }; + key { [ 2, quotedbl, dead_caron, oneeighth ] }; + key { [ 3, numbersign, dead_circumflex, sterling ] }; + key { [ 4, dollar, dead_breve, dollar ] }; + key { [ 5, percent, degree, threeeighths ] }; + key { [ 6, ampersand, dead_ogonek, fiveeighths ] }; + key { [ 7, slash, dead_grave, seveneighths ] }; + key { [ 8, parenleft, dead_abovedot, trademark ] }; + key { [ 9, parenright, dead_acute, plusminus ] }; + key { [ 0, equal, dead_doubleacute, degree ] }; + key { [ plus, question, dead_diaeresis, questiondown ] }; + key { [apostrophe, asterisk, dead_cedilla, dead_ogonek ] }; + + key { [ e, E, EuroSign, cent ] }; + key { [ zabovedot, nacute, division, dead_abovering ] }; + key { [ sacute, cacute, multiply, dead_macron ] }; + + key { [ s, S, dstroke, section ] }; + key { [ d, D, Dstroke, ETH ] }; + key { [ k, K, kra, ampersand ] }; + key { [ l, L, lstroke, Lstroke ] }; + key { [ lstroke, Lstroke, dollar, dead_doubleacute ] }; + key { [ aogonek, eogonek, ssharp, dead_caron ] }; + key { [ abovedot, dead_ogonek, notsign, notsign ] }; + + key { [ oacute, zacute, dead_grave, dead_breve ] }; + key { [ c, C, cent, copyright ] }; + key { [ minus, underscore, dead_belowdot, dead_abovedot ] }; + + include "keypad(comma)" + + include "level3(ralt_switch)" +}; + +// Polish Dvorak keymaps +// by Rafal Rzepecki + +// The base keymap "pl" places Polish quotes on quotemark key and +// moves the dead symbols from there to "1/!" key. If you are used to common +// dead keys placement, you could use "pl_altquotes"; in this layout +// dead keys remain in the old place, whereas Polish quotes are placed on the +// "1/!" key. If you do not use Polish quotes at all, you can use "pl_basic" map. + +// Basic Polish keymap (without Polish quotes) +partial alphanumeric_keys +xkb_symbols "dvorak" { + include "pc/us(dvorak)" + + name[Group1] = "Poland - Dvorak"; + + key { [ c, C, cacute, Cacute ] }; + key { [ l, L, lstroke, Lstroke ] }; + key { [ a, A, aogonek, Aogonek ] }; + key { [ o, O, oacute, Oacute ] }; + key { [ e, E, eogonek, Eogonek ] }; + key { [ n, N, nacute, Nacute ] }; + key { [ s, S, sacute, Sacute ] }; + key { [ v, V, zacute, Zacute ] }; + key { [ z, Z, zabovedot, Zabovedot ] }; + + include "keypad(comma)" + + // this to allow writing ALL CAPS with a Shift key + include "level3(ralt_switch)" + + // use one of compose:* options to choose Multi_key, if you will, + // or layout +level3(ralt_switch_multikey) to revert standard behaviour +}; + +// Default Polish keymap with Polish quotes on quotemark key +partial alphanumeric_keys +xkb_symbols "dvorak_quotes" { + include "pc/pl(dvorak)" + + name[Group1] = "Poland - Dvorak, Polish quotes on quotemark key"; + + key { [ apostrophe, quotedbl, doublelowquotemark, rightdoublequotemark ] }; + + // Dead symbols moved to this key + key { [ 1, exclam, dead_acute, dead_diaeresis ] }; +}; + +// Polish keymap with Polish quotes on key "1/!" +partial alphanumeric_keys +xkb_symbols "dvorak_altquotes" { + include "pc/pl(dvorak)" + + name[Group1] = "Poland - Dvorak, Polish quotes on key 1/!"; + + key { [ 1, exclam, doublelowquotemark, rightdoublequotemark ] }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/pc/pt /opt/SUNWut/lib/xkb/symbols/pc/pt --- /opt/SUNWut.orig/lib/xkb/symbols/pc/pt 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/pc/pt 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,62 @@ +// $XdotOrg$ + +// based on a keyboard map from an 'xkb/symbols/pt' file +// +// $XFree86: xc/programs/xkbcomp/symbols/pt,v 1.2 2002/11/22 04:03:28 dawes Exp $ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + include "pc/latin(type4)" + + name[Group1]="Portugal"; + + key { [ 3, numbersign, sterling, sterling ] }; + key { [ 4, dollar, section, dollar ] }; + key { [apostrophe, question, backslash, questiondown ] }; + key { [guillemotleft, guillemotright, dead_cedilla, dead_ogonek ] }; + + key { [ plus, asterisk, dead_diaeresis, dead_abovering ] }; + key { [dead_acute, dead_grave, dead_tilde, dead_macron ] }; + + key { [ ccedilla, Ccedilla, dead_acute, dead_doubleacute ] }; + key { [ masculine, ordfeminine, dead_circumflex, dead_caron ] }; + key { [ backslash, bar, notsign, notsign ] }; + + key { [dead_tilde, dead_circumflex, dead_grave, dead_breve] }; + + include "level3(ralt_switch)" +}; + +partial alphanumeric_keys +xkb_symbols "Sundeadkeys" { + + include "pc/pt(basic)" // for consistent naming + + key { [plus, asterisk, SunFA_Diaeresis, SunFA_Diaeresis ] }; + key { [SunFA_Tilde, SunFA_Circum ] }; + key { [SunFA_Acute, SunFA_Grave ] }; +}; + +partial alphanumeric_keys +xkb_symbols "sundeadkeys" { + include "pc/pt(Sundeadkeys)" // for consistent naming + + name[Group1]="Portugal - Sun dead keys"; +}; + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + + include "pc/pt(basic)" // for consistent naming + + name[Group1]="Portugal - Eliminate dead keys"; + + key { [guillemotleft, guillemotright, cedilla, ogonek ] }; + key { [ plus, asterisk, quotedbl, quotedbl ] }; + key { [ acute, grave ] }; + key { [ ccedilla, Ccedilla, acute, doubleacute ] }; + key { [ masculine, ordfeminine, asciicircum, caron ] }; + key { [asciitilde, asciicircum ] }; + key { [ minus, underscore, dead_belowdot, abovedot ] }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/pc/ro /opt/SUNWut/lib/xkb/symbols/pc/ro --- /opt/SUNWut.orig/lib/xkb/symbols/pc/ro 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/pc/ro 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,100 @@ +// $XdotOrg$ +// $XFree86: xc/programs/xkbcomp/symbols/ro,v 1.6 2003/09/08 13:12:51 pascal Exp $ + +default partial alphanumeric_keys +xkb_symbols "basic" { + + // Describes the differences between a very simple US/ASCII + // keyboard and a very simple Romanian keybaord + // Created by Manfred Pohler, (C) 2003 + + include "pc/latin" + + name[Group1]="Romania"; + + // Alphanumeric section + key { [ bracketright, bracketleft ] }; + + key { [ 1, exclam, asciitilde, asciitilde ] }; + key { [ 2, quotedbl, at, at ] }; + key { [ 3, numbersign, asciicircum,asciicircum ] }; + key { [ 4, currency ] }; + key { [ 5, percent, degree, degree ] }; + key { [ 6, ampersand ] }; + key { [ 7, slash, grave, grave ] }; + key { [ 8, parenleft ] }; + key { [ 9, parenright ] }; + key { [ 0, equal ] }; + key { [ plus, question ] }; + key { [ apostrophe, asterisk ] }; + + key { [ q, Q, backslash, backslash ] }; + key { [ w, W, bar, bar ] }; + key { [ e, E, EuroSign, EuroSign ] }; + key { [ t, T ] }; + key { [ z, Z ] }; + key { [ u, U ] }; + key { [ i, I ] }; + key { [ abreve, Abreve, division, division ] }; + key { [ icircumflex, Icircumflex, multiply, multiply ] }; + + key { [ f, F ] }; + key { [ g, G ] }; + key { [ scedilla, Scedilla, dollar, dollar ] }; + key { [ tcedilla, Tcedilla, ssharp, ssharp ] }; + + key { [ y, Y ] }; + key { [ b, B, braceleft, braceleft ] }; + key { [ n, N, braceright, braceright ] }; + key { [ m, M, section, section ] }; + key { [ comma, semicolon, less, less ] }; + key { [ period, colon, greater, greater ] }; + key { [ minus, underscore ] }; + + key { [ acircumflex, Acircumflex ] }; + + // End alphanumeric section, begin "Keypad" + include "keypad(comma)" + // End "Keypad" section + + include "level3(ralt_switch)" +}; + +// based on a keyboard +// Created by Cristian Gafton, (C) 2000 +// Modified by Miu Moldovan, (C) 2001 +// Modified by Marius Andreiana, (C) 2001 +// +partial alphanumeric_keys +xkb_symbols "us" { + + include "pc/latin" + + name[Group1]="Romania - US keyboard with Romanian letters"; + + key { [ q, Q, acircumflex, Acircumflex ] }; + key { [ t, T, tcedilla, Tcedilla ] }; + key { [ i, I, icircumflex, Icircumflex ] }; + + key { [ a, A, abreve, Abreve ] }; + key { [ s, S, scedilla, Scedilla ] }; + + include "level3(ralt_switch)" +}; + +// Romanian keyboard with access to German umlauts"; +// Created by Manfred Pohler, (C) 2003 +// German umlauts are accessible with and a, o , u, s (+shift for capital letters) +// +partial alphanumeric_keys +xkb_symbols "de" { + + include "pc/ro(basic)" + + name[Group1]="Romania - Romanian keyboard with German letters"; + + key { [ u, U, udiaeresis, Udiaeresis ] }; + key { [ o, O, odiaeresis, Odiaeresis ] }; + key { [ a, A, adiaeresis, Adiaeresis ] }; + key { [ s, S, ssharp , ssharp ] }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/pc/ru /opt/SUNWut/lib/xkb/symbols/pc/ru --- /opt/SUNWut.orig/lib/xkb/symbols/pc/ru 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/pc/ru 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,167 @@ +// $XdotOrg$ + +// based on +// russian standard keyboard +// AEN +// Last Changes 2001/12/23 by Leon Kanter +// +// $XFree86: xc/programs/xkbcomp/symbols/ru,v 1.3 2003/02/15 22:27:05 dawes Exp $ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + name[Group1]= "Russia"; + + key { [ 1, exclam ] }; + key { [ 2, quotedbl ] }; + key { [ 3, numbersign ] }; + key { [ 4, asterisk ] }; + key { [ 5, colon ] }; + key { [ 6, comma ] }; + key { [ 7, period ] }; + key { [ 8, semicolon ] }; + key { [ 9, parenleft ] }; + key { [ 0, parenright ] }; + key { [ minus, underscore ] }; + key { [ equal, plus ] }; + key { [ backslash, bar ] }; + key { [ slash, question ] }; + key { [ slash, bar ] }; + +key.type[group1]="ALPHABETIC"; + + key { [ Cyrillic_io, Cyrillic_IO ] }; + key { [ Cyrillic_shorti, Cyrillic_SHORTI ] }; + key { [ Cyrillic_tse, Cyrillic_TSE ] }; + key { [ Cyrillic_u, Cyrillic_U ] }; + key { [ Cyrillic_ka, Cyrillic_KA ] }; + key { [ Cyrillic_ie, Cyrillic_IE ] }; + key { [ Cyrillic_en, Cyrillic_EN ] }; + key { [ Cyrillic_ghe, Cyrillic_GHE ] }; + key { [ Cyrillic_sha, Cyrillic_SHA ] }; + key { [ Cyrillic_shcha, Cyrillic_SHCHA ] }; + key { [ Cyrillic_ze, Cyrillic_ZE ] }; + key { [ Cyrillic_ha, Cyrillic_HA ] }; + key { [Cyrillic_hardsign,Cyrillic_HARDSIGN ] }; + key { [ Cyrillic_ef, Cyrillic_EF ] }; + key { [ Cyrillic_yeru, Cyrillic_YERU ] }; + key { [ Cyrillic_ve, Cyrillic_VE ] }; + key { [ Cyrillic_a, Cyrillic_A ] }; + key { [ Cyrillic_pe, Cyrillic_PE ] }; + key { [ Cyrillic_er, Cyrillic_ER ] }; + key { [ Cyrillic_o, Cyrillic_O ] }; + key { [ Cyrillic_el, Cyrillic_EL ] }; + key { [ Cyrillic_de, Cyrillic_DE ] }; + key { [ Cyrillic_zhe, Cyrillic_ZHE ] }; + key { [ Cyrillic_e, Cyrillic_E ] }; + key { [ Cyrillic_ya, Cyrillic_YA ] }; + key { [ Cyrillic_che, Cyrillic_CHE ] }; + key { [ Cyrillic_es, Cyrillic_ES ] }; + key { [ Cyrillic_em, Cyrillic_EM ] }; + key { [ Cyrillic_i, Cyrillic_I ] }; + key { [ Cyrillic_te, Cyrillic_TE ] }; + key { [Cyrillic_softsign,Cyrillic_SOFTSIGN ] }; + key { [ Cyrillic_be, Cyrillic_BE ] }; + key { [ Cyrillic_yu, Cyrillic_YU ] }; + +key.type[group1]="TWO_LEVEL"; + + // End alphanumeric section +}; + +partial alphanumeric_keys +xkb_symbols "winkeys" { + include "pc/ru(basic)" + name[Group1]= "Russia - Winkeys"; + key { [ 3, numerosign ] }; + key { [ 4, semicolon ] }; + key { [ 5, percent ] }; + key { [ 6, colon ] }; + key { [ 7, question ] }; + key { [ 8, asterisk ] }; + key { [ period, comma ] }; + key { [ backslash, slash ] }; +}; + +partial alphanumeric_keys +xkb_symbols "typewriter" { + include "pc/ru(basic)" + name[Group1]= "Russia - Typewriter"; + key { [ apostrophe, quotedbl ] }; + key { [ exclam, 1 ] }; + key { [ numerosign, 2 ] }; + key { [ slash, 3 ] }; + key { [ semicolon, 4 ] }; + key { [ colon, 5 ] }; + key { [ comma, 6 ] }; + key { [ period, 7 ] }; + key { [ underscore, 8 ] }; + key { [ question, 9 ] }; + key { [ percent, 0 ] }; + key { [ parenleft, parenright ] }; + +key.type[group1]="ALPHABETIC"; + + key { [Cyrillic_hardsign,Cyrillic_HARDSIGN ] }; + key { [ Cyrillic_io, Cyrillic_IO ] }; +}; + +partial alphanumeric_keys +xkb_symbols "phonetic" { + + name[Group1]= "Russia - Phonetic"; + + key { [ 1, exclam ] }; + key { [ 2, at ] }; + key { [ 3, Cyrillic_io ] }; + key { [ 4, Cyrillic_IO ] }; + key { [ 5, percent ] }; + key { [ 6, asciicircum ] }; + key { [ 7, ampersand ] }; + key { [ 8, asterisk ] }; + key { [ 9, parenleft ] }; + key { [ 0, parenright ] }; + + key { [ period, greater ] }; + key { [ slash, question ] }; + key { [ comma, less ] }; + key { [ semicolon, colon ] }; + key { [ apostrophe, quotedbl ] }; + key { [ bar, brokenbar ] }; + +key.type[group1]="ALPHABETIC"; + + key { [ Cyrillic_yu, Cyrillic_YU ] }; + key { [ Cyrillic_ya, Cyrillic_YA ] }; + key { [ Cyrillic_ze, Cyrillic_ZE ] }; + key { [ Cyrillic_es, Cyrillic_ES ] }; + key { [ Cyrillic_a, Cyrillic_A ] }; + key { [ Cyrillic_ve, Cyrillic_VE ] }; + key { [ Cyrillic_tse, Cyrillic_TSE ] }; + key { [Cyrillic_softsign,Cyrillic_SOFTSIGN ] }; + key { [ Cyrillic_de, Cyrillic_DE ] }; + key { [ Cyrillic_ie, Cyrillic_IE ] }; + key { [ Cyrillic_zhe, Cyrillic_ZHE ] }; + key { [ Cyrillic_ef, Cyrillic_EF ] }; + key { [ Cyrillic_te, Cyrillic_TE ] }; + key { [ Cyrillic_er, Cyrillic_ER ] }; + key { [ Cyrillic_en, Cyrillic_EN ] }; + key { [ Cyrillic_be, Cyrillic_BE ] }; + key { [ Cyrillic_ha, Cyrillic_HA ] }; + key { [ Cyrillic_ghe, Cyrillic_GHE ] }; + key { [ Cyrillic_yeru, Cyrillic_YERU ] }; + key { [ Cyrillic_em, Cyrillic_EM ] }; + key { [ Cyrillic_shorti, Cyrillic_SHORTI ] }; + key { [ Cyrillic_u, Cyrillic_U ] }; + key { [ Cyrillic_ka, Cyrillic_KA ] }; + key { [ Cyrillic_i, Cyrillic_I ] }; + key { [ Cyrillic_o, Cyrillic_O ] }; + key { [ Cyrillic_el, Cyrillic_EL ] }; + key { [ Cyrillic_pe, Cyrillic_PE ] }; + + key { [ minus, Cyrillic_hardsign ] }; + key { [ Cyrillic_sha, Cyrillic_SHA ] }; + key { [ Cyrillic_che, Cyrillic_CHE ] }; + key { [ Cyrillic_shcha, Cyrillic_SHCHA ] }; + key { [ Cyrillic_e, Cyrillic_E ] }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/pc/se /opt/SUNWut/lib/xkb/symbols/pc/se --- /opt/SUNWut.orig/lib/xkb/symbols/pc/se 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/pc/se 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,154 @@ +// $XdotOrg$ +// based on a keyboard map from an 'xkb/symbols/se' file +// +// $XFree86: xc/programs/xkbcomp/symbols/se,v 1.5 2003/01/26 02:01:48 dawes Exp $ + +partial default alphanumeric_keys +xkb_symbols "basic" { + include "pc/latin(type2)" + include "pc/se(se)" +}; + +partial alphanumeric_keys +xkb_symbols "se" { + + name[Group1]="Sweden"; + + key { [ 5, percent, EuroSign, cent ] }; + key { [ plus, question, backslash, questiondown ] }; + key { [dead_acute, dead_grave, plusminus, notsign ] }; + + + key { [odiaeresis, Odiaeresis, oslash, Ooblique ] }; + key { [adiaeresis, Adiaeresis, ae, AE ] }; + key { [ section, onehalf, paragraph, threequarters] }; + + key { [apostrophe, asterisk, acute, multiply ] }; + + key { [ space, space, space, nobreakspace ] }; + + include "keypad(comma)" + + include "level3(ralt_switch)" +}; + +partial alphanumeric_keys +xkb_symbols "nodeadkeys" { + + // Modifies the basic Swedish layout to eliminate all dead keys + + include "pc/latin(type2)" + include "pc/latin(type2_nodeadkeys)" + include "pc/se(se)" + + name[Group1]="Sweden - Eliminate dead keys"; + + key { [ acute, grave, plusminus, notsign ] }; + +}; + +// Swedish Dvorak +partial alphanumeric_keys +xkb_symbols "dvorak" { + include "pc/no(dvorak)" + + name[Group1]="Sweden - Dvorak"; + + key { [ section, onehalf ] }; + + key { [ 4, currency, dollar, onequarter ] }; + key { [ plus, question, backslash, questiondown ] }; + key { [ dead_acute, dead_grave, backslash, grave ] }; + + key { [ odiaeresis, Odiaeresis, braceright, bracketright ] }; + key { [ aring, Aring ] }; + key { [ adiaeresis, Adiaeresis ] }; + key { [ q, Q ] }; + key { [ dead_diaeresis, dead_circumflex, dead_tilde, asciicircum ] }; + + key { [ comma, semicolon, dead_cedilla, cedilla ] }; + key { [ period, colon, periodcentered ] }; + + key { [ less, greater, bar, brokenbar ] }; + + key { [ apostrophe, asterisk, bar, backslash ] }; +}; + +// Ivan Popov, 2005-07-17 +// phonetic layout for Russian cyrillic letters +// on Swedish (latin type2) keyboards + +// level3 modifier is a shortcut to the "se" meaning of the keys where +// we place cyrillic letters, handy for accessing the corresponding +// punctuation marks. +// It is important to have access to punctuation marks, and the rest of +// alphabetical keys are added for being consequent so that the users +// can expect the level3 modifier to give what the key label shows. + +partial alphanumeric_keys +xkb_symbols "rus" { + include "pc/se(basic)" + + name[Group1]="Sweden - Russian phonetic"; + key.type[group1]="ALPHABETIC"; + + key { [ Cyrillic_io, Cyrillic_IO ] }; + key { [ Cyrillic_hardsign, Cyrillic_HARDSIGN ] }; + + key { [ Cyrillic_ya, Cyrillic_YA ] }; + key { [ Cyrillic_ve, Cyrillic_VE ] }; + key { [ Cyrillic_ie, Cyrillic_IE ] }; + key { [ Cyrillic_er, Cyrillic_ER ] }; + key { [ Cyrillic_te, Cyrillic_TE ] }; + key { [ Cyrillic_yeru, Cyrillic_YERU ] }; + key { [ Cyrillic_u, Cyrillic_U ] }; + key { [ Cyrillic_i, Cyrillic_I ] }; + key { [ Cyrillic_o, Cyrillic_O ] }; + key { [ Cyrillic_pe, Cyrillic_PE ] }; + key { [ Cyrillic_e, Cyrillic_E ] }; + + key { [ Cyrillic_a, Cyrillic_A ] }; + key { [ Cyrillic_es, Cyrillic_ES ] }; + key { [ Cyrillic_de, Cyrillic_DE ] }; + key { [ Cyrillic_ef, Cyrillic_EF ] }; + key { [ Cyrillic_ghe, Cyrillic_GHE ] }; + key { [ Cyrillic_ha, Cyrillic_HA ] }; + key { [ Cyrillic_shorti, Cyrillic_SHORTI ] }; + key { [ Cyrillic_ka, Cyrillic_KA ] }; + key { [ Cyrillic_el, Cyrillic_EL ] }; + key { [ Cyrillic_sha, Cyrillic_SHA ] }; + key { [ Cyrillic_shcha, Cyrillic_SHCHA ] }; + key { [ Cyrillic_yu, Cyrillic_YU ] }; + + key { [ Cyrillic_che, Cyrillic_CHE ] }; + key { [ Cyrillic_ze, Cyrillic_ZE ] }; + key { [ Cyrillic_softsign, Cyrillic_SOFTSIGN ] }; + key { [ Cyrillic_tse, Cyrillic_TSE ] }; + key { [ Cyrillic_zhe, Cyrillic_ZHE ] }; + key { [ Cyrillic_be, Cyrillic_BE ] }; + key { [ Cyrillic_en, Cyrillic_EN ] }; + key { [ Cyrillic_em, Cyrillic_EM ] }; +}; + +partial alphanumeric_keys +xkb_symbols "rus_nodeadkeys" { + + include "pc/se(nodeadkeys)" + include "pc/se(rus)" + + name[Group1]="Sweden - Russian phonetic, eliminate dead keys"; + + key { [ Cyrillic_hardsign, Cyrillic_HARDSIGN ] }; +}; + +xkb_symbols "smi" { + + // Describes the differences between a Norwegian Northern Sami + // (keyboard with dead key support) and a Swedish/Finnish Sami + // keyboard according to the specs at: + // http://www.hum.uit.no/a/trond/se-lat9-sefi-keys.html + + include "pc/fi(smi)" + + name[Group1]= "Sweden - Northern Saami"; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/pc/si /opt/SUNWut/lib/xkb/symbols/pc/si --- /opt/SUNWut.orig/lib/xkb/symbols/pc/si 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/pc/si 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,44 @@ +// $XdotOrg$ +// based on +// Slovenian keyboards +// by Marko Samastur (markos@elite.org) and +// Primoz Peterlin (primoz.peterlin@biofiz.mf.uni-lj.si) +// +// $XFree86: xc/programs/xkbcomp/symbols/si,v 1.3 2003/02/05 01:38:36 dawes Exp $ + +default partial alphanumeric_keys +xkb_symbols "basic" { + + include "pc/latin(type3)" + + name[Group1]="Slovenia"; + + key { [ 1, exclam, asciitilde, dead_tilde ] }; + key { [ 2, quotedbl, dead_caron, caron ] }; + key { [ 3, numbersign, asciicircum, dead_circumflex ] }; + key { [ 4, dollar, dead_breve, breve ] }; + key { [ 5, percent, degree, dead_abovering ] }; + key { [ 6, ampersand, dead_ogonek, ogonek ] }; + key { [ 7, slash, grave, dead_grave ] }; + key { [ 8, parenleft, dead_abovedot, abovedot ] }; + key { [ 9, parenright, dead_acute, apostrophe ] }; + key { [ 0, equal, dead_doubleacute, doubleacute ] }; + key { [apostrophe, question, dead_diaeresis, diaeresis ] }; + key { [ plus, asterisk, dead_cedilla, cedilla ] }; + + key { [ e, E, EuroSign, EuroSign ] }; + key { [ scaron, Scaron, division, dead_abovering ] }; + key { [ dstroke, Dstroke, multiply, dead_macron ] }; + + key { [ ccaron, Ccaron, dead_acute, dead_doubleacute ] }; + key { [ cacute, Cacute, ssharp, dead_caron ] }; + + key { [dead_cedilla, dead_diaeresis, notsign, notsign ] }; + + key { [ zcaron, Zcaron, currency, dead_breve ] }; + + include "keypad(comma)" + + include "level3(ralt_switch)" +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/pc/sk /opt/SUNWut/lib/xkb/symbols/pc/sk --- /opt/SUNWut.orig/lib/xkb/symbols/pc/sk 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/pc/sk 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,111 @@ +// $XdotOrg$ + +// $XFree86: xc/programs/xkbcomp/symbols/sk,v 1.2 2002/11/22 04:02:22 dawes +// Exp $ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + // This layout conforms to a new sk compromise standard designed + // to satisfy most unix, windows and mac users. + // 2001 by Kamil Toman + + include "pc/latin" + + name[Group1] = "Slovakia"; + + key { [ semicolon, dead_abovering, grave, asciitilde ] }; + key { [ plus, 1, exclam, dead_tilde ] }; + key { [ lcaron, 2, at, dead_caron ] }; + key { [ scaron, 3, numbersign, dead_circumflex ] }; + key { [ ccaron, 4, dollar, dead_breve ] }; + key { [ tcaron, 5, percent, dead_abovering ] }; + key { [ zcaron, 6, asciicircum, dead_ogonek ] }; + key { [ yacute, 7, ampersand, dead_grave ] }; + key { [ aacute, 8, asterisk, dead_abovedot ] }; + key { [ iacute, 9, braceleft, dead_acute ] }; + key { [ eacute, 0, braceright, dead_doubleacute ] }; + key { [ equal, percent, NoSymbol, dead_diaeresis ] }; + key { [dead_acute, dead_caron, dead_macron, dead_cedilla ] }; + + key { [ q, Q, backslash, NoSymbol ] }; + key { [ w, W, bar, Nosymbol ] }; + key { [ e, E, EuroSign, NoSymbol ] }; + key { [ r, R, NoSymbol, NoSymbol ] }; + key { [ t, T, NoSymbol, NoSymbol ] }; + key { [ z, Z, NoSymbol, NoSymbol ] }; + key { [ u, U, NoSymbol, NoSymbol ] }; + key { [ i, I, NoSymbol, NoSymbol ] }; + key { [ o, O, NoSymbol, NoSymbol ] }; + key { [ p, P, NoSymbol, NoSymbol ] }; + + key { [ uacute, slash, bracketleft, division ] }; + key { [adiaeresis, parenleft, bracketright, multiply ] }; + + key { [ a, A, asciitilde, NoSymbol ] }; + key { [ s, S, dstroke, NoSymbol ] }; + key { [ d, D, Dstroke, NoSymbol ] }; + key { [ f, F, bracketleft, NoSymbol ] }; + key { [ g, G, bracketright, NoSymbol ] }; + key { [ h, H, grave, NoSymbol ] }; + key { [ j, J, apostrophe, NoSymbol ] }; + key { [ k, K, lstroke, NoSymbol ] }; + key { [ l, L, Lstroke, NoSymbol ] }; + + key { [ocircumflex, quotedbl, dollar, NoSymbol ] }; + key { [ section, exclam, apostrophe, ssharp ] }; + key { [ EuroSign, dead_diaeresis, NoSymbol, NoSymbol ] }; + key { [ ncaron, parenright, backslash, bar ] }; + + key { [ backslash, bar, slash, NoSymbol ] }; + key { [ y, Y, degree, NoSymbol ] }; + key { [ x, X, numbersign, Nosymbol ] }; + key { [ c, C, ampersand, NoSymbol ] }; + key { [ v, V, at, NoSymbol ] }; + key { [ b, B, braceleft, NoSymbol ] }; + key { [ n, N, braceright, NoSymbol ] }; + key { [ m, M, asciicircum, NoSymbol ] }; + key { [ comma, question, less, NoSymbol ] }; + key { [ period, colon, greater, NoSymbol ] }; + key { [ minus, underscore, asterisk, NoSymbol ] }; + + key { [ space, space, nobreakspace, nobreakspace ] }; + + key { type[Group1]="FOUR_LEVEL_KEYPAD", + [ KP_Delete, comma, KP_Delete, KP_Decimal ] }; + + include "level3(ralt_switch)" +}; + +// Use instead of (useful for keyboard without key) +xkb_symbols "bksl" { + include "pc/sk(basic)" + + name[Group1] = "Slovakia - Extended Backslash"; + + key { [ backslash, bar, slash, NoSymbol ] }; +}; + +partial alphanumeric_keys +xkb_symbols "qwerty" { + + // This layout should work exactly as a sk with the exception + // of 'Z' and 'Y' keys, which are in the qwerty style (ie. swapped). + // 2001 by Kamil Toman + + include "pc/sk(basic)" + + name[Group1] = "Slovakia - qwerty"; + + key { [ z, Z, degree, NoSymbol ] }; + key { [ y, Y, NoSymbol, NoSymbol ] }; +}; + +// Use instead of (useful for keyboard without key) +xkb_symbols "qwerty_bksl" { + include "pc/sk(qwerty)" + + name[Group1] = "Slovakia - qwerty, extended Backslash"; + + key { [ backslash, bar, slash, NoSymbol ] }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/pc/srp /opt/SUNWut/lib/xkb/symbols/pc/srp --- /opt/SUNWut.orig/lib/xkb/symbols/pc/srp 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/pc/srp 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,280 @@ +// $XdotOrg$ +// Serbian XKB keyboard mapping (derived from "Danube" D.2) +// +// Danube D.2 from 2003-05-12 is available at http://srpski.org/dunav/ +// +// Original authors: +// Danilo Segan (Данило Шеган) +// Chusslove Illich (Часлав Илић) +// +// Modified for inclusion in XFree86 by Danilo Segan +// + +default partial alphanumeric_keys +xkb_symbols "basic" { + + name[Group1]= "Serbian"; + + include "pc/srp(level3)" + include "pc/srp(common)" + include "pc/srp(cyralpha)" + include "level3(ralt_switch)" +}; + +partial alphanumeric_keys +xkb_symbols "yz" { + // Cyrillic_zhe and Cyrillic_ze swapped. + + name[Group1]= "Serbian - Z and ZHE swapped"; + + include "pc/srp(basic)" + + key { [ Cyrillic_zhe, Cyrillic_ZHE, any,any ] }; // y + key { [ Cyrillic_ze, Cyrillic_ZE, any,any ] }; // z +}; + +partial alphanumeric_keys +xkb_symbols "common" { + // "Common" keys: keys which are same for both latin and cyrillic keyboards + + key.type[Group1] = "FOUR_LEVEL"; + + key { [ quoteleft, asciitilde, any,any ] }; // + key { [ 1, exclam, any,any ] }; // + key { [ 2, quotedbl, any,any ] }; // + key { [ 3, numbersign, any,any ] }; // + key { [ 4, dollar, any,any ] }; // + key { [ 5, percent, any,any ] }; // + key { [ 6, ampersand, any,any ] }; // + key { [ 7, slash, any,any ] }; // + key { [ 8, parenleft, any,any ] }; // + key { [ 9, parenright, any,any ] }; // + key { [ 0, equal, any,any ] }; // + key { [ apostrophe, question, any,any ] }; // + key { [ plus, asterisk, any,any ] }; // + + key { [ comma, semicolon, any,any ] }; // + key { [ period, colon, any,any ] }; // + key { [ minus, underscore, any,any ] }; // + + include "keypad(comma)" +}; + +partial alphanumeric_keys +xkb_symbols "cyralpha" { + + key.type[Group1] = "FOUR_LEVEL_ALPHABETIC"; + + key { [ Cyrillic_lje, Cyrillic_LJE, any,any ] }; // q + key { [ Cyrillic_nje, Cyrillic_NJE, any,any ] }; // w + key { [ Cyrillic_ie, Cyrillic_IE, any,any ] }; // e + key { [ Cyrillic_er, Cyrillic_ER, any,any ] }; // r + key { [ Cyrillic_te, Cyrillic_TE, any,any ] }; // t + key { [ Cyrillic_ze, Cyrillic_ZE, any,any ] }; // y + key { [ Cyrillic_u, Cyrillic_U, any,any ] }; // u + key { [ Cyrillic_i, Cyrillic_I, any,any ] }; // i + key { [ Cyrillic_o, Cyrillic_O, any,any ] }; // o + key { [ Cyrillic_pe, Cyrillic_PE, any,any ] }; // p + key { [ Cyrillic_sha, Cyrillic_SHA, any,any ] }; // [ { + key { [ Serbian_dje, Serbian_DJE, any,any ] }; // ] } + + key { [ Cyrillic_a, Cyrillic_A, any,any ] }; // a + key { [ Cyrillic_es, Cyrillic_ES, any,any ] }; // s + key { [ Cyrillic_de, Cyrillic_DE, any,any ] }; // d + key { [ Cyrillic_ef, Cyrillic_EF, any,any ] }; // f + key { [ Cyrillic_ghe, Cyrillic_GHE, any,any ] }; // g + key { [ Cyrillic_ha, Cyrillic_HA, any,any ] }; // h + key { [ Cyrillic_je, Cyrillic_JE, any,any ] }; // j + key { [ Cyrillic_ka, Cyrillic_KA, any,any ] }; // k + key { [ Cyrillic_el, Cyrillic_EL, any,any ] }; // l + key { [ Cyrillic_che, Cyrillic_CHE, any,any ] }; // ; : + key { [ Serbian_tshe, Serbian_TSHE, any,any ] }; // ' " + key { [ Cyrillic_zhe, Cyrillic_ZHE, any,any ] }; // \ | + + key { [ Cyrillic_zhe, Cyrillic_ZHE, any,any ] }; // z + key { [ Cyrillic_dzhe, Cyrillic_DZHE, any,any ] }; // x + key { [ Cyrillic_tse, Cyrillic_TSE, any,any ] }; // c + key { [ Cyrillic_ve, Cyrillic_VE, any,any ] }; // v + key { [ Cyrillic_be, Cyrillic_BE, any,any ] }; // b + key { [ Cyrillic_en, Cyrillic_EN, any,any ] }; // n + key { [ Cyrillic_em, Cyrillic_EM, any,any ] }; // m +}; + + +partial alphanumeric_keys +xkb_symbols "latalpha" { + + key.type[Group1] = "FOUR_LEVEL_ALPHABETIC"; + + key { [ q, Q, any,any ] }; // + key { [ w, W, any,any ] }; // + key { [ e, E, any,any ] }; // + key { [ r, R, any,any ] }; // + key { [ t, T, any,any ] }; // + key { [ z, Z, any,any ] }; // + key { [ u, U, any,any ] }; // + key { [ i, I, any,any ] }; // + key { [ o, O, any,any ] }; // + key { [ p, P, any,any ] }; // + key { [ scaron, Scaron, any,any ] }; // + key { [ dstroke, Dstroke, any,any ] }; // + + key { [ a, A, any,any ] }; // + key { [ s, S, any,any ] }; // + key { [ d, D, any,any ] }; // + key { [ f, F, any,any ] }; // + key { [ g, G, any,any ] }; // + key { [ h, H, any,any ] }; // + key { [ j, J, any,any ] }; // + key { [ k, K, any,any ] }; // + key { [ l, L, any,any ] }; // + key { [ ccaron, Ccaron, any,any ] }; // + key { [ cacute, Cacute, any,any ] }; // + key { [ zcaron, Zcaron, any,any ] }; // + + key { [ y, Y, any,any ] }; // + key { [ x, X, any,any ] }; // + key { [ c, C, any,any ] }; // + key { [ v, V, any,any ] }; // + key { [ b, B, any,any ] }; // + key { [ n, N, any,any ] }; // + key { [ m, M, any,any ] }; // +}; + +partial alphanumeric_keys +xkb_symbols "twoletter" { + // These are letters which are written in latin transcription with two-characters. + + key { type[Group1] = "SEPARATE_CAPS_AND_SHIFT_ALPHABETIC", + [ U1C9, U1C8, any, U1C7 ] }; // q + key { type[Group1] = "SEPARATE_CAPS_AND_SHIFT_ALPHABETIC", + [ U1CC, U1CB, any, U1CA ] }; // w + key { type[Group1] = "SEPARATE_CAPS_AND_SHIFT_ALPHABETIC", + [ U1C6, U1C5, any, U1C4 ] }; // x + + // Also replace letter Y with Zcaron, since Y is of no use any longer + key { [ zcaron, Zcaron, any,any ] }; // +}; + +partial alphanumeric_keys +xkb_symbols "level3" { + key { [ any,any, NoSymbol, NoSymbol ] }; // ` ~ + key { [ any,any, dead_tilde, NoSymbol ] }; // 1 ! + key { [ any,any, dead_caron, NoSymbol ] }; // 2 @ + key { [ any,any, dead_circumflex, NoSymbol ] }; // 3 # + key { [ any,any, dead_breve, NoSymbol ] }; // 4 $ + key { [ any,any, dead_abovering, NoSymbol ] }; // 5 % + key { [ any,any, dead_ogonek, NoSymbol ] }; // 6 ^ + key { [ any,any, dead_grave, NoSymbol ] }; // 7 & + key { [ any,any, dead_abovedot, NoSymbol ] }; // 8 * + key { [ any,any, dead_acute, NoSymbol ] }; // 9 ( + key { [ any,any, dead_doubleacute, NoSymbol ] }; // 0 ) + key { [ any,any, dead_diaeresis, NoSymbol ] }; // - _ + key { [ any,any, dead_cedilla, NoSymbol ] }; // = + + + key { [ any,any, backslash, NoSymbol ] }; // q + key { [ any,any, bar, NoSymbol ] }; // w + key { [ any,any, EuroSign, NoSymbol ] }; // e + key { [ any,any, NoSymbol, NoSymbol ] }; // r + key { [ any,any, NoSymbol, NoSymbol ] }; // t + key { [ any,any, NoSymbol, NoSymbol ] }; // y + key { [ any,any, NoSymbol, NoSymbol ] }; // u + key { [ any,any, NoSymbol, NoSymbol ] }; // i + key { [ any,any, NoSymbol, NoSymbol ] }; // o + key { [ any,any, NoSymbol, NoSymbol ] }; // p + key { [ any,any, NoSymbol, NoSymbol ] }; // [ + key { [ any,any, NoSymbol, NoSymbol ] }; // ] + + key { [ any,any, NoSymbol, NoSymbol ] }; // a + key { [ any,any, doublelowquotemark, NoSymbol ] }; // s + key { [ any,any, leftdoublequotemark, NoSymbol ] }; // d + key { [ any,any, bracketleft, NoSymbol ] }; // f + key { [ any,any, bracketright, NoSymbol ] }; // g + key { [ any,any, NoSymbol, NoSymbol ] }; // h + key { [ any,any, NoSymbol, NoSymbol ] }; // j + key { [ any,any, NoSymbol, NoSymbol ] }; // k + key { [ any,any, NoSymbol, NoSymbol ] }; // l + key { [ any,any, NoSymbol, NoSymbol ] }; // ; + key { [ any,any, NoSymbol, NoSymbol ] }; // ' + key { [ any,any, NoSymbol, NoSymbol ] }; // \ + + key { [ any,any, leftsinglequotemark, NoSymbol ] }; // z + key { [ any,any, rightsinglequotemark,NoSymbol ] }; // x + key { [ any,any, NoSymbol, NoSymbol ] }; // c + key { [ any,any, at, NoSymbol ] }; // v + key { [ any,any, braceleft, NoSymbol ] }; // b + key { [ any,any, braceright, NoSymbol ] }; // n + key { [ any,any, asciicircum, NoSymbol ] }; // m + key { [ any,any, less, NoSymbol ] }; // , < + key { [ any,any, greater, NoSymbol ] }; // . > + key { [ any,any, emdash, endash ] }; // / ? + +}; + +partial alphanumeric_keys +xkb_symbols "latin" { + + name[Group1]= "Serbian - Latin"; + + include "pc/srp(level3)" + include "pc/srp(common)" + include "pc/srp(latalpha)" + include "level3(ralt_switch)" +}; + +partial alphanumeric_keys +xkb_symbols "latinunicode" { + // This mapping supports the Unicode characters 0x1c4-0x1cc (dz, lj, and nj + // as single character). You get the title form with AltGr+Shift. + + name[Group1]= "Serbian - Latin Unicode"; + + include "pc/srp(latin)" + include "pc/srp(twoletter)" +}; + +partial alphanumeric_keys +xkb_symbols "latinyz" { + // For those who insist on using "english-position" Z and Y. + + name[Group1]= "Serbian - Latin qwerty"; + + include "pc/srp(latin)" + + key { [ y, Y, any,any ] }; // y + key { [ z, Z, any,any ] }; // z +}; + +partial alphanumeric_keys +xkb_symbols "latinunicodeyz" { + // Unicode, ZHE and Z swapped. + + name[Group1]= "Serbian - Latin Unicode qwerty"; + + include "pc/srp(latinunicode)" + + key { [ zcaron, Zcaron, any,any ] }; // y + key { [ z, Z, any,any ] }; // z +}; + +xkb_symbols "alternatequotes" { + // Another acceptable »pair of quotes« for Serbian + + name[Group1]= "Serbian - With guillemots"; + + include "pc/srp(basic)" + + key { [ any,any, guillemotright, NoSymbol ] }; // s + key { [ any,any, guillemotleft, NoSymbol ] }; // d +}; + +xkb_symbols "latinalternatequotes" { + // Another acceptable »pair of quotes« for Serbian + + name[Group1]= "Serbian - Latin with guillemots"; + + include "pc/srp(latin)" + + key { [ any,any, guillemotright, NoSymbol ] }; // s + key { [ any,any, guillemotleft, NoSymbol ] }; // d +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/pc/sy /opt/SUNWut/lib/xkb/symbols/pc/sy --- /opt/SUNWut.orig/lib/xkb/symbols/pc/sy 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/pc/sy 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,152 @@ +// $XdotOrg$ + +// +// $XFree86: xc/programs/xkbcomp/symbols/syr,v 1.1 2002/11/22 03:06:50 dawes Exp $ +// + +partial default alphanumeric_keys +xkb_symbols "basic" { + include "pc/ara(basic)" + name[Group1]= "Syria"; +}; + +partial alphanumeric_keys +xkb_symbols "syc" { + name[Group1]= "Syria - Syriac"; + + key { [ 0x100070F, 0x100032E, Arabic_shadda ] }; + key { [ 1, exclam, 0x1000701 ] }; + key { [ 2, 0x100030A, 0x1000702 ] }; + key { [ 3, 0x1000325, 0x1000703 ] }; + key { [ 4, 0x1000749, 0x1000704 ] }; + key { [ 5, 0x1002670, 0x1000705 ] }; + key { [ 6, 0x1002671, 0x1000708 ] }; + key { [ 7, 0x100070A, 0x1000709 ] }; + key { [ 8, 0x10000BB, 0x100070B ] }; + key { [ 9, parenright, 0x100070C ] }; + key { [ 0, parenleft, 0x100070D ] }; + key { [ minus, 0x10000AB, 0x100250C ] }; + key { [ equal, plus, 0x1002510 ] }; + + key { [ 0x1000714, 0x1000730, Arabic_fatha ] }; + key { [ 0x1000728, 0x1000733, Arabic_fathatan ] }; + key { [ 0x1000716, 0x1000736, Arabic_damma ] }; + key { [ 0x1000729, 0x100073A, Arabic_dammatan ] }; + key { [ 0x1000726, 0x100073D, Arabic_madda_above ] }; + key { [ 0x100071C, 0x1000740, Arabic_hamza_above ] }; + key { [ 0x1000725, 0x1000741, 0x1000747 ] }; + key { [ 0x1000717, 0x1000308, 0x1000743 ] }; + key { [ 0x100071E, 0x1000304, 0x1000745 ] }; + key { [ 0x100071A, 0x1000307, 0x100032D ] }; + key { [ 0x1000713, 0x1000303 ] }; + key { [ 0x1000715, 0x100074A ] }; + key { [ 0x1000706, colon ] }; + + key { [ 0x100072B, 0x1000731, Arabic_kasra ] }; + key { [ 0x1000723, 0x1000734, Arabic_kasratan ] }; + key { [ 0x100071D, 0x1000737 ] }; + key { [ 0x1000712, 0x100073B, Arabic_hamza ] }; + key { [ 0x1000720, 0x100073E, Arabic_hamza_below ] }; + key { [ 0x1000710, 0x1000711, Arabic_superscript_alef ] }; + key { [ 0x100072C, Arabic_tatweel, 0x1000748 ] }; + key { [ 0x1000722, 0x1000324, 0x1000744 ] }; + key { [ 0x1000721, 0x1000331, 0x1000746 ] }; + key { [ 0x100071F, 0x1000323 ] }; + key { [ 0x100071B, 0x1000330 ] }; + + key { [ space, 0x100200c ] }; + key { [ bracketright, 0x1000732, Arabic_sukun ] }; + key { [ bracketleft, 0x1000735 ] }; + key { [ 0x1000724, 0x1000738, 0x100200D ] }; + key { [ 0x100072A, 0x100073C, 0x100200C ] }; + key { [ 0x1000727, 0x100073F, 0x100200E ] }; + key { [ 0x1000700, 0x1000739, 0x100200F ] }; + key { [ 0x100002E, 0x1000742 ] }; + key { [ 0x1000718, Arabic_comma ] }; + key { [ 0x1000719, Arabic_semicolon ] }; + key { [ 0x1000707, Arabic_question_mark ] }; + + // End Alphanumeric Section + + + // Begin Modifier Mappings + + modifier_map Shift { Shift_L, Shift_R }; + modifier_map Lock { Caps_Lock, ISO_Lock }; + modifier_map Control{ Control_L, Control_R }; + modifier_map Mod1 { Alt_L, Alt_R }; + modifier_map Mod2 { Mode_switch }; + +}; +// +// $XFree86: xc/programs/xkbcomp/symbols/syr_phonetic,v 1.1 2002/11/22 03:06:50 dawes Exp $ +// + +partial alphanumeric_keys +xkb_symbols "syc_phonetic" { + name[Group1]= "Syria - Syriac phonetic"; + + key { [ 0x100070F, 0x100032E, Arabic_shadda ] }; + key { [ 1, exclam, 0x1000701 ] }; + key { [ 2, 0x100030A, 0x1000702 ] }; + key { [ 3, 0x1000325, 0x1000703 ] }; + key { [ 4, 0x1000749, 0x1000704 ] }; + key { [ 5, 0x1002670, 0x1000705 ] }; + key { [ 6, 0x1002671, 0x1000708 ] }; + key { [ 7, 0x100070A, 0x1000709 ] }; + key { [ 8, 0x10000BB, 0x100070B ] }; + key { [ 9, parenright, 0x100070C ] }; + key { [ 0, parenleft, 0x100070D ] }; + key { [ minus, 0x10000AB, 0x100250C ] }; + key { [ equal, plus, 0x1002510 ] }; + + key { [ 0x1000729, 0x1000730, Arabic_fatha ] }; + key { [ 0x1000718, 0x1000733, Arabic_fathatan ] }; + key { [ 0x1000716, 0x1000736, Arabic_damma ] }; + key { [ 0x100072A, 0x100073A, Arabic_dammatan ] }; + key { [ 0x100072C, 0x100073D, Arabic_madda_above ] }; + key { [ 0x100071D, 0x1000740, Arabic_hamza_above ] }; + key { [ 0x100071C, 0x1000741, 0x1000747 ] }; + key { [ 0x1000725, 0x1000308, 0x1000743 ] }; + key { [ 0x1000727, 0x1000304, 0x1000745 ] }; + key { [ 0x1000726, 0x1000307, 0x100032D ] }; + key { [ bracketright, 0x1000303 ] }; + key { [ bracketleft, 0x100074A ] }; + key { [ 0x1000706, colon ] }; + + key { [ 0x1000710, 0x1000731, Arabic_kasra ] }; + key { [ 0x1000723, 0x1000734, Arabic_kasratan ] }; + key { [ 0x1000715, 0x1000737 ] }; + key { [ 0x1000714, 0x100073B, Arabic_hamza ] }; + key { [ 0x1000713, 0x100073E, Arabic_hamza_below ] }; + key { [ 0x1000717, 0x1000711, Arabic_superscript_alef ] }; + key { [ 0x100071B, Arabic_tatweel, 0x1000748 ] }; + key { [ 0x100071F, 0x1000324, 0x1000744 ] }; + key { [ 0x1000720, 0x1000331, 0x1000746 ] }; + key { [ 0x100071A, 0x1000323 ] }; + key { [ 0x100071E, 0x1000330 ] }; + + key { [ space, 0x100200c ] }; + key { [ 0x1000719, 0x1000732, Arabic_sukun ] }; + key { [ 0x1000728, 0x1000735 ] }; + key { [ 0x1000724, 0x1000738, 0x100200D ] }; + key { [ 0x100072B, 0x100073C, 0x100200C ] }; + key { [ 0x1000712, 0x100073F, 0x100200E ] }; + key { [ 0x1000722, 0x1000739, 0x100200F ] }; + key { [ 0x1000721, 0x1000742 ] }; + key { [ 0x1000700, Arabic_comma ] }; + key { [ 0x100002E, Arabic_semicolon ] }; + key { [ 0x1000707, Arabic_question_mark ] }; + + // End Alphanumeric Section + + + // Begin Modifier Mappings + + modifier_map Shift { Shift_L, Shift_R }; + modifier_map Lock { Caps_Lock, ISO_Lock }; + modifier_map Control{ Control_L, Control_R }; + modifier_map Mod1 { Alt_L, Alt_R }; + modifier_map Mod2 { Mode_switch }; + +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/pc/th /opt/SUNWut/lib/xkb/symbols/pc/th --- /opt/SUNWut.orig/lib/xkb/symbols/pc/th 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/pc/th 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,188 @@ +// $XdotOrg$ + +// based on a keyboard map from an 'xkb/symbols/th' file +// +// $XFree86: xc/programs/xkbcomp/symbols/th,v 1.3 2003/04/03 16:34:51 dawes Exp $ + +partial default alphanumeric_keys +xkb_symbols "basic" { + name[Group1]= "Thailand"; + + // converted to THai keysysms - Pablo Saratxaga + + key { [ underscore, percent ] }; + key { [ Thai_lakkhangyao, plus ] }; + key { [ slash, Thai_leknung ] }; + key { [ minus, Thai_leksong ] }; + key { [ Thai_phosamphao, Thai_leksam ] }; + key { [ Thai_thothung, Thai_leksi ] }; + key { [ Thai_sarau, Thai_sarauu ] }; + key { [ Thai_saraue, Thai_baht ] }; + key { [ Thai_khokhwai, Thai_lekha ] }; + key { [ Thai_totao, Thai_lekhok ] }; + key { [ Thai_chochan, Thai_lekchet ] }; + key { [ Thai_khokhai, Thai_lekpaet ] }; + key { [ Thai_chochang, Thai_lekkao ] }; + + key { [ Thai_maiyamok, Thai_leksun ] }; + key { [ Thai_saraaimaimalai, quotedbl ] }; + key { [ Thai_saraam, Thai_dochada ] }; + key { [ Thai_phophan, Thai_thonangmontho ] }; + key { [ Thai_saraa, Thai_thothong ] }; + key { [ Thai_maihanakat, Thai_nikhahit ] }; + key { [ Thai_saraii, Thai_maitri ] }; + key { [ Thai_rorua, Thai_nonen ] }; + key { [ Thai_nonu, Thai_paiyannoi ] }; + key { [ Thai_yoyak, Thai_yoying ] }; + key { [ Thai_bobaimai, Thai_thothan ] }; + key { [ Thai_loling, comma ] }; + + key { [ Thai_fofan, Thai_ru ] }; + key { [ Thai_hohip, Thai_khorakhang ] }; + key { [ Thai_kokai, Thai_topatak ] }; + key { [ Thai_dodek, Thai_sarao ] }; + key { [ Thai_sarae, Thai_chochoe ] }; + key { [ Thai_maitho, Thai_maitaikhu ] }; + key { [ Thai_maiek, Thai_maichattawa ] }; + key { [ Thai_saraaa, Thai_sorusi ] }; + key { [ Thai_sosua, Thai_sosala ] }; + key { [ Thai_wowaen, Thai_soso ] }; + key { [ Thai_ngongu, period ] }; + + key { [ Thai_phophung, parenleft ] }; + key { [ Thai_popla, parenright ] }; + key { [ Thai_saraae, Thai_choching ] }; + key { [ Thai_oang, Thai_honokhuk ] }; + key { [ Thai_sarai, Thai_phinthu ] }; + key { [ Thai_sarauee, Thai_thanthakhat ] }; + key { [ Thai_thothahan, question ] }; + key { [ Thai_moma, Thai_thophuthao ] }; + key { [ Thai_saraaimaimuan, Thai_lochula ] }; + key { [ Thai_fofa, Thai_lu ] }; + + key { [ Thai_khokhuat, Thai_khokhon ] }; +}; + +partial alphanumeric_keys +xkb_symbols "pat" { + name[Group1]= "Thailand - Pattachote"; + // The thai layout defines a second keyboard group and changes + // the behavior of a few modifier keys. + + // converted to THai keysysms - Pablo Saratxaga pablo@mandrakesoft.com + // Pattachote modification by Visanu Euarchukiati -- visanu@inet.co.th + key { [ underscore, Thai_baht ] }; + key { [ equal, plus ] }; + key { [ Thai_leksong, quotedbl ] }; + key { [ Thai_leksam, slash ] }; + key { [ Thai_leksi, comma ] }; + key { [ Thai_lekha, question ] }; + key { [ Thai_sarauu, Thai_sarau ] }; + key { [ Thai_lekchet, underscore ] }; + key { [ Thai_lekpaet, period ] }; + key { [ Thai_lekkao, parenleft ] }; + key { [ Thai_leksun, parenright ] }; + key { [ Thai_leknung, minus ] }; + key { [ Thai_lekhok, percent ] }; + + key { [ Thai_maitaikhu, Thai_maitri ] }; + key { [ Thai_totao, Thai_ru ] }; + key { [ Thai_yoyak, Thai_maiyamok ] }; + key { [ Thai_oang, Thai_yoying ] }; + key { [ Thai_rorua, Thai_sorusi ] }; + key { [ Thai_maiek, Thai_saraue ] }; + key { [ Thai_dodek, Thai_fofa ] }; + key { [ Thai_moma, Thai_soso ] }; + key { [ Thai_wowaen, Thai_thothung ] }; + key { [ Thai_saraae, Thai_thophuthao ] }; + key { [ Thai_saraaimaimuan, Thai_paiyannoi ] }; + key { [ Thai_chochoe, Thai_lu ] }; + + key { [ Thai_maitho, Thai_maichattawa] }; + key { [ Thai_thothahan, Thai_thothong ] }; + key { [ Thai_ngongu, Thai_saraam ] }; + key { [ Thai_kokai, Thai_nonen ] }; + key { [ Thai_maihanakat, Thai_thanthakhat] }; + key { [ Thai_saraii, Thai_sarauee ] }; + key { [ Thai_saraaa, Thai_phophung ] }; + key { [ Thai_nonu, Thai_chochang ] }; + key { [ Thai_sarae, Thai_sarao ] }; + key { [ Thai_saraaimaimalai, Thai_khorakhang ] }; + key { [ Thai_khokhai, Thai_thonangmontho ] }; + + key { [ Thai_bobaimai, Thai_dochada ] }; + key { [ Thai_popla, Thai_topatak ] }; + key { [ Thai_loling, Thai_thothan ] }; + key { [ Thai_hohip, Thai_phosamphao ] }; + key { [ Thai_sarai, Thai_phinthu ] }; + key { [ Thai_khokhwai, Thai_sosala ] }; + key { [ Thai_sosua, Thai_honokhuk ] }; + key { [ Thai_saraa, Thai_fofan ] }; + key { [ Thai_chochan, Thai_choching ] }; + key { [ Thai_phophan, Thai_lochula ] }; + + key { [ Thai_lakkhangyao, Thai_nikhahit ] }; +}; + + +partial alphanumeric_keys +xkb_symbols "tis" { + name[Group1]= "Thailand - TIS-820.2538"; + // The thai layout defines a second keyboard group and changes + // the behavior of a few modifier keys. + + // converted to THai keysysms - Pablo Saratxaga + // modified to TIS-820.2538 - Theppitak Karoonboonyanan + key { [ 0x1000e4f, 0x1000e5b ] }; + key { [ Thai_baht, Thai_lakkhangyao] }; + key { [ slash, Thai_leknung ] }; + key { [ minus, Thai_leksong ] }; + key { [ Thai_phosamphao, Thai_leksam ] }; + key { [ Thai_thothung, Thai_leksi ] }; + key { [ Thai_sarau, Thai_sarauu ] }; + key { [ Thai_saraue, 0x1000e4e ] }; + key { [ Thai_khokhwai, Thai_lekha ] }; + key { [ Thai_totao, Thai_lekhok ] }; + key { [ Thai_chochan, Thai_lekchet ] }; + key { [ Thai_khokhai, Thai_lekpaet ] }; + key { [ Thai_chochang, Thai_lekkao ] }; + + key { [ Thai_maiyamok, Thai_leksun ] }; + key { [ Thai_saraaimaimalai, quotedbl ] }; + key { [ Thai_saraam, Thai_dochada ] }; + key { [ Thai_phophan, Thai_thonangmontho ] }; + key { [ Thai_saraa, Thai_thothong ] }; + key { [ Thai_maihanakat, Thai_nikhahit ] }; + key { [ Thai_saraii, Thai_maitri ] }; + key { [ Thai_rorua, Thai_nonen ] }; + key {type[Group1]="THREE_LEVEL", + [ Thai_nonu, Thai_paiyannoi, 0x1000e5a] }; + key { [ Thai_yoyak, Thai_yoying ] }; + key { [ Thai_bobaimai, Thai_thothan ] }; + key { [ Thai_loling, comma ] }; + + key { [ Thai_fofan, Thai_ru ] }; + key { [ Thai_hohip, Thai_khorakhang ] }; + key { [ Thai_kokai, Thai_topatak ] }; + key { [ Thai_dodek, Thai_sarao ] }; + key { [ Thai_sarae, Thai_chochoe ] }; + key { [ Thai_maitho, Thai_maitaikhu ] }; + key { [ Thai_maiek, Thai_maichattawa ] }; + key { [ Thai_saraaa, Thai_sorusi ] }; + key { [ Thai_sosua, Thai_sosala ] }; + key { [ Thai_wowaen, Thai_soso ] }; + key { [ Thai_ngongu, period ] }; + + key { [ Thai_phophung, parenleft ] }; + key { [ Thai_popla, parenright ] }; + key { [ Thai_saraae, Thai_choching ] }; + key { [ Thai_oang, Thai_honokhuk ] }; + key { [ Thai_sarai, Thai_phinthu ] }; + key { [ Thai_sarauee, Thai_thanthakhat ] }; + key { [ Thai_thothahan, question ] }; + key { [ Thai_moma, Thai_thophuthao ] }; + key { [ Thai_saraaimaimuan, Thai_lochula ] }; + key { [ Thai_fofa, Thai_lu ] }; + + key { [ Thai_khokhon, Thai_khokhuat ] }; +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/pc/tj /opt/SUNWut/lib/xkb/symbols/pc/tj --- /opt/SUNWut.orig/lib/xkb/symbols/pc/tj 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/pc/tj 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,74 @@ +// $XdotOrg$ + +// based on +// Tajik keyboard +// it is a Russian layout keyboard, with SHCHA replaced with +// dead_cedilla/dead_macron +// that allows to type the SHCHA with dead_cedilla + SHA +// and all the extra Tajik keys: +// dead_cedilla + KA, HA --> KA descender, HA descender +// dead_macron + I, U, GHE --> I macron, U macron, GHE horizontal stroke +// it requires proper dead_cedilla and dead_macron entries in Compose file +// it also allows to use Mode_switch when in cyrillic mode to enter +// special letters by doing Mode_switch + base letter +// +// AEN (for the Russian layout) +// Pablo Saratxaga (for the dead keys changes) +// + +partial default alphanumeric_keys +xkb_symbols "basic" { + + name[Group1]= "Tajikistan"; + + key { [ Cyrillic_io, Cyrillic_IO ] }; + key { [ bar, brokenbar ] }; + key { [ Cyrillic_shorti, Cyrillic_SHORTI ] }; + key { [ 1, exclam ] }; + key { [ Cyrillic_ya, Cyrillic_YA ] }; + key { [ Cyrillic_yeru, Cyrillic_YERU ] }; + key { [ Cyrillic_ef, Cyrillic_EF ] }; + key { [ Cyrillic_tse, Cyrillic_TSE ] }; + key { [ 2, quotedbl ] }; + key { [ Cyrillic_es, Cyrillic_ES ] }; + key { [ Cyrillic_che, Cyrillic_CHE, 0x010004b7, 0x010004b6 ] }; + key { [ Cyrillic_ve, Cyrillic_VE ] }; + key { [ Cyrillic_u, Cyrillic_U, 0x010004ef, 0x010004ee ] }; + key { [ 4, asterisk ] }; + key { [ 3, apostrophe ] }; + key { [ Cyrillic_em, Cyrillic_EM ] }; + key { [ Cyrillic_a, Cyrillic_A ] }; + key { [ Cyrillic_ie, Cyrillic_IE ] }; + key { [ Cyrillic_ka, Cyrillic_KA, 0x0100049b, 0x0100049a ] }; + key { [ 5, colon ] }; + key { [ Cyrillic_te, Cyrillic_TE ] }; + key { [ Cyrillic_i, Cyrillic_I, 0x010004e3, 0x010004e2 ] }; + key { [ Cyrillic_er, Cyrillic_ER ] }; + key { [ Cyrillic_pe, Cyrillic_PE ] }; + key { [ Cyrillic_en, Cyrillic_EN ] }; + key { [ 6, comma ] }; + key { [Cyrillic_softsign,Cyrillic_SOFTSIGN ] }; + key { [ Cyrillic_o, Cyrillic_O ] }; + key { [ Cyrillic_ghe, Cyrillic_GHE, 0x01000493, 0x01000492 ] }; + key { [ 7, period ] }; + key { [ 8, semicolon ] }; + key { [ Cyrillic_be, Cyrillic_BE ] }; + key { [ Cyrillic_el, Cyrillic_EL ] }; + key { [ Cyrillic_sha, Cyrillic_SHA, Cyrillic_shcha, Cyrillic_SHCHA] }; + key { [ dead_cedilla, dead_macron ] }; + key { [ 0, parenright ] }; + key { [ 9, parenleft ] }; + key { [ Cyrillic_yu, Cyrillic_YU ] }; + key { [ slash, question ] }; + key { [ Cyrillic_de, Cyrillic_DE ] }; + key { [ Cyrillic_zhe, Cyrillic_ZHE, 0x01000497, 0x01000496 ] }; + key { [ Cyrillic_ze, Cyrillic_ZE ] }; + key { [ minus, underscore ] }; + key { [ Cyrillic_e, Cyrillic_E ] }; + key { [ Cyrillic_ha, Cyrillic_HA, 0x010004b3, 0x010004b2 ] }; + key { [ equal, plus ] }; + key { [Cyrillic_hardsign,Cyrillic_HARDSIGN ] }; + + // End alphanumeric section + +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/pc/tr /opt/SUNWut/lib/xkb/symbols/pc/tr --- /opt/SUNWut.orig/lib/xkb/symbols/pc/tr 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/pc/tr 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,158 @@ +// $XdotOrg$ + +// based on +// Turkish keyboard symbols for PC and xkb +// This file distributed without any expressed or implied warranty +// Nilgün Belma Bugüner , 2005 +// +// $XFree86: xc/programs/xkbcomp/symbols/tr,v 1.5 2003/04/19 12:22:12 pascal Exp $ + +//Default Layout (Turkish Q) +default partial +xkb_symbols "basic" { + + include "pc/latin" + + name[Group1]="Turkish"; + + key { [ 1, exclam, onesuperior, exclamdown ] }; + key { [ 2, apostrophe, sterling, twosuperior ] }; + key { [ 3, asciicircum, numbersign, threesuperior ] }; + key { [ 4, plus, dollar, onequarter ] }; + key { [ 6, ampersand, threequarters, VoidSymbol ] }; + key { [ 7, slash, braceleft, VoidSymbol ] }; + key { [ 8, parenleft, bracketleft, VoidSymbol ] }; + key { [ 9, parenright, bracketright, plusminus ] }; + key { [ 0, equal, braceright, degree ] }; + key { [ asterisk, question, backslash, questiondown ] }; + key { [ minus, underscore, division, VoidSymbol ] }; + + key { [ w, W, VoidSymbol, VoidSymbol ] }; + key { [ e, E, EuroSign, VoidSymbol ] }; + key { [ t, T, trademark, VoidSymbol ] }; + key { [ u, U, ucircumflex, Ucircumflex ] }; + key { type[group1] = "FOUR_LEVEL_ALPHABETIC", + [ idotless, I, icircumflex, Icircumflex ] }; + key { [ o, O, ocircumflex, Ocircumflex ] }; + key { [ p, P, VoidSymbol, VoidSymbol ] }; + key { [ gbreve, Gbreve ] }; + key { [udiaeresis, Udiaeresis, asciitilde, dead_macron ] }; + + key { [ a, A, acircumflex, Acircumflex ] }; + key { [ s, S, section, VoidSymbol ] }; + key { [ d, D, VoidSymbol, VoidSymbol ] }; + key { [ f, F, ordfeminine, VoidSymbol ] }; + key { [ g, G, VoidSymbol, VoidSymbol ] }; + key { [ h, H, VoidSymbol, VoidSymbol ] }; + key { [ k, K, VoidSymbol, VoidSymbol ] }; + key { [ l, L, VoidSymbol, VoidSymbol ] }; + key { [ scedilla, Scedilla, acute, dead_acute ] }; + key { type[group1] = "FOUR_LEVEL_SEMIALPHABETIC", + [ i, Iabovedot, apostrophe, dead_caron ] }; + key { [ quotedbl, eacute, plusminus, degree ] }; + + key { [ comma, semicolon, grave, dead_grave ] }; + key { [ less, greater, bar, brokenbar ] }; + key { [odiaeresis, Odiaeresis, multiply, VoidSymbol ] }; + key { [ ccedilla, Ccedilla, periodcentered, division ] }; + key { [ period, colon, dead_abovedot, dead_abovedot ] }; + key { [ space, space, nobreakspace, nobreakspace ] }; + + include "level3(ralt_switch)" +}; + + +// Turkish F Layout +partial +xkb_symbols "f" { + + include "pc/latin" + + name[Group1]="Turkish - (F)"; + + key { [ 1, exclam, onesuperior, exclamdown ] }; + key { [ 2, quotedbl, twosuperior, VoidSymbol ] }; + key { [ 3, asciicircum, numbersign, threesuperior ] }; + key { [ 4, dollar, onequarter, VoidSymbol ] }; + key { [ 6, ampersand, threequarters, VoidSymbol ] }; + key { [ 7, apostrophe, braceleft, VoidSymbol ] }; + key { [ 8, parenleft, bracketleft, VoidSymbol ] }; + key { [ 9, parenright, bracketright, plusminus ] }; + key { [ 0, equal, braceright, degree ] }; + key { [ slash, question, backslash, questiondown ] }; + key { [ minus, underscore, division, VoidSymbol ] }; + + key { [ f, F, at, VoidSymbol ] }; + key { [ g, G, VoidSymbol, VoidSymbol ] }; + key { [ gbreve, Gbreve, VoidSymbol, VoidSymbol ] }; + key { type[group1] = "FOUR_LEVEL_SEMIALPHABETIC", + [ idotless, I, paragraph, VoidSymbol ] }; + key { [ o, O, ocircumflex, Ocircumflex ] }; + key { [ d, D, yen, VoidSymbol ] }; + key { [ r, R, registered, VoidSymbol ] }; + key { [ n, N, VoidSymbol, VoidSymbol ] }; + key { [ h, H, degree, VoidSymbol ] }; + key { [ p, P, sterling, VoidSymbol ] }; + key { [ q, Q, dead_diaeresis, dead_abovering ] }; + key { [ w, W, asciitilde, dead_breve ] }; + + key { [ u, U, ucircumflex, Ucircumflex ] }; + key { type[group1] = "FOUR_LEVEL_ALPHABETIC", + [ i, Iabovedot, icircumflex, Icircumflex ] }; + key { [ e, E, EuroSign, VoidSymbol ] }; + key { [ a, A, acircumflex, Acircumflex ] }; + key { [udiaeresis, Udiaeresis, ucircumflex, Ucircumflex ] }; + key { [ t, T, trademark, VoidSymbol ] }; + key { [ k, K, VoidSymbol, VoidSymbol ] }; + key { [ m, M, mu, VoidSymbol ] }; + key { [ l, L, VoidSymbol, VoidSymbol ] }; + key { [ y, Y, acute, dead_acute ] }; + key { [ scedilla, Scedilla, numbersign, dead_caron ] }; + key { [ plus, asterisk, notsign, plusminus ] }; + + key { [ x, X, grave, dead_grave ] }; + key { [ j, J, guillemotleft, VoidSymbol ] }; + key { [odiaeresis, Odiaeresis, guillemotright, VoidSymbol ] }; + key { [ v, V, leftdoublequotemark, VoidSymbol ] }; + key { [ c, C, cent, copyright ] }; + key { [ ccedilla, Ccedilla, rightdoublequotemark, VoidSymbol] }; + key { [ z, Z, VoidSymbol, VoidSymbol ] }; + key { [ s, S, section, VoidSymbol ] }; + key { [ b, B, multiply, nobreakspace ] }; + key { [ period, colon, division, dead_abovedot] }; + key { [ comma, semicolon, periodcentered, VoidSymbol ] }; + key { [ space, space, nobreakspace, nobreakspace ] }; + key { [ less, greater, bar, brokenbar ] }; + + include "level3(ralt_switch)" +}; + +// Turkish Alt-Q Layout +partial +xkb_symbols "alt" { + + include "pc/latin" + + name[Group1]="Turkish - Alt-Q"; + + key { [ 7, ampersand, lowleftcorner, upleftcorner ] }; + key { [ 8, asterisk, leftt, topt ] }; + key { [ 9, parenleft, rightt, bott ] }; + key { [ 0, parenright, lowrightcorner, uprightcorner ] }; + key { [ minus, underscore, horizlinescan5, vertbar ] }; + key { [ equal, plus, crossinglines ] }; + + key { [ e, E, EuroSign, VoidSymbol ] }; +// key { [ t, T, trademark, VoidSymbol > + key { [ u, U, udiaeresis, Udiaeresis ] }; + key { [ i, I, idotless, Iabovedot ] }; + key { [ o, O, odiaeresis, Odiaeresis ] }; + key { [ a, A, acircumflex, Acircumflex ] }; + key { [ s, S, scedilla, Scedilla ] }; + key { [ g, G, gbreve, Gbreve ] }; + + key { [ c, C, ccedilla, Ccedilla ] }; + key { [ space, space, nobreakspace, nobreakspace ] }; + + include "level3(ralt_switch)" +}; diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/pc/ua /opt/SUNWut/lib/xkb/symbols/pc/ua --- /opt/SUNWut.orig/lib/xkb/symbols/pc/ua 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/pc/ua 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,213 @@ +// $XdotOrg$ + +// based on +// ukrainian standard keyboard +// AEN & Leon Kanter +// Last Changes 2003/09/03 by Andriy Rysin +// +// $XFree86: xc/programs/xkbcomp/symbols/ua,v 1.4 2003/05/15 11:29:47 pascal Exp $ + +partial default alphanumeric_keys +xkb_symbols "basic" { + + name[Group1]= "Ukraine"; + + key { [ apostrophe, asciitilde ] }; + key { [ 1, exclam ] }; + key { [ 2, quotedbl ] }; + key { [ 3, numbersign ] }; + key { [ 4, asterisk ] }; + key { [ 5, colon ] }; + key { [ 6, comma ] }; + key { [ 7, period ] }; + key { [ 8, semicolon ] }; + key { [ 9, parenleft ] }; + key { [ 0, parenright ] }; + key { [ minus, underscore ] }; + key { [ equal, plus ] }; + + key { [ Cyrillic_shorti, Cyrillic_SHORTI ] }; + key { [ Cyrillic_tse, Cyrillic_TSE ] }; + key { [ Cyrillic_u, Cyrillic_U ] }; + key { [ Cyrillic_ka, Cyrillic_KA ] }; + key { [ Cyrillic_ie, Cyrillic_IE ] }; + key { [ Cyrillic_en, Cyrillic_EN ] }; + key { [ Cyrillic_ghe, Cyrillic_GHE ] }; + key { [ Cyrillic_sha, Cyrillic_SHA ] }; + key { [ Cyrillic_shcha, Cyrillic_SHCHA ] }; + key { [ Cyrillic_ze, Cyrillic_ZE ] }; + key { [ Cyrillic_ha, Cyrillic_HA ] }; + key { [ Ukrainian_yi, Ukrainian_YI ] }; + key { [ Ukrainian_ghe_with_upturn, Ukrainian_GHE_WITH_UPTURN ] }; + + key { [ Cyrillic_ef, Cyrillic_EF ] }; + key { [ Ukrainian_i, Ukrainian_I ] }; + key { [ Cyrillic_ve, Cyrillic_VE ] }; + key { [ Cyrillic_a, Cyrillic_A ] }; + key { [ Cyrillic_pe, Cyrillic_PE ] }; + key { [ Cyrillic_er, Cyrillic_ER ] }; + key { [ Cyrillic_o, Cyrillic_O ] }; + key { [ Cyrillic_el, Cyrillic_EL ] }; + key { [ Cyrillic_de, Cyrillic_DE ] }; + key { [ Cyrillic_zhe, Cyrillic_ZHE ] }; + key { [ Ukrainian_ie, Ukrainian_IE ] }; + + key { [ Cyrillic_ya, Cyrillic_YA ] }; + key { [ Cyrillic_che, Cyrillic_CHE ] }; + key { [ Cyrillic_es, Cyrillic_ES ] }; + key { [ Cyrillic_em, Cyrillic_EM ] }; + key { [ Cyrillic_te, Cyrillic_TE ] }; + key { [ Cyrillic_i, Cyrillic_I ] }; + key { [Cyrillic_softsign,Cyrillic_SOFTSIGN ] }; + key { [ Cyrillic_be, Cyrillic_BE ] }; + key { [ Cyrillic_yu, Cyrillic_YU ] }; + key { [ slash, question ] }; + + key { [ slash, bar ] }; + // End alphanumeric section +}; + +partial alphanumeric_keys +xkb_symbols "winkeys" { + include "pc/ua(basic)" + + name[Group1]= "Ukraine - Winkeys"; + + key { [ 3, numerosign ] }; + key { [ 4, semicolon ] }; + key { [ 5, percent ] }; + key { [ 6, colon ] }; + key { [ 7, question ] }; + key { [ 8, asterisk ] }; + key { [ period, comma ] }; +}; + +partial alphanumeric_keys +xkb_symbols "typewriter" { + include "pc/ua(basic)" + + name[Group1]= "Ukraine - Typewriter"; + + key { [ apostrophe, quotedbl ] }; + key { [ exclam, 1 ] }; + key { [ numerosign, 2 ] }; + key { [ slash, 3 ] }; + key { [ semicolon, 4 ] }; + key { [ colon, 5 ] }; + key { [ comma, 6 ] }; + key { [ period, 7 ] }; + key { [ underscore, 8 ] }; + key { [ question, 9 ] }; + key { [ percent, 0 ] }; + + key { [ Ukrainian_ghe_with_upturn, Ukrainian_GHE_WITH_UPTURN ] }; + + key { [ Cyrillic_i, Cyrillic_I ] }; + + key { [ Ukrainian_i, Ukrainian_I ] }; + + key { [ Ukrainian_yi, Ukrainian_YI ] }; + + key { [ parenleft, parenright ] }; +}; + +partial alphanumeric_keys +xkb_symbols "phonetic" { + include "pc/ua(basic)" + + name[Group1]= "Ukraine - Phonetic"; + + key { [ Cyrillic_ya, Cyrillic_YA ] }; + key { [ Cyrillic_ve, Cyrillic_VE ] }; + key { [ Cyrillic_ie, Cyrillic_IE ] }; + key { [ Cyrillic_er, Cyrillic_ER ] }; + key { [ Cyrillic_te, Cyrillic_TE ] }; + key { [ Cyrillic_i, Cyrillic_i ] }; + key { [ Cyrillic_u, Cyrillic_U ] }; + key { [ Ukrainian_i, Ukrainian_I ] }; + key { [ Cyrillic_o, Cyrillic_O ] }; + key { [ Cyrillic_pe, Cyrillic_PE ] }; + key { [ Cyrillic_sha, Cyrillic_SHA ] }; + key { [ Cyrillic_shcha, Cyrillic_SHCHA ] }; + + key { [ Cyrillic_a, Cyrillic_A ] }; + key { [ Cyrillic_es, Cyrillic_ES ] }; + key { [ Cyrillic_de, Cyrillic_DE ] }; + key { [ Cyrillic_ef, Cyrillic_EF ] }; + key { [ Cyrillic_ghe, Cyrillic_GHE ] }; + key { [ Cyrillic_ha, Cyrillic_HA ] }; + key { [ Cyrillic_shorti, Cyrillic_SHORTI ] }; + key { [ Cyrillic_ka, Cyrillic_KA ] }; + key { [ Cyrillic_el, Cyrillic_EL ] }; + key { [ Ukrainian_ghe_with_upturn, Ukrainian_GHE_WITH_UPTURN ] }; + key { [ Cyrillic_che, Cyrillic_CHE ] }; + key { [ Cyrillic_yu, Cyrillic_YU ] }; + + key { [ Cyrillic_ze, Cyrillic_ZE ] }; + key { [ Cyrillic_softsign, Cyrillic_SOFTSIGN ] }; + key { [ Cyrillic_tse, Cyrillic_TSE ] }; + key { [ Cyrillic_zhe, Cyrillic_ZHE ] }; + key { [ Cyrillic_be, Cyrillic_BE ] }; + key { [ Cyrillic_en, Cyrillic_EN ] }; + key { [ Cyrillic_em, Cyrillic_EM ] }; + key { [ Ukrainian_yi, Ukrainian_YI ] }; + key { [ Ukrainian_ie, Ukrainian_IE ] }; + key { [ slash, question ] }; +}; + +// ukrainian keyboard layout RSTU 2019-91 (Respublikanskij STandart Ukrajiny) +// Andrew Porokhnyak +partial alphanumeric_keys +xkb_symbols "rstu" { + include "pc/ua(basic)" + + name[Group1]= "Ukraine - Standard RSTU"; + + key { [ apostrophe, question ] }; + key { [ exclam, 1 ] }; + key { [ quotedbl, 2 ] }; + key { [ numbersign, 3 ] }; + key { [ semicolon, 4 ] }; + key { [ colon, 5 ] }; + key { [ comma, 6 ] }; + key { [ period, 7 ] }; + key { [ asterisk, 8 ] }; + key { [ parenleft, 9 ] }; + key { [ parenright, 0 ] }; + + key { [ Ukrainian_ghe_with_upturn, Ukrainian_GHE_WITH_UPTURN ] }; + + key { [ Cyrillic_i, Cyrillic_I ] }; + + key { [ Ukrainian_i, Ukrainian_I ] }; + + key { [ Ukrainian_yi, Ukrainian_YI ] }; + + key { [ slash, percent ] }; +}; + +// russian keyboard layout RSTU 2019-91 (Respublikanskij STandart Ukrajiny) +// Andrew Porokhnyak +partial alphanumeric_keys +xkb_symbols "rstu_ru" { + include "pc/ru(basic)" + name[Group1]= "Ukraine - Standard RSTU on Russian layout"; + + key { [ apostrophe, question ] }; + key { [ exclam, 1 ] }; + key { [ quotedbl, 2 ] }; + key { [ numbersign, 3 ] }; + key { [ semicolon, 4 ] }; + key { [ colon, 5 ] }; + key { [ comma, 6 ] }; + key { [ period, 7 ] }; + key { [ asterisk, 8 ] }; + key { [ parenleft, 9 ] }; + key { [ parenright, 0 ] }; + key { [ slash, percent ] }; + +key.type[group1]="ALPHABETIC"; + + key { [ Cyrillic_io, Cyrillic_IO ] }; +}; + diff -ruN /opt/SUNWut.orig/lib/xkb/symbols/pc/us /opt/SUNWut/lib/xkb/symbols/pc/us --- /opt/SUNWut.orig/lib/xkb/symbols/pc/us 1970-01-01 01:00:00.000000000 +0100 +++ /opt/SUNWut/lib/xkb/symbols/pc/us 2006-04-18 08:31:53.000000000 +0200 @@ -0,0 +1,295 @@ +// +// $XdotOrg: xc/programs/xkbcomp/symbols/us,v 1.1.4.3 2004/03/05 13:41:33 eich Exp $ +// $XFree86: xc/programs/xkbcomp/symbols/us,v 1.6 2003/10/31 14:32:05 pascal Exp $ + +default +partial alphanumeric_keys modifier_keys +xkb_symbols "basic" { + + name[Group1]= "U.S. English"; + + include "pc/pc(common)" + + // Alphanumeric section + key { [ grave, asciitilde ] }; + key { [ 1, exclam ] }; + key { [ 2, at ] }; + key { [ 3, numbersign ] }; + key { [ 4, dollar ] }; + key { [ 5, percent ] }; + key { [ 6, asciicircum ] }; + key { [ 7, ampersand ] }; + key { [ 8, asterisk ] }; + key { [ 9, parenleft ] }; + key { [ 0, parenright ] }; + key { [ minus, underscore ] }; + key { [ equal, plus ] }; + + key { [ q, Q ] }; + key { [ w, W ] }; + key { [ e, E ] }; + key { [ r, R ] }; + key { [ t, T ] }; + key { [ y, Y ] }; + key { [ u, U ] }; + key { [ i, I ] }; + key { [ o, O ] }; + key { [ p, P ] }; + key { [ bracketleft, braceleft ] }; + key { [ bracketright, braceright ] }; + + key { [ a, A ] }; + key { [ s, S ] }; + key { [ d, D ] }; + key { [ f, F ] }; + key { [ g, G ] }; + key { [ h, H ] }; + key { [ j, J ] }; + key { [ k, K ] }; + key { [ l, L ] }; + key { [ semicolon, colon ] }; + key { [ apostrophe, quotedbl ] }; + + key { [ z, Z ] }; + key { [ x, X ] }; + key { [ c, C ] }; + key { [ v, V ] }; + key { [ b, B ] }; + key { [ n, N ] }; + key { [ m, M ] }; + key { [ comma, less ] }; + key { [ period, greater ] }; + key { [ slash, question ] }; + + key { [ backslash, bar ] }; + // End alphanumeric section +}; + + +partial alphanumeric_keys +xkb_symbols "intl" { + + name[Group1]= "U.S. English - International (with dead keys)"; + + include "pc/us(basic)" + + // Alphanumeric section + key { [dead_grave, dead_tilde, grave, asciitilde ] }; + key { [ 1, exclam, exclamdown, onesuperior ] }; + key { [ 2, at, twosuperior, dead_doubleacute ] }; + key { [ 3, numbersign, threesuperior, dead_macron ] }; + key { [ 4, dollar, currency, sterling ] }; + key { [ 5, percent, EuroSign ] }; + key { [ 6, dead_circumflex, onequarter, asciicircum ] }; + key { [ 7, ampersand, onehalf, dead_horn ] }; + key { [ 8, asterisk, threequarters, dead_ogonek ] }; + key { [ 9, parenleft, leftsinglequotemark, dead_breve ] }; + key { [ 0, parenright, rightsinglequotemark, dead_abovering ] }; + key { [ minus, underscore, yen, dead_belowdot ] }; + key { [ equal, plus, multiply, division ] }; + + key { [ q, Q, adiaeresis, Adiaeresis ] }; + key { [ w, W, aring, Aring ] }; + key { [ e, E, eacute, Eacute ] }; + key { [ r, R, registered, registered ] }; + key { [ t, T, thorn, THORN ] }; + key { [ y, Y, udiaeresis, Udiaeresis ] }; + key { [ u, U, uacute, Uacute ] }; + key { [ i, I, iacute, Iacute ] }; + key { [ o, O, oacute, Oacute ] }; + key { [ p, P, odiaeresis, Odiaeresis ] }; + key { [ bracketleft, braceleft, guillemotleft, guillemotleft ] }; + key { [bracketright, braceright, guillemotright,guillemotright ] }; + + key { [ a, A, aacute, Aacute ] }; + key { [ s, S, ssharp, section ] }; + key { [ d, D, eth, ETH ] }; + + key { [ l, L, oslash, Ooblique ] }; + key { [ semicolon, colon, paragraph, degree ] }; + key { [dead_acute, dead_diaeresis, apostrophe, quotedbl ] }; + + key { [ z, Z, ae, AE ] }; + key { [ c, C, copyright, cent ] }; + key { [ n, N, ntilde, Ntilde ] }; + key { [ m, M, mu, mu ] }; + key { [ comma, less, ccedilla, Ccedilla ] }; + key { [ period, greater, dead_abovedot, dead_caron ] }; + key { [ slash, question, questiondown, dead_hook ] }; + key { [ backslash, bar, notsign, brokenbar ] }; + + include "level3(ralt_switch)" +}; + +// Based on symbols/us_intl keyboard map: +// Dead-keys definition for a very simple US/ASCII layout. +// by Conectiva (http://www.conectiva.com.br) +// modified by Ricardo Y. Igarashi (iga@that.com.br) + +// Added the following deadkeys, to make it truly international: +// +// dead_macron: on AltGr-minus +// dead_breve: on AltGr-parenleft +// dead_abovedot: on AltGr-period +// dead_abovering: on AltGr-0 +// dead_doubleacute: on AltGr-equal (as quotedbl is already used) +// dead_caron: on AltGr-less (AltGr-shift-comma) +// dead_cedilla: on AltGr-comma +// dead_ogonek: on AltGr-semicolon +// dead_belowdot: on AltGr-underscore (AltGr-shift-minus) +// dead_hook: on AltGr-question +// dead_horn: on AltGr-plus (AltGr-shift-equal) +// dead_diaeresis: on AltGr-colon (Alt-shift-semicolon) +// +// those were already there: +// dead_grave +// dead_acute +// dead_circumflex +// dead_tilde +// dead_diaeresis + +partial alphanumeric_keys +xkb_symbols "alt-intl" { + + name[Group1]= "U.S. English - Alternative international (former us_intl)"; + + include "pc/us" + + key { [ dead_grave, dead_tilde, grave, asciitilde ] }; + key { [ 5, percent, EuroSign ] }; + key { [ 6, dead_circumflex, asciicircum, asciicircum ] }; + key { [ 9, parenleft, dead_breve, dead_breve ] }; + key { [ 0, parenright, dead_abovering, dead_abovering] }; + key { [ minus, underscore, dead_macron, dead_belowdot ] }; + key { [ equal, plus, dead_doubleacute, dead_horn ] }; + + key { [ e, E, EuroSign, cent ] }; + + key { [ semicolon, colon, dead_ogonek, dead_diaeresis ] }; + key { [ dead_acute, dead_diaeresis, apostrophe, quotedbl ] }; + + key { [ comma, less, dead_cedilla, dead_caron ] }; + key { [ period, greater, dead_abovedot, dead_circumflex ] }; + key { [ slash, question, dead_hook, dead_hook ] }; + + include "level3(ralt_switch)" +}; + +// based on a keyboard map from an 'xkb/symbols/dk' file +// +// $XFree86: xc/programs/xkbcomp/symbols/dvorak,v 1.5 2004/01/03 16:35:07 herrb Exp $ + +partial alphanumeric_keys +xkb_symbols "dvorak" { + + name[Group1]= "U.S. English - Dvorak"; + + // Alphanumeric section + + key { [ grave, asciitilde, dead_grave, dead_tilde ] }; + + key { [ 1, exclam ] }; + key { [ 2, at ] }; + key { [ 3, numbersign ] }; + key { [ 4, dollar ] }; + key { [ 5, percent ] }; + key { [ 6, asciicircum, dead_circumflex, dead_circumflex ] }; + key { [ 7, ampersand ] }; + key { [ 8, asterisk ] }; + key { [ 9, parenleft, dead_grave] }; + key { [ 0, parenright ] }; + key { [ bracketleft, braceleft ] }; +